From 12b12bde4c5a81c7630cf5cee4a37d0251fb593e Mon Sep 17 00:00:00 2001 From: alicekb Date: Tue, 2 Jul 2024 11:54:45 -0400 Subject: [PATCH] Update CTAs --- hugo_stats.json | 1 + public/404.html | 2 +- public/blog/example-post/index.html | 2 +- public/blog/index.html | 2 +- public/categories/index.html | 2 +- public/contributors/index.html | 2 +- public/docs/about/changelog/index.html | 2 +- public/docs/about/faq/index.html | 2 +- public/docs/about/glossary/index.html | 2 +- .../docs/about/how-to-contribute/index.html | 2 +- public/docs/about/index.html | 2 +- public/docs/components/actions/index.html | 2 +- public/docs/components/computed/index.html | 2 +- .../custom-sheet-macro-attributes/index.html | 2 +- public/docs/components/dispatch/index.html | 2 +- public/docs/components/handlers/index.html | 2 +- public/docs/components/index.html | 2 +- public/docs/components/initrelay/index.html | 2 +- public/docs/components/rolls/index.html | 2 +- .../example-patterns-sheet/index.html | 2 +- public/docs/gettingstarted/index.html | 2 +- .../installing-beacon/index.html | 2 +- .../gettingstarted/introduction/index.html | 2 +- .../quick-start-sheet-template/index.html | 2 +- .../releasing-a-sheet/index.html | 2 +- public/docs/index.html | 2 +- public/index.html | 4 +- ...a8a5d184fb0ef5797824b450f80fd2eba9e267.css | 14472 ++++++++++++++++ ...f8f7d4a783d14c4a5829172cc3c9a243115e50.css | 1 + public/privacy/index.html | 2 +- public/tags/index.html | 2 +- ...s_cdf9d7c9eb97e4550ded64a8776dd9e8.content | 2 +- ...scss_cdf9d7c9eb97e4550ded64a8776dd9e8.json | 2 +- 33 files changed, 14505 insertions(+), 31 deletions(-) create mode 100644 public/main.ca4895d78c50bb4533a515f6f86301d48ce8ed778882b950c84f1925d837f4f472005a5a3e1be02dc63065e88da8a5d184fb0ef5797824b450f80fd2eba9e267.css create mode 100644 public/main.e28529c7be9ecda8ce19eac1174bca0d6f2153f0711f154ca27317330d3f0085350487d79841146fa897321b65f8f7d4a783d14c4a5829172cc3c9a243115e50.css diff --git a/hugo_stats.json b/hugo_stats.json index 3113b28..90e6e67 100644 --- a/hugo_stats.json +++ b/hugo_stats.json @@ -53,6 +53,7 @@ "ul" ], "classes": [ + "CTAbutton", "active", "anchor", "bg-dots", diff --git a/public/404.html b/public/404.html index 6efc29b..d00ed87 100644 --- a/public/404.html +++ b/public/404.html @@ -1 +1 @@ -404 Page not found |

Page not found :(

The page you are looking for doesn't exist or has been moved.

\ No newline at end of file +404 Page not found |

Page not found :(

The page you are looking for doesn't exist or has been moved.

\ No newline at end of file diff --git a/public/blog/example-post/index.html b/public/blog/example-post/index.html index 6f57414..f341cdd 100644 --- a/public/blog/example-post/index.html +++ b/public/blog/example-post/index.html @@ -1 +1 @@ -Example Post |

Example Post

September 7, 20231 minute

You can use blog posts for announcing product updates and features.

Well-thought-through product announcements will help increase feature awareness and engage users with new functionality. Just like sharing your public roadmap, it’s also a great way to let potential customers see that you’re constantly improving.

Further reading

\ No newline at end of file +Example Post |

Example Post

September 7, 20231 minute

You can use blog posts for announcing product updates and features.

Well-thought-through product announcements will help increase feature awareness and engage users with new functionality. Just like sharing your public roadmap, it’s also a great way to let potential customers see that you’re constantly improving.

Further reading

\ No newline at end of file diff --git a/public/blog/index.html b/public/blog/index.html index cc12a36..b0add3b 100644 --- a/public/blog/index.html +++ b/public/blog/index.html @@ -1 +1 @@ -Blog |

Blog

Example Post

You can use blog posts for announcing product updates and features.

September 7, 20231 minute

\ No newline at end of file +Blog |

Blog

Example Post

You can use blog posts for announcing product updates and features.

September 7, 20231 minute

\ No newline at end of file diff --git a/public/categories/index.html b/public/categories/index.html index 6841b97..ef06c3e 100644 --- a/public/categories/index.html +++ b/public/categories/index.html @@ -1 +1 @@ -Categories |

Categories

\ No newline at end of file +Categories |

Categories

\ No newline at end of file diff --git a/public/contributors/index.html b/public/contributors/index.html index eb93b7b..d5d795a 100644 --- a/public/contributors/index.html +++ b/public/contributors/index.html @@ -1 +1 @@ -Contributors |

Contributors

\ No newline at end of file +Contributors |

Contributors

\ No newline at end of file diff --git a/public/docs/about/changelog/index.html b/public/docs/about/changelog/index.html index 6b9521b..fa5d907 100644 --- a/public/docs/about/changelog/index.html +++ b/public/docs/about/changelog/index.html @@ -1,3 +1,3 @@ -Changelog | Changelog |
\ No newline at end of file diff --git a/public/docs/about/faq/index.html b/public/docs/about/faq/index.html index 49e8189..ac02032 100644 --- a/public/docs/about/faq/index.html +++ b/public/docs/about/faq/index.html @@ -1,3 +1,3 @@ -FAQ | FAQ |

FAQ

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Q: How is Beacon better than the old way of building sheets (known as Custom Sheets)?

It depends on your web development skill level. There are a number of benefits to the Beacon SDK if you know how to build web applications. If you don’t know how to set up your own local environment, than the Beacon SDK might now be the first place you should start. Learn more about sheet development using the custom sheet.

If you have the skill to take advantage of the Beacon SDK, there are a number of improvements that will make it much easier to build characters sheets.

First, the Beacon SDK allows you to develop locally and preview your changes automatically in the Roll20 Tabletop and Roll20 Character sandboxes. This means that you don’t have to keep uploading your HTML and CSS into the custom sheet to see your changes.

Next, it allows you to develop your character sheet with all the power of JavaScript frameworks and modern web development libraries. In our example sheets, we use Vue.js, but you are free to use whatever you are most comfortable with. Also, you could use something like Cypress to create automated testing. That’s what we use in our Beacon sheets.

Lastly, the Beacon SDK makes it much easier for a web developer who knows JSON and Javascript to access character data and manage attributes on the character. If you’re familiar with the custom sheet, you no longer have to deal with sheet workers to get the data you need for a character. Also, the Beacon SDK introduces nested and computed attributes that make complex data models for your character sheet easier to create and maintain.

Q: I’m not really a web developer, should I use Beacon or the custom sheet to make a my own character sheet?

That is up to you and your comfort level. If you’re looking to learn more about web development, building a character sheet with the Beacon SDK is a great way to level up your skills. What you learn during this process can be taken with you into any other web development project you work on in the future.

If setting up your own development environment is too intimidating for you, than it might be easier for you to start with the custom sheet and to go from there.

Q: I’m interested in using Beacon, but I don’t know the basics of setting up a local environment. Where can I go to learn more about web development?

You can start learning how to build a local development environment by reading or watching the following tutorials. Note: these are not tutorials that we’ve produced, but we have found them helpful in getting started with web development.

Q: Now that Roll20 has acquired Demiplane, will you continue to support character sheets built on Beacon?

The recent acquisition of Demiplane brings exciting new opportunities for character sheets and compendiums on Roll20. At the same time, we are fully committed to supporting the Beacon SDK and character sheets that are built in our new advanced sheets ecosystem on Roll20. In fact, we believe that the Beacon SDK will be a key component of our future plans for Demiplane integration. In addition, our new D&D 2024 sheet is built on top of the Beacon SDK, and we will continue to utilize it to build first-class experiences on Roll20.

In short, you can rest assured that the Beacon SDK is an important tool in our toolbox moving forward.

Q: What are actions in the context of Beacon?Actions are methods executed in the chat log of Roll20 Tabletop or Roll20 Characters, often used for rolls triggered from macros or chat buttons. They are defined in the sheet’s configuration and can interact with character data.
Q: How are computed properties used in Roll20?Computed properties are attributes which are accessible by users of your character sheet. They are usable in macros to create custom rolls or common actions for each character. Computed properties can represent derived values or complex calculations based on character data.
Q: What is the dispatch function used for?The dispatch function provides methods for sending commands from the character sheet back to Roll20, including updating character data, performing actions, and interacting with the interface.
Q: What are roll buttons, and how do they work?Roll buttons are HTML elements with specific attributes that execute designated sheet actions when clicked. They can pass arguments to the action method and are commonly used for triggering rolls from the character sheet.
Q: How are Custom Sheet attributes handled in Beacon?Beacon gives you the ability to transition your Custom Sheet attributes to new attributes you create in Beacon. This means that when a user updates their sheet to the new Beacon sheet, their Custom Sheet attribute can be mapped to Beacon attributes using the convertLegacyMacroAttributes function. Sheet developers can define how to handle Custom Sheet attribute values to ensure compatibility with existing macros.
Q: What is the purpose of the query function?The query function displays a SweetAlert2 prompt to users and returns the results along with any errors. It is commonly used for interactive prompts or confirmations within the VTT interface.
Q: How are tokens managed in the VTT?Tokens represent characters or objects on Roll20 Tabletop (VTT). Functions like getTokens, updateTokensByCharacter, and addToTracker are used to retrieve token information, update token data, and manage tokens in the turn tracker.
Q: What is the role of the convertLegacyMacroAttributesArgs type?The convertLegacyMacroAttributesArgs type defines the arguments used for handling Custom Sheet macro attributes. It includes the attribute name, character ID, and character data needed for mapping Custom Sheet attributes to the new sheet structure.
\ No newline at end of file diff --git a/public/docs/about/glossary/index.html b/public/docs/about/glossary/index.html index 3c66c58..82981b3 100644 --- a/public/docs/about/glossary/index.html +++ b/public/docs/about/glossary/index.html @@ -1,3 +1,3 @@ -Glossary | Glossary |

Glossary

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Background:

The background color of the alert box.

Character:

An entity in the game with attributes, bio, GM notes, and a token representation.

Character sheet:

A digital or printed page used to track a character’s attributes, abilities, and other relevant information in a role-playing game.

Computed Property:

Properties that have both get and set methods, which can be dynamically calculated.

ConvertLegacyMacroAttributes:

A function to handle mapping Custom Sheet macro attributes to the new Beacon Sheet format.

Dispatch:

A set of functions enabling the sheet to send commands back to the VTT.

GM (Game Master):

The person who runs the game, controls the NPCs & the story, and provides challenges for the players.

Handler:

Methods that act as event handlers to process messages from the host.

InitRelay:

Function to initialize the SDK relay, setting up communication between the host and the character sheet.

Macro:

A script that automates repetitive tasks in the VTT.

Roll Template:

A predefined format for displaying the results of a dice roll.

Token:

A visual representation of a character or object on the virtual tabletop, with various properties like position, size, and attributes.

VTT (Virtual Tabletop):

An online platform that allows players to play tabletop role-playing games over the internet.

ValidationMessage:

A message displayed when an input value does not meet specific criteria.

Quantum Roll:

A system that ensures the fairness and authenticity of dice rolls in the VTT by using cryptographic methods.

\ No newline at end of file diff --git a/public/docs/about/how-to-contribute/index.html b/public/docs/about/how-to-contribute/index.html index 9977c2a..5a4ff7f 100644 --- a/public/docs/about/how-to-contribute/index.html +++ b/public/docs/about/how-to-contribute/index.html @@ -1 +1 @@ -How to Contribute |

How to Contribute

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

We strive to make the Beacon SDK and its documentation a better tool for Community Sheet Developers like you! So before we get started, thank you for helping us make them the best they can be. It is no small task supporting all games with the best digital character sheets, but with your help, players around the world will can use awesome characeter sheets for their favorite games.

Reporting Bugs

If you find a bug with the Beacon SDK, and you want to report it, thank you. There are several ways you can go about reporting it. Feel free to choose the easiest for you. Most importantly, we want you to let us know so we can fix them.

  1. You can create an issue on the Beacon Documentation Github Repo.
  2. You can create an issue on the Beacon Community Sheets Repo.
  3. You can let us know in the Community Sheet Developers Discord Channels. Make sure to fill out a [Beta Sign up form(https://docs.google.com/forms/d/e/1FAIpQLScwIAc38NhSTYBtZH04pkDj9O7APwysdgsRnVssFNhsoONOUw/viewform?usp=sf_link)] before joining the Discord.
  4. You can submit a Roll20 Help Ticket where our support staff and make sure we get the information.

When you submit a bug report, it’s most helpful for you to include steps that will reliably reproduce the bug. If you don’t have those, that’s fine too. The most important thing is to report it. We’ll work with you to figure out how we can reproduce and fix the bug.

Ultimately, our team manages our sprint work with an internal tool. No matter which method you use to report the issue, we’ll create a companion ticket in our internal tool and link it to your original report. This is why if we have questions, we can find your report, and when we’re done, we can let you know that it has been fixed.

Suggesting Features

If you have an idea of a feature that we should add to make things easier for you or others, please let us know! Here are a few ways that you can choose from to let us know.

  1. You can create an issue on the Beacon Documentation Github Repo.
  2. You can create an issue on the Beacon Community Sheets Repo.
  3. You can let us know in the Community Sheet Developers Discord Channels. Make sure to fill out a [Beta Sign up form(https://docs.google.com/forms/d/e/1FAIpQLScwIAc38NhSTYBtZH04pkDj9O7APwysdgsRnVssFNhsoONOUw/viewform?usp=sf_link)] before joining the Discord.
  4. You can schedule a meeting with Andrew and/or Alice directly to talk about it and give him the opportunity to ask questions about it.

Ultimately, we want to hear what is particularly painful and time consuming for you so we can work to make it easier for you to create awesome digtial character sheets for the games you love.

Code Contributions to the Beacon SDK Documentation

Our goal it to build this site into the single source of information for Community Sheet Developers. The task of documenting everything will take time and iteration. If you find something in the documention that is wrong or needs to be updated, please let us know! You are also welcome to make a pull request of the Beacon SDK Documentation Repo, update the files, and commit your changes. We’ll review and publish them on a regular basis.

When you do submit a pull request, thank you for helping us make the Beacon SDK project better!

\ No newline at end of file +How to Contribute |

How to Contribute

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

We strive to make the Beacon SDK and its documentation a better tool for Community Sheet Developers like you! So before we get started, thank you for helping us make them the best they can be. It is no small task supporting all games with the best digital character sheets, but with your help, players around the world will can use awesome characeter sheets for their favorite games.

Reporting Bugs

If you find a bug with the Beacon SDK, and you want to report it, thank you. There are several ways you can go about reporting it. Feel free to choose the easiest for you. Most importantly, we want you to let us know so we can fix them.

  1. You can create an issue on the Beacon Documentation Github Repo.
  2. You can create an issue on the Beacon Community Sheets Repo.
  3. You can let us know in the Community Sheet Developers Discord Channels. Make sure to fill out a [Beta Sign up form(https://docs.google.com/forms/d/e/1FAIpQLScwIAc38NhSTYBtZH04pkDj9O7APwysdgsRnVssFNhsoONOUw/viewform?usp=sf_link)] before joining the Discord.
  4. You can submit a Roll20 Help Ticket where our support staff and make sure we get the information.

When you submit a bug report, it’s most helpful for you to include steps that will reliably reproduce the bug. If you don’t have those, that’s fine too. The most important thing is to report it. We’ll work with you to figure out how we can reproduce and fix the bug.

Ultimately, our team manages our sprint work with an internal tool. No matter which method you use to report the issue, we’ll create a companion ticket in our internal tool and link it to your original report. This is why if we have questions, we can find your report, and when we’re done, we can let you know that it has been fixed.

Suggesting Features

If you have an idea of a feature that we should add to make things easier for you or others, please let us know! Here are a few ways that you can choose from to let us know.

  1. You can create an issue on the Beacon Documentation Github Repo.
  2. You can create an issue on the Beacon Community Sheets Repo.
  3. You can let us know in the Community Sheet Developers Discord Channels. Make sure to fill out a [Beta Sign up form(https://docs.google.com/forms/d/e/1FAIpQLScwIAc38NhSTYBtZH04pkDj9O7APwysdgsRnVssFNhsoONOUw/viewform?usp=sf_link)] before joining the Discord.
  4. You can schedule a meeting with Andrew and/or Alice directly to talk about it and give him the opportunity to ask questions about it.

Ultimately, we want to hear what is particularly painful and time consuming for you so we can work to make it easier for you to create awesome digtial character sheets for the games you love.

Code Contributions to the Beacon SDK Documentation

Our goal it to build this site into the single source of information for Community Sheet Developers. The task of documenting everything will take time and iteration. If you find something in the documention that is wrong or needs to be updated, please let us know! You are also welcome to make a pull request of the Beacon SDK Documentation Repo, update the files, and commit your changes. We’ll review and publish them on a regular basis.

When you do submit a pull request, thank you for helping us make the Beacon SDK project better!

\ No newline at end of file diff --git a/public/docs/about/index.html b/public/docs/about/index.html index c8edbfe..0e861b6 100644 --- a/public/docs/about/index.html +++ b/public/docs/about/index.html @@ -1 +1 @@ -About |
\ No newline at end of file +About |
\ No newline at end of file diff --git a/public/docs/components/actions/index.html b/public/docs/components/actions/index.html index becef32..6ae608b 100644 --- a/public/docs/components/actions/index.html +++ b/public/docs/components/actions/index.html @@ -1,4 +1,4 @@ -Actions | Actions |

Actions

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

initRelay({
   //...other methods
diff --git a/public/docs/components/computed/index.html b/public/docs/components/computed/index.html
index f702d17..1c48be4 100644
--- a/public/docs/components/computed/index.html
+++ b/public/docs/components/computed/index.html
@@ -1,4 +1,4 @@
-Computed | Computed | 

Computed

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Sheet authors define computed properties that are accessed by the Roll20 Tabletop or Roll20 Characters. These computed properties can be used as attributes in macros and are available to assign as values to token bars - if the tokenBarValue property is set to true.

initRelay({
   //...other methods
diff --git a/public/docs/components/custom-sheet-macro-attributes/index.html b/public/docs/components/custom-sheet-macro-attributes/index.html
index 210bc36..91cae97 100644
--- a/public/docs/components/custom-sheet-macro-attributes/index.html
+++ b/public/docs/components/custom-sheet-macro-attributes/index.html
@@ -1,4 +1,4 @@
-Custom Sheet Macro Attributes | Custom Sheet Macro Attributes | 

Custom Sheet Macro Attributes

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

When utilizing Macroswithin the Roll20 Tabletop or Roll20 Characters (both refered to as host throughout this page), there are instances where a older Custom Sheet macro might need to be employed for a Beacon sheet.

This scenario commonly arises when transitioning from an existing older Custom Sheet to a Beacon sheet. During such transitions, it’s possible that the attributes or roll templates called from the older Custom Sheet macros may not align with the structure of attributes or the lack of roll templates in the Beacon Sheet.

convertLegacyMacroAttributes

The convertLegacyMacroAttributes method allows us to determine the mapping strategy for older Custom Sheet attributes to the new Beacon Sheet.

initRelay({
   convertLegacyMacroAttributes: (messages:  {
diff --git a/public/docs/components/dispatch/index.html b/public/docs/components/dispatch/index.html
index b043ab3..a50f4b4 100644
--- a/public/docs/components/dispatch/index.html
+++ b/public/docs/components/dispatch/index.html
@@ -1,4 +1,4 @@
-Dispatch | Dispatch | 

Dispatch

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

The dispatch is returned by the initRelay and provides methods for sending commands from the character sheet back to the host. Except when specified every method below will return a promise.

update

dispatch.update({
   options: { overwrite?: boolean }
diff --git a/public/docs/components/handlers/index.html b/public/docs/components/handlers/index.html
index 0f77bef..c459ac1 100644
--- a/public/docs/components/handlers/index.html
+++ b/public/docs/components/handlers/index.html
@@ -1,4 +1,4 @@
-Handlers | Handlers | 

Handlers

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Handler methods allow the sheet to respond to data passed from the Roll20 Tabletop or Roll20 Characters (both refered to as host throughout this page) to the sheet. It is the main agrument that must be passed into initRelay or the sheet will never fully load.

initRelay({
     handlers: {
diff --git a/public/docs/components/index.html b/public/docs/components/index.html
index 386d773..c7037ce 100644
--- a/public/docs/components/index.html
+++ b/public/docs/components/index.html
@@ -1 +1 @@
-Components | 
\ No newline at end of file +Components |
\ No newline at end of file diff --git a/public/docs/components/initrelay/index.html b/public/docs/components/initrelay/index.html index cef35f0..bc18d09 100644 --- a/public/docs/components/initrelay/index.html +++ b/public/docs/components/initrelay/index.html @@ -1,4 +1,4 @@ -InitRelay | InitRelay |

InitRelay

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

The Beacon SDK is composed of various methods and components that allow developers to create dynamic and interactive character sheets for virtual tabletop (VTT) games. initRelay is the main method that initializes the Beacon SDK communication channel with the host (Either the Roll20 tabletop or in Roll20 Characters). It should be initialized as soon as the sheet loads, as its onInit handler will be the earliest we can get access to that character’s data.

initRelay({
     handlers: {
diff --git a/public/docs/components/rolls/index.html b/public/docs/components/rolls/index.html
index 75c9d77..b78f95d 100644
--- a/public/docs/components/rolls/index.html
+++ b/public/docs/components/rolls/index.html
@@ -1,4 +1,4 @@
-Rolls | Rolls | 

Rolls

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

The Roll20 Tabletop and Roll20 Characters (both refered to as host throughout the rest of this page) have several new features that enhance the way rolls are handled and displayed. These features include attributes and elements that allow for dynamic roll results and interactivity within the host. Vist the Roll20 help center to learn more about Roll20’s Dice Rolling system

The most command way to trigger a dice roll is through the dispatch object returned from the initRelay, but it could also be called from actions:

dispatch.roll({
diff --git a/public/docs/gettingstarted/example-patterns-sheet/index.html b/public/docs/gettingstarted/example-patterns-sheet/index.html
index 93e5abc..c91adda 100644
--- a/public/docs/gettingstarted/example-patterns-sheet/index.html
+++ b/public/docs/gettingstarted/example-patterns-sheet/index.html
@@ -1 +1 @@
-Example Patterns Sheet | 

Example Patterns Sheet

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Prerequisites

To set this sheet up properly, make sure that you have the following:

  • Vue framework & Routing
  • Multiple Data Stores
  • Complex Roll Templates
  • Rich Sheet Actions
  • TypeScript
  • Vite
  • SCSS
  • Ability to run Unit & End-to-End Tests

To download the community quick start sheet, refer to these repositories:

Figure 1: Advanced sheet

This sheet uses the same steps listed in the . Immediately after implementing those three steps, you’ll add the following step:

  • Run a CI check: This will run several checks to ensure your code is as optimal as possible, including formatting, linting, type checking, unit tests, and end-to-end tests.
npm run ci-check

You can think of this command as a sanity check you can leverage when pushing a big release for your sheet!

Useful Commands

The following set of commands can come in handy when working with this sheet:

  • For Hot reloading and building CSS files, use the following command:
npm run watch-scss
  • For linting, use the following command:
npm run lint
  • For formatting with Prettier, use the following command:
npm run format
  • For type checking with TypeScript, use the following command:
npm run type-check
  • For running unit tests with Vitest, use the following command:
npm run test:unit
  • To open up and develop local end-to-end tests with Cypress, use the following command:
npm run test:e2e:open:local
  • For running local end-to-end tests with Cypress, use the following command:
npm run test:e2e:local
  • To run CDN-hosted end-to-end tests with Cypress, use the following command:
npm run test:e2e
\ No newline at end of file +Example Patterns Sheet |

Example Patterns Sheet

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Prerequisites

To set this sheet up properly, make sure that you have the following:

  • Vue framework & Routing
  • Multiple Data Stores
  • Complex Roll Templates
  • Rich Sheet Actions
  • TypeScript
  • Vite
  • SCSS
  • Ability to run Unit & End-to-End Tests

To download the community quick start sheet, refer to these repositories:

Figure 1: Advanced sheet

This sheet uses the same steps listed in the . Immediately after implementing those three steps, you’ll add the following step:

  • Run a CI check: This will run several checks to ensure your code is as optimal as possible, including formatting, linting, type checking, unit tests, and end-to-end tests.
npm run ci-check

You can think of this command as a sanity check you can leverage when pushing a big release for your sheet!

Useful Commands

The following set of commands can come in handy when working with this sheet:

  • For Hot reloading and building CSS files, use the following command:
npm run watch-scss
  • For linting, use the following command:
npm run lint
  • For formatting with Prettier, use the following command:
npm run format
  • For type checking with TypeScript, use the following command:
npm run type-check
  • For running unit tests with Vitest, use the following command:
npm run test:unit
  • To open up and develop local end-to-end tests with Cypress, use the following command:
npm run test:e2e:open:local
  • For running local end-to-end tests with Cypress, use the following command:
npm run test:e2e:local
  • To run CDN-hosted end-to-end tests with Cypress, use the following command:
npm run test:e2e
\ No newline at end of file diff --git a/public/docs/gettingstarted/index.html b/public/docs/gettingstarted/index.html index 5a3460b..9ff8858 100644 --- a/public/docs/gettingstarted/index.html +++ b/public/docs/gettingstarted/index.html @@ -1 +1 @@ -Getting Started |
\ No newline at end of file +Getting Started |
\ No newline at end of file diff --git a/public/docs/gettingstarted/installing-beacon/index.html b/public/docs/gettingstarted/installing-beacon/index.html index 02fc326..b3e51f7 100644 --- a/public/docs/gettingstarted/installing-beacon/index.html +++ b/public/docs/gettingstarted/installing-beacon/index.html @@ -1,4 +1,4 @@ -Installing Beacon |

Installing Beacon

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

This installation guide is designed for sheet developers with experience in web development, that want to start creating a character sheet from scratch or already have an existing project they wish to add Beacon to.

To get started quickly with a boilerplate, you can download and start editing the Quick Start Example Sheet which already has the Beacon SDK installed, along with several recommanded patterns implemented in a Vue.js project.

Prerequisites

Before you can install the Beacon SDK, you’ll need to have the following:

  • A local web development environment with a code editor.
  • Node.js installed on your machine. If you don’t have Node.js installed, use the following steps in the official Node.js documentation.
  • A javascript project, we recommand Vue.js but you can choose whichever you are more comfortable with.

These steps use npm but you are free to use any package manager and framework you prefer.

The following steps will guide you in installing the Beacon SDK in your application:

Step 1: Add the package to your project

You can find the latest version of the package on the NPM registry.

In your project’s directory, run the following:

  npm i @roll20-official/beacon-sdk

This will install the Beacon SDK package to your project’s package.json file.

Step 2: Use the Beacon package in your project

The Beacon package exports various utilities you can use in your application. The main one that needs to be setup to enable the connection between Beacon SDK and Roll20 is initRelay.

Ideally you would want to call this when your sheet is initalizing, and it is the function where you will define sheet actions, computed values, and how the sheet will response to or send character data changes. visit the initRelay page for a more detailed breakdown.

Add the following to your project:

import { initRelay } from '@roll20/beacon-sdk';
+Installing Beacon | 

Installing Beacon

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

This installation guide is designed for sheet developers with experience in web development, that want to start creating a character sheet from scratch or already have an existing project they wish to add Beacon to.

To get started quickly with a boilerplate, you can download and start editing the Quick Start Example Sheet which already has the Beacon SDK installed, along with several recommanded patterns implemented in a Vue.js project.

Prerequisites

Before you can install the Beacon SDK, you’ll need to have the following:

  • A local web development environment with a code editor.
  • Node.js installed on your machine. If you don’t have Node.js installed, use the following steps in the official Node.js documentation.
  • A javascript project, we recommand Vue.js but you can choose whichever you are more comfortable with.

These steps use npm but you are free to use any package manager and framework you prefer.

The following steps will guide you in installing the Beacon SDK in your application:

Step 1: Add the package to your project

You can find the latest version of the package on the NPM registry.

In your project’s directory, run the following:

  npm i @roll20-official/beacon-sdk

This will install the Beacon SDK package to your project’s package.json file.

Step 2: Use the Beacon package in your project

The Beacon package exports various utilities you can use in your application. The main one that needs to be setup to enable the connection between Beacon SDK and Roll20 is initRelay.

Ideally you would want to call this when your sheet is initalizing, and it is the function where you will define sheet actions, computed values, and how the sheet will response to or send character data changes. visit the initRelay page for a more detailed breakdown.

Add the following to your project:

import { initRelay } from '@roll20/beacon-sdk';
 
 const dispatch = initRelay({
     handlers: {
diff --git a/public/docs/gettingstarted/introduction/index.html b/public/docs/gettingstarted/introduction/index.html
index 8f04754..306fa83 100644
--- a/public/docs/gettingstarted/introduction/index.html
+++ b/public/docs/gettingstarted/introduction/index.html
@@ -1 +1 @@
-Introduction | 

Introduction

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

The Beacon SDK is a Software Development Toolset (SDK) designed to allow web developers create digital TTRPG character sheets for Roll20 using modern web development tools.

The Beacon SDK provides a framework to create dynamic, responsive, and fully integrated character sheet for both Roll20 Tabletop and Roll20 Characters.

What is the Beacon SDK?

The Beacon SDK gives you tools to easily access character data on Roll20 in your local web environment. This allows you hook up your local host to development sandboxes in Roll20 Tabletop and Roll20 Characters so you develop and test your characters in Roll20 using actual compendium and character data.

Beacon SDK also gives you more tools to create and manage attributes that define your sheet’s data structure. It helps to bypass problematic callback functions, and completely removes the need for sheetworkers from the custom sheet development method.

Key Features

  • Develop Sheets Your Way: Beacon allows you to use the modern web development frameworks of your choice essentially making digital character sheets out of a web applications.
  • Roll Mechanics: Integrate complex roll formulas and display roll results directly within Roll20 Tabletop or Roll20 Characters.
  • Macros: Create attributes that give players control to make macros for automated actions and roll calculations without giving them too much asses to attributes that could break their character sheet.
  • Event Handling: Utilize a comprehensive set of handlers to manage various events and interactions within Roll20 Tabletop.
  • Legacy Support: Convert and integrate legacy macros and roll templates with the new Beacon architecture.
  • Customization: Define custom actions, computed attibutes, and handle specific roll templates tailored to your game’s needs.

Getting Started

To get started with the Beacon SDK, you must initialize the relay, set up your character sheets, and define the necessary actions, handlers, and computed attributes.

This documentation provides detailed guides and examples to help you through each step of the process.

By leveraging the Beacon SDK, you can create rich, interactive, fully integrated characters sheet in Roll20 Tabletop and Roll20 Characters that enhance gameplay and streamline game management for players and GMs.

Whether adapting existing character sheets or building new ones from scratch, the Beacon SDK offers the tools and flexibility to bring your game to life.

\ No newline at end of file +Introduction |

Introduction

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

The Beacon SDK is a Software Development Toolset (SDK) designed to allow web developers create digital TTRPG character sheets for Roll20 using modern web development tools.

The Beacon SDK provides a framework to create dynamic, responsive, and fully integrated character sheet for both Roll20 Tabletop and Roll20 Characters.

What is the Beacon SDK?

The Beacon SDK gives you tools to easily access character data on Roll20 in your local web environment. This allows you hook up your local host to development sandboxes in Roll20 Tabletop and Roll20 Characters so you develop and test your characters in Roll20 using actual compendium and character data.

Beacon SDK also gives you more tools to create and manage attributes that define your sheet’s data structure. It helps to bypass problematic callback functions, and completely removes the need for sheetworkers from the custom sheet development method.

Key Features

  • Develop Sheets Your Way: Beacon allows you to use the modern web development frameworks of your choice essentially making digital character sheets out of a web applications.
  • Roll Mechanics: Integrate complex roll formulas and display roll results directly within Roll20 Tabletop or Roll20 Characters.
  • Macros: Create attributes that give players control to make macros for automated actions and roll calculations without giving them too much asses to attributes that could break their character sheet.
  • Event Handling: Utilize a comprehensive set of handlers to manage various events and interactions within Roll20 Tabletop.
  • Legacy Support: Convert and integrate legacy macros and roll templates with the new Beacon architecture.
  • Customization: Define custom actions, computed attibutes, and handle specific roll templates tailored to your game’s needs.

Getting Started

To get started with the Beacon SDK, you must initialize the relay, set up your character sheets, and define the necessary actions, handlers, and computed attributes.

This documentation provides detailed guides and examples to help you through each step of the process.

By leveraging the Beacon SDK, you can create rich, interactive, fully integrated characters sheet in Roll20 Tabletop and Roll20 Characters that enhance gameplay and streamline game management for players and GMs.

Whether adapting existing character sheets or building new ones from scratch, the Beacon SDK offers the tools and flexibility to bring your game to life.

\ No newline at end of file diff --git a/public/docs/gettingstarted/quick-start-sheet-template/index.html b/public/docs/gettingstarted/quick-start-sheet-template/index.html index c0db640..58c181c 100644 --- a/public/docs/gettingstarted/quick-start-sheet-template/index.html +++ b/public/docs/gettingstarted/quick-start-sheet-template/index.html @@ -1,4 +1,4 @@ -Quick Start Sheet Template |

Quick Start Sheet Template

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Prerequisites

To set this sheet up properly, make sure that you have the following tools installed:

  • Vue.js
  • Vite
  • SCSS

To download the community quick start sheet, refer to these repositories:

Figure 1: Quickstart sheet

Use the following steps to get started:

  1. Install the Beacon SDK: Run the following command.
npm i @roll20-official/beacon-sdk
  1. Install dependencies: Install the dependencies for the project.
npm install
  1. Start the Vite server: After installing the project’s dependencies, you’ll need to start the Vite server. There are two ways to do this:

a. Offline Development: This method will run the Vite server with the default port and environment set to development.

npm run dev

Once this code executes successfully, you can access the Vite server at http://localhost:5173.

This method is useful when you do not have access to the Roll20 website or would like to work on parts of your project that do not depend on a connection to the Roll20 Tabletop or Roll20 Characters, such as working on styling, mocking up the environment, building Vue components, testing functionality, etc.

In development mode, you cannot save or access existing character data or use the Beacon SDK functions that depend on Roll20 Tabletop or Roll20 Characters functionality, such as dice rolling and token manipulation.

b. Sandbox Development: This method will run the Vite server with the port set to 7620 and the environment set to staging mode.

npm run sandbox

This command will build the SCSS files and then run the Vite server. This will set the server up for connecting to a Roll20 Tabletop custom sheet sandbox as well as through the sandbox in Roll20 Characters.

To test your changes in the Roll20 Tabletop custom sheet sandbox, you will need to add the following to the sheet.json editor in the game settings:

{
+Quick Start Sheet Template | 

Quick Start Sheet Template

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

Prerequisites

To set this sheet up properly, make sure that you have the following tools installed:

  • Vue.js
  • Vite
  • SCSS

To download the community quick start sheet, refer to these repositories:

Figure 1: Quickstart sheet

Use the following steps to get started:

  1. Install the Beacon SDK: Run the following command.
npm i @roll20-official/beacon-sdk
  1. Install dependencies: Install the dependencies for the project.
npm install
  1. Start the Vite server: After installing the project’s dependencies, you’ll need to start the Vite server. There are two ways to do this:

a. Offline Development: This method will run the Vite server with the default port and environment set to development.

npm run dev

Once this code executes successfully, you can access the Vite server at http://localhost:5173.

This method is useful when you do not have access to the Roll20 website or would like to work on parts of your project that do not depend on a connection to the Roll20 Tabletop or Roll20 Characters, such as working on styling, mocking up the environment, building Vue components, testing functionality, etc.

In development mode, you cannot save or access existing character data or use the Beacon SDK functions that depend on Roll20 Tabletop or Roll20 Characters functionality, such as dice rolling and token manipulation.

b. Sandbox Development: This method will run the Vite server with the port set to 7620 and the environment set to staging mode.

npm run sandbox

This command will build the SCSS files and then run the Vite server. This will set the server up for connecting to a Roll20 Tabletop custom sheet sandbox as well as through the sandbox in Roll20 Characters.

To test your changes in the Roll20 Tabletop custom sheet sandbox, you will need to add the following to the sheet.json editor in the game settings:

{
        "advanced": true,
        "advancedPort": 7620
 }

Useful Commands

The following set of commands can come in handy when working with this sheet:

  • For Hot reloading and building CSS files, use the following command:
npm run watch-scss
  • For linting, use the following command:
npm run lint
  • For formatting with Prettier, use the following command:
npm run format
\ No newline at end of file diff --git a/public/docs/gettingstarted/releasing-a-sheet/index.html b/public/docs/gettingstarted/releasing-a-sheet/index.html index 26adeca..5431f8e 100644 --- a/public/docs/gettingstarted/releasing-a-sheet/index.html +++ b/public/docs/gettingstarted/releasing-a-sheet/index.html @@ -1,4 +1,4 @@ -Releasing a Sheet |

Releasing a Sheet

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

There are two ways you can publish a Beacon sheet.

  1. You can publish a testing verison of the sheet privately and give specific Roll20 users access to it on Roll20 Characters and Roll20 Tabletop, or
  2. You can submit a request to publish your sheet publicly for all users on Roll20 Characters and Roll20 Tabletop to have access.

When publishing a sheet, you will need to includes all the necessary code, assets, and metadata packaged together to be easily deployed and tested on the Roll20 platform. When a sheet is published, either publicly or privately for testing purposes, the sheet will run on Roll20 and will no longer require a local development environment to use it.

Who can release a sheet?

We allow anyone to create and release a sheet on Roll20 provided the sheet meets our code of conduct, does not infringe on our intellectual property or the intellectual property of our partners, and does not violate copyright laws. Before submitting a sheet to be released either as a test sheet in private or a publicly released sheet, please ensure that atleast one of these conditions are met.

  • I have authorization from the game’s publisher to make this an official sheet on Roll20 with their name attached.
  • This sheet is for an unofficial fan game and it does not contain any copyright material.
  • This sheet is a modification to an existing game with an open license that allows me to make a sheet for the game.
  • This sheet is a homebrew game system that I created myself.

Releasing a Test Sheet

The following steps will aid you while releasing your sheet. These steps assume this is your first time releasing your sheet for testing, but you will likely multiple times. Each time, follow these steps, making sure that everything is up-to-date with each release.

Step 1: Create a build command.

You must have a build command that will produce the minified production-ready code for the sheet. The build command must be able to create these exact files:
+Releasing a Sheet | 

Releasing a Sheet

Join the Closed Beta

The Beacon SDK is currently in closed Beta. Please complete the form to sign up for the closed beta.

Join to get access to the Beacon SDK, the community sheet repo for Beacon sheet, the community sheet developers in discord, and the new sheet developer Roll20 permissions.

There are two ways you can publish a Beacon sheet.

  1. You can publish a testing verison of the sheet privately and give specific Roll20 users access to it on Roll20 Characters and Roll20 Tabletop, or
  2. You can submit a request to publish your sheet publicly for all users on Roll20 Characters and Roll20 Tabletop to have access.

When publishing a sheet, you will need to includes all the necessary code, assets, and metadata packaged together to be easily deployed and tested on the Roll20 platform. When a sheet is published, either publicly or privately for testing purposes, the sheet will run on Roll20 and will no longer require a local development environment to use it.

Who can release a sheet?

We allow anyone to create and release a sheet on Roll20 provided the sheet meets our code of conduct, does not infringe on our intellectual property or the intellectual property of our partners, and does not violate copyright laws. Before submitting a sheet to be released either as a test sheet in private or a publicly released sheet, please ensure that atleast one of these conditions are met.

  • I have authorization from the game’s publisher to make this an official sheet on Roll20 with their name attached.
  • This sheet is for an unofficial fan game and it does not contain any copyright material.
  • This sheet is a modification to an existing game with an open license that allows me to make a sheet for the game.
  • This sheet is a homebrew game system that I created myself.

Releasing a Test Sheet

The following steps will aid you while releasing your sheet. These steps assume this is your first time releasing your sheet for testing, but you will likely multiple times. Each time, follow these steps, making sure that everything is up-to-date with each release.

Step 1: Create a build command.

You must have a build command that will produce the minified production-ready code for the sheet. The build command must be able to create these exact files:
 
 - `sheet.js`
 - `sheet.css`
diff --git a/public/docs/index.html b/public/docs/index.html
index a5b7492..85ed087 100644
--- a/public/docs/index.html
+++ b/public/docs/index.html
@@ -1 +1 @@
-Docs | 
\ No newline at end of file +Docs |
\ No newline at end of file diff --git a/public/index.html b/public/index.html index 501a2d5..b18711c 100644 --- a/public/index.html +++ b/public/index.html @@ -1,2 +1,2 @@ -The Beacon SDK by Roll20 -

The Beacon SDK by Roll20

Roll20 Character Sheets with Modern Web Development Tools

Code Your Way

The Beacon SDK connects you to Roll20 character sheet data, allowing you to create a modern web application using whatever tools you'd like. You are free to create a character sheet your way.

Develop Locally, Quickly

With the Beacon SDK, you can make edits and run them locally. Connect to the Roll20 sandboxes to instantly see your changes in Roll20 Tabletop or Roll20 Characters. Assign a compendium and access character data while building your sheet locally, making the development process swift and efficient.

Playtest Your Sheet

When you’re ready, release your sheet for a select group of people, giving them access to it in Roll20 Tabletop or Roll20 Characters. Gather feedback, make changes, and playtest it again with the same group. Build a sheet millions of players can enjoy.

\ No newline at end of file +The Beacon SDK by Roll20 +

The Beacon SDK by Roll20

Roll20 Character Sheets with Modern Web Development Tools

Code Your Way

The Beacon SDK connects you to Roll20 character sheet data, allowing you to create a modern web application using whatever tools you'd like. You are free to create a character sheet your way.

Develop Locally, Quickly

With the Beacon SDK, you can make edits and run them locally. Connect to the Roll20 sandboxes to instantly see your changes in Roll20 Tabletop or Roll20 Characters. Assign a compendium and access character data while building your sheet locally, making the development process swift and efficient.

Playtest Your Sheet

When you’re ready, release your sheet for a select group of people, giving them access to it in Roll20 Tabletop or Roll20 Characters. Gather feedback, make changes, and playtest it again with the same group. Build a sheet millions of players can enjoy.

\ No newline at end of file diff --git a/public/main.ca4895d78c50bb4533a515f6f86301d48ce8ed778882b950c84f1925d837f4f472005a5a3e1be02dc63065e88da8a5d184fb0ef5797824b450f80fd2eba9e267.css b/public/main.ca4895d78c50bb4533a515f6f86301d48ce8ed778882b950c84f1925d837f4f472005a5a3e1be02dc63065e88da8a5d184fb0ef5797824b450f80fd2eba9e267.css new file mode 100644 index 0000000..6efa3f4 --- /dev/null +++ b/public/main.ca4895d78c50bb4533a515f6f86301d48ce8ed778882b950c84f1925d837f4f472005a5a3e1be02dc63065e88da8a5d184fb0ef5797824b450f80fd2eba9e267.css @@ -0,0 +1,14472 @@ +@charset "UTF-8"; +/* Bluish cyan */ +/* Gray */ +/* Yellow */ +/* Khaki */ +/* Purple */ +/* Vermilion */ +:root[data-bs-theme="light"], +[data-bs-theme="light"] ::backdrop { + --sl-color-white: hsl(224, 10%, 10%); + --sl-color-gray-1: hsl(224, 14%, 16%); + --sl-color-gray-2: hsl(224, 10%, 23%); + --sl-color-gray-3: hsl(224, 7%, 36%); + --sl-color-gray-4: hsl(224, 6%, 56%); + --sl-color-gray-5: hsl(224, 6%, 77%); + --sl-color-gray-6: hsl(224, 20%, 94%); + --sl-color-gray-7: hsl(224, 19%, 97%); + --sl-color-black: hsl(0, 0%, 100%); } + +:root, +::backdrop { + --sl-color-white: hsl(0, 0%, 100%); + --sl-color-gray-1: hsl(224, 20%, 94%); + --sl-color-gray-2: hsl(224, 6%, 77%); + --sl-color-gray-3: hsl(224, 6%, 56%); + --sl-color-gray-4: hsl(224, 7%, 36%); + --sl-color-gray-5: hsl(224, 10%, 23%); + --sl-color-gray-6: hsl(224, 14%, 16%); + --sl-color-black: hsl(224, 10%, 10%); + --sl-hue-orange: 41; + --sl-color-orange-low: hsl(var(--sl-hue-orange), 39%, 22%); + --sl-color-orange: hsl(var(--sl-hue-orange), 82%, 63%); + --sl-color-orange-high: hsl(var(--sl-hue-orange), 82%, 87%); + --sl-hue-green: 101; + --sl-color-green-low: hsl(var(--sl-hue-green), 39%, 22%); + --sl-color-green: hsl(var(--sl-hue-green), 82%, 63%); + --sl-color-green-high: hsl(var(--sl-hue-green), 82%, 80%); + --sl-hue-blue: 234; + --sl-color-blue-low: hsl(var(--sl-hue-blue), 54%, 20%); + --sl-color-blue: hsl(var(--sl-hue-blue), 100%, 60%); + --sl-color-blue-high: hsl(var(--sl-hue-blue), 100%, 87%); + --sl-hue-purple: 281; + --sl-color-purple-low: hsl(var(--sl-hue-purple), 39%, 22%); + --sl-color-purple: hsl(var(--sl-hue-purple), 82%, 63%); + --sl-color-purple-high: hsl(var(--sl-hue-purple), 82%, 89%); + --sl-hue-red: 339; + --sl-color-red-low: hsl(var(--sl-hue-red), 39%, 22%); + --sl-color-red: hsl(var(--sl-hue-red), 82%, 63%); + --sl-color-red-high: hsl(var(--sl-hue-red), 82%, 87%); + --sl-color-accent-low: hsl(224, 54%, 20%); + --sl-color-accent: hsl(224, 100%, 60%); + --sl-color-accent-high: hsl(224, 100%, 85%); + --sl-color-text: var(--sl-color-gray-2); + --sl-color-text-accent: var(--sl-color-accent-high); + --sl-color-text-invert: var(--sl-color-accent-low); + --sl-color-bg: var(--sl-color-black); + --sl-color-bg-nav: var(--sl-color-gray-6); + --sl-color-bg-sidebar: var(--sl-color-gray-6); + --sl-color-bg-inline-code: var(--sl-color-gray-5); + --sl-color-hairline-light: var(--sl-color-gray-5); + --sl-color-hairline: var(--sl-color-gray-6); + --sl-color-hairline-shade: var(--sl-color-black); + --sl-color-backdrop-overlay: hsla(223, 13%, 10%, 0.66); + --sl-shadow-sm: 0px 1px 1px hsla(0, 0%, 0%, 0.12), 0px 2px 1px hsla(0, 0%, 0%, 0.24); + --sl-shadow-md: 0px 8px 4px hsla(0, 0%, 0%, 0.08), 0px 5px 2px hsla(0, 0%, 0%, 0.08), 0px 3px 2px hsla(0, 0%, 0%, 0.12), 0px 1px 1px hsla(0, 0%, 0%, 0.15); + --sl-shadow-lg: 0px 25px 7px hsla(0, 0%, 0%, 0.03), 0px 16px 6px hsla(0, 0%, 0%, 0.1), 0px 9px 5px hsla(223, 13%, 10%, 0.33), 0px 4px 4px hsla(0, 0%, 0%, 0.75), 0px 4px 2px hsla(0, 0%, 0%, 0.25); + --sl-text-xs: 0.8125rem; + --sl-text-sm: 0.875rem; + --sl-text-base: 1rem; + --sl-text-lg: 1.125rem; + --sl-text-xl: 1.25rem; + --sl-text-2xl: 1.5rem; + --sl-text-3xl: 1.8125rem; + --sl-text-4xl: 2.1875rem; + --sl-text-5xl: 2.625rem; + --sl-text-6xl: 4rem; + --sl-text-body: var(--sl-text-base); + --sl-text-body-sm: var(--sl-text-xs); + --sl-text-code: var(--sl-text-sm); + --sl-text-code-sm: var(--sl-text-xs); + --sl-text-h1: var(--sl-text-4xl); + --sl-text-h2: var(--sl-text-3xl); + --sl-text-h3: var(--sl-text-2xl); + --sl-text-h4: var(--sl-text-xl); + --sl-text-h5: var(--sl-text-lg); + --sl-line-height: 1.8; + --sl-line-height-headings: 1.2; + --sl-font-system: ui-sans-serif, system-ui, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + --sl-font-system-mono: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + --__sl-font: var(--sl-font, ""), var(--sl-font-system); + --__sl-font-mono: var(--sl-font-mono, ""), var(--sl-font-system-mono); + --sl-nav-height: 3.5rem; + --sl-nav-pad-x: 1rem; + --sl-nav-pad-y: 0.75rem; + --sl-mobile-toc-height: 3rem; + --sl-sidebar-width: 18.75rem; + --sl-sidebar-pad-x: 1rem; + --sl-content-width: 45rem; + --sl-content-pad-x: 1rem; + --sl-menu-button-size: 2rem; + --sl-nav-gap: var(--sl-content-pad-x); + --sl-outline-offset-inside: -0.1875rem; + --sl-z-index-toc: 4; + --sl-z-index-menu: 5; + --sl-z-index-navbar: 10; + --sl-z-index-skiplink: 20; } + +:root { + --purple-hsl: 255, 60%, 60%; + --overlay-blurple: hsla(var(--purple-hsl), 0.2); } + +:root { + --ec-brdRad: 0px; + --ec-brdWd: 1px; + --ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-codeFontFml: var(--__sl-font-mono); + --ec-codeFontSize: var(--sl-text-code); + --ec-codeFontWg: 400; + --ec-codeLineHt: var(--sl-line-height); + --ec-codePadBlk: 0.75rem; + --ec-codePadInl: 1rem; + --ec-codeBg: #011627; + --ec-codeFg: #d6deeb; + --ec-codeSelBg: #1d3b53; + --ec-uiFontFml: var(--__sl-font); + --ec-uiFontSize: 0.9rem; + --ec-uiFontWg: 400; + --ec-uiLineHt: 1.65; + --ec-uiPadBlk: 0.25rem; + --ec-uiPadInl: 1rem; + --ec-uiSelBg: #234d708c; + --ec-uiSelFg: #ffffff; + --ec-focusBrd: #122d42; + --ec-sbThumbCol: #ffffff17; + --ec-sbThumbHoverCol: #ffffff49; + --ec-tm-lineMarkerAccentMarg: 0rem; + --ec-tm-lineMarkerAccentWd: 0.15rem; + --ec-tm-lineDiffIndMargLeft: 0.25rem; + --ec-tm-inlMarkerBrdWd: 1.5px; + --ec-tm-inlMarkerBrdRad: 0.2rem; + --ec-tm-inlMarkerPad: 0.15rem; + --ec-tm-insDiffIndContent: "+"; + --ec-tm-delDiffIndContent: "-"; + --ec-tm-markBg: #ffffff17; + --ec-tm-markBrdCol: #ffffff40; + --ec-tm-insBg: #1e571599; + --ec-tm-insBrdCol: #487f3bd0; + --ec-tm-insDiffIndCol: #79b169d0; + --ec-tm-delBg: #862d2799; + --ec-tm-delBrdCol: #b4554bd0; + --ec-tm-delDiffIndCol: #ed8779d0; + --ec-frm-shdCol: #011627; + --ec-frm-frameBoxShdCssVal: none; + --ec-frm-edActTabBg: var(--sl-color-gray-6); + --ec-frm-edActTabFg: var(--sl-color-text); + --ec-frm-edActTabBrdCol: transparent; + --ec-frm-edActTabIndHt: 1px; + --ec-frm-edActTabIndTopCol: var(--sl-color-accent-high); + --ec-frm-edActTabIndBtmCol: transparent; + --ec-frm-edTabsMargInlStart: 0; + --ec-frm-edTabsMargBlkStart: 0; + --ec-frm-edTabBrdRad: 0px; + --ec-frm-edTabBarBg: var(--sl-color-black); + --ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-edBg: var(--sl-color-gray-6); + --ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-trmTtbDotsOpa: 0.75; + --ec-frm-trmTtbBg: var(--sl-color-black); + --ec-frm-trmTtbFg: var(--sl-color-text); + --ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-trmBg: var(--sl-color-gray-6); + --ec-frm-inlBtnFg: var(--sl-color-text); + --ec-frm-inlBtnBg: var(--sl-color-text); + --ec-frm-inlBtnBgIdleOpa: 0; + --ec-frm-inlBtnBgHoverOrFocusOpa: 0.2; + --ec-frm-inlBtnBgActOpa: 0.3; + --ec-frm-inlBtnBrd: var(--sl-color-text); + --ec-frm-inlBtnBrdOpa: 0.4; + --ec-frm-tooltipSuccessBg: #158744; + --ec-frm-tooltipSuccessFg: white; } + +:root, +[data-bs-theme="light"] { + --bs-blue: #3347ff; + --bs-indigo: #6610f2; + --bs-purple: #bd53ee; + --bs-pink: #d63384; + --bs-red: #ee5389; + --bs-orange: #fd7e14; + --bs-yellow: #eebd53; + --bs-green: #84ee53; + --bs-teal: #20c997; + --bs-cyan: #0dcaf0; + --bs-black: #000; + --bs-white: #fff; + --bs-gray: #6c757d; + --bs-gray-dark: #343a40; + --bs-gray-100: #f8f9fa; + --bs-gray-200: #e9ecef; + --bs-gray-300: #dee2e6; + --bs-gray-400: #ced4da; + --bs-gray-500: #adb5bd; + --bs-gray-600: #6c757d; + --bs-gray-700: #495057; + --bs-gray-800: #343a40; + --bs-gray-900: #212529; + --bs-primary: #5d2f86; + --bs-secondary: #6c757d; + --bs-success: #84ee53; + --bs-info: #3347ff; + --bs-warning: #eebd53; + --bs-danger: #ee5389; + --bs-light: #f8f9fa; + --bs-dark: #212529; + --bs-primary-rgb: 93, 47, 134; + --bs-secondary-rgb: 108, 117, 125; + --bs-success-rgb: 132.2821, 238.017, 83.283; + --bs-info-rgb: 51, 71.4, 255; + --bs-warning-rgb: 238.017, 189.0179, 83.283; + --bs-danger-rgb: 238.017, 83.283, 137.4399; + --bs-light-rgb: 248, 249, 250; + --bs-dark-rgb: 33, 37, 41; + --bs-primary-text-emphasis: #251336; + --bs-secondary-text-emphasis: #2b2f32; + --bs-success-text-emphasis: #355f21; + --bs-info-text-emphasis: #141d66; + --bs-warning-text-emphasis: #5f4c21; + --bs-danger-text-emphasis: #5f2137; + --bs-light-text-emphasis: #495057; + --bs-dark-text-emphasis: #495057; + --bs-primary-bg-subtle: #dfd5e7; + --bs-secondary-bg-subtle: #e2e3e5; + --bs-success-bg-subtle: #e6fcdd; + --bs-info-bg-subtle: #d6daff; + --bs-warning-bg-subtle: #fcf2dd; + --bs-danger-bg-subtle: #fcdde7; + --bs-light-bg-subtle: #fcfcfd; + --bs-dark-bg-subtle: #ced4da; + --bs-primary-border-subtle: #beaccf; + --bs-secondary-border-subtle: #c4c8cb; + --bs-success-border-subtle: #cef8ba; + --bs-info-border-subtle: #adb6ff; + --bs-warning-border-subtle: #f8e5ba; + --bs-danger-border-subtle: #f8bad0; + --bs-light-border-subtle: #e9ecef; + --bs-dark-border-subtle: #adb5bd; + --bs-white-rgb: 255, 255, 255; + --bs-black-rgb: 0, 0, 0; + --bs-font-sans-serif: "Jost", system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0)); + --bs-body-font-family: var(--bs-font-sans-serif); + --bs-body-font-size: 1rem; + --bs-body-font-weight: 400; + --bs-body-line-height: 1.5; + --bs-body-color: #1d2d35; + --bs-body-color-rgb: 29, 45, 53; + --bs-body-bg: #fff; + --bs-body-bg-rgb: 255, 255, 255; + --bs-emphasis-color: #000; + --bs-emphasis-color-rgb: 0, 0, 0; + --bs-secondary-color: rgba(29, 45, 53, 0.75); + --bs-secondary-color-rgb: 29, 45, 53; + --bs-secondary-bg: #e9ecef; + --bs-secondary-bg-rgb: 233, 236, 239; + --bs-tertiary-color: rgba(29, 45, 53, 0.5); + --bs-tertiary-color-rgb: 29, 45, 53; + --bs-tertiary-bg: #f8f9fa; + --bs-tertiary-bg-rgb: 248, 249, 250; + --bs-heading-color: inherit; + --bs-link-color: #5d2f86; + --bs-link-color-rgb: 93, 47, 134; + --bs-link-decoration: none; + --bs-link-hover-color: #4a266b; + --bs-link-hover-color-rgb: 74, 38, 107; + --bs-link-hover-decoration: underline; + --bs-code-color: #d63384; + --bs-highlight-color: #1d2d35; + --bs-highlight-bg: #fcf2dd; + --bs-border-width: 1px; + --bs-border-style: solid; + --bs-border-color: #dee2e6; + --bs-border-color-translucent: rgba(0, 0, 0, 0.175); + --bs-border-radius: 0.375rem; + --bs-border-radius-sm: 0.25rem; + --bs-border-radius-lg: 0.5rem; + --bs-border-radius-xl: 1rem; + --bs-border-radius-xxl: 2rem; + --bs-border-radius-2xl: var(--bs-border-radius-xxl); + --bs-border-radius-pill: 50rem; + --bs-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15); + --bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075); + --bs-box-shadow-lg: 0 1rem 3rem rgba(0, 0, 0, 0.175); + --bs-box-shadow-inset: inset 0 1px 2px rgba(0, 0, 0, 0.075); + --bs-focus-ring-width: 0.25rem; + --bs-focus-ring-opacity: 0.25; + --bs-focus-ring-color: rgba(93, 47, 134, 0.25); + --bs-form-valid-color: #84ee53; + --bs-form-valid-border-color: #84ee53; + --bs-form-invalid-color: #ee5389; + --bs-form-invalid-border-color: #ee5389; } + +[data-bs-theme="dark"] { + color-scheme: dark; + --bs-body-color: #c1c3c8; + --bs-body-color-rgb: 192.831, 194.7078, 199.869; + --bs-body-bg: #17181c; + --bs-body-bg-rgb: 22.95, 24.31, 28.05; + --bs-emphasis-color: #fff; + --bs-emphasis-color-rgb: 255, 255, 255; + --bs-secondary-color: rgba(193, 195, 200, 0.75); + --bs-secondary-color-rgb: 192.831, 194.7078, 199.869; + --bs-secondary-bg: #343a40; + --bs-secondary-bg-rgb: 52, 58, 64; + --bs-tertiary-color: rgba(193, 195, 200, 0.5); + --bs-tertiary-color-rgb: 192.831, 194.7078, 199.869; + --bs-tertiary-bg: #2b3035; + --bs-tertiary-bg-rgb: 43, 48, 53; + --bs-primary-text-emphasis: #9e82b6; + --bs-secondary-text-emphasis: #a7acb1; + --bs-success-text-emphasis: #b5f598; + --bs-info-text-emphasis: #8591ff; + --bs-warning-text-emphasis: #f5d798; + --bs-danger-text-emphasis: #f598b8; + --bs-light-text-emphasis: #f8f9fa; + --bs-dark-text-emphasis: #dee2e6; + --bs-primary-bg-subtle: #13091b; + --bs-secondary-bg-subtle: #161719; + --bs-success-bg-subtle: #1a3011; + --bs-info-bg-subtle: #0a0e33; + --bs-warning-bg-subtle: #302611; + --bs-danger-bg-subtle: #30111b; + --bs-light-bg-subtle: #23262f; + --bs-dark-bg-subtle: #1a1d20; + --bs-primary-border-subtle: #381c50; + --bs-secondary-border-subtle: #41464b; + --bs-success-border-subtle: #4f8f32; + --bs-info-border-subtle: #1f2b99; + --bs-warning-border-subtle: #8f7132; + --bs-danger-border-subtle: #8f3252; + --bs-light-border-subtle: #353841; + --bs-dark-border-subtle: #343a40; + --bs-heading-color: white; + --bs-link-color: #b3c7ff; + --bs-link-hover-color: #c2d2ff; + --bs-link-color-rgb: 178.5, 198.9, 255; + --bs-link-hover-color-rgb: 194, 210, 255; + --bs-code-color: #e685b5; + --bs-highlight-color: #c1c3c8; + --bs-highlight-bg: #5f4c21; + --bs-border-color: #495057; + --bs-border-color-translucent: rgba(255, 255, 255, 0.15); + --bs-form-valid-color: #b5f598; + --bs-form-valid-border-color: #b5f598; + --bs-form-invalid-color: #f598b8; + --bs-form-invalid-border-color: #f598b8; } + +*, +*::before, +*::after { + box-sizing: border-box; } + +@media (prefers-reduced-motion: no-preference) { + :root { + scroll-behavior: smooth; } } + +body { + margin: 0; + font-family: var(--bs-body-font-family); + font-size: var(--bs-body-font-size); + font-weight: var(--bs-body-font-weight); + line-height: var(--bs-body-line-height); + color: var(--bs-body-color); + text-align: var(--bs-body-text-align); + background-color: var(--bs-body-bg); + -webkit-text-size-adjust: 100%; + -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } + +hr { + margin: 1rem 0; + color: inherit; + border: 0; + border-top: var(--bs-border-width) solid; + opacity: 0.25; } + +h6, .h6, h5, .h5, h4, .h4, h3, .h3, h2, .h2, h1, .h1 { + margin-top: 0; + margin-bottom: 0.5rem; + font-weight: 700; + line-height: 1.2; + color: var(--bs-heading-color); } + +h1, .h1 { + font-size: calc(1.375rem + 1.5vw); } + @media (min-width: 1200px) { + h1, .h1 { + font-size: 2.5rem; } } +h2, .h2 { + font-size: calc(1.325rem + 0.9vw); } + @media (min-width: 1200px) { + h2, .h2 { + font-size: 2rem; } } +h3, .h3 { + font-size: calc(1.3rem + 0.6vw); } + @media (min-width: 1200px) { + h3, .h3 { + font-size: 1.75rem; } } +h4, .h4 { + font-size: calc(1.275rem + 0.3vw); } + @media (min-width: 1200px) { + h4, .h4 { + font-size: 1.5rem; } } +h5, .h5 { + font-size: 1.25rem; } + +h6, .h6 { + font-size: 1rem; } + +p { + margin-top: 0; + margin-bottom: 1rem; } + +abbr[title] { + text-decoration: underline dotted; + cursor: help; + text-decoration-skip-ink: none; } + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; } + +ol, +ul { + padding-left: 2rem; } + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; } + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; } + +dt { + font-weight: 700; } + +dd { + margin-bottom: .5rem; + margin-left: 0; } + +blockquote { + margin: 0 0 1rem; } + +b, +strong { + font-weight: bolder; } + +small, .small { + font-size: 0.875em; } + +mark, .mark { + padding: 0.1875em; + color: var(--bs-highlight-color); + background-color: var(--bs-highlight-bg); } + +sub, +sup { + position: relative; + font-size: 0.75em; + line-height: 0; + vertical-align: baseline; } + +sub { + bottom: -.25em; } + +sup { + top: -.5em; } + +a { + color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1)); + text-decoration: none; } + a:hover { + --bs-link-color-rgb: var(--bs-link-hover-color-rgb); + text-decoration: underline; } + +a:not([href]):not([class]), a:not([href]):not([class]):hover { + color: inherit; + text-decoration: none; } + +pre, +code, +kbd, +samp { + font-family: var(--bs-font-monospace); + font-size: 1em; } + +pre { + display: block; + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + font-size: 0.875em; } + pre code { + font-size: inherit; + color: inherit; + word-break: normal; } + +code { + font-size: 0.875em; + color: var(--bs-code-color); + word-wrap: break-word; } + a > code { + color: inherit; } + +kbd { + padding: 0.1875rem 0.375rem; + font-size: 0.875em; + color: var(--bs-body-bg); + background-color: var(--bs-body-color); + border-radius: 0.25rem; } + kbd kbd { + padding: 0; + font-size: 1em; } + +figure { + margin: 0 0 1rem; } + +img, +svg { + vertical-align: middle; } + +table { + caption-side: bottom; + border-collapse: collapse; } + +caption { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + color: var(--bs-secondary-color); + text-align: left; } + +th { + text-align: inherit; + text-align: -webkit-match-parent; } + +thead, +tbody, +tfoot, +tr, +td, +th { + border-color: inherit; + border-style: solid; + border-width: 0; } + +label { + display: inline-block; } + +button { + border-radius: 0; } + +button:focus:not(:focus-visible) { + outline: 0; } + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; } + +button, +select { + text-transform: none; } + +[role="button"] { + cursor: pointer; } + +select { + word-wrap: normal; } + select:disabled { + opacity: 1; } + +[list]:not([type="date"]):not([type="datetime-local"]):not([type="month"]):not([type="week"]):not([type="time"])::-webkit-calendar-picker-indicator { + display: none !important; } + +button, +[type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; } + button:not(:disabled), + [type="button"]:not(:disabled), + [type="reset"]:not(:disabled), + [type="submit"]:not(:disabled) { + cursor: pointer; } + +::-moz-focus-inner { + padding: 0; + border-style: none; } + +textarea { + resize: vertical; } + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; } + +legend { + float: left; + width: 100%; + padding: 0; + margin-bottom: 0.5rem; + font-size: calc(1.275rem + 0.3vw); + line-height: inherit; } + @media (min-width: 1200px) { + legend { + font-size: 1.5rem; } } + legend + * { + clear: left; } + +::-webkit-datetime-edit-fields-wrapper, +::-webkit-datetime-edit-text, +::-webkit-datetime-edit-minute, +::-webkit-datetime-edit-hour-field, +::-webkit-datetime-edit-day-field, +::-webkit-datetime-edit-month-field, +::-webkit-datetime-edit-year-field { + padding: 0; } + +::-webkit-inner-spin-button { + height: auto; } + +[type="search"] { + -webkit-appearance: textfield; + outline-offset: -2px; } + +/* rtl:raw: +[type="tel"], +[type="url"], +[type="email"], +[type="number"] { + direction: ltr; +} +*/ +::-webkit-search-decoration { + -webkit-appearance: none; } + +::-webkit-color-swatch-wrapper { + padding: 0; } + +::file-selector-button { + font: inherit; + -webkit-appearance: button; } + +output { + display: inline-block; } + +iframe { + border: 0; } + +summary { + display: list-item; + cursor: pointer; } + +progress { + vertical-align: baseline; } + +[hidden] { + display: none !important; } + +.lead { + font-size: 1.25rem; + font-weight: 400; } + +.display-1 { + font-size: calc(1.625rem + 4.5vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-1 { + font-size: 5rem; } } +.display-2 { + font-size: calc(1.575rem + 3.9vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-2 { + font-size: 4.5rem; } } +.display-3 { + font-size: calc(1.525rem + 3.3vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-3 { + font-size: 4rem; } } +.display-4 { + font-size: calc(1.475rem + 2.7vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-4 { + font-size: 3.5rem; } } +.display-5 { + font-size: calc(1.425rem + 2.1vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-5 { + font-size: 3rem; } } +.display-6 { + font-size: calc(1.375rem + 1.5vw); + font-weight: 300; + line-height: 1.2; } + @media (min-width: 1200px) { + .display-6 { + font-size: 2.5rem; } } +.list-unstyled, ul.list-star li, ul.list-package li, ul.list-speech-balloon li, ul.list-books li, ul.list-toolbox li, .comment-list { + padding-left: 0; + list-style: none; } + +.list-inline { + padding-left: 0; + list-style: none; } + +.list-inline-item { + display: inline-block; } + .list-inline-item:not(:last-child) { + margin-right: 0.5rem; } + +.initialism { + font-size: 0.875em; + text-transform: uppercase; } + +.blockquote { + margin-bottom: 1rem; + font-size: 1.25rem; } + .blockquote > :last-child { + margin-bottom: 0; } + +.blockquote-footer { + margin-top: -1rem; + margin-bottom: 1rem; + font-size: 0.875em; + color: #6c757d; } + .blockquote-footer::before { + content: "\2014\00A0"; } + +.img-fluid { + max-width: 100%; + height: auto; } + +.img-thumbnail { + padding: 0.25rem; + background-color: var(--bs-body-bg); + border: var(--bs-border-width) solid var(--bs-border-color); + border-radius: var(--bs-border-radius); + max-width: 100%; + height: auto; } + +.figure { + display: inline-block; } + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; } + +.figure-caption { + font-size: 0.875em; + color: var(--bs-secondary-color); } + +.container, +.container-fluid, +.container-xxl, +.container-xl, +.container-lg, +.container-md, +.container-sm { + --bs-gutter-x: 3rem; + --bs-gutter-y: 0; + width: 100%; + padding-right: calc(var(--bs-gutter-x) * .5); + padding-left: calc(var(--bs-gutter-x) * .5); + margin-right: auto; + margin-left: auto; } + +@media (min-width: 576px) { + .container-sm, .container { + max-width: 540px; } } + +@media (min-width: 768px) { + .container-md, .container-sm, .container { + max-width: 720px; } } + +@media (min-width: 992px) { + .container-lg, .container-md, .container-sm, .container { + max-width: 960px; } } + +@media (min-width: 1200px) { + .container-xl, .container-lg, .container-md, .container-sm, .container { + max-width: 1240px; } } + +@media (min-width: 1400px) { + .container-xxl, .container-xl, .container-lg, .container-md, .container-sm, .container { + max-width: 1320px; } } + +:root { + --bs-breakpoint-xs: 0; + --bs-breakpoint-sm: 576px; + --bs-breakpoint-md: 768px; + --bs-breakpoint-lg: 992px; + --bs-breakpoint-xl: 1200px; + --bs-breakpoint-xxl: 1400px; } + +.row { + --bs-gutter-x: 3rem; + --bs-gutter-y: 0; + display: flex; + flex-wrap: wrap; + margin-top: calc(-1 * var(--bs-gutter-y)); + margin-right: calc(-.5 * var(--bs-gutter-x)); + margin-left: calc(-.5 * var(--bs-gutter-x)); } + .row > * { + flex-shrink: 0; + width: 100%; + max-width: 100%; + padding-right: calc(var(--bs-gutter-x) * .5); + padding-left: calc(var(--bs-gutter-x) * .5); + margin-top: var(--bs-gutter-y); } + +.col { + flex: 1 0 0%; } + +.row-cols-auto > * { + flex: 0 0 auto; + width: auto; } + +.row-cols-1 > * { + flex: 0 0 auto; + width: 100%; } + +.row-cols-2 > * { + flex: 0 0 auto; + width: 50%; } + +.row-cols-3 > * { + flex: 0 0 auto; + width: 33.33333333%; } + +.row-cols-4 > * { + flex: 0 0 auto; + width: 25%; } + +.row-cols-5 > * { + flex: 0 0 auto; + width: 20%; } + +.row-cols-6 > * { + flex: 0 0 auto; + width: 16.66666667%; } + +.col-auto { + flex: 0 0 auto; + width: auto; } + +.col-1 { + flex: 0 0 auto; + width: 6.25%; } + +.col-2 { + flex: 0 0 auto; + width: 12.5%; } + +.col-3 { + flex: 0 0 auto; + width: 18.75%; } + +.col-4 { + flex: 0 0 auto; + width: 25%; } + +.col-5 { + flex: 0 0 auto; + width: 31.25%; } + +.col-6 { + flex: 0 0 auto; + width: 37.5%; } + +.col-7 { + flex: 0 0 auto; + width: 43.75%; } + +.col-8 { + flex: 0 0 auto; + width: 50%; } + +.col-9 { + flex: 0 0 auto; + width: 56.25%; } + +.col-10 { + flex: 0 0 auto; + width: 62.5%; } + +.col-11 { + flex: 0 0 auto; + width: 68.75%; } + +.col-12 { + flex: 0 0 auto; + width: 75%; } + +.col-13 { + flex: 0 0 auto; + width: 81.25%; } + +.col-14 { + flex: 0 0 auto; + width: 87.5%; } + +.col-15 { + flex: 0 0 auto; + width: 93.75%; } + +.col-16 { + flex: 0 0 auto; + width: 100%; } + +.offset-1 { + margin-left: 6.25%; } + +.offset-2 { + margin-left: 12.5%; } + +.offset-3 { + margin-left: 18.75%; } + +.offset-4 { + margin-left: 25%; } + +.offset-5 { + margin-left: 31.25%; } + +.offset-6 { + margin-left: 37.5%; } + +.offset-7 { + margin-left: 43.75%; } + +.offset-8 { + margin-left: 50%; } + +.offset-9 { + margin-left: 56.25%; } + +.offset-10 { + margin-left: 62.5%; } + +.offset-11 { + margin-left: 68.75%; } + +.offset-12 { + margin-left: 75%; } + +.offset-13 { + margin-left: 81.25%; } + +.offset-14 { + margin-left: 87.5%; } + +.offset-15 { + margin-left: 93.75%; } + +.g-0, +.gx-0 { + --bs-gutter-x: 0; } + +.g-0, +.gy-0 { + --bs-gutter-y: 0; } + +.g-1, +.gx-1 { + --bs-gutter-x: 0.25rem; } + +.g-1, +.gy-1 { + --bs-gutter-y: 0.25rem; } + +.g-2, +.gx-2 { + --bs-gutter-x: 0.5rem; } + +.g-2, +.gy-2 { + --bs-gutter-y: 0.5rem; } + +.g-3, +.gx-3 { + --bs-gutter-x: 1rem; } + +.g-3, +.gy-3 { + --bs-gutter-y: 1rem; } + +.g-4, +.gx-4 { + --bs-gutter-x: 1.5rem; } + +.g-4, +.gy-4 { + --bs-gutter-y: 1.5rem; } + +.g-5, +.gx-5 { + --bs-gutter-x: 3rem; } + +.g-5, +.gy-5 { + --bs-gutter-y: 3rem; } + +@media (min-width: 576px) { + .col-sm { + flex: 1 0 0%; } + .row-cols-sm-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-sm-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-sm-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-sm-3 > * { + flex: 0 0 auto; + width: 33.33333333%; } + .row-cols-sm-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-sm-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-sm-6 > * { + flex: 0 0 auto; + width: 16.66666667%; } + .col-sm-auto { + flex: 0 0 auto; + width: auto; } + .col-sm-1 { + flex: 0 0 auto; + width: 6.25%; } + .col-sm-2 { + flex: 0 0 auto; + width: 12.5%; } + .col-sm-3 { + flex: 0 0 auto; + width: 18.75%; } + .col-sm-4 { + flex: 0 0 auto; + width: 25%; } + .col-sm-5 { + flex: 0 0 auto; + width: 31.25%; } + .col-sm-6 { + flex: 0 0 auto; + width: 37.5%; } + .col-sm-7 { + flex: 0 0 auto; + width: 43.75%; } + .col-sm-8 { + flex: 0 0 auto; + width: 50%; } + .col-sm-9 { + flex: 0 0 auto; + width: 56.25%; } + .col-sm-10 { + flex: 0 0 auto; + width: 62.5%; } + .col-sm-11 { + flex: 0 0 auto; + width: 68.75%; } + .col-sm-12 { + flex: 0 0 auto; + width: 75%; } + .col-sm-13 { + flex: 0 0 auto; + width: 81.25%; } + .col-sm-14 { + flex: 0 0 auto; + width: 87.5%; } + .col-sm-15 { + flex: 0 0 auto; + width: 93.75%; } + .col-sm-16 { + flex: 0 0 auto; + width: 100%; } + .offset-sm-0 { + margin-left: 0; } + .offset-sm-1 { + margin-left: 6.25%; } + .offset-sm-2 { + margin-left: 12.5%; } + .offset-sm-3 { + margin-left: 18.75%; } + .offset-sm-4 { + margin-left: 25%; } + .offset-sm-5 { + margin-left: 31.25%; } + .offset-sm-6 { + margin-left: 37.5%; } + .offset-sm-7 { + margin-left: 43.75%; } + .offset-sm-8 { + margin-left: 50%; } + .offset-sm-9 { + margin-left: 56.25%; } + .offset-sm-10 { + margin-left: 62.5%; } + .offset-sm-11 { + margin-left: 68.75%; } + .offset-sm-12 { + margin-left: 75%; } + .offset-sm-13 { + margin-left: 81.25%; } + .offset-sm-14 { + margin-left: 87.5%; } + .offset-sm-15 { + margin-left: 93.75%; } + .g-sm-0, + .gx-sm-0 { + --bs-gutter-x: 0; } + .g-sm-0, + .gy-sm-0 { + --bs-gutter-y: 0; } + .g-sm-1, + .gx-sm-1 { + --bs-gutter-x: 0.25rem; } + .g-sm-1, + .gy-sm-1 { + --bs-gutter-y: 0.25rem; } + .g-sm-2, + .gx-sm-2 { + --bs-gutter-x: 0.5rem; } + .g-sm-2, + .gy-sm-2 { + --bs-gutter-y: 0.5rem; } + .g-sm-3, + .gx-sm-3 { + --bs-gutter-x: 1rem; } + .g-sm-3, + .gy-sm-3 { + --bs-gutter-y: 1rem; } + .g-sm-4, + .gx-sm-4 { + --bs-gutter-x: 1.5rem; } + .g-sm-4, + .gy-sm-4 { + --bs-gutter-y: 1.5rem; } + .g-sm-5, + .gx-sm-5 { + --bs-gutter-x: 3rem; } + .g-sm-5, + .gy-sm-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 768px) { + .col-md { + flex: 1 0 0%; } + .row-cols-md-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-md-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-md-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-md-3 > * { + flex: 0 0 auto; + width: 33.33333333%; } + .row-cols-md-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-md-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-md-6 > * { + flex: 0 0 auto; + width: 16.66666667%; } + .col-md-auto { + flex: 0 0 auto; + width: auto; } + .col-md-1 { + flex: 0 0 auto; + width: 6.25%; } + .col-md-2 { + flex: 0 0 auto; + width: 12.5%; } + .col-md-3 { + flex: 0 0 auto; + width: 18.75%; } + .col-md-4 { + flex: 0 0 auto; + width: 25%; } + .col-md-5 { + flex: 0 0 auto; + width: 31.25%; } + .col-md-6 { + flex: 0 0 auto; + width: 37.5%; } + .col-md-7 { + flex: 0 0 auto; + width: 43.75%; } + .col-md-8 { + flex: 0 0 auto; + width: 50%; } + .col-md-9 { + flex: 0 0 auto; + width: 56.25%; } + .col-md-10 { + flex: 0 0 auto; + width: 62.5%; } + .col-md-11 { + flex: 0 0 auto; + width: 68.75%; } + .col-md-12 { + flex: 0 0 auto; + width: 75%; } + .col-md-13 { + flex: 0 0 auto; + width: 81.25%; } + .col-md-14 { + flex: 0 0 auto; + width: 87.5%; } + .col-md-15 { + flex: 0 0 auto; + width: 93.75%; } + .col-md-16 { + flex: 0 0 auto; + width: 100%; } + .offset-md-0 { + margin-left: 0; } + .offset-md-1 { + margin-left: 6.25%; } + .offset-md-2 { + margin-left: 12.5%; } + .offset-md-3 { + margin-left: 18.75%; } + .offset-md-4 { + margin-left: 25%; } + .offset-md-5 { + margin-left: 31.25%; } + .offset-md-6 { + margin-left: 37.5%; } + .offset-md-7 { + margin-left: 43.75%; } + .offset-md-8 { + margin-left: 50%; } + .offset-md-9 { + margin-left: 56.25%; } + .offset-md-10 { + margin-left: 62.5%; } + .offset-md-11 { + margin-left: 68.75%; } + .offset-md-12 { + margin-left: 75%; } + .offset-md-13 { + margin-left: 81.25%; } + .offset-md-14 { + margin-left: 87.5%; } + .offset-md-15 { + margin-left: 93.75%; } + .g-md-0, + .gx-md-0 { + --bs-gutter-x: 0; } + .g-md-0, + .gy-md-0 { + --bs-gutter-y: 0; } + .g-md-1, + .gx-md-1 { + --bs-gutter-x: 0.25rem; } + .g-md-1, + .gy-md-1 { + --bs-gutter-y: 0.25rem; } + .g-md-2, + .gx-md-2 { + --bs-gutter-x: 0.5rem; } + .g-md-2, + .gy-md-2 { + --bs-gutter-y: 0.5rem; } + .g-md-3, + .gx-md-3 { + --bs-gutter-x: 1rem; } + .g-md-3, + .gy-md-3 { + --bs-gutter-y: 1rem; } + .g-md-4, + .gx-md-4 { + --bs-gutter-x: 1.5rem; } + .g-md-4, + .gy-md-4 { + --bs-gutter-y: 1.5rem; } + .g-md-5, + .gx-md-5 { + --bs-gutter-x: 3rem; } + .g-md-5, + .gy-md-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 992px) { + .col-lg { + flex: 1 0 0%; } + .row-cols-lg-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-lg-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-lg-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-lg-3 > * { + flex: 0 0 auto; + width: 33.33333333%; } + .row-cols-lg-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-lg-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-lg-6 > * { + flex: 0 0 auto; + width: 16.66666667%; } + .col-lg-auto { + flex: 0 0 auto; + width: auto; } + .col-lg-1 { + flex: 0 0 auto; + width: 6.25%; } + .col-lg-2 { + flex: 0 0 auto; + width: 12.5%; } + .col-lg-3 { + flex: 0 0 auto; + width: 18.75%; } + .col-lg-4 { + flex: 0 0 auto; + width: 25%; } + .col-lg-5 { + flex: 0 0 auto; + width: 31.25%; } + .col-lg-6 { + flex: 0 0 auto; + width: 37.5%; } + .col-lg-7 { + flex: 0 0 auto; + width: 43.75%; } + .col-lg-8 { + flex: 0 0 auto; + width: 50%; } + .col-lg-9 { + flex: 0 0 auto; + width: 56.25%; } + .col-lg-10 { + flex: 0 0 auto; + width: 62.5%; } + .col-lg-11 { + flex: 0 0 auto; + width: 68.75%; } + .col-lg-12 { + flex: 0 0 auto; + width: 75%; } + .col-lg-13 { + flex: 0 0 auto; + width: 81.25%; } + .col-lg-14 { + flex: 0 0 auto; + width: 87.5%; } + .col-lg-15 { + flex: 0 0 auto; + width: 93.75%; } + .col-lg-16 { + flex: 0 0 auto; + width: 100%; } + .offset-lg-0 { + margin-left: 0; } + .offset-lg-1 { + margin-left: 6.25%; } + .offset-lg-2 { + margin-left: 12.5%; } + .offset-lg-3 { + margin-left: 18.75%; } + .offset-lg-4 { + margin-left: 25%; } + .offset-lg-5 { + margin-left: 31.25%; } + .offset-lg-6 { + margin-left: 37.5%; } + .offset-lg-7 { + margin-left: 43.75%; } + .offset-lg-8 { + margin-left: 50%; } + .offset-lg-9 { + margin-left: 56.25%; } + .offset-lg-10 { + margin-left: 62.5%; } + .offset-lg-11 { + margin-left: 68.75%; } + .offset-lg-12 { + margin-left: 75%; } + .offset-lg-13 { + margin-left: 81.25%; } + .offset-lg-14 { + margin-left: 87.5%; } + .offset-lg-15 { + margin-left: 93.75%; } + .g-lg-0, + .gx-lg-0 { + --bs-gutter-x: 0; } + .g-lg-0, + .gy-lg-0 { + --bs-gutter-y: 0; } + .g-lg-1, + .gx-lg-1 { + --bs-gutter-x: 0.25rem; } + .g-lg-1, + .gy-lg-1 { + --bs-gutter-y: 0.25rem; } + .g-lg-2, + .gx-lg-2 { + --bs-gutter-x: 0.5rem; } + .g-lg-2, + .gy-lg-2 { + --bs-gutter-y: 0.5rem; } + .g-lg-3, + .gx-lg-3 { + --bs-gutter-x: 1rem; } + .g-lg-3, + .gy-lg-3 { + --bs-gutter-y: 1rem; } + .g-lg-4, + .gx-lg-4 { + --bs-gutter-x: 1.5rem; } + .g-lg-4, + .gy-lg-4 { + --bs-gutter-y: 1.5rem; } + .g-lg-5, + .gx-lg-5 { + --bs-gutter-x: 3rem; } + .g-lg-5, + .gy-lg-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 1200px) { + .col-xl { + flex: 1 0 0%; } + .row-cols-xl-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-xl-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-xl-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-xl-3 > * { + flex: 0 0 auto; + width: 33.33333333%; } + .row-cols-xl-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-xl-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-xl-6 > * { + flex: 0 0 auto; + width: 16.66666667%; } + .col-xl-auto { + flex: 0 0 auto; + width: auto; } + .col-xl-1 { + flex: 0 0 auto; + width: 6.25%; } + .col-xl-2 { + flex: 0 0 auto; + width: 12.5%; } + .col-xl-3 { + flex: 0 0 auto; + width: 18.75%; } + .col-xl-4 { + flex: 0 0 auto; + width: 25%; } + .col-xl-5 { + flex: 0 0 auto; + width: 31.25%; } + .col-xl-6 { + flex: 0 0 auto; + width: 37.5%; } + .col-xl-7 { + flex: 0 0 auto; + width: 43.75%; } + .col-xl-8 { + flex: 0 0 auto; + width: 50%; } + .col-xl-9 { + flex: 0 0 auto; + width: 56.25%; } + .col-xl-10 { + flex: 0 0 auto; + width: 62.5%; } + .col-xl-11 { + flex: 0 0 auto; + width: 68.75%; } + .col-xl-12 { + flex: 0 0 auto; + width: 75%; } + .col-xl-13 { + flex: 0 0 auto; + width: 81.25%; } + .col-xl-14 { + flex: 0 0 auto; + width: 87.5%; } + .col-xl-15 { + flex: 0 0 auto; + width: 93.75%; } + .col-xl-16 { + flex: 0 0 auto; + width: 100%; } + .offset-xl-0 { + margin-left: 0; } + .offset-xl-1 { + margin-left: 6.25%; } + .offset-xl-2 { + margin-left: 12.5%; } + .offset-xl-3 { + margin-left: 18.75%; } + .offset-xl-4 { + margin-left: 25%; } + .offset-xl-5 { + margin-left: 31.25%; } + .offset-xl-6 { + margin-left: 37.5%; } + .offset-xl-7 { + margin-left: 43.75%; } + .offset-xl-8 { + margin-left: 50%; } + .offset-xl-9 { + margin-left: 56.25%; } + .offset-xl-10 { + margin-left: 62.5%; } + .offset-xl-11 { + margin-left: 68.75%; } + .offset-xl-12 { + margin-left: 75%; } + .offset-xl-13 { + margin-left: 81.25%; } + .offset-xl-14 { + margin-left: 87.5%; } + .offset-xl-15 { + margin-left: 93.75%; } + .g-xl-0, + .gx-xl-0 { + --bs-gutter-x: 0; } + .g-xl-0, + .gy-xl-0 { + --bs-gutter-y: 0; } + .g-xl-1, + .gx-xl-1 { + --bs-gutter-x: 0.25rem; } + .g-xl-1, + .gy-xl-1 { + --bs-gutter-y: 0.25rem; } + .g-xl-2, + .gx-xl-2 { + --bs-gutter-x: 0.5rem; } + .g-xl-2, + .gy-xl-2 { + --bs-gutter-y: 0.5rem; } + .g-xl-3, + .gx-xl-3 { + --bs-gutter-x: 1rem; } + .g-xl-3, + .gy-xl-3 { + --bs-gutter-y: 1rem; } + .g-xl-4, + .gx-xl-4 { + --bs-gutter-x: 1.5rem; } + .g-xl-4, + .gy-xl-4 { + --bs-gutter-y: 1.5rem; } + .g-xl-5, + .gx-xl-5 { + --bs-gutter-x: 3rem; } + .g-xl-5, + .gy-xl-5 { + --bs-gutter-y: 3rem; } } + +@media (min-width: 1400px) { + .col-xxl { + flex: 1 0 0%; } + .row-cols-xxl-auto > * { + flex: 0 0 auto; + width: auto; } + .row-cols-xxl-1 > * { + flex: 0 0 auto; + width: 100%; } + .row-cols-xxl-2 > * { + flex: 0 0 auto; + width: 50%; } + .row-cols-xxl-3 > * { + flex: 0 0 auto; + width: 33.33333333%; } + .row-cols-xxl-4 > * { + flex: 0 0 auto; + width: 25%; } + .row-cols-xxl-5 > * { + flex: 0 0 auto; + width: 20%; } + .row-cols-xxl-6 > * { + flex: 0 0 auto; + width: 16.66666667%; } + .col-xxl-auto { + flex: 0 0 auto; + width: auto; } + .col-xxl-1 { + flex: 0 0 auto; + width: 6.25%; } + .col-xxl-2 { + flex: 0 0 auto; + width: 12.5%; } + .col-xxl-3 { + flex: 0 0 auto; + width: 18.75%; } + .col-xxl-4 { + flex: 0 0 auto; + width: 25%; } + .col-xxl-5 { + flex: 0 0 auto; + width: 31.25%; } + .col-xxl-6 { + flex: 0 0 auto; + width: 37.5%; } + .col-xxl-7 { + flex: 0 0 auto; + width: 43.75%; } + .col-xxl-8 { + flex: 0 0 auto; + width: 50%; } + .col-xxl-9 { + flex: 0 0 auto; + width: 56.25%; } + .col-xxl-10 { + flex: 0 0 auto; + width: 62.5%; } + .col-xxl-11 { + flex: 0 0 auto; + width: 68.75%; } + .col-xxl-12 { + flex: 0 0 auto; + width: 75%; } + .col-xxl-13 { + flex: 0 0 auto; + width: 81.25%; } + .col-xxl-14 { + flex: 0 0 auto; + width: 87.5%; } + .col-xxl-15 { + flex: 0 0 auto; + width: 93.75%; } + .col-xxl-16 { + flex: 0 0 auto; + width: 100%; } + .offset-xxl-0 { + margin-left: 0; } + .offset-xxl-1 { + margin-left: 6.25%; } + .offset-xxl-2 { + margin-left: 12.5%; } + .offset-xxl-3 { + margin-left: 18.75%; } + .offset-xxl-4 { + margin-left: 25%; } + .offset-xxl-5 { + margin-left: 31.25%; } + .offset-xxl-6 { + margin-left: 37.5%; } + .offset-xxl-7 { + margin-left: 43.75%; } + .offset-xxl-8 { + margin-left: 50%; } + .offset-xxl-9 { + margin-left: 56.25%; } + .offset-xxl-10 { + margin-left: 62.5%; } + .offset-xxl-11 { + margin-left: 68.75%; } + .offset-xxl-12 { + margin-left: 75%; } + .offset-xxl-13 { + margin-left: 81.25%; } + .offset-xxl-14 { + margin-left: 87.5%; } + .offset-xxl-15 { + margin-left: 93.75%; } + .g-xxl-0, + .gx-xxl-0 { + --bs-gutter-x: 0; } + .g-xxl-0, + .gy-xxl-0 { + --bs-gutter-y: 0; } + .g-xxl-1, + .gx-xxl-1 { + --bs-gutter-x: 0.25rem; } + .g-xxl-1, + .gy-xxl-1 { + --bs-gutter-y: 0.25rem; } + .g-xxl-2, + .gx-xxl-2 { + --bs-gutter-x: 0.5rem; } + .g-xxl-2, + .gy-xxl-2 { + --bs-gutter-y: 0.5rem; } + .g-xxl-3, + .gx-xxl-3 { + --bs-gutter-x: 1rem; } + .g-xxl-3, + .gy-xxl-3 { + --bs-gutter-y: 1rem; } + .g-xxl-4, + .gx-xxl-4 { + --bs-gutter-x: 1.5rem; } + .g-xxl-4, + .gy-xxl-4 { + --bs-gutter-y: 1.5rem; } + .g-xxl-5, + .gx-xxl-5 { + --bs-gutter-x: 3rem; } + .g-xxl-5, + .gy-xxl-5 { + --bs-gutter-y: 3rem; } } + +.clearfix::after { + display: block; + clear: both; + content: ""; } + +.text-bg-primary { + color: #fff !important; + background-color: RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-secondary { + color: #fff !important; + background-color: RGBA(var(--bs-secondary-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-success { + color: #000 !important; + background-color: RGBA(var(--bs-success-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-info { + color: #fff !important; + background-color: RGBA(var(--bs-info-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-warning { + color: #000 !important; + background-color: RGBA(var(--bs-warning-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-danger { + color: #000 !important; + background-color: RGBA(var(--bs-danger-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-light { + color: #000 !important; + background-color: RGBA(var(--bs-light-rgb), var(--bs-bg-opacity, 1)) !important; } + +.text-bg-dark { + color: #fff !important; + background-color: RGBA(var(--bs-dark-rgb), var(--bs-bg-opacity, 1)) !important; } + +.link-primary { + color: RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-primary:hover, .link-primary:focus { + color: RGBA(74, 38, 107, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(74, 38, 107, var(--bs-link-underline-opacity, 1)) !important; } + +.link-secondary { + color: RGBA(var(--bs-secondary-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-secondary:hover, .link-secondary:focus { + color: RGBA(86, 94, 100, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1)) !important; } + +.link-success { + color: RGBA(var(--bs-success-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-success:hover, .link-success:focus { + color: RGBA(157, 241, 118, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(157, 241, 118, var(--bs-link-underline-opacity, 1)) !important; } + +.link-info { + color: RGBA(var(--bs-info-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-info:hover, .link-info:focus { + color: RGBA(41, 57, 204, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(41, 57, 204, var(--bs-link-underline-opacity, 1)) !important; } + +.link-warning { + color: RGBA(var(--bs-warning-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-warning:hover, .link-warning:focus { + color: RGBA(241, 202, 118, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(241, 202, 118, var(--bs-link-underline-opacity, 1)) !important; } + +.link-danger { + color: RGBA(var(--bs-danger-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-danger:hover, .link-danger:focus { + color: RGBA(241, 118, 161, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(241, 118, 161, var(--bs-link-underline-opacity, 1)) !important; } + +.link-light { + color: RGBA(var(--bs-light-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-light:hover, .link-light:focus { + color: RGBA(249, 250, 251, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1)) !important; } + +.link-dark { + color: RGBA(var(--bs-dark-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-dark:hover, .link-dark:focus { + color: RGBA(26, 30, 33, var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1)) !important; } + +.link-body-emphasis { + color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1)) !important; + text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important; } + .link-body-emphasis:hover, .link-body-emphasis:focus { + color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 0.75)) !important; + text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important; } + +.focus-ring:focus { + outline: 0; + box-shadow: var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color); } + +.icon-link { + display: inline-flex; + gap: 0.375rem; + align-items: center; + text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5)); + text-underline-offset: 0.25em; + backface-visibility: hidden; } + .icon-link > .bi { + flex-shrink: 0; + width: 1em; + height: 1em; + fill: currentcolor; + transition: 0.2s ease-in-out transform; } + @media (prefers-reduced-motion: reduce) { + .icon-link > .bi { + transition: none; } } +.icon-link-hover:hover > .bi, .icon-link-hover:focus-visible > .bi { + transform: var(--bs-icon-link-transform, translate3d(0.25em, 0, 0)); } + +.ratio { + position: relative; + width: 100%; } + .ratio::before { + display: block; + padding-top: var(--bs-aspect-ratio); + content: ""; } + .ratio > * { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; } + +.ratio-1x1 { + --bs-aspect-ratio: 100%; } + +.ratio-4x3 { + --bs-aspect-ratio: calc(3 / 4 * 100%); } + +.ratio-16x9 { + --bs-aspect-ratio: calc(9 / 16 * 100%); } + +.ratio-21x9 { + --bs-aspect-ratio: calc(9 / 21 * 100%); } + +.fixed-top { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; } + +.fixed-bottom { + position: fixed; + right: 0; + bottom: 0; + left: 0; + z-index: 1030; } + +.sticky-top { + position: sticky; + top: 0; + z-index: 1020; } + +.sticky-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } + +@media (min-width: 576px) { + .sticky-sm-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-sm-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 768px) { + .sticky-md-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-md-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 992px) { + .sticky-lg-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-lg-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 1200px) { + .sticky-xl-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-xl-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +@media (min-width: 1400px) { + .sticky-xxl-top { + position: sticky; + top: 0; + z-index: 1020; } + .sticky-xxl-bottom { + position: sticky; + bottom: 0; + z-index: 1020; } } + +.hstack { + display: flex; + flex-direction: row; + align-items: center; + align-self: stretch; } + +.vstack { + display: flex; + flex: 1 1 auto; + flex-direction: column; + align-self: stretch; } + +.visually-hidden, +.visually-hidden-focusable:not(:focus):not(:focus-within) { + width: 1px !important; + height: 1px !important; + padding: 0 !important; + margin: -1px !important; + overflow: hidden !important; + clip: rect(0, 0, 0, 0) !important; + white-space: nowrap !important; + border: 0 !important; } + .visually-hidden:not(caption), + .visually-hidden-focusable:not(:focus):not(:focus-within):not(caption) { + position: absolute !important; } + +.stretched-link::after { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1; + content: ""; } + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; } + +.vr { + display: inline-block; + align-self: stretch; + width: var(--bs-border-width); + min-height: 1em; + background-color: currentcolor; + opacity: 0.25; } + +.table, table { + --bs-table-color-type: initial; + --bs-table-bg-type: initial; + --bs-table-color-state: initial; + --bs-table-bg-state: initial; + --bs-table-color: var(--bs-emphasis-color); + --bs-table-bg: var(--bs-body-bg); + --bs-table-border-color: var(--bs-border-color); + --bs-table-accent-bg: transparent; + --bs-table-striped-color: var(--bs-emphasis-color); + --bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05); + --bs-table-active-color: var(--bs-emphasis-color); + --bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1); + --bs-table-hover-color: var(--bs-emphasis-color); + --bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075); + width: 100%; + margin-bottom: 1rem; + vertical-align: top; + border-color: var(--bs-table-border-color); } + .table > :not(caption) > * > *, table > :not(caption) > * > * { + padding: 0.5rem 0.5rem; + color: var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color))); + background-color: var(--bs-table-bg); + border-bottom-width: var(--bs-border-width); + box-shadow: inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg))); } + .table > tbody, table > tbody { + vertical-align: inherit; } + .table > thead, table > thead { + vertical-align: bottom; } + +.table-group-divider { + border-top: calc(var(--bs-border-width) * 2) solid currentcolor; } + +.caption-top { + caption-side: top; } + +.table-sm > :not(caption) > * > * { + padding: 0.25rem 0.25rem; } + +.table-bordered > :not(caption) > * { + border-width: var(--bs-border-width) 0; } + .table-bordered > :not(caption) > * > * { + border-width: 0 var(--bs-border-width); } + +.table-borderless > :not(caption) > * > * { + border-bottom-width: 0; } + +.table-borderless > :not(:first-child) { + border-top-width: 0; } + +.table-striped > tbody > tr:nth-of-type(odd) > * { + --bs-table-color-type: var(--bs-table-striped-color); + --bs-table-bg-type: var(--bs-table-striped-bg); } + +.table-striped-columns > :not(caption) > tr > :nth-child(even) { + --bs-table-color-type: var(--bs-table-striped-color); + --bs-table-bg-type: var(--bs-table-striped-bg); } + +.table-active { + --bs-table-color-state: var(--bs-table-active-color); + --bs-table-bg-state: var(--bs-table-active-bg); } + +.table-hover > tbody > tr:hover > * { + --bs-table-color-state: var(--bs-table-hover-color); + --bs-table-bg-state: var(--bs-table-hover-bg); } + +.table-primary { + --bs-table-color: #000; + --bs-table-bg: #dfd5e7; + --bs-table-border-color: #b2aab9; + --bs-table-striped-bg: #d4cadb; + --bs-table-striped-color: #000; + --bs-table-active-bg: #c9c0d0; + --bs-table-active-color: #000; + --bs-table-hover-bg: #cec5d6; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-secondary { + --bs-table-color: #000; + --bs-table-bg: #e2e3e5; + --bs-table-border-color: #b5b6b7; + --bs-table-striped-bg: #d7d8da; + --bs-table-striped-color: #000; + --bs-table-active-bg: #cbccce; + --bs-table-active-color: #000; + --bs-table-hover-bg: #d1d2d4; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-success { + --bs-table-color: #000; + --bs-table-bg: #e6fcdd; + --bs-table-border-color: #b8cab1; + --bs-table-striped-bg: #dbefd2; + --bs-table-striped-color: #000; + --bs-table-active-bg: #cfe3c7; + --bs-table-active-color: #000; + --bs-table-hover-bg: #d5e9cc; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-info { + --bs-table-color: #000; + --bs-table-bg: #d6daff; + --bs-table-border-color: #abaecc; + --bs-table-striped-bg: #cbcff2; + --bs-table-striped-color: #000; + --bs-table-active-bg: #c1c4e6; + --bs-table-active-color: #000; + --bs-table-hover-bg: #c6caec; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-warning { + --bs-table-color: #000; + --bs-table-bg: #fcf2dd; + --bs-table-border-color: #cac2b1; + --bs-table-striped-bg: #efe6d2; + --bs-table-striped-color: #000; + --bs-table-active-bg: #e3dac7; + --bs-table-active-color: #000; + --bs-table-hover-bg: #e9e0cc; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-danger { + --bs-table-color: #000; + --bs-table-bg: #fcdde7; + --bs-table-border-color: #cab1b9; + --bs-table-striped-bg: #efd2db; + --bs-table-striped-color: #000; + --bs-table-active-bg: #e3c7d0; + --bs-table-active-color: #000; + --bs-table-hover-bg: #e9ccd6; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-light { + --bs-table-color: #000; + --bs-table-bg: #f8f9fa; + --bs-table-border-color: #c6c7c8; + --bs-table-striped-bg: #ecedee; + --bs-table-striped-color: #000; + --bs-table-active-bg: #dfe0e1; + --bs-table-active-color: #000; + --bs-table-hover-bg: #e5e6e7; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-dark, [data-bs-theme="dark"] table { + --bs-table-color: #fff; + --bs-table-bg: #212529; + --bs-table-border-color: #4d5154; + --bs-table-striped-bg: #2c3034; + --bs-table-striped-color: #fff; + --bs-table-active-bg: #373b3e; + --bs-table-active-color: #fff; + --bs-table-hover-bg: #323539; + --bs-table-hover-color: #fff; + color: var(--bs-table-color); + border-color: var(--bs-table-border-color); } + +.table-responsive { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } + +@media (max-width: 575.98px) { + .table-responsive-sm { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 767.98px) { + .table-responsive-md { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 991.98px) { + .table-responsive-lg { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 1199.98px) { + .table-responsive-xl { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +@media (max-width: 1399.98px) { + .table-responsive-xxl { + overflow-x: auto; + -webkit-overflow-scrolling: touch; } } + +.form-label { + margin-bottom: 0.5rem; } + +.col-form-label { + padding-top: calc(0.375rem + var(--bs-border-width)); + padding-bottom: calc(0.375rem + var(--bs-border-width)); + margin-bottom: 0; + font-size: inherit; + line-height: 1.5; } + +.col-form-label-lg { + padding-top: calc(0.5rem + var(--bs-border-width)); + padding-bottom: calc(0.5rem + var(--bs-border-width)); + font-size: 1.25rem; } + +.col-form-label-sm { + padding-top: calc(0.25rem + var(--bs-border-width)); + padding-bottom: calc(0.25rem + var(--bs-border-width)); + font-size: 0.875rem; } + +.form-text { + margin-top: 0.25rem; + font-size: 0.875em; + color: var(--bs-secondary-color); } + +.form-control, .search-form .search-field, .comment-form input[type="text"], +.comment-form input[type="email"], +.comment-form input[type="url"], +.comment-form textarea { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 1rem; + font-weight: 400; + line-height: 1.5; + color: var(--bs-body-color); + appearance: none; + background-color: var(--bs-body-bg); + background-clip: padding-box; + border: var(--bs-border-width) solid var(--bs-border-color); + border-radius: var(--bs-border-radius); + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-control, .search-form .search-field, .comment-form input[type="text"], + .comment-form input[type="email"], + .comment-form input[type="url"], + .comment-form textarea { + transition: none; } } + .form-control[type="file"], .search-form [type="file"].search-field, .comment-form input[type="file"][type="text"], + .comment-form input[type="file"][type="email"], + .comment-form input[type="file"][type="url"], + .comment-form textarea[type="file"] { + overflow: hidden; } + .form-control[type="file"]:not(:disabled):not([readonly]), .search-form [type="file"].search-field:not(:disabled):not([readonly]), .comment-form input[type="file"][type="text"]:not(:disabled):not([readonly]), + .comment-form input[type="file"][type="email"]:not(:disabled):not([readonly]), + .comment-form input[type="file"][type="url"]:not(:disabled):not([readonly]), + .comment-form textarea[type="file"]:not(:disabled):not([readonly]) { + cursor: pointer; } + .form-control:focus, .search-form .search-field:focus, .comment-form input[type="text"]:focus, + .comment-form input[type="email"]:focus, + .comment-form input[type="url"]:focus, + .comment-form textarea:focus { + color: var(--bs-body-color); + background-color: var(--bs-body-bg); + border-color: #ae97c3; + outline: 0; + box-shadow: none; } + .form-control::-webkit-date-and-time-value, .search-form .search-field::-webkit-date-and-time-value, .comment-form input[type="text"]::-webkit-date-and-time-value, + .comment-form input[type="email"]::-webkit-date-and-time-value, + .comment-form input[type="url"]::-webkit-date-and-time-value, + .comment-form textarea::-webkit-date-and-time-value { + min-width: 85px; + height: 1.5em; + margin: 0; } + .form-control::-webkit-datetime-edit, .search-form .search-field::-webkit-datetime-edit, .comment-form input[type="text"]::-webkit-datetime-edit, + .comment-form input[type="email"]::-webkit-datetime-edit, + .comment-form input[type="url"]::-webkit-datetime-edit, + .comment-form textarea::-webkit-datetime-edit { + display: block; + padding: 0; } + .form-control::placeholder, .search-form .search-field::placeholder, .comment-form input[type="text"]::placeholder, + .comment-form input[type="email"]::placeholder, + .comment-form input[type="url"]::placeholder, + .comment-form textarea::placeholder { + color: var(--bs-secondary-color); + opacity: 1; } + .form-control:disabled, .search-form .search-field:disabled, .comment-form input[type="text"]:disabled, + .comment-form input[type="email"]:disabled, + .comment-form input[type="url"]:disabled, + .comment-form textarea:disabled { + background-color: var(--bs-secondary-bg); + opacity: 1; } + .form-control::file-selector-button, .search-form .search-field::file-selector-button, .comment-form input[type="text"]::file-selector-button, + .comment-form input[type="email"]::file-selector-button, + .comment-form input[type="url"]::file-selector-button, + .comment-form textarea::file-selector-button { + padding: 0.375rem 0.75rem; + margin: -0.375rem -0.75rem; + margin-inline-end: 0.75rem; + color: var(--bs-body-color); + background-color: var(--bs-tertiary-bg); + pointer-events: none; + border-color: inherit; + border-style: solid; + border-width: 0; + border-inline-end-width: var(--bs-border-width); + border-radius: 0; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-control::file-selector-button, .search-form .search-field::file-selector-button, .comment-form input[type="text"]::file-selector-button, + .comment-form input[type="email"]::file-selector-button, + .comment-form input[type="url"]::file-selector-button, + .comment-form textarea::file-selector-button { + transition: none; } } + .form-control:hover:not(:disabled):not([readonly])::file-selector-button, .search-form .search-field:hover:not(:disabled):not([readonly])::file-selector-button, .comment-form input[type="text"]:hover:not(:disabled):not([readonly])::file-selector-button, + .comment-form input[type="email"]:hover:not(:disabled):not([readonly])::file-selector-button, + .comment-form input[type="url"]:hover:not(:disabled):not([readonly])::file-selector-button, + .comment-form textarea:hover:not(:disabled):not([readonly])::file-selector-button { + background-color: var(--bs-secondary-bg); } + +.form-control-plaintext { + display: block; + width: 100%; + padding: 0.375rem 0; + margin-bottom: 0; + line-height: 1.5; + color: var(--bs-body-color); + background-color: transparent; + border: solid transparent; + border-width: var(--bs-border-width) 0; } + .form-control-plaintext:focus { + outline: 0; } + .form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg { + padding-right: 0; + padding-left: 0; } + +.form-control-sm { + min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2)); + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + border-radius: var(--bs-border-radius-sm); } + .form-control-sm::file-selector-button { + padding: 0.25rem 0.5rem; + margin: -0.25rem -0.5rem; + margin-inline-end: 0.5rem; } + +.form-control-lg { + min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2)); + padding: 0.5rem 1rem; + font-size: 1.25rem; + border-radius: var(--bs-border-radius-lg); } + .form-control-lg::file-selector-button { + padding: 0.5rem 1rem; + margin: -0.5rem -1rem; + margin-inline-end: 1rem; } + +textarea.form-control, .search-form textarea.search-field { + min-height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2)); } + +textarea.form-control-sm { + min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2)); } + +textarea.form-control-lg { + min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2)); } + +.form-control-color { + width: 3rem; + height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2)); + padding: 0.375rem; } + .form-control-color:not(:disabled):not([readonly]) { + cursor: pointer; } + .form-control-color::-moz-color-swatch { + border: 0 !important; + border-radius: var(--bs-border-radius); } + .form-control-color::-webkit-color-swatch { + border: 0 !important; + border-radius: var(--bs-border-radius); } + .form-control-color.form-control-sm { + height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2)); } + .form-control-color.form-control-lg { + height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2)); } + +.form-select { + --bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"); + display: block; + width: 100%; + padding: 0.375rem 2.25rem 0.375rem 0.75rem; + font-size: 1rem; + font-weight: 400; + line-height: 1.5; + color: var(--bs-body-color); + appearance: none; + background-color: var(--bs-body-bg); + background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none); + background-repeat: no-repeat; + background-position: right 0.75rem center; + background-size: 16px 12px; + border: var(--bs-border-width) solid var(--bs-border-color); + border-radius: var(--bs-border-radius); + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-select { + transition: none; } } + .form-select:focus { + border-color: #ae97c3; + outline: 0; + box-shadow: 0 0 0 0 rgba(93, 47, 134, 0.25); } + .form-select[multiple], .form-select[size]:not([size="1"]) { + padding-right: 0.75rem; + background-image: none; } + .form-select:disabled { + background-color: var(--bs-secondary-bg); } + .form-select:-moz-focusring { + color: transparent; + text-shadow: 0 0 0 var(--bs-body-color); } + +.form-select-sm { + padding-top: 0.25rem; + padding-bottom: 0.25rem; + padding-left: 0.5rem; + font-size: 0.875rem; + border-radius: var(--bs-border-radius-sm); } + +.form-select-lg { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + padding-left: 1rem; + font-size: 1.25rem; + border-radius: var(--bs-border-radius-lg); } + +[data-bs-theme="dark"] .form-select { + --bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23c1c3c8' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"); } + +.form-check { + display: block; + min-height: 1.5rem; + padding-left: 1.5em; + margin-bottom: 0.125rem; } + .form-check .form-check-input, .form-check li input[type="checkbox"], li .form-check input[type="checkbox"] { + float: left; + margin-left: -1.5em; } + +.form-check-reverse { + padding-right: 1.5em; + padding-left: 0; + text-align: right; } + .form-check-reverse .form-check-input, .form-check-reverse li input[type="checkbox"], li .form-check-reverse input[type="checkbox"] { + float: right; + margin-right: -1.5em; + margin-left: 0; } + +.form-check-input, li input[type="checkbox"] { + --bs-form-check-bg: var(--bs-body-bg); + flex-shrink: 0; + width: 1em; + height: 1em; + margin-top: 0.25em; + vertical-align: top; + appearance: none; + background-color: var(--bs-form-check-bg); + background-image: var(--bs-form-check-bg-image); + background-repeat: no-repeat; + background-position: center; + background-size: contain; + border: var(--bs-border-width) solid var(--bs-border-color); + print-color-adjust: exact; } + .form-check-input[type="checkbox"], li input[type="checkbox"] { + border-radius: 0.25em; } + .form-check-input[type="radio"], li input[type="radio"][type="checkbox"] { + border-radius: 50%; } + .form-check-input:active, li input[type="checkbox"]:active { + filter: brightness(90%); } + .form-check-input:focus, li input[type="checkbox"]:focus { + border-color: #ae97c3; + outline: 0; + box-shadow: 0 0 0 0.25rem rgba(93, 47, 134, 0.25); } + .form-check-input:checked, li input[type="checkbox"]:checked { + background-color: #5d2f86; + border-color: #5d2f86; } + .form-check-input:checked[type="checkbox"], li input:checked[type="checkbox"] { + --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e"); } + .form-check-input:checked[type="radio"], li input[type="checkbox"]:checked[type="radio"] { + --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e"); } + .form-check-input[type="checkbox"]:indeterminate, li input[type="checkbox"]:indeterminate { + background-color: #5d2f86; + border-color: #5d2f86; + --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e"); } + .form-check-input:disabled, li input[type="checkbox"]:disabled { + pointer-events: none; + filter: none; + opacity: 0.5; } + .form-check-input[disabled] ~ .form-check-label, li input[disabled][type="checkbox"] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label, li input[type="checkbox"]:disabled ~ .form-check-label { + cursor: default; + opacity: 0.5; } + +.form-switch { + padding-left: 2.5em; } + .form-switch .form-check-input, .form-switch li input[type="checkbox"], li .form-switch input[type="checkbox"] { + --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e"); + width: 2em; + margin-left: -2.5em; + background-image: var(--bs-form-switch-bg); + background-position: left center; + border-radius: 2em; + transition: background-position 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-switch .form-check-input, .form-switch li input[type="checkbox"], li .form-switch input[type="checkbox"] { + transition: none; } } + .form-switch .form-check-input:focus, .form-switch li input[type="checkbox"]:focus, li .form-switch input[type="checkbox"]:focus { + --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23ae97c3'/%3e%3c/svg%3e"); } + .form-switch .form-check-input:checked, .form-switch li input[type="checkbox"]:checked, li .form-switch input[type="checkbox"]:checked { + background-position: right center; + --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e"); } + .form-switch.form-check-reverse { + padding-right: 2.5em; + padding-left: 0; } + .form-switch.form-check-reverse .form-check-input, .form-switch.form-check-reverse li input[type="checkbox"], li .form-switch.form-check-reverse input[type="checkbox"] { + margin-right: -2.5em; + margin-left: 0; } + +.form-check-inline { + display: inline-block; + margin-right: 1rem; } + +.btn-check { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; } + .btn-check[disabled] + .btn, .search-form .btn-check[disabled] + .search-submit, .comment-form .btn-check[disabled] + input[type="submit"], .btn-check:disabled + .btn, .search-form .btn-check:disabled + .search-submit, .comment-form .btn-check:disabled + input[type="submit"] { + pointer-events: none; + filter: none; + opacity: 0.65; } + +[data-bs-theme="dark"] .form-switch .form-check-input:not(:checked):not(:focus), [data-bs-theme="dark"] .form-switch li input[type="checkbox"]:not(:checked):not(:focus), li [data-bs-theme="dark"] .form-switch input[type="checkbox"]:not(:checked):not(:focus) { + --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e"); } + +.form-range { + width: 100%; + height: 1rem; + padding: 0; + appearance: none; + background-color: transparent; } + .form-range:focus { + outline: 0; } + .form-range:focus::-webkit-slider-thumb { + box-shadow: 0 0 0 1px #fff, none; } + .form-range:focus::-moz-range-thumb { + box-shadow: 0 0 0 1px #fff, none; } + .form-range::-moz-focus-outer { + border: 0; } + .form-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + appearance: none; + background-color: #5d2f86; + border: 0; + border-radius: 1rem; + transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-range::-webkit-slider-thumb { + transition: none; } } + .form-range::-webkit-slider-thumb:active { + background-color: #cec1db; } + .form-range::-webkit-slider-runnable-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: var(--bs-secondary-bg); + border-color: transparent; + border-radius: 1rem; } + .form-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + appearance: none; + background-color: #5d2f86; + border: 0; + border-radius: 1rem; + transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-range::-moz-range-thumb { + transition: none; } } + .form-range::-moz-range-thumb:active { + background-color: #cec1db; } + .form-range::-moz-range-track { + width: 100%; + height: 0.5rem; + color: transparent; + cursor: pointer; + background-color: var(--bs-secondary-bg); + border-color: transparent; + border-radius: 1rem; } + .form-range:disabled { + pointer-events: none; } + .form-range:disabled::-webkit-slider-thumb { + background-color: var(--bs-secondary-color); } + .form-range:disabled::-moz-range-thumb { + background-color: var(--bs-secondary-color); } + +.form-floating { + position: relative; } + .form-floating > .form-control, .search-form .form-floating > .search-field, .comment-form .form-floating > input[type="text"], + .comment-form .form-floating > input[type="email"], + .comment-form .form-floating > input[type="url"], + .comment-form .form-floating > textarea, + .form-floating > .form-control-plaintext, + .form-floating > .form-select { + height: calc(3.5rem + calc(var(--bs-border-width) * 2)); + min-height: calc(3.5rem + calc(var(--bs-border-width) * 2)); + line-height: 1.25; } + .form-floating > label { + position: absolute; + top: 0; + left: 0; + z-index: 2; + height: 100%; + padding: 1rem 0.75rem; + overflow: hidden; + text-align: start; + text-overflow: ellipsis; + white-space: nowrap; + pointer-events: none; + border: var(--bs-border-width) solid transparent; + transform-origin: 0 0; + transition: opacity 0.1s ease-in-out, transform 0.1s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .form-floating > label { + transition: none; } } + .form-floating > .form-control, .search-form .form-floating > .search-field, .comment-form .form-floating > input[type="text"], + .comment-form .form-floating > input[type="email"], + .comment-form .form-floating > input[type="url"], + .comment-form .form-floating > textarea, + .form-floating > .form-control-plaintext { + padding: 1rem 0.75rem; } + .form-floating > .form-control::placeholder, .search-form .form-floating > .search-field::placeholder, .comment-form .form-floating > input[type="text"]::placeholder, + .comment-form .form-floating > input[type="email"]::placeholder, + .comment-form .form-floating > input[type="url"]::placeholder, + .comment-form .form-floating > textarea::placeholder, + .form-floating > .form-control-plaintext::placeholder { + color: transparent; } + .form-floating > .form-control:focus, .search-form .form-floating > .search-field:focus, .comment-form .form-floating > input[type="text"]:focus, + .comment-form .form-floating > input[type="email"]:focus, + .comment-form .form-floating > input[type="url"]:focus, + .comment-form .form-floating > textarea:focus, .form-floating > .form-control:not(:placeholder-shown), .search-form .form-floating > .search-field:not(:placeholder-shown), .comment-form .form-floating > input[type="text"]:not(:placeholder-shown), + .comment-form .form-floating > input[type="email"]:not(:placeholder-shown), + .comment-form .form-floating > input[type="url"]:not(:placeholder-shown), + .comment-form .form-floating > textarea:not(:placeholder-shown), + .form-floating > .form-control-plaintext:focus, + .form-floating > .form-control-plaintext:not(:placeholder-shown) { + padding-top: 1.625rem; + padding-bottom: 0.625rem; } + .form-floating > .form-control:-webkit-autofill, .search-form .form-floating > .search-field:-webkit-autofill, .comment-form .form-floating > input[type="text"]:-webkit-autofill, + .comment-form .form-floating > input[type="email"]:-webkit-autofill, + .comment-form .form-floating > input[type="url"]:-webkit-autofill, + .comment-form .form-floating > textarea:-webkit-autofill, + .form-floating > .form-control-plaintext:-webkit-autofill { + padding-top: 1.625rem; + padding-bottom: 0.625rem; } + .form-floating > .form-select { + padding-top: 1.625rem; + padding-bottom: 0.625rem; } + .form-floating > .form-control:focus ~ label, .search-form .form-floating > .search-field:focus ~ label, .comment-form .form-floating > input[type="text"]:focus ~ label, + .comment-form .form-floating > input[type="email"]:focus ~ label, + .comment-form .form-floating > input[type="url"]:focus ~ label, + .comment-form .form-floating > textarea:focus ~ label, + .form-floating > .form-control:not(:placeholder-shown) ~ label, + .search-form .form-floating > .search-field:not(:placeholder-shown) ~ label, + .comment-form .form-floating > input[type="text"]:not(:placeholder-shown) ~ label, + .comment-form .form-floating > input[type="email"]:not(:placeholder-shown) ~ label, + .comment-form .form-floating > input[type="url"]:not(:placeholder-shown) ~ label, + .comment-form .form-floating > textarea:not(:placeholder-shown) ~ label, + .form-floating > .form-control-plaintext ~ label, + .form-floating > .form-select ~ label { + color: rgba(var(--bs-body-color-rgb), 0.65); + transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem); } + .form-floating > .form-control:focus ~ label::after, .search-form .form-floating > .search-field:focus ~ label::after, .comment-form .form-floating > input[type="text"]:focus ~ label::after, + .comment-form .form-floating > input[type="email"]:focus ~ label::after, + .comment-form .form-floating > input[type="url"]:focus ~ label::after, + .comment-form .form-floating > textarea:focus ~ label::after, + .form-floating > .form-control:not(:placeholder-shown) ~ label::after, + .search-form .form-floating > .search-field:not(:placeholder-shown) ~ label::after, + .comment-form .form-floating > input[type="text"]:not(:placeholder-shown) ~ label::after, + .comment-form .form-floating > input[type="email"]:not(:placeholder-shown) ~ label::after, + .comment-form .form-floating > input[type="url"]:not(:placeholder-shown) ~ label::after, + .comment-form .form-floating > textarea:not(:placeholder-shown) ~ label::after, + .form-floating > .form-control-plaintext ~ label::after, + .form-floating > .form-select ~ label::after { + position: absolute; + inset: 1rem 0.375rem; + z-index: -1; + height: 1.5em; + content: ""; + background-color: var(--bs-body-bg); + border-radius: var(--bs-border-radius); } + .form-floating > .form-control:-webkit-autofill ~ label, .search-form .form-floating > .search-field:-webkit-autofill ~ label, .comment-form .form-floating > input[type="text"]:-webkit-autofill ~ label, + .comment-form .form-floating > input[type="email"]:-webkit-autofill ~ label, + .comment-form .form-floating > input[type="url"]:-webkit-autofill ~ label, + .comment-form .form-floating > textarea:-webkit-autofill ~ label { + color: rgba(var(--bs-body-color-rgb), 0.65); + transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem); } + .form-floating > .form-control-plaintext ~ label { + border-width: var(--bs-border-width) 0; } + .form-floating > :disabled ~ label, + .form-floating > .form-control:disabled ~ label { + color: #6c757d; } + .form-floating > :disabled ~ label::after, + .form-floating > .form-control:disabled ~ label::after { + background-color: var(--bs-secondary-bg); } + +.input-group { + position: relative; + display: flex; + flex-wrap: wrap; + align-items: stretch; + width: 100%; } + .input-group > .form-control, .search-form .input-group > .search-field, .comment-form .input-group > input[type="text"], + .comment-form .input-group > input[type="email"], + .comment-form .input-group > input[type="url"], + .comment-form .input-group > textarea, + .input-group > .form-select, + .input-group > .form-floating { + position: relative; + flex: 1 1 auto; + width: 1%; + min-width: 0; } + .input-group > .form-control:focus, .search-form .input-group > .search-field:focus, .comment-form .input-group > input[type="text"]:focus, + .comment-form .input-group > input[type="email"]:focus, + .comment-form .input-group > input[type="url"]:focus, + .comment-form .input-group > textarea:focus, + .input-group > .form-select:focus, + .input-group > .form-floating:focus-within { + z-index: 5; } + .input-group .btn, .input-group .search-form .search-submit, .search-form .input-group .search-submit, .input-group .comment-form input[type="submit"], .comment-form .input-group input[type="submit"] { + position: relative; + z-index: 2; } + .input-group .btn:focus, .input-group .search-form .search-submit:focus, .search-form .input-group .search-submit:focus, .input-group .comment-form input[type="submit"]:focus, .comment-form .input-group input[type="submit"]:focus { + z-index: 5; } + +.input-group-text { + display: flex; + align-items: center; + padding: 0.375rem 0.75rem; + font-size: 1rem; + font-weight: 400; + line-height: 1.5; + color: var(--bs-body-color); + text-align: center; + white-space: nowrap; + background-color: var(--bs-tertiary-bg); + border: var(--bs-border-width) solid var(--bs-border-color); + border-radius: var(--bs-border-radius); } + +.input-group-lg > .form-control, .search-form .input-group-lg > .search-field, .comment-form .input-group-lg > input[type="text"], +.comment-form .input-group-lg > input[type="email"], +.comment-form .input-group-lg > input[type="url"], +.comment-form .input-group-lg > textarea, +.input-group-lg > .form-select, +.input-group-lg > .input-group-text, +.input-group-lg > .btn, +.search-form .input-group-lg > .search-submit, +.comment-form .input-group-lg > input[type="submit"] { + padding: 0.5rem 1rem; + font-size: 1.25rem; + border-radius: var(--bs-border-radius-lg); } + +.input-group-sm > .form-control, .search-form .input-group-sm > .search-field, .comment-form .input-group-sm > input[type="text"], +.comment-form .input-group-sm > input[type="email"], +.comment-form .input-group-sm > input[type="url"], +.comment-form .input-group-sm > textarea, +.input-group-sm > .form-select, +.input-group-sm > .input-group-text, +.input-group-sm > .btn, +.search-form .input-group-sm > .search-submit, +.comment-form .input-group-sm > input[type="submit"] { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + border-radius: var(--bs-border-radius-sm); } + +.input-group-lg > .form-select, +.input-group-sm > .form-select { + padding-right: 3rem; } + +.input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating), +.input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n + 3), +.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control, +.search-form .input-group:not(.has-validation) > .form-floating:not(:last-child) > .search-field, +.comment-form .input-group:not(.has-validation) > .form-floating:not(:last-child) > input[type="text"], +.comment-form .input-group:not(.has-validation) > .form-floating:not(:last-child) > input[type="email"], +.comment-form .input-group:not(.has-validation) > .form-floating:not(:last-child) > input[type="url"], +.comment-form .input-group:not(.has-validation) > .form-floating:not(:last-child) > textarea, +.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + +.input-group.has-validation > :nth-last-child(n + 3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating), +.input-group.has-validation > .dropdown-toggle:nth-last-child(n + 4), +.input-group.has-validation > .form-floating:nth-last-child(n + 3) > .form-control, +.search-form .input-group.has-validation > .form-floating:nth-last-child(n + 3) > .search-field, +.comment-form .input-group.has-validation > .form-floating:nth-last-child(n + 3) > input[type="text"], +.comment-form .input-group.has-validation > .form-floating:nth-last-child(n + 3) > input[type="email"], +.comment-form .input-group.has-validation > .form-floating:nth-last-child(n + 3) > input[type="url"], +.comment-form .input-group.has-validation > .form-floating:nth-last-child(n + 3) > textarea, +.input-group.has-validation > .form-floating:nth-last-child(n + 3) > .form-select { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + +.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) { + margin-left: calc(var(--bs-border-width) * -1); + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + +.input-group > .form-floating:not(:first-child) > .form-control, .search-form .input-group > .form-floating:not(:first-child) > .search-field, .comment-form .input-group > .form-floating:not(:first-child) > input[type="text"], +.comment-form .input-group > .form-floating:not(:first-child) > input[type="email"], +.comment-form .input-group > .form-floating:not(:first-child) > input[type="url"], +.comment-form .input-group > .form-floating:not(:first-child) > textarea, +.input-group > .form-floating:not(:first-child) > .form-select { + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 0.875em; + color: var(--bs-form-valid-color); } + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: 0.25rem 0.5rem; + margin-top: .1rem; + font-size: 0.875rem; + color: #fff; + background-color: var(--bs-success); + border-radius: var(--bs-border-radius); } + +.was-validated :valid ~ .valid-feedback, +.was-validated :valid ~ .valid-tooltip, +.is-valid ~ .valid-feedback, +.is-valid ~ .valid-tooltip { + display: block; } + +.was-validated .form-control:valid, .was-validated .search-form .search-field:valid, .search-form .was-validated .search-field:valid, .was-validated .comment-form input[type="text"]:valid, .comment-form .was-validated input[type="text"]:valid, +.was-validated .comment-form input[type="email"]:valid, +.comment-form .was-validated input[type="email"]:valid, +.was-validated .comment-form input[type="url"]:valid, +.comment-form .was-validated input[type="url"]:valid, +.was-validated .comment-form textarea:valid, +.comment-form .was-validated textarea:valid, .form-control.is-valid, .search-form .is-valid.search-field, .comment-form input.is-valid[type="text"], +.comment-form input.is-valid[type="email"], +.comment-form input.is-valid[type="url"], +.comment-form textarea.is-valid { + border-color: var(--bs-form-valid-border-color); + padding-right: calc(1.5em + 0.75rem); + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2384ee53' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right calc(0.375em + 0.1875rem) center; + background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-control:valid:focus, .was-validated .search-form .search-field:valid:focus, .search-form .was-validated .search-field:valid:focus, .was-validated .comment-form input[type="text"]:valid:focus, .comment-form .was-validated input[type="text"]:valid:focus, + .was-validated .comment-form input[type="email"]:valid:focus, + .comment-form .was-validated input[type="email"]:valid:focus, + .was-validated .comment-form input[type="url"]:valid:focus, + .comment-form .was-validated input[type="url"]:valid:focus, + .was-validated .comment-form textarea:valid:focus, + .comment-form .was-validated textarea:valid:focus, .form-control.is-valid:focus, .search-form .is-valid.search-field:focus, .comment-form input.is-valid[type="text"]:focus, + .comment-form input.is-valid[type="email"]:focus, + .comment-form input.is-valid[type="url"]:focus, + .comment-form textarea.is-valid:focus { + border-color: var(--bs-form-valid-border-color); + box-shadow: 0 0 0 0 rgba(var(--bs-success-rgb), 0.25); } + +.was-validated textarea.form-control:valid, .was-validated .search-form textarea.search-field:valid, .search-form .was-validated textarea.search-field:valid, textarea.form-control.is-valid, .search-form textarea.is-valid.search-field { + padding-right: calc(1.5em + 0.75rem); + background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } + +.was-validated .form-select:valid, .form-select.is-valid { + border-color: var(--bs-form-valid-border-color); } + .was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"], .form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"] { + --bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2384ee53' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + padding-right: 4.125rem; + background-position: right 0.75rem center, center right 2.25rem; + background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-select:valid:focus, .form-select.is-valid:focus { + border-color: var(--bs-form-valid-border-color); + box-shadow: 0 0 0 0 rgba(var(--bs-success-rgb), 0.25); } + +.was-validated .form-control-color:valid, .form-control-color.is-valid { + width: calc(3rem + calc(1.5em + 0.75rem)); } + +.was-validated .form-check-input:valid, .was-validated li input[type="checkbox"]:valid, li .was-validated input[type="checkbox"]:valid, .form-check-input.is-valid, li input.is-valid[type="checkbox"] { + border-color: var(--bs-form-valid-border-color); } + .was-validated .form-check-input:valid:checked, .was-validated li input[type="checkbox"]:valid:checked, li .was-validated input[type="checkbox"]:valid:checked, .form-check-input.is-valid:checked, li input.is-valid[type="checkbox"]:checked { + background-color: var(--bs-form-valid-color); } + .was-validated .form-check-input:valid:focus, .was-validated li input[type="checkbox"]:valid:focus, li .was-validated input[type="checkbox"]:valid:focus, .form-check-input.is-valid:focus, li input.is-valid[type="checkbox"]:focus { + box-shadow: 0 0 0 0 rgba(var(--bs-success-rgb), 0.25); } + .was-validated .form-check-input:valid ~ .form-check-label, .was-validated li input[type="checkbox"]:valid ~ .form-check-label, li .was-validated input[type="checkbox"]:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label, li input.is-valid[type="checkbox"] ~ .form-check-label { + color: var(--bs-form-valid-color); } + +.form-check-inline .form-check-input ~ .valid-feedback, .form-check-inline li input[type="checkbox"] ~ .valid-feedback, li .form-check-inline input[type="checkbox"] ~ .valid-feedback { + margin-left: .5em; } + +.was-validated .input-group > .form-control:not(:focus):valid, .was-validated .search-form .input-group > .search-field:not(:focus):valid, .search-form .was-validated .input-group > .search-field:not(:focus):valid, .was-validated .comment-form .input-group > input[type="text"]:not(:focus):valid, .comment-form .was-validated .input-group > input[type="text"]:not(:focus):valid, +.was-validated .comment-form .input-group > input[type="email"]:not(:focus):valid, +.comment-form .was-validated .input-group > input[type="email"]:not(:focus):valid, +.was-validated .comment-form .input-group > input[type="url"]:not(:focus):valid, +.comment-form .was-validated .input-group > input[type="url"]:not(:focus):valid, +.was-validated .comment-form .input-group > textarea:not(:focus):valid, +.comment-form .was-validated .input-group > textarea:not(:focus):valid, .input-group > .form-control:not(:focus).is-valid, .search-form .input-group > .search-field:not(:focus).is-valid, .comment-form .input-group > input[type="text"]:not(:focus).is-valid, +.comment-form .input-group > input[type="email"]:not(:focus).is-valid, +.comment-form .input-group > input[type="url"]:not(:focus).is-valid, +.comment-form .input-group > textarea:not(:focus).is-valid, .was-validated .input-group > .form-select:not(:focus):valid, +.input-group > .form-select:not(:focus).is-valid, .was-validated .input-group > .form-floating:not(:focus-within):valid, +.input-group > .form-floating:not(:focus-within).is-valid { + z-index: 3; } + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 0.875em; + color: var(--bs-form-invalid-color); } + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: 0.25rem 0.5rem; + margin-top: .1rem; + font-size: 0.875rem; + color: #fff; + background-color: var(--bs-danger); + border-radius: var(--bs-border-radius); } + +.was-validated :invalid ~ .invalid-feedback, +.was-validated :invalid ~ .invalid-tooltip, +.is-invalid ~ .invalid-feedback, +.is-invalid ~ .invalid-tooltip { + display: block; } + +.was-validated .form-control:invalid, .was-validated .search-form .search-field:invalid, .search-form .was-validated .search-field:invalid, .was-validated .comment-form input[type="text"]:invalid, .comment-form .was-validated input[type="text"]:invalid, +.was-validated .comment-form input[type="email"]:invalid, +.comment-form .was-validated input[type="email"]:invalid, +.was-validated .comment-form input[type="url"]:invalid, +.comment-form .was-validated input[type="url"]:invalid, +.was-validated .comment-form textarea:invalid, +.comment-form .was-validated textarea:invalid, .form-control.is-invalid, .search-form .is-invalid.search-field, .comment-form input.is-invalid[type="text"], +.comment-form input.is-invalid[type="email"], +.comment-form input.is-invalid[type="url"], +.comment-form textarea.is-invalid { + border-color: var(--bs-form-invalid-border-color); + padding-right: calc(1.5em + 0.75rem); + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23ee5389'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23ee5389' stroke='none'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right calc(0.375em + 0.1875rem) center; + background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-control:invalid:focus, .was-validated .search-form .search-field:invalid:focus, .search-form .was-validated .search-field:invalid:focus, .was-validated .comment-form input[type="text"]:invalid:focus, .comment-form .was-validated input[type="text"]:invalid:focus, + .was-validated .comment-form input[type="email"]:invalid:focus, + .comment-form .was-validated input[type="email"]:invalid:focus, + .was-validated .comment-form input[type="url"]:invalid:focus, + .comment-form .was-validated input[type="url"]:invalid:focus, + .was-validated .comment-form textarea:invalid:focus, + .comment-form .was-validated textarea:invalid:focus, .form-control.is-invalid:focus, .search-form .is-invalid.search-field:focus, .comment-form input.is-invalid[type="text"]:focus, + .comment-form input.is-invalid[type="email"]:focus, + .comment-form input.is-invalid[type="url"]:focus, + .comment-form textarea.is-invalid:focus { + border-color: var(--bs-form-invalid-border-color); + box-shadow: 0 0 0 0 rgba(var(--bs-danger-rgb), 0.25); } + +.was-validated textarea.form-control:invalid, .was-validated .search-form textarea.search-field:invalid, .search-form .was-validated textarea.search-field:invalid, textarea.form-control.is-invalid, .search-form textarea.is-invalid.search-field { + padding-right: calc(1.5em + 0.75rem); + background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } + +.was-validated .form-select:invalid, .form-select.is-invalid { + border-color: var(--bs-form-invalid-border-color); } + .was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"], .form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"] { + --bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23ee5389'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23ee5389' stroke='none'/%3e%3c/svg%3e"); + padding-right: 4.125rem; + background-position: right 0.75rem center, center right 2.25rem; + background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } + .was-validated .form-select:invalid:focus, .form-select.is-invalid:focus { + border-color: var(--bs-form-invalid-border-color); + box-shadow: 0 0 0 0 rgba(var(--bs-danger-rgb), 0.25); } + +.was-validated .form-control-color:invalid, .form-control-color.is-invalid { + width: calc(3rem + calc(1.5em + 0.75rem)); } + +.was-validated .form-check-input:invalid, .was-validated li input[type="checkbox"]:invalid, li .was-validated input[type="checkbox"]:invalid, .form-check-input.is-invalid, li input.is-invalid[type="checkbox"] { + border-color: var(--bs-form-invalid-border-color); } + .was-validated .form-check-input:invalid:checked, .was-validated li input[type="checkbox"]:invalid:checked, li .was-validated input[type="checkbox"]:invalid:checked, .form-check-input.is-invalid:checked, li input.is-invalid[type="checkbox"]:checked { + background-color: var(--bs-form-invalid-color); } + .was-validated .form-check-input:invalid:focus, .was-validated li input[type="checkbox"]:invalid:focus, li .was-validated input[type="checkbox"]:invalid:focus, .form-check-input.is-invalid:focus, li input.is-invalid[type="checkbox"]:focus { + box-shadow: 0 0 0 0 rgba(var(--bs-danger-rgb), 0.25); } + .was-validated .form-check-input:invalid ~ .form-check-label, .was-validated li input[type="checkbox"]:invalid ~ .form-check-label, li .was-validated input[type="checkbox"]:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label, li input.is-invalid[type="checkbox"] ~ .form-check-label { + color: var(--bs-form-invalid-color); } + +.form-check-inline .form-check-input ~ .invalid-feedback, .form-check-inline li input[type="checkbox"] ~ .invalid-feedback, li .form-check-inline input[type="checkbox"] ~ .invalid-feedback { + margin-left: .5em; } + +.was-validated .input-group > .form-control:not(:focus):invalid, .was-validated .search-form .input-group > .search-field:not(:focus):invalid, .search-form .was-validated .input-group > .search-field:not(:focus):invalid, .was-validated .comment-form .input-group > input[type="text"]:not(:focus):invalid, .comment-form .was-validated .input-group > input[type="text"]:not(:focus):invalid, +.was-validated .comment-form .input-group > input[type="email"]:not(:focus):invalid, +.comment-form .was-validated .input-group > input[type="email"]:not(:focus):invalid, +.was-validated .comment-form .input-group > input[type="url"]:not(:focus):invalid, +.comment-form .was-validated .input-group > input[type="url"]:not(:focus):invalid, +.was-validated .comment-form .input-group > textarea:not(:focus):invalid, +.comment-form .was-validated .input-group > textarea:not(:focus):invalid, .input-group > .form-control:not(:focus).is-invalid, .search-form .input-group > .search-field:not(:focus).is-invalid, .comment-form .input-group > input[type="text"]:not(:focus).is-invalid, +.comment-form .input-group > input[type="email"]:not(:focus).is-invalid, +.comment-form .input-group > input[type="url"]:not(:focus).is-invalid, +.comment-form .input-group > textarea:not(:focus).is-invalid, .was-validated .input-group > .form-select:not(:focus):invalid, +.input-group > .form-select:not(:focus).is-invalid, .was-validated .input-group > .form-floating:not(:focus-within):invalid, +.input-group > .form-floating:not(:focus-within).is-invalid { + z-index: 4; } + +.btn, .search-form .search-submit, .comment-form input[type="submit"] { + --bs-btn-padding-x: 0.75rem; + --bs-btn-padding-y: 0.375rem; + --bs-btn-font-family: ; + --bs-btn-font-size: 1rem; + --bs-btn-font-weight: 400; + --bs-btn-line-height: 1.5; + --bs-btn-color: var(--bs-body-color); + --bs-btn-bg: transparent; + --bs-btn-border-width: var(--bs-border-width); + --bs-btn-border-color: transparent; + --bs-btn-border-radius: var(--bs-border-radius); + --bs-btn-hover-border-color: transparent; + --bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075); + --bs-btn-disabled-opacity: 0.65; + --bs-btn-focus-box-shadow: 0 0 0 0 rgba(var(--bs-btn-focus-shadow-rgb), .5); + display: inline-block; + padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x); + font-family: var(--bs-btn-font-family); + font-size: var(--bs-btn-font-size); + font-weight: var(--bs-btn-font-weight); + line-height: var(--bs-btn-line-height); + color: var(--bs-btn-color); + text-align: center; + vertical-align: middle; + cursor: pointer; + user-select: none; + border: var(--bs-btn-border-width) solid var(--bs-btn-border-color); + border-radius: var(--bs-btn-border-radius); + background-color: var(--bs-btn-bg); + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .btn, .search-form .search-submit, .comment-form input[type="submit"] { + transition: none; } } + .btn:hover, .search-form .search-submit:hover, .comment-form input[type="submit"]:hover { + color: var(--bs-btn-hover-color); + text-decoration: none; + background-color: var(--bs-btn-hover-bg); + border-color: var(--bs-btn-hover-border-color); } + .btn-check + .btn:hover, .search-form .btn-check + .search-submit:hover, .comment-form .btn-check + input[type="submit"]:hover { + color: var(--bs-btn-color); + background-color: var(--bs-btn-bg); + border-color: var(--bs-btn-border-color); } + .btn:focus-visible, .search-form .search-submit:focus-visible, .comment-form input[type="submit"]:focus-visible { + color: var(--bs-btn-hover-color); + background-color: var(--bs-btn-hover-bg); + border-color: var(--bs-btn-hover-border-color); + outline: 0; + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn-check:focus-visible + .btn, .search-form .btn-check:focus-visible + .search-submit, .comment-form .btn-check:focus-visible + input[type="submit"] { + border-color: var(--bs-btn-hover-border-color); + outline: 0; + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn-check:checked + .btn, .search-form .btn-check:checked + .search-submit, .comment-form .btn-check:checked + input[type="submit"], :not(.btn-check) + .btn:active, .search-form :not(.btn-check) + .search-submit:active, .comment-form :not(.btn-check) + input[type="submit"]:active, .btn:first-child:active, .search-form .search-submit:first-child:active, .comment-form input[type="submit"]:first-child:active, .btn.active, .search-form .active.search-submit, .comment-form input.active[type="submit"], .btn.show, .search-form .show.search-submit, .comment-form input.show[type="submit"] { + color: var(--bs-btn-active-color); + background-color: var(--bs-btn-active-bg); + border-color: var(--bs-btn-active-border-color); } + .btn-check:checked + .btn:focus-visible, .search-form .btn-check:checked + .search-submit:focus-visible, .comment-form .btn-check:checked + input[type="submit"]:focus-visible, :not(.btn-check) + .btn:active:focus-visible, .search-form :not(.btn-check) + .search-submit:active:focus-visible, .comment-form :not(.btn-check) + input[type="submit"]:active:focus-visible, .btn:first-child:active:focus-visible, .search-form .search-submit:first-child:active:focus-visible, .comment-form input[type="submit"]:first-child:active:focus-visible, .btn.active:focus-visible, .search-form .active.search-submit:focus-visible, .comment-form input.active[type="submit"]:focus-visible, .btn.show:focus-visible, .search-form .show.search-submit:focus-visible, .comment-form input.show[type="submit"]:focus-visible { + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn-check:checked:focus-visible + .btn, .search-form .btn-check:checked:focus-visible + .search-submit, .comment-form .btn-check:checked:focus-visible + input[type="submit"] { + box-shadow: var(--bs-btn-focus-box-shadow); } + .btn:disabled, .search-form .search-submit:disabled, .comment-form input[type="submit"]:disabled, .btn.disabled, .search-form .disabled.search-submit, .comment-form input.disabled[type="submit"], fieldset:disabled .btn, fieldset:disabled .search-form .search-submit, .search-form fieldset:disabled .search-submit, fieldset:disabled .comment-form input[type="submit"], .comment-form fieldset:disabled input[type="submit"] { + color: var(--bs-btn-disabled-color); + pointer-events: none; + background-color: var(--bs-btn-disabled-bg); + border-color: var(--bs-btn-disabled-border-color); + opacity: var(--bs-btn-disabled-opacity); } + +.btn-primary { + --bs-btn-color: #fff; + --bs-btn-bg: #5d2f86; + --bs-btn-border-color: #5d2f86; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #4f2872; + --bs-btn-hover-border-color: #4a266b; + --bs-btn-focus-shadow-rgb: 117, 78, 152; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #4a266b; + --bs-btn-active-border-color: #462365; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #5d2f86; + --bs-btn-disabled-border-color: #5d2f86; } + +.btn-secondary, .search-form .search-submit, .comment-form input[type="submit"] { + --bs-btn-color: #fff; + --bs-btn-bg: #6c757d; + --bs-btn-border-color: #6c757d; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #5c636a; + --bs-btn-hover-border-color: #565e64; + --bs-btn-focus-shadow-rgb: 130, 138, 145; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #565e64; + --bs-btn-active-border-color: #51585e; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #6c757d; + --bs-btn-disabled-border-color: #6c757d; } + +.btn-success { + --bs-btn-color: #000; + --bs-btn-bg: #84ee53; + --bs-btn-border-color: #84ee53; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #97f16d; + --bs-btn-hover-border-color: #91f064; + --bs-btn-focus-shadow-rgb: 112, 202, 71; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #9df176; + --bs-btn-active-border-color: #91f064; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #84ee53; + --bs-btn-disabled-border-color: #84ee53; } + +.btn-info { + --bs-btn-color: #fff; + --bs-btn-bg: #3347ff; + --bs-btn-border-color: #3347ff; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #2b3dd9; + --bs-btn-hover-border-color: #2939cc; + --bs-btn-focus-shadow-rgb: 82, 99, 255; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #2939cc; + --bs-btn-active-border-color: #2636bf; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #3347ff; + --bs-btn-disabled-border-color: #3347ff; } + +.btn-warning { + --bs-btn-color: #000; + --bs-btn-bg: #eebd53; + --bs-btn-border-color: #eebd53; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #f1c76d; + --bs-btn-hover-border-color: #f0c464; + --bs-btn-focus-shadow-rgb: 202, 161, 71; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #f1ca76; + --bs-btn-active-border-color: #f0c464; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #eebd53; + --bs-btn-disabled-border-color: #eebd53; } + +.btn-danger { + --bs-btn-color: #000; + --bs-btn-bg: #ee5389; + --bs-btn-border-color: #ee5389; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #f16d9b; + --bs-btn-hover-border-color: #f06495; + --bs-btn-focus-shadow-rgb: 202, 71, 117; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #f176a1; + --bs-btn-active-border-color: #f06495; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #ee5389; + --bs-btn-disabled-border-color: #ee5389; } + +.btn-light { + --bs-btn-color: #000; + --bs-btn-bg: #f8f9fa; + --bs-btn-border-color: #f8f9fa; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #d3d4d5; + --bs-btn-hover-border-color: #c6c7c8; + --bs-btn-focus-shadow-rgb: 211, 212, 213; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #c6c7c8; + --bs-btn-active-border-color: #babbbc; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #f8f9fa; + --bs-btn-disabled-border-color: #f8f9fa; } + +.btn-dark { + --bs-btn-color: #fff; + --bs-btn-bg: #212529; + --bs-btn-border-color: #212529; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #424649; + --bs-btn-hover-border-color: #373b3e; + --bs-btn-focus-shadow-rgb: 66, 70, 73; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #4d5154; + --bs-btn-active-border-color: #373b3e; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #212529; + --bs-btn-disabled-border-color: #212529; } + +.btn-outline-primary { + --bs-btn-color: #5d2f86; + --bs-btn-border-color: #5d2f86; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #5d2f86; + --bs-btn-hover-border-color: #5d2f86; + --bs-btn-focus-shadow-rgb: 93, 47, 134; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #5d2f86; + --bs-btn-active-border-color: #5d2f86; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #5d2f86; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #5d2f86; + --bs-gradient: none; } + +.btn-outline-secondary { + --bs-btn-color: #6c757d; + --bs-btn-border-color: #6c757d; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #6c757d; + --bs-btn-hover-border-color: #6c757d; + --bs-btn-focus-shadow-rgb: 108, 117, 125; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #6c757d; + --bs-btn-active-border-color: #6c757d; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #6c757d; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #6c757d; + --bs-gradient: none; } + +.btn-outline-success { + --bs-btn-color: #84ee53; + --bs-btn-border-color: #84ee53; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #84ee53; + --bs-btn-hover-border-color: #84ee53; + --bs-btn-focus-shadow-rgb: 132.2821, 238.017, 83.283; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #84ee53; + --bs-btn-active-border-color: #84ee53; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #84ee53; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #84ee53; + --bs-gradient: none; } + +.btn-outline-info { + --bs-btn-color: #3347ff; + --bs-btn-border-color: #3347ff; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #3347ff; + --bs-btn-hover-border-color: #3347ff; + --bs-btn-focus-shadow-rgb: 51, 71.4, 255; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #3347ff; + --bs-btn-active-border-color: #3347ff; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #3347ff; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #3347ff; + --bs-gradient: none; } + +.btn-outline-warning { + --bs-btn-color: #eebd53; + --bs-btn-border-color: #eebd53; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #eebd53; + --bs-btn-hover-border-color: #eebd53; + --bs-btn-focus-shadow-rgb: 238.017, 189.0179, 83.283; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #eebd53; + --bs-btn-active-border-color: #eebd53; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #eebd53; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #eebd53; + --bs-gradient: none; } + +.btn-outline-danger { + --bs-btn-color: #ee5389; + --bs-btn-border-color: #ee5389; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #ee5389; + --bs-btn-hover-border-color: #ee5389; + --bs-btn-focus-shadow-rgb: 238.017, 83.283, 137.4399; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #ee5389; + --bs-btn-active-border-color: #ee5389; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #ee5389; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #ee5389; + --bs-gradient: none; } + +.btn-outline-light { + --bs-btn-color: #f8f9fa; + --bs-btn-border-color: #f8f9fa; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #f8f9fa; + --bs-btn-hover-border-color: #f8f9fa; + --bs-btn-focus-shadow-rgb: 248, 249, 250; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #f8f9fa; + --bs-btn-active-border-color: #f8f9fa; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #f8f9fa; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #f8f9fa; + --bs-gradient: none; } + +.btn-outline-dark { + --bs-btn-color: #212529; + --bs-btn-border-color: #212529; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #212529; + --bs-btn-hover-border-color: #212529; + --bs-btn-focus-shadow-rgb: 33, 37, 41; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #212529; + --bs-btn-active-border-color: #212529; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #212529; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #212529; + --bs-gradient: none; } + +.btn-link { + --bs-btn-font-weight: 400; + --bs-btn-color: var(--bs-link-color); + --bs-btn-bg: transparent; + --bs-btn-border-color: transparent; + --bs-btn-hover-color: var(--bs-link-hover-color); + --bs-btn-hover-border-color: transparent; + --bs-btn-active-color: var(--bs-link-hover-color); + --bs-btn-active-border-color: transparent; + --bs-btn-disabled-color: #6c757d; + --bs-btn-disabled-border-color: transparent; + --bs-btn-box-shadow: 0 0 0 #000; + --bs-btn-focus-shadow-rgb: 117, 78, 152; + text-decoration: none; } + .btn-link:hover, .btn-link:focus-visible { + text-decoration: underline; } + .btn-link:focus-visible { + color: var(--bs-btn-color); } + .btn-link:hover { + color: var(--bs-btn-hover-color); } + +.btn-lg, .btn-group-lg > .btn, .search-form .btn-group-lg > .search-submit, .comment-form .btn-group-lg > input[type="submit"] { + --bs-btn-padding-y: 0.5rem; + --bs-btn-padding-x: 1rem; + --bs-btn-font-size: 1.25rem; + --bs-btn-border-radius: var(--bs-border-radius-lg); } + +.btn-sm, .btn-group-sm > .btn, .search-form .btn-group-sm > .search-submit, .comment-form .btn-group-sm > input[type="submit"] { + --bs-btn-padding-y: 0.25rem; + --bs-btn-padding-x: 0.5rem; + --bs-btn-font-size: 0.875rem; + --bs-btn-border-radius: var(--bs-border-radius-sm); } + +.fade { + transition: opacity 0.15s linear; } + @media (prefers-reduced-motion: reduce) { + .fade { + transition: none; } } + .fade:not(.show) { + opacity: 0; } + +.collapse:not(.show) { + display: none; } + +.collapsing { + height: 0; + overflow: hidden; + transition: height 0.35s ease; } + @media (prefers-reduced-motion: reduce) { + .collapsing { + transition: none; } } + .collapsing.collapse-horizontal { + width: 0; + height: auto; + transition: width 0.35s ease; } + @media (prefers-reduced-motion: reduce) { + .collapsing.collapse-horizontal { + transition: none; } } +.dropup, +.dropend, +.dropdown, +.dropstart, +.dropup-center, +.dropdown-center { + position: relative; } + +.dropdown-toggle { + white-space: nowrap; } + .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-right: 0.3em solid transparent; + border-bottom: 0; + border-left: 0.3em solid transparent; } + .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropdown-menu { + --bs-dropdown-zindex: 1000; + --bs-dropdown-min-width: 10rem; + --bs-dropdown-padding-x: 0; + --bs-dropdown-padding-y: 0.5rem; + --bs-dropdown-spacer: 0.125rem; + --bs-dropdown-font-size: 1rem; + --bs-dropdown-color: var(--bs-body-color); + --bs-dropdown-bg: var(--bs-body-bg); + --bs-dropdown-border-color: var(--bs-border-color-translucent); + --bs-dropdown-border-radius: var(--bs-border-radius); + --bs-dropdown-border-width: var(--bs-border-width); + --bs-dropdown-inner-border-radius: calc(var(--bs-border-radius) - var(--bs-border-width)); + --bs-dropdown-divider-bg: var(--bs-border-color-translucent); + --bs-dropdown-divider-margin-y: 0.5rem; + --bs-dropdown-box-shadow: var(--bs-box-shadow); + --bs-dropdown-link-color: var(--bs-body-color); + --bs-dropdown-link-hover-color: var(--bs-body-color); + --bs-dropdown-link-hover-bg: var(--bs-tertiary-bg); + --bs-dropdown-link-active-color: #fff; + --bs-dropdown-link-active-bg: #5d2f86; + --bs-dropdown-link-disabled-color: var(--bs-tertiary-color); + --bs-dropdown-item-padding-x: 1rem; + --bs-dropdown-item-padding-y: 0.25rem; + --bs-dropdown-header-color: #6c757d; + --bs-dropdown-header-padding-x: 1rem; + --bs-dropdown-header-padding-y: 0.5rem; + position: absolute; + z-index: var(--bs-dropdown-zindex); + display: none; + min-width: var(--bs-dropdown-min-width); + padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x); + margin: 0; + font-size: var(--bs-dropdown-font-size); + color: var(--bs-dropdown-color); + text-align: left; + list-style: none; + background-color: var(--bs-dropdown-bg); + background-clip: padding-box; + border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color); + border-radius: var(--bs-dropdown-border-radius); } + .dropdown-menu[data-bs-popper] { + top: 100%; + left: 0; + margin-top: var(--bs-dropdown-spacer); } + +.dropdown-menu-start { + --bs-position: start; } + .dropdown-menu-start[data-bs-popper] { + right: auto; + left: 0; } + +.dropdown-menu-end { + --bs-position: end; } + .dropdown-menu-end[data-bs-popper] { + right: 0; + left: auto; } + +@media (min-width: 576px) { + .dropdown-menu-sm-start { + --bs-position: start; } + .dropdown-menu-sm-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-sm-end { + --bs-position: end; } + .dropdown-menu-sm-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 768px) { + .dropdown-menu-md-start { + --bs-position: start; } + .dropdown-menu-md-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-md-end { + --bs-position: end; } + .dropdown-menu-md-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 992px) { + .dropdown-menu-lg-start { + --bs-position: start; } + .dropdown-menu-lg-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-lg-end { + --bs-position: end; } + .dropdown-menu-lg-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 1200px) { + .dropdown-menu-xl-start { + --bs-position: start; } + .dropdown-menu-xl-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-xl-end { + --bs-position: end; } + .dropdown-menu-xl-end[data-bs-popper] { + right: 0; + left: auto; } } + +@media (min-width: 1400px) { + .dropdown-menu-xxl-start { + --bs-position: start; } + .dropdown-menu-xxl-start[data-bs-popper] { + right: auto; + left: 0; } + .dropdown-menu-xxl-end { + --bs-position: end; } + .dropdown-menu-xxl-end[data-bs-popper] { + right: 0; + left: auto; } } + +.dropup .dropdown-menu[data-bs-popper] { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom: var(--bs-dropdown-spacer); } + +.dropup .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-right: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-left: 0.3em solid transparent; } + +.dropup .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropend .dropdown-menu[data-bs-popper] { + top: 0; + right: auto; + left: 100%; + margin-top: 0; + margin-left: var(--bs-dropdown-spacer); } + +.dropend .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0; + border-bottom: 0.3em solid transparent; + border-left: 0.3em solid; } + +.dropend .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropend .dropdown-toggle::after { + vertical-align: 0; } + +.dropstart .dropdown-menu[data-bs-popper] { + top: 0; + right: 100%; + left: auto; + margin-top: 0; + margin-right: var(--bs-dropdown-spacer); } + +.dropstart .dropdown-toggle::after { + display: inline-block; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; } + +.dropstart .dropdown-toggle::after { + display: none; } + +.dropstart .dropdown-toggle::before { + display: inline-block; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0.3em solid; + border-bottom: 0.3em solid transparent; } + +.dropstart .dropdown-toggle:empty::after { + margin-left: 0; } + +.dropstart .dropdown-toggle::before { + vertical-align: 0; } + +.dropdown-divider { + height: 0; + margin: var(--bs-dropdown-divider-margin-y) 0; + overflow: hidden; + border-top: 1px solid var(--bs-dropdown-divider-bg); + opacity: 1; } + +.dropdown-item { + display: block; + width: 100%; + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + clear: both; + font-weight: 400; + color: var(--bs-dropdown-link-color); + text-align: inherit; + white-space: nowrap; + background-color: transparent; + border: 0; + border-radius: var(--bs-dropdown-item-border-radius, 0); } + .dropdown-item:hover, .dropdown-item:focus { + color: var(--bs-dropdown-link-hover-color); + text-decoration: none; + background-color: var(--bs-dropdown-link-hover-bg); } + .dropdown-item.active, .dropdown-item:active { + color: var(--bs-dropdown-link-active-color); + text-decoration: none; + background-color: var(--bs-dropdown-link-active-bg); } + .dropdown-item.disabled, .dropdown-item:disabled { + color: var(--bs-dropdown-link-disabled-color); + pointer-events: none; + background-color: transparent; } + +.dropdown-menu.show { + display: block; } + +.dropdown-header { + display: block; + padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x); + margin-bottom: 0; + font-size: 0.875rem; + color: var(--bs-dropdown-header-color); + white-space: nowrap; } + +.dropdown-item-text { + display: block; + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + color: var(--bs-dropdown-link-color); } + +.dropdown-menu-dark { + --bs-dropdown-color: #dee2e6; + --bs-dropdown-bg: #343a40; + --bs-dropdown-border-color: var(--bs-border-color-translucent); + --bs-dropdown-box-shadow: ; + --bs-dropdown-link-color: #dee2e6; + --bs-dropdown-link-hover-color: #fff; + --bs-dropdown-divider-bg: var(--bs-border-color-translucent); + --bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15); + --bs-dropdown-link-active-color: #fff; + --bs-dropdown-link-active-bg: #5d2f86; + --bs-dropdown-link-disabled-color: #adb5bd; + --bs-dropdown-header-color: #adb5bd; } + +.btn-group, +.btn-group-vertical { + position: relative; + display: inline-flex; + vertical-align: middle; } + .btn-group > .btn, .search-form .btn-group > .search-submit, .comment-form .btn-group > input[type="submit"], + .btn-group-vertical > .btn, + .search-form .btn-group-vertical > .search-submit, + .comment-form .btn-group-vertical > input[type="submit"] { + position: relative; + flex: 1 1 auto; } + .btn-group > .btn-check:checked + .btn, .search-form .btn-group > .btn-check:checked + .search-submit, .comment-form .btn-group > .btn-check:checked + input[type="submit"], + .btn-group > .btn-check:focus + .btn, + .search-form .btn-group > .btn-check:focus + .search-submit, + .comment-form .btn-group > .btn-check:focus + input[type="submit"], + .btn-group > .btn:hover, + .search-form .btn-group > .search-submit:hover, + .comment-form .btn-group > input[type="submit"]:hover, + .btn-group > .btn:focus, + .search-form .btn-group > .search-submit:focus, + .comment-form .btn-group > input[type="submit"]:focus, + .btn-group > .btn:active, + .search-form .btn-group > .search-submit:active, + .comment-form .btn-group > input[type="submit"]:active, + .btn-group > .btn.active, + .search-form .btn-group > .active.search-submit, + .comment-form .btn-group > input.active[type="submit"], + .btn-group-vertical > .btn-check:checked + .btn, + .search-form .btn-group-vertical > .btn-check:checked + .search-submit, + .comment-form .btn-group-vertical > .btn-check:checked + input[type="submit"], + .btn-group-vertical > .btn-check:focus + .btn, + .search-form .btn-group-vertical > .btn-check:focus + .search-submit, + .comment-form .btn-group-vertical > .btn-check:focus + input[type="submit"], + .btn-group-vertical > .btn:hover, + .search-form .btn-group-vertical > .search-submit:hover, + .comment-form .btn-group-vertical > input[type="submit"]:hover, + .btn-group-vertical > .btn:focus, + .search-form .btn-group-vertical > .search-submit:focus, + .comment-form .btn-group-vertical > input[type="submit"]:focus, + .btn-group-vertical > .btn:active, + .search-form .btn-group-vertical > .search-submit:active, + .comment-form .btn-group-vertical > input[type="submit"]:active, + .btn-group-vertical > .btn.active, + .search-form .btn-group-vertical > .active.search-submit, + .comment-form .btn-group-vertical > input.active[type="submit"] { + z-index: 1; } + +.btn-toolbar { + display: flex; + flex-wrap: wrap; + justify-content: flex-start; } + .btn-toolbar .input-group { + width: auto; } + +.btn-group { + border-radius: var(--bs-border-radius); } + .btn-group > :not(.btn-check:first-child) + .btn, .search-form .btn-group > :not(.btn-check:first-child) + .search-submit, .comment-form .btn-group > :not(.btn-check:first-child) + input[type="submit"], + .btn-group > .btn-group:not(:first-child) { + margin-left: calc(var(--bs-border-width) * -1); } + .btn-group > .btn:not(:last-child):not(.dropdown-toggle), .search-form .btn-group > .search-submit:not(:last-child):not(.dropdown-toggle), .comment-form .btn-group > input[type="submit"]:not(:last-child):not(.dropdown-toggle), + .btn-group > .btn.dropdown-toggle-split:first-child, + .search-form .btn-group > .dropdown-toggle-split.search-submit:first-child, + .comment-form .btn-group > input.dropdown-toggle-split[type="submit"]:first-child, + .btn-group > .btn-group:not(:last-child) > .btn, + .search-form .btn-group > .btn-group:not(:last-child) > .search-submit, + .comment-form .btn-group > .btn-group:not(:last-child) > input[type="submit"] { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + .btn-group > .btn:nth-child(n + 3), .search-form .btn-group > .search-submit:nth-child(n + 3), .comment-form .btn-group > input[type="submit"]:nth-child(n + 3), + .btn-group > :not(.btn-check) + .btn, + .search-form .btn-group > :not(.btn-check) + .search-submit, + .comment-form .btn-group > :not(.btn-check) + input[type="submit"], + .btn-group > .btn-group:not(:first-child) > .btn, + .search-form .btn-group > .btn-group:not(:first-child) > .search-submit, + .comment-form .btn-group > .btn-group:not(:first-child) > input[type="submit"] { + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + +.dropdown-toggle-split { + padding-right: 0.5625rem; + padding-left: 0.5625rem; } + .dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after { + margin-left: 0; } + .dropstart .dropdown-toggle-split::before { + margin-right: 0; } + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split, .search-form .btn-group-sm > .search-submit + .dropdown-toggle-split, .comment-form .btn-group-sm > input[type="submit"] + .dropdown-toggle-split { + padding-right: 0.375rem; + padding-left: 0.375rem; } + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split, .search-form .btn-group-lg > .search-submit + .dropdown-toggle-split, .comment-form .btn-group-lg > input[type="submit"] + .dropdown-toggle-split { + padding-right: 0.75rem; + padding-left: 0.75rem; } + +.btn-group-vertical { + flex-direction: column; + align-items: flex-start; + justify-content: center; } + .btn-group-vertical > .btn, .search-form .btn-group-vertical > .search-submit, .comment-form .btn-group-vertical > input[type="submit"], + .btn-group-vertical > .btn-group { + width: 100%; } + .btn-group-vertical > .btn:not(:first-child), .search-form .btn-group-vertical > .search-submit:not(:first-child), .comment-form .btn-group-vertical > input[type="submit"]:not(:first-child), + .btn-group-vertical > .btn-group:not(:first-child) { + margin-top: calc(var(--bs-border-width) * -1); } + .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), .search-form .btn-group-vertical > .search-submit:not(:last-child):not(.dropdown-toggle), .comment-form .btn-group-vertical > input[type="submit"]:not(:last-child):not(.dropdown-toggle), + .btn-group-vertical > .btn-group:not(:last-child) > .btn, + .search-form .btn-group-vertical > .btn-group:not(:last-child) > .search-submit, + .comment-form .btn-group-vertical > .btn-group:not(:last-child) > input[type="submit"] { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; } + .btn-group-vertical > .btn ~ .btn, .search-form .btn-group-vertical > .search-submit ~ .btn, .search-form .btn-group-vertical > .btn ~ .search-submit, .search-form .btn-group-vertical > .search-submit ~ .search-submit, .comment-form .btn-group-vertical > input[type="submit"] ~ .btn, .comment-form .search-form .btn-group-vertical > input[type="submit"] ~ .search-submit, .search-form .comment-form .btn-group-vertical > input[type="submit"] ~ .search-submit, .comment-form .btn-group-vertical > .btn ~ input[type="submit"], .comment-form .search-form .btn-group-vertical > .search-submit ~ input[type="submit"], .search-form .comment-form .btn-group-vertical > .search-submit ~ input[type="submit"], .comment-form .btn-group-vertical > input[type="submit"] ~ input[type="submit"], + .btn-group-vertical > .btn-group:not(:first-child) > .btn, + .search-form .btn-group-vertical > .btn-group:not(:first-child) > .search-submit, + .comment-form .btn-group-vertical > .btn-group:not(:first-child) > input[type="submit"] { + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.nav { + --bs-nav-link-padding-x: 1rem; + --bs-nav-link-padding-y: 0.5rem; + --bs-nav-link-font-weight: ; + --bs-nav-link-color: var(--bs-link-color); + --bs-nav-link-hover-color: var(--bs-link-hover-color); + --bs-nav-link-disabled-color: var(--bs-secondary-color); + display: flex; + flex-wrap: wrap; + padding-left: 0; + margin-bottom: 0; + list-style: none; } + +.nav-link, .banner .nav a { + display: block; + padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x); + font-size: var(--bs-nav-link-font-size); + font-weight: var(--bs-nav-link-font-weight); + color: var(--bs-nav-link-color); + background: none; + border: 0; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .nav-link, .banner .nav a { + transition: none; } } + .nav-link:hover, .banner .nav a:hover, .nav-link:focus, .banner .nav a:focus { + color: var(--bs-nav-link-hover-color); + text-decoration: none; } + .nav-link:focus-visible, .banner .nav a:focus-visible { + outline: 0; + box-shadow: 0 0 0 0.25rem rgba(93, 47, 134, 0.25); } + .nav-link.disabled, .banner .nav a.disabled, .nav-link:disabled, .banner .nav a:disabled { + color: var(--bs-nav-link-disabled-color); + pointer-events: none; + cursor: default; } + +.nav-tabs { + --bs-nav-tabs-border-width: var(--bs-border-width); + --bs-nav-tabs-border-color: var(--bs-border-color); + --bs-nav-tabs-border-radius: var(--bs-border-radius); + --bs-nav-tabs-link-hover-border-color: var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color); + --bs-nav-tabs-link-active-color: var(--bs-emphasis-color); + --bs-nav-tabs-link-active-bg: var(--bs-body-bg); + --bs-nav-tabs-link-active-border-color: var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg); + border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color); } + .nav-tabs .nav-link, .nav-tabs .banner .nav a, .banner .nav .nav-tabs a { + margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width)); + border: var(--bs-nav-tabs-border-width) solid transparent; + border-top-left-radius: var(--bs-nav-tabs-border-radius); + border-top-right-radius: var(--bs-nav-tabs-border-radius); } + .nav-tabs .nav-link:hover, .nav-tabs .banner .nav a:hover, .banner .nav .nav-tabs a:hover, .nav-tabs .nav-link:focus, .nav-tabs .banner .nav a:focus, .banner .nav .nav-tabs a:focus { + isolation: isolate; + border-color: var(--bs-nav-tabs-link-hover-border-color); } + .nav-tabs .nav-link.active, .nav-tabs .banner .nav a.active, .banner .nav .nav-tabs a.active, + .nav-tabs .nav-item.show .nav-link, + .nav-tabs .nav-item.show .banner .nav a, + .banner .nav .nav-tabs .nav-item.show a, + .nav-tabs .banner .nav li.show .nav-link, + .nav-tabs .banner .nav li.show a, + .banner .nav .nav-tabs li.show .nav-link, + .banner .nav .nav-tabs li.show a { + color: var(--bs-nav-tabs-link-active-color); + background-color: var(--bs-nav-tabs-link-active-bg); + border-color: var(--bs-nav-tabs-link-active-border-color); } + .nav-tabs .dropdown-menu { + margin-top: calc(-1 * var(--bs-nav-tabs-border-width)); + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.nav-pills { + --bs-nav-pills-border-radius: var(--bs-border-radius); + --bs-nav-pills-link-active-color: #fff; + --bs-nav-pills-link-active-bg: #5d2f86; } + .nav-pills .nav-link, .nav-pills .banner .nav a, .banner .nav .nav-pills a { + border-radius: var(--bs-nav-pills-border-radius); } + .nav-pills .nav-link.active, .nav-pills .banner .nav a.active, .banner .nav .nav-pills a.active, + .nav-pills .show > .nav-link, + .nav-pills .banner .nav .show > a, + .banner .nav .nav-pills .show > a { + color: var(--bs-nav-pills-link-active-color); + background-color: var(--bs-nav-pills-link-active-bg); } + +.nav-underline { + --bs-nav-underline-gap: 1rem; + --bs-nav-underline-border-width: 0.125rem; + --bs-nav-underline-link-active-color: var(--bs-emphasis-color); + gap: var(--bs-nav-underline-gap); } + .nav-underline .nav-link, .nav-underline .banner .nav a, .banner .nav .nav-underline a { + padding-right: 0; + padding-left: 0; + border-bottom: var(--bs-nav-underline-border-width) solid transparent; } + .nav-underline .nav-link:hover, .nav-underline .banner .nav a:hover, .banner .nav .nav-underline a:hover, .nav-underline .nav-link:focus, .nav-underline .banner .nav a:focus, .banner .nav .nav-underline a:focus { + border-bottom-color: currentcolor; } + .nav-underline .nav-link.active, .nav-underline .banner .nav a.active, .banner .nav .nav-underline a.active, + .nav-underline .show > .nav-link, + .nav-underline .banner .nav .show > a, + .banner .nav .nav-underline .show > a { + font-weight: 700; + color: var(--bs-nav-underline-link-active-color); + border-bottom-color: currentcolor; } + +.nav-fill > .nav-link, .banner .nav .nav-fill > a, +.nav-fill .nav-item, +.nav-fill .banner .nav li, +.banner .nav .nav-fill li { + flex: 1 1 auto; + text-align: center; } + +.nav-justified > .nav-link, .banner .nav .nav-justified > a, +.nav-justified .nav-item, +.nav-justified .banner .nav li, +.banner .nav .nav-justified li { + flex-basis: 0; + flex-grow: 1; + text-align: center; } + +.nav-fill .nav-item .nav-link, .nav-fill .nav-item .banner .nav a, .banner .nav .nav-fill .nav-item a, .nav-fill .banner .nav li .nav-link, .nav-fill .banner .nav li a, .banner .nav .nav-fill li .nav-link, .banner .nav .nav-fill li a, +.nav-justified .nav-item .nav-link, +.nav-justified .nav-item .banner .nav a, +.banner .nav .nav-justified .nav-item a, +.nav-justified .banner .nav li .nav-link, +.nav-justified .banner .nav li a, +.banner .nav .nav-justified li .nav-link, +.banner .nav .nav-justified li a { + width: 100%; } + +.tab-content > .tab-pane { + display: none; } + +.tab-content > .active { + display: block; } + +.navbar { + --bs-navbar-padding-x: 0; + --bs-navbar-padding-y: 0.5rem; + --bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65); + --bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8); + --bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3); + --bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1); + --bs-navbar-brand-padding-y: 0.3125rem; + --bs-navbar-brand-margin-end: 1rem; + --bs-navbar-brand-font-size: 1.25rem; + --bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1); + --bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1); + --bs-navbar-nav-link-padding-x: 0.5rem; + --bs-navbar-toggler-padding-y: 0.25rem; + --bs-navbar-toggler-padding-x: 0.75rem; + --bs-navbar-toggler-font-size: 1.25rem; + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2829, 45, 53, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); + --bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15); + --bs-navbar-toggler-border-radius: var(--bs-border-radius); + --bs-navbar-toggler-focus-width: 0; + --bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out; + position: relative; + display: flex; + flex-wrap: wrap; + align-items: center; + justify-content: space-between; + padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x); } + .navbar > .container, + .navbar > .container-fluid, + .navbar > .container-sm, + .navbar > .container-md, + .navbar > .container-lg, + .navbar > .container-xl, + .navbar > .container-xxl { + display: flex; + flex-wrap: inherit; + align-items: center; + justify-content: space-between; } + +.navbar-brand { + padding-top: var(--bs-navbar-brand-padding-y); + padding-bottom: var(--bs-navbar-brand-padding-y); + margin-right: var(--bs-navbar-brand-margin-end); + font-size: var(--bs-navbar-brand-font-size); + color: var(--bs-navbar-brand-color); + white-space: nowrap; } + .navbar-brand:hover, .navbar-brand:focus { + color: var(--bs-navbar-brand-hover-color); + text-decoration: none; } + +.navbar-nav { + --bs-nav-link-padding-x: 0; + --bs-nav-link-padding-y: 0.5rem; + --bs-nav-link-font-weight: ; + --bs-nav-link-color: var(--bs-navbar-color); + --bs-nav-link-hover-color: var(--bs-navbar-hover-color); + --bs-nav-link-disabled-color: var(--bs-navbar-disabled-color); + display: flex; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + list-style: none; } + .navbar-nav .nav-link.active, .navbar-nav .banner .nav a.active, .banner .nav .navbar-nav a.active, .navbar-nav .nav-link.show, .navbar-nav .banner .nav a.show, .banner .nav .navbar-nav a.show { + color: var(--bs-navbar-active-color); } + .navbar-nav .dropdown-menu { + position: static; } + +.navbar-text { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + color: var(--bs-navbar-color); } + .navbar-text a, + .navbar-text a:hover, + .navbar-text a:focus { + color: var(--bs-navbar-active-color); } + +.navbar-collapse { + flex-basis: 100%; + flex-grow: 1; + align-items: center; } + +.navbar-toggler { + padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x); + font-size: var(--bs-navbar-toggler-font-size); + line-height: 1; + color: var(--bs-navbar-color); + background-color: transparent; + border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color); + border-radius: var(--bs-navbar-toggler-border-radius); + transition: var(--bs-navbar-toggler-transition); } + @media (prefers-reduced-motion: reduce) { + .navbar-toggler { + transition: none; } } + .navbar-toggler:hover { + text-decoration: none; } + .navbar-toggler:focus { + text-decoration: none; + outline: 0; + box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width); } + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + background-image: var(--bs-navbar-toggler-icon-bg); + background-repeat: no-repeat; + background-position: center; + background-size: 100%; } + +.navbar-nav-scroll { + max-height: var(--bs-scroll-height, 75vh); + overflow-y: auto; } + +@media (min-width: 576px) { + .navbar-expand-sm { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-sm .navbar-nav { + flex-direction: row; } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-sm .navbar-nav .nav-link, .navbar-expand-sm .navbar-nav .banner .nav a, .banner .nav .navbar-expand-sm .navbar-nav a { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-sm .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-sm .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-sm .navbar-toggler { + display: none; } + .navbar-expand-sm .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-sm .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-sm .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 768px) { + .navbar-expand-md { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-md .navbar-nav { + flex-direction: row; } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-md .navbar-nav .nav-link, .navbar-expand-md .navbar-nav .banner .nav a, .banner .nav .navbar-expand-md .navbar-nav a { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-md .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-md .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-md .navbar-toggler { + display: none; } + .navbar-expand-md .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-md .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-md .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 992px) { + .navbar-expand-lg { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-lg .navbar-nav { + flex-direction: row; } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-lg .navbar-nav .nav-link, .navbar-expand-lg .navbar-nav .banner .nav a, .banner .nav .navbar-expand-lg .navbar-nav a { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-lg .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-lg .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-lg .navbar-toggler { + display: none; } + .navbar-expand-lg .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-lg .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-lg .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 1200px) { + .navbar-expand-xl { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-xl .navbar-nav { + flex-direction: row; } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-xl .navbar-nav .nav-link, .navbar-expand-xl .navbar-nav .banner .nav a, .banner .nav .navbar-expand-xl .navbar-nav a { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-xl .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-xl .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-xl .navbar-toggler { + display: none; } + .navbar-expand-xl .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-xl .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-xl .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +@media (min-width: 1400px) { + .navbar-expand-xxl { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand-xxl .navbar-nav { + flex-direction: row; } + .navbar-expand-xxl .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand-xxl .navbar-nav .nav-link, .navbar-expand-xxl .navbar-nav .banner .nav a, .banner .nav .navbar-expand-xxl .navbar-nav a { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand-xxl .navbar-nav-scroll { + overflow: visible; } + .navbar-expand-xxl .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand-xxl .navbar-toggler { + display: none; } + .navbar-expand-xxl .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand-xxl .offcanvas .offcanvas-header { + display: none; } + .navbar-expand-xxl .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } } + +.navbar-expand { + flex-wrap: nowrap; + justify-content: flex-start; } + .navbar-expand .navbar-nav { + flex-direction: row; } + .navbar-expand .navbar-nav .dropdown-menu { + position: absolute; } + .navbar-expand .navbar-nav .nav-link, .navbar-expand .navbar-nav .banner .nav a, .banner .nav .navbar-expand .navbar-nav a { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left: var(--bs-navbar-nav-link-padding-x); } + .navbar-expand .navbar-nav-scroll { + overflow: visible; } + .navbar-expand .navbar-collapse { + display: flex !important; + flex-basis: auto; } + .navbar-expand .navbar-toggler { + display: none; } + .navbar-expand .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: transparent !important; + border: 0 !important; + transform: none !important; + transition: none; } + .navbar-expand .offcanvas .offcanvas-header { + display: none; } + .navbar-expand .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; } + +.navbar-dark, +.navbar[data-bs-theme="dark"] { + --bs-navbar-color: #c1c3c8; + --bs-navbar-hover-color: #b3c7ff; + --bs-navbar-disabled-color: rgba(255, 255, 255, 0.25); + --bs-navbar-active-color: #b3c7ff; + --bs-navbar-brand-color: #b3c7ff; + --bs-navbar-brand-hover-color: #b3c7ff; + --bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1); + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23c1c3c8' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); } + +[data-bs-theme="dark"] .navbar-toggler-icon { + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23c1c3c8' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); } + +.card { + --bs-card-spacer-y: 1rem; + --bs-card-spacer-x: 1rem; + --bs-card-title-spacer-y: 0.5rem; + --bs-card-title-color: ; + --bs-card-subtitle-color: ; + --bs-card-border-width: var(--bs-border-width); + --bs-card-border-color: #e9ecef; + --bs-card-border-radius: var(--bs-border-radius); + --bs-card-box-shadow: ; + --bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width))); + --bs-card-cap-padding-y: 0.5rem; + --bs-card-cap-padding-x: 1rem; + --bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03); + --bs-card-cap-color: ; + --bs-card-height: ; + --bs-card-color: ; + --bs-card-bg: var(--bs-body-bg); + --bs-card-img-overlay-padding: 1rem; + --bs-card-group-margin: 1.5rem; + position: relative; + display: flex; + flex-direction: column; + min-width: 0; + height: var(--bs-card-height); + color: var(--bs-body-color); + word-wrap: break-word; + background-color: var(--bs-card-bg); + background-clip: border-box; + border: var(--bs-card-border-width) solid var(--bs-card-border-color); + border-radius: var(--bs-card-border-radius); } + .card > hr { + margin-right: 0; + margin-left: 0; } + .card > .list-group { + border-top: inherit; + border-bottom: inherit; } + .card > .list-group:first-child { + border-top-width: 0; + border-top-left-radius: var(--bs-card-inner-border-radius); + border-top-right-radius: var(--bs-card-inner-border-radius); } + .card > .list-group:last-child { + border-bottom-width: 0; + border-bottom-right-radius: var(--bs-card-inner-border-radius); + border-bottom-left-radius: var(--bs-card-inner-border-radius); } + .card > .card-header + .list-group, + .card > .list-group + .card-footer { + border-top: 0; } + +.card-body { + flex: 1 1 auto; + padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x); + color: var(--bs-card-color); } + +.card-title { + margin-bottom: var(--bs-card-title-spacer-y); + color: var(--bs-card-title-color); } + +.card-subtitle { + margin-top: calc(-.5 * var(--bs-card-title-spacer-y)); + margin-bottom: 0; + color: var(--bs-card-subtitle-color); } + +.card-text:last-child { + margin-bottom: 0; } + +.card-link:hover { + text-decoration: none; } + +.card-link + .card-link { + margin-left: var(--bs-card-spacer-x); } + +.card-header { + padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x); + margin-bottom: 0; + color: var(--bs-card-cap-color); + background-color: var(--bs-card-cap-bg); + border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color); } + .card-header:first-child { + border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0; } + +.card-footer { + padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x); + color: var(--bs-card-cap-color); + background-color: var(--bs-card-cap-bg); + border-top: var(--bs-card-border-width) solid var(--bs-card-border-color); } + .card-footer:last-child { + border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius); } + +.card-header-tabs { + margin-right: calc(-.5 * var(--bs-card-cap-padding-x)); + margin-bottom: calc(-1 * var(--bs-card-cap-padding-y)); + margin-left: calc(-.5 * var(--bs-card-cap-padding-x)); + border-bottom: 0; } + .card-header-tabs .nav-link.active, .card-header-tabs .banner .nav a.active, .banner .nav .card-header-tabs a.active { + background-color: var(--bs-card-bg); + border-bottom-color: var(--bs-card-bg); } + +.card-header-pills { + margin-right: calc(-.5 * var(--bs-card-cap-padding-x)); + margin-left: calc(-.5 * var(--bs-card-cap-padding-x)); } + +.card-img-overlay { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: var(--bs-card-img-overlay-padding); + border-radius: var(--bs-card-inner-border-radius); } + +.card-img, +.card-img-top, +.card-img-bottom { + width: 100%; } + +.card-img, +.card-img-top { + border-top-left-radius: var(--bs-card-inner-border-radius); + border-top-right-radius: var(--bs-card-inner-border-radius); } + +.card-img, +.card-img-bottom { + border-bottom-right-radius: var(--bs-card-inner-border-radius); + border-bottom-left-radius: var(--bs-card-inner-border-radius); } + +.card-group > .card { + margin-bottom: var(--bs-card-group-margin); } + +@media (min-width: 576px) { + .card-group { + display: flex; + flex-flow: row wrap; } + .card-group > .card { + flex: 1 0 0%; + margin-bottom: 0; } + .card-group > .card + .card { + margin-left: 0; + border-left: 0; } + .card-group > .card:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; } + .card-group > .card:not(:last-child) .card-img-top, + .card-group > .card:not(:last-child) .card-header { + border-top-right-radius: 0; } + .card-group > .card:not(:last-child) .card-img-bottom, + .card-group > .card:not(:last-child) .card-footer { + border-bottom-right-radius: 0; } + .card-group > .card:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; } + .card-group > .card:not(:first-child) .card-img-top, + .card-group > .card:not(:first-child) .card-header { + border-top-left-radius: 0; } + .card-group > .card:not(:first-child) .card-img-bottom, + .card-group > .card:not(:first-child) .card-footer { + border-bottom-left-radius: 0; } } + +.accordion { + --bs-accordion-color: var(--bs-body-color); + --bs-accordion-bg: var(--bs-body-bg); + --bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease; + --bs-accordion-border-color: var(--bs-border-color); + --bs-accordion-border-width: var(--bs-border-width); + --bs-accordion-border-radius: var(--bs-border-radius); + --bs-accordion-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width))); + --bs-accordion-btn-padding-x: 1.25rem; + --bs-accordion-btn-padding-y: 1rem; + --bs-accordion-btn-color: var(--bs-body-color); + --bs-accordion-btn-bg: var(--bs-accordion-bg); + --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%231d2d35' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e"); + --bs-accordion-btn-icon-width: 1.25rem; + --bs-accordion-btn-icon-transform: rotate(-180deg); + --bs-accordion-btn-icon-transition: transform 0.2s ease-in-out; + --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23251336' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e"); + --bs-accordion-btn-focus-box-shadow: none; + --bs-accordion-body-padding-x: 1.25rem; + --bs-accordion-body-padding-y: 1rem; + --bs-accordion-active-color: var(--bs-primary-text-emphasis); + --bs-accordion-active-bg: var(--bs-primary-bg-subtle); } + +.accordion-button { + position: relative; + display: flex; + align-items: center; + width: 100%; + padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x); + font-size: 1rem; + color: var(--bs-accordion-btn-color); + text-align: left; + background-color: var(--bs-accordion-btn-bg); + border: 0; + border-radius: 0; + overflow-anchor: none; + transition: var(--bs-accordion-transition); } + @media (prefers-reduced-motion: reduce) { + .accordion-button { + transition: none; } } + .accordion-button:not(.collapsed) { + color: var(--bs-accordion-active-color); + background-color: var(--bs-accordion-active-bg); + box-shadow: inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color); } + .accordion-button:not(.collapsed)::after { + background-image: var(--bs-accordion-btn-active-icon); + transform: var(--bs-accordion-btn-icon-transform); } + .accordion-button::after { + flex-shrink: 0; + width: var(--bs-accordion-btn-icon-width); + height: var(--bs-accordion-btn-icon-width); + margin-left: auto; + content: ""; + background-image: var(--bs-accordion-btn-icon); + background-repeat: no-repeat; + background-size: var(--bs-accordion-btn-icon-width); + transition: var(--bs-accordion-btn-icon-transition); } + @media (prefers-reduced-motion: reduce) { + .accordion-button::after { + transition: none; } } + .accordion-button:hover { + z-index: 2; } + .accordion-button:focus { + z-index: 3; + outline: 0; + box-shadow: var(--bs-accordion-btn-focus-box-shadow); } + +.accordion-header { + margin-bottom: 0; } + +.accordion-item { + color: var(--bs-accordion-color); + background-color: var(--bs-accordion-bg); + border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color); } + .accordion-item:first-of-type { + border-top-left-radius: var(--bs-accordion-border-radius); + border-top-right-radius: var(--bs-accordion-border-radius); } + .accordion-item:first-of-type > .accordion-header .accordion-button { + border-top-left-radius: var(--bs-accordion-inner-border-radius); + border-top-right-radius: var(--bs-accordion-inner-border-radius); } + .accordion-item:not(:first-of-type) { + border-top: 0; } + .accordion-item:last-of-type { + border-bottom-right-radius: var(--bs-accordion-border-radius); + border-bottom-left-radius: var(--bs-accordion-border-radius); } + .accordion-item:last-of-type > .accordion-header .accordion-button.collapsed { + border-bottom-right-radius: var(--bs-accordion-inner-border-radius); + border-bottom-left-radius: var(--bs-accordion-inner-border-radius); } + .accordion-item:last-of-type > .accordion-collapse { + border-bottom-right-radius: var(--bs-accordion-border-radius); + border-bottom-left-radius: var(--bs-accordion-border-radius); } + +.accordion-body { + padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x); } + +.accordion-flush > .accordion-item { + border-right: 0; + border-left: 0; + border-radius: 0; } + .accordion-flush > .accordion-item:first-child { + border-top: 0; } + .accordion-flush > .accordion-item:last-child { + border-bottom: 0; } + .accordion-flush > .accordion-item > .accordion-header .accordion-button, .accordion-flush > .accordion-item > .accordion-header .accordion-button.collapsed { + border-radius: 0; } + .accordion-flush > .accordion-item > .accordion-collapse { + border-radius: 0; } + +[data-bs-theme="dark"] .accordion-button::after { + --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%239e82b6'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); + --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%239e82b6'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); } + +.breadcrumb { + --bs-breadcrumb-padding-x: 0; + --bs-breadcrumb-padding-y: 0; + --bs-breadcrumb-margin-bottom: 1rem; + --bs-breadcrumb-bg: ; + --bs-breadcrumb-border-radius: ; + --bs-breadcrumb-divider-color: var(--bs-secondary-color); + --bs-breadcrumb-item-padding-x: 0.5rem; + --bs-breadcrumb-item-active-color: var(--bs-secondary-color); + display: flex; + flex-wrap: wrap; + padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x); + margin-bottom: var(--bs-breadcrumb-margin-bottom); + font-size: var(--bs-breadcrumb-font-size); + list-style: none; + background-color: var(--bs-breadcrumb-bg); + border-radius: var(--bs-breadcrumb-border-radius); } + +.breadcrumb-item + .breadcrumb-item { + padding-left: var(--bs-breadcrumb-item-padding-x); } + .breadcrumb-item + .breadcrumb-item::before { + float: left; + padding-right: var(--bs-breadcrumb-item-padding-x); + color: var(--bs-breadcrumb-divider-color); + content: var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */; } + +.breadcrumb-item.active { + color: var(--bs-breadcrumb-item-active-color); } + +.pagination { + --bs-pagination-padding-x: 0.75rem; + --bs-pagination-padding-y: 0.375rem; + --bs-pagination-font-size: 1rem; + --bs-pagination-color: var(--bs-link-color); + --bs-pagination-bg: var(--bs-body-bg); + --bs-pagination-border-width: var(--bs-border-width); + --bs-pagination-border-color: var(--bs-border-color); + --bs-pagination-border-radius: var(--bs-border-radius); + --bs-pagination-hover-color: var(--bs-link-hover-color); + --bs-pagination-hover-bg: var(--bs-tertiary-bg); + --bs-pagination-hover-border-color: var(--bs-border-color); + --bs-pagination-focus-color: var(--bs-link-hover-color); + --bs-pagination-focus-bg: var(--bs-secondary-bg); + --bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(93, 47, 134, 0.25); + --bs-pagination-active-color: #fff; + --bs-pagination-active-bg: #5d2f86; + --bs-pagination-active-border-color: #5d2f86; + --bs-pagination-disabled-color: var(--bs-secondary-color); + --bs-pagination-disabled-bg: var(--bs-secondary-bg); + --bs-pagination-disabled-border-color: var(--bs-border-color); + display: flex; + padding-left: 0; + list-style: none; } + +.page-link { + position: relative; + display: block; + padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x); + font-size: var(--bs-pagination-font-size); + color: var(--bs-pagination-color); + background-color: var(--bs-pagination-bg); + border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color); + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .page-link { + transition: none; } } + .page-link:hover { + z-index: 2; + color: var(--bs-pagination-hover-color); + text-decoration: none; + background-color: var(--bs-pagination-hover-bg); + border-color: var(--bs-pagination-hover-border-color); } + .page-link:focus { + z-index: 3; + color: var(--bs-pagination-focus-color); + background-color: var(--bs-pagination-focus-bg); + outline: 0; + box-shadow: var(--bs-pagination-focus-box-shadow); } + .page-link.active, .active > .page-link { + z-index: 3; + color: var(--bs-pagination-active-color); + background-color: var(--bs-pagination-active-bg); + border-color: var(--bs-pagination-active-border-color); } + .page-link.disabled, .disabled > .page-link { + color: var(--bs-pagination-disabled-color); + pointer-events: none; + background-color: var(--bs-pagination-disabled-bg); + border-color: var(--bs-pagination-disabled-border-color); } + +.page-item:not(:first-child) .page-link { + margin-left: calc(var(--bs-border-width) * -1); } + +.page-item:first-child .page-link { + border-top-left-radius: var(--bs-pagination-border-radius); + border-bottom-left-radius: var(--bs-pagination-border-radius); } + +.page-item:last-child .page-link { + border-top-right-radius: var(--bs-pagination-border-radius); + border-bottom-right-radius: var(--bs-pagination-border-radius); } + +.pagination-lg { + --bs-pagination-padding-x: 1.5rem; + --bs-pagination-padding-y: 0.75rem; + --bs-pagination-font-size: 1.25rem; + --bs-pagination-border-radius: var(--bs-border-radius-lg); } + +.pagination-sm { + --bs-pagination-padding-x: 0.5rem; + --bs-pagination-padding-y: 0.25rem; + --bs-pagination-font-size: 0.875rem; + --bs-pagination-border-radius: var(--bs-border-radius-sm); } + +.badge { + --bs-badge-padding-x: 0.65em; + --bs-badge-padding-y: 0.35em; + --bs-badge-font-size: 0.75em; + --bs-badge-font-weight: 700; + --bs-badge-color: #fff; + --bs-badge-border-radius: var(--bs-border-radius); + display: inline-block; + padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x); + font-size: var(--bs-badge-font-size); + font-weight: var(--bs-badge-font-weight); + line-height: 1; + color: var(--bs-badge-color); + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: var(--bs-badge-border-radius); } + .badge:empty { + display: none; } + +.btn .badge, .search-form .search-submit .badge, .comment-form input[type="submit"] .badge { + position: relative; + top: -1px; } + +.alert { + --bs-alert-bg: transparent; + --bs-alert-padding-x: 1.5rem; + --bs-alert-padding-y: 1rem; + --bs-alert-margin-bottom: 0; + --bs-alert-color: inherit; + --bs-alert-border-color: transparent; + --bs-alert-border: 0 solid var(--bs-alert-border-color); + --bs-alert-border-radius: 0; + --bs-alert-link-color: inherit; + position: relative; + padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x); + margin-bottom: var(--bs-alert-margin-bottom); + color: var(--bs-alert-color); + background-color: var(--bs-alert-bg); + border: var(--bs-alert-border); + border-radius: var(--bs-alert-border-radius); } + +.alert-heading { + color: inherit; } + +.alert-link { + font-weight: 700; + color: var(--bs-alert-link-color); } + +.alert-dismissible { + padding-right: 4.5rem; } + .alert-dismissible .btn-close { + position: absolute; + top: 0; + right: 0; + z-index: 2; + padding: 1.25rem 1.5rem; } + +.alert-primary { + --bs-alert-color: var(--bs-primary-text-emphasis); + --bs-alert-bg: var(--bs-primary-bg-subtle); + --bs-alert-border-color: var(--bs-primary-border-subtle); + --bs-alert-link-color: var(--bs-primary-text-emphasis); } + +.alert-secondary { + --bs-alert-color: var(--bs-secondary-text-emphasis); + --bs-alert-bg: var(--bs-secondary-bg-subtle); + --bs-alert-border-color: var(--bs-secondary-border-subtle); + --bs-alert-link-color: var(--bs-secondary-text-emphasis); } + +.alert-success { + --bs-alert-color: var(--bs-success-text-emphasis); + --bs-alert-bg: var(--bs-success-bg-subtle); + --bs-alert-border-color: var(--bs-success-border-subtle); + --bs-alert-link-color: var(--bs-success-text-emphasis); } + +.alert-info { + --bs-alert-color: var(--bs-info-text-emphasis); + --bs-alert-bg: var(--bs-info-bg-subtle); + --bs-alert-border-color: var(--bs-info-border-subtle); + --bs-alert-link-color: var(--bs-info-text-emphasis); } + +.alert-warning { + --bs-alert-color: var(--bs-warning-text-emphasis); + --bs-alert-bg: var(--bs-warning-bg-subtle); + --bs-alert-border-color: var(--bs-warning-border-subtle); + --bs-alert-link-color: var(--bs-warning-text-emphasis); } + +.alert-danger { + --bs-alert-color: var(--bs-danger-text-emphasis); + --bs-alert-bg: var(--bs-danger-bg-subtle); + --bs-alert-border-color: var(--bs-danger-border-subtle); + --bs-alert-link-color: var(--bs-danger-text-emphasis); } + +.alert-light { + --bs-alert-color: var(--bs-light-text-emphasis); + --bs-alert-bg: var(--bs-light-bg-subtle); + --bs-alert-border-color: var(--bs-light-border-subtle); + --bs-alert-link-color: var(--bs-light-text-emphasis); } + +.alert-dark { + --bs-alert-color: var(--bs-dark-text-emphasis); + --bs-alert-bg: var(--bs-dark-bg-subtle); + --bs-alert-border-color: var(--bs-dark-border-subtle); + --bs-alert-link-color: var(--bs-dark-text-emphasis); } + +@keyframes progress-bar-stripes { + 0% { + background-position-x: 1rem; } } + +.progress, +.progress-stacked { + --bs-progress-height: 1rem; + --bs-progress-font-size: 0.75rem; + --bs-progress-bg: var(--bs-secondary-bg); + --bs-progress-border-radius: var(--bs-border-radius); + --bs-progress-box-shadow: var(--bs-box-shadow-inset); + --bs-progress-bar-color: #fff; + --bs-progress-bar-bg: #5d2f86; + --bs-progress-bar-transition: width 0.6s ease; + display: flex; + height: var(--bs-progress-height); + overflow: hidden; + font-size: var(--bs-progress-font-size); + background-color: var(--bs-progress-bg); + border-radius: var(--bs-progress-border-radius); } + +.progress-bar { + display: flex; + flex-direction: column; + justify-content: center; + overflow: hidden; + color: var(--bs-progress-bar-color); + text-align: center; + white-space: nowrap; + background-color: var(--bs-progress-bar-bg); + transition: var(--bs-progress-bar-transition); } + @media (prefers-reduced-motion: reduce) { + .progress-bar { + transition: none; } } +.progress-bar-striped { + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: var(--bs-progress-height) var(--bs-progress-height); } + +.progress-stacked > .progress { + overflow: visible; } + +.progress-stacked > .progress > .progress-bar { + width: 100%; } + +.progress-bar-animated { + animation: 1s linear infinite progress-bar-stripes; } + @media (prefers-reduced-motion: reduce) { + .progress-bar-animated { + animation: none; } } +.list-group { + --bs-list-group-color: var(--bs-body-color); + --bs-list-group-bg: var(--bs-body-bg); + --bs-list-group-border-color: var(--bs-border-color); + --bs-list-group-border-width: var(--bs-border-width); + --bs-list-group-border-radius: var(--bs-border-radius); + --bs-list-group-item-padding-x: 1rem; + --bs-list-group-item-padding-y: 0.5rem; + --bs-list-group-action-color: var(--bs-secondary-color); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-tertiary-bg); + --bs-list-group-action-active-color: var(--bs-body-color); + --bs-list-group-action-active-bg: var(--bs-secondary-bg); + --bs-list-group-disabled-color: var(--bs-secondary-color); + --bs-list-group-disabled-bg: var(--bs-body-bg); + --bs-list-group-active-color: #fff; + --bs-list-group-active-bg: #5d2f86; + --bs-list-group-active-border-color: #5d2f86; + display: flex; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + border-radius: var(--bs-list-group-border-radius); } + +.list-group-numbered { + list-style-type: none; + counter-reset: section; } + .list-group-numbered > .list-group-item::before { + content: counters(section, ".") ". "; + counter-increment: section; } + +.list-group-item-action { + width: 100%; + color: var(--bs-list-group-action-color); + text-align: inherit; } + .list-group-item-action:hover, .list-group-item-action:focus { + z-index: 1; + color: var(--bs-list-group-action-hover-color); + text-decoration: none; + background-color: var(--bs-list-group-action-hover-bg); } + .list-group-item-action:active { + color: var(--bs-list-group-action-active-color); + background-color: var(--bs-list-group-action-active-bg); } + +.list-group-item { + position: relative; + display: block; + padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x); + color: var(--bs-list-group-color); + background-color: var(--bs-list-group-bg); + border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color); } + .list-group-item:first-child { + border-top-left-radius: inherit; + border-top-right-radius: inherit; } + .list-group-item:last-child { + border-bottom-right-radius: inherit; + border-bottom-left-radius: inherit; } + .list-group-item.disabled, .list-group-item:disabled { + color: var(--bs-list-group-disabled-color); + pointer-events: none; + background-color: var(--bs-list-group-disabled-bg); } + .list-group-item.active { + z-index: 2; + color: var(--bs-list-group-active-color); + background-color: var(--bs-list-group-active-bg); + border-color: var(--bs-list-group-active-border-color); } + .list-group-item + .list-group-item { + border-top-width: 0; } + .list-group-item + .list-group-item.active { + margin-top: calc(-1 * var(--bs-list-group-border-width)); + border-top-width: var(--bs-list-group-border-width); } + +.list-group-horizontal { + flex-direction: row; } + .list-group-horizontal > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } + +@media (min-width: 576px) { + .list-group-horizontal-sm { + flex-direction: row; } + .list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-sm > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-sm > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-sm > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 768px) { + .list-group-horizontal-md { + flex-direction: row; } + .list-group-horizontal-md > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-md > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-md > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-md > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-md > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 992px) { + .list-group-horizontal-lg { + flex-direction: row; } + .list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-lg > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-lg > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-lg > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 1200px) { + .list-group-horizontal-xl { + flex-direction: row; } + .list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-xl > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-xl > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-xl > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +@media (min-width: 1400px) { + .list-group-horizontal-xxl { + flex-direction: row; } + .list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius: 0; } + .list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius: 0; } + .list-group-horizontal-xxl > .list-group-item.active { + margin-top: 0; } + .list-group-horizontal-xxl > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width: 0; } + .list-group-horizontal-xxl > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width: var(--bs-list-group-border-width); } } + +.list-group-flush { + border-radius: 0; } + .list-group-flush > .list-group-item { + border-width: 0 0 var(--bs-list-group-border-width); } + .list-group-flush > .list-group-item:last-child { + border-bottom-width: 0; } + +.list-group-item-primary { + --bs-list-group-color: var(--bs-primary-text-emphasis); + --bs-list-group-bg: var(--bs-primary-bg-subtle); + --bs-list-group-border-color: var(--bs-primary-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-primary-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-primary-border-subtle); + --bs-list-group-active-color: var(--bs-primary-bg-subtle); + --bs-list-group-active-bg: var(--bs-primary-text-emphasis); + --bs-list-group-active-border-color: var(--bs-primary-text-emphasis); } + +.list-group-item-secondary { + --bs-list-group-color: var(--bs-secondary-text-emphasis); + --bs-list-group-bg: var(--bs-secondary-bg-subtle); + --bs-list-group-border-color: var(--bs-secondary-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-secondary-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-secondary-border-subtle); + --bs-list-group-active-color: var(--bs-secondary-bg-subtle); + --bs-list-group-active-bg: var(--bs-secondary-text-emphasis); + --bs-list-group-active-border-color: var(--bs-secondary-text-emphasis); } + +.list-group-item-success { + --bs-list-group-color: var(--bs-success-text-emphasis); + --bs-list-group-bg: var(--bs-success-bg-subtle); + --bs-list-group-border-color: var(--bs-success-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-success-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-success-border-subtle); + --bs-list-group-active-color: var(--bs-success-bg-subtle); + --bs-list-group-active-bg: var(--bs-success-text-emphasis); + --bs-list-group-active-border-color: var(--bs-success-text-emphasis); } + +.list-group-item-info { + --bs-list-group-color: var(--bs-info-text-emphasis); + --bs-list-group-bg: var(--bs-info-bg-subtle); + --bs-list-group-border-color: var(--bs-info-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-info-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-info-border-subtle); + --bs-list-group-active-color: var(--bs-info-bg-subtle); + --bs-list-group-active-bg: var(--bs-info-text-emphasis); + --bs-list-group-active-border-color: var(--bs-info-text-emphasis); } + +.list-group-item-warning { + --bs-list-group-color: var(--bs-warning-text-emphasis); + --bs-list-group-bg: var(--bs-warning-bg-subtle); + --bs-list-group-border-color: var(--bs-warning-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-warning-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-warning-border-subtle); + --bs-list-group-active-color: var(--bs-warning-bg-subtle); + --bs-list-group-active-bg: var(--bs-warning-text-emphasis); + --bs-list-group-active-border-color: var(--bs-warning-text-emphasis); } + +.list-group-item-danger { + --bs-list-group-color: var(--bs-danger-text-emphasis); + --bs-list-group-bg: var(--bs-danger-bg-subtle); + --bs-list-group-border-color: var(--bs-danger-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-danger-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-danger-border-subtle); + --bs-list-group-active-color: var(--bs-danger-bg-subtle); + --bs-list-group-active-bg: var(--bs-danger-text-emphasis); + --bs-list-group-active-border-color: var(--bs-danger-text-emphasis); } + +.list-group-item-light { + --bs-list-group-color: var(--bs-light-text-emphasis); + --bs-list-group-bg: var(--bs-light-bg-subtle); + --bs-list-group-border-color: var(--bs-light-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-light-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-light-border-subtle); + --bs-list-group-active-color: var(--bs-light-bg-subtle); + --bs-list-group-active-bg: var(--bs-light-text-emphasis); + --bs-list-group-active-border-color: var(--bs-light-text-emphasis); } + +.list-group-item-dark { + --bs-list-group-color: var(--bs-dark-text-emphasis); + --bs-list-group-bg: var(--bs-dark-bg-subtle); + --bs-list-group-border-color: var(--bs-dark-border-subtle); + --bs-list-group-action-hover-color: var(--bs-emphasis-color); + --bs-list-group-action-hover-bg: var(--bs-dark-border-subtle); + --bs-list-group-action-active-color: var(--bs-emphasis-color); + --bs-list-group-action-active-bg: var(--bs-dark-border-subtle); + --bs-list-group-active-color: var(--bs-dark-bg-subtle); + --bs-list-group-active-bg: var(--bs-dark-text-emphasis); + --bs-list-group-active-border-color: var(--bs-dark-text-emphasis); } + +.btn-close { + --bs-btn-close-color: #000; + --bs-btn-close-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e"); + --bs-btn-close-opacity: 0.5; + --bs-btn-close-hover-opacity: 0.75; + --bs-btn-close-focus-shadow: 0 0 0 0.25rem rgba(93, 47, 134, 0.25); + --bs-btn-close-focus-opacity: 1; + --bs-btn-close-disabled-opacity: 0.25; + --bs-btn-close-white-filter: invert(1) grayscale(100%) brightness(200%); + box-sizing: content-box; + width: 1em; + height: 1em; + padding: 0.25em 0.25em; + color: var(--bs-btn-close-color); + background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat; + border: 0; + border-radius: 0.375rem; + opacity: var(--bs-btn-close-opacity); } + .btn-close:hover { + color: var(--bs-btn-close-color); + text-decoration: none; + opacity: var(--bs-btn-close-hover-opacity); } + .btn-close:focus { + outline: 0; + box-shadow: var(--bs-btn-close-focus-shadow); + opacity: var(--bs-btn-close-focus-opacity); } + .btn-close:disabled, .btn-close.disabled { + pointer-events: none; + user-select: none; + opacity: var(--bs-btn-close-disabled-opacity); } + +.btn-close-white { + filter: var(--bs-btn-close-white-filter); } + +[data-bs-theme="dark"] .btn-close { + filter: var(--bs-btn-close-white-filter); } + +.toast { + --bs-toast-zindex: 1090; + --bs-toast-padding-x: 0.75rem; + --bs-toast-padding-y: 0.5rem; + --bs-toast-spacing: 3rem; + --bs-toast-max-width: 350px; + --bs-toast-font-size: 0.875rem; + --bs-toast-color: ; + --bs-toast-bg: rgba(var(--bs-body-bg-rgb), 0.85); + --bs-toast-border-width: var(--bs-border-width); + --bs-toast-border-color: var(--bs-border-color-translucent); + --bs-toast-border-radius: var(--bs-border-radius); + --bs-toast-box-shadow: var(--bs-box-shadow); + --bs-toast-header-color: var(--bs-secondary-color); + --bs-toast-header-bg: rgba(var(--bs-body-bg-rgb), 0.85); + --bs-toast-header-border-color: var(--bs-border-color-translucent); + width: var(--bs-toast-max-width); + max-width: 100%; + font-size: var(--bs-toast-font-size); + color: var(--bs-toast-color); + pointer-events: auto; + background-color: var(--bs-toast-bg); + background-clip: padding-box; + border: var(--bs-toast-border-width) solid var(--bs-toast-border-color); + box-shadow: var(--bs-toast-box-shadow); + border-radius: var(--bs-toast-border-radius); } + .toast.showing { + opacity: 0; } + .toast:not(.show) { + display: none; } + +.toast-container { + --bs-toast-zindex: 1090; + position: absolute; + z-index: var(--bs-toast-zindex); + width: max-content; + max-width: 100%; + pointer-events: none; } + .toast-container > :not(:last-child) { + margin-bottom: var(--bs-toast-spacing); } + +.toast-header { + display: flex; + align-items: center; + padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x); + color: var(--bs-toast-header-color); + background-color: var(--bs-toast-header-bg); + background-clip: padding-box; + border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color); + border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width)); + border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width)); } + .toast-header .btn-close { + margin-right: calc(-.5 * var(--bs-toast-padding-x)); + margin-left: var(--bs-toast-padding-x); } + +.toast-body { + padding: var(--bs-toast-padding-x); + word-wrap: break-word; } + +.modal { + --bs-modal-zindex: 1055; + --bs-modal-width: 500px; + --bs-modal-padding: 1rem; + --bs-modal-margin: 0.5rem; + --bs-modal-color: ; + --bs-modal-bg: var(--bs-body-bg); + --bs-modal-border-color: var(--bs-border-color-translucent); + --bs-modal-border-width: var(--bs-border-width); + --bs-modal-border-radius: var(--bs-border-radius-lg); + --bs-modal-box-shadow: var(--bs-box-shadow-sm); + --bs-modal-inner-border-radius: calc(var(--bs-border-radius-lg) - (var(--bs-border-width))); + --bs-modal-header-padding-x: 1rem; + --bs-modal-header-padding-y: 1rem; + --bs-modal-header-padding: 1rem 1rem; + --bs-modal-header-border-color: var(--bs-border-color); + --bs-modal-header-border-width: var(--bs-border-width); + --bs-modal-title-line-height: 1.5; + --bs-modal-footer-gap: 0.5rem; + --bs-modal-footer-bg: ; + --bs-modal-footer-border-color: var(--bs-border-color); + --bs-modal-footer-border-width: var(--bs-border-width); + position: fixed; + top: 0; + left: 0; + z-index: var(--bs-modal-zindex); + display: none; + width: 100%; + height: 100%; + overflow-x: hidden; + overflow-y: auto; + outline: 0; } + +.modal-dialog { + position: relative; + width: auto; + margin: var(--bs-modal-margin); + pointer-events: none; } + .modal.fade .modal-dialog { + transition: transform 0.3s ease-out; + transform: translate(0, -50px); } + @media (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition: none; } } + .modal.show .modal-dialog { + transform: none; } + .modal.modal-static .modal-dialog { + transform: scale(1.02); } + +.modal-dialog-scrollable { + height: calc(100% - var(--bs-modal-margin) * 2); } + .modal-dialog-scrollable .modal-content { + max-height: 100%; + overflow: hidden; } + .modal-dialog-scrollable .modal-body { + overflow-y: auto; } + +.modal-dialog-centered { + display: flex; + align-items: center; + min-height: calc(100% - var(--bs-modal-margin) * 2); } + +.modal-content { + position: relative; + display: flex; + flex-direction: column; + width: 100%; + color: var(--bs-modal-color); + pointer-events: auto; + background-color: var(--bs-modal-bg); + background-clip: padding-box; + border: var(--bs-modal-border-width) solid var(--bs-modal-border-color); + border-radius: var(--bs-modal-border-radius); + outline: 0; } + +.modal-backdrop { + --bs-backdrop-zindex: 1050; + --bs-backdrop-bg: #000; + --bs-backdrop-opacity: 0.5; + position: fixed; + top: 0; + left: 0; + z-index: var(--bs-backdrop-zindex); + width: 100vw; + height: 100vh; + background-color: var(--bs-backdrop-bg); } + .modal-backdrop.fade { + opacity: 0; } + .modal-backdrop.show { + opacity: var(--bs-backdrop-opacity); } + +.modal-header { + display: flex; + flex-shrink: 0; + align-items: center; + padding: var(--bs-modal-header-padding); + border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color); + border-top-left-radius: var(--bs-modal-inner-border-radius); + border-top-right-radius: var(--bs-modal-inner-border-radius); } + .modal-header .btn-close { + padding: calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5); + margin: calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto; } + +.modal-title { + margin-bottom: 0; + line-height: var(--bs-modal-title-line-height); } + +.modal-body { + position: relative; + flex: 1 1 auto; + padding: var(--bs-modal-padding); } + +.modal-footer { + display: flex; + flex-shrink: 0; + flex-wrap: wrap; + align-items: center; + justify-content: flex-end; + padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5); + background-color: var(--bs-modal-footer-bg); + border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color); + border-bottom-right-radius: var(--bs-modal-inner-border-radius); + border-bottom-left-radius: var(--bs-modal-inner-border-radius); } + .modal-footer > * { + margin: calc(var(--bs-modal-footer-gap) * .5); } + +@media (min-width: 576px) { + .modal { + --bs-modal-margin: 1.75rem; + --bs-modal-box-shadow: var(--bs-box-shadow); } + .modal-dialog { + max-width: var(--bs-modal-width); + margin-right: auto; + margin-left: auto; } + .modal-sm { + --bs-modal-width: 300px; } } + +@media (min-width: 992px) { + .modal-lg, + .modal-xl { + --bs-modal-width: 800px; } } + +@media (min-width: 1200px) { + .modal-xl { + --bs-modal-width: 1140px; } } + +.modal-fullscreen { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen .modal-header, + .modal-fullscreen .modal-footer { + border-radius: 0; } + .modal-fullscreen .modal-body { + overflow-y: auto; } + +@media (max-width: 575.98px) { + .modal-fullscreen-sm-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-sm-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-sm-down .modal-header, + .modal-fullscreen-sm-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-sm-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 767.98px) { + .modal-fullscreen-md-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-md-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-md-down .modal-header, + .modal-fullscreen-md-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-md-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 991.98px) { + .modal-fullscreen-lg-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-lg-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-lg-down .modal-header, + .modal-fullscreen-lg-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-lg-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 1199.98px) { + .modal-fullscreen-xl-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-xl-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-xl-down .modal-header, + .modal-fullscreen-xl-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-xl-down .modal-body { + overflow-y: auto; } } + +@media (max-width: 1399.98px) { + .modal-fullscreen-xxl-down { + width: 100vw; + max-width: none; + height: 100%; + margin: 0; } + .modal-fullscreen-xxl-down .modal-content { + height: 100%; + border: 0; + border-radius: 0; } + .modal-fullscreen-xxl-down .modal-header, + .modal-fullscreen-xxl-down .modal-footer { + border-radius: 0; } + .modal-fullscreen-xxl-down .modal-body { + overflow-y: auto; } } + +.tooltip { + --bs-tooltip-zindex: 1080; + --bs-tooltip-max-width: 200px; + --bs-tooltip-padding-x: 0.5rem; + --bs-tooltip-padding-y: 0.25rem; + --bs-tooltip-margin: ; + --bs-tooltip-font-size: 0.875rem; + --bs-tooltip-color: var(--bs-body-bg); + --bs-tooltip-bg: var(--bs-emphasis-color); + --bs-tooltip-border-radius: var(--bs-border-radius); + --bs-tooltip-opacity: 0.9; + --bs-tooltip-arrow-width: 0.8rem; + --bs-tooltip-arrow-height: 0.4rem; + z-index: var(--bs-tooltip-zindex); + display: block; + margin: var(--bs-tooltip-margin); + font-family: var(--bs-font-sans-serif); + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + white-space: normal; + word-spacing: normal; + line-break: auto; + font-size: var(--bs-tooltip-font-size); + word-wrap: break-word; + opacity: 0; } + .tooltip.show { + opacity: var(--bs-tooltip-opacity); } + .tooltip .tooltip-arrow { + display: block; + width: var(--bs-tooltip-arrow-width); + height: var(--bs-tooltip-arrow-height); } + .tooltip .tooltip-arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; } + +.bs-tooltip-top .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="top"] .tooltip-arrow { + bottom: calc(-1 * var(--bs-tooltip-arrow-height)); } + .bs-tooltip-top .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="top"] .tooltip-arrow::before { + top: -1px; + border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0; + border-top-color: var(--bs-tooltip-bg); } + +/* rtl:begin:ignore */ +.bs-tooltip-end .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="right"] .tooltip-arrow { + left: calc(-1 * var(--bs-tooltip-arrow-height)); + width: var(--bs-tooltip-arrow-height); + height: var(--bs-tooltip-arrow-width); } + .bs-tooltip-end .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="right"] .tooltip-arrow::before { + right: -1px; + border-width: calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0; + border-right-color: var(--bs-tooltip-bg); } + +/* rtl:end:ignore */ +.bs-tooltip-bottom .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="bottom"] .tooltip-arrow { + top: calc(-1 * var(--bs-tooltip-arrow-height)); } + .bs-tooltip-bottom .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="bottom"] .tooltip-arrow::before { + bottom: -1px; + border-width: 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height); + border-bottom-color: var(--bs-tooltip-bg); } + +/* rtl:begin:ignore */ +.bs-tooltip-start .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^="left"] .tooltip-arrow { + right: calc(-1 * var(--bs-tooltip-arrow-height)); + width: var(--bs-tooltip-arrow-height); + height: var(--bs-tooltip-arrow-width); } + .bs-tooltip-start .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^="left"] .tooltip-arrow::before { + left: -1px; + border-width: calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height); + border-left-color: var(--bs-tooltip-bg); } + +/* rtl:end:ignore */ +.tooltip-inner { + max-width: var(--bs-tooltip-max-width); + padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x); + color: var(--bs-tooltip-color); + text-align: center; + background-color: var(--bs-tooltip-bg); + border-radius: var(--bs-tooltip-border-radius); } + +.popover { + --bs-popover-zindex: 1070; + --bs-popover-max-width: 276px; + --bs-popover-font-size: 0.875rem; + --bs-popover-bg: var(--bs-body-bg); + --bs-popover-border-width: var(--bs-border-width); + --bs-popover-border-color: var(--bs-border-color-translucent); + --bs-popover-border-radius: var(--bs-border-radius-lg); + --bs-popover-inner-border-radius: calc(var(--bs-border-radius-lg) - var(--bs-border-width)); + --bs-popover-box-shadow: var(--bs-box-shadow); + --bs-popover-header-padding-x: 1rem; + --bs-popover-header-padding-y: 0.5rem; + --bs-popover-header-font-size: 1rem; + --bs-popover-header-color: inherit; + --bs-popover-header-bg: var(--bs-secondary-bg); + --bs-popover-body-padding-x: 1rem; + --bs-popover-body-padding-y: 1rem; + --bs-popover-body-color: var(--bs-body-color); + --bs-popover-arrow-width: 1rem; + --bs-popover-arrow-height: 0.5rem; + --bs-popover-arrow-border: var(--bs-popover-border-color); + z-index: var(--bs-popover-zindex); + display: block; + max-width: var(--bs-popover-max-width); + font-family: var(--bs-font-sans-serif); + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + white-space: normal; + word-spacing: normal; + line-break: auto; + font-size: var(--bs-popover-font-size); + word-wrap: break-word; + background-color: var(--bs-popover-bg); + background-clip: padding-box; + border: var(--bs-popover-border-width) solid var(--bs-popover-border-color); + border-radius: var(--bs-popover-border-radius); } + .popover .popover-arrow { + display: block; + width: var(--bs-popover-arrow-width); + height: var(--bs-popover-arrow-height); } + .popover .popover-arrow::before, .popover .popover-arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; + border-width: 0; } + +.bs-popover-top > .popover-arrow, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow { + bottom: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); } + .bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::after { + border-width: var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0; } + .bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::before { + bottom: 0; + border-top-color: var(--bs-popover-arrow-border); } + .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="top"] > .popover-arrow::after { + bottom: var(--bs-popover-border-width); + border-top-color: var(--bs-popover-bg); } + +/* rtl:begin:ignore */ +.bs-popover-end > .popover-arrow, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow { + left: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); + width: var(--bs-popover-arrow-height); + height: var(--bs-popover-arrow-width); } + .bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::after { + border-width: calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0; } + .bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::before { + left: 0; + border-right-color: var(--bs-popover-arrow-border); } + .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="right"] > .popover-arrow::after { + left: var(--bs-popover-border-width); + border-right-color: var(--bs-popover-bg); } + +/* rtl:end:ignore */ +.bs-popover-bottom > .popover-arrow, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow { + top: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); } + .bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::after { + border-width: 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height); } + .bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::before { + top: 0; + border-bottom-color: var(--bs-popover-arrow-border); } + .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="bottom"] > .popover-arrow::after { + top: var(--bs-popover-border-width); + border-bottom-color: var(--bs-popover-bg); } + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[data-popper-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + left: 50%; + display: block; + width: var(--bs-popover-arrow-width); + margin-left: calc(-.5 * var(--bs-popover-arrow-width)); + content: ""; + border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg); } + +/* rtl:begin:ignore */ +.bs-popover-start > .popover-arrow, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow { + right: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); + width: var(--bs-popover-arrow-height); + height: var(--bs-popover-arrow-width); } + .bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::after { + border-width: calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height); } + .bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::before { + right: 0; + border-left-color: var(--bs-popover-arrow-border); } + .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^="left"] > .popover-arrow::after { + right: var(--bs-popover-border-width); + border-left-color: var(--bs-popover-bg); } + +/* rtl:end:ignore */ +.popover-header { + padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x); + margin-bottom: 0; + font-size: var(--bs-popover-header-font-size); + color: var(--bs-popover-header-color); + background-color: var(--bs-popover-header-bg); + border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color); + border-top-left-radius: var(--bs-popover-inner-border-radius); + border-top-right-radius: var(--bs-popover-inner-border-radius); } + .popover-header:empty { + display: none; } + +.popover-body { + padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x); + color: var(--bs-popover-body-color); } + +.carousel { + position: relative; } + +.carousel.pointer-event { + touch-action: pan-y; } + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; } + .carousel-inner::after { + display: block; + clear: both; + content: ""; } + +.carousel-item { + position: relative; + display: none; + float: left; + width: 100%; + margin-right: -100%; + backface-visibility: hidden; + transition: transform 0.6s ease-in-out; } + @media (prefers-reduced-motion: reduce) { + .carousel-item { + transition: none; } } +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; } + +.carousel-item-next:not(.carousel-item-start), +.active.carousel-item-end { + transform: translateX(100%); } + +.carousel-item-prev:not(.carousel-item-end), +.active.carousel-item-start { + transform: translateX(-100%); } + +.carousel-fade .carousel-item { + opacity: 0; + transition-property: opacity; + transform: none; } + +.carousel-fade .carousel-item.active, +.carousel-fade .carousel-item-next.carousel-item-start, +.carousel-fade .carousel-item-prev.carousel-item-end { + z-index: 1; + opacity: 1; } + +.carousel-fade .active.carousel-item-start, +.carousel-fade .active.carousel-item-end { + z-index: 0; + opacity: 0; + transition: opacity 0s 0.6s; } + @media (prefers-reduced-motion: reduce) { + .carousel-fade .active.carousel-item-start, + .carousel-fade .active.carousel-item-end { + transition: none; } } +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + z-index: 1; + display: flex; + align-items: center; + justify-content: center; + width: 15%; + padding: 0; + color: #fff; + text-align: center; + background: none; + border: 0; + opacity: 0.5; + transition: opacity 0.15s ease; } + @media (prefers-reduced-motion: reduce) { + .carousel-control-prev, + .carousel-control-next { + transition: none; } } + .carousel-control-prev:hover, .carousel-control-prev:focus, + .carousel-control-next:hover, + .carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: 0.9; } + +.carousel-control-prev { + left: 0; } + +.carousel-control-next { + right: 0; } + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 2rem; + height: 2rem; + background-repeat: no-repeat; + background-position: 50%; + background-size: 100% 100%; } + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e") /*rtl:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")*/; } + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e") /*rtl:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")*/; } + +.carousel-indicators { + position: absolute; + right: 0; + bottom: 0; + left: 0; + z-index: 2; + display: flex; + justify-content: center; + padding: 0; + margin-right: 15%; + margin-bottom: 1rem; + margin-left: 15%; } + .carousel-indicators [data-bs-target] { + box-sizing: content-box; + flex: 0 1 auto; + width: 30px; + height: 3px; + padding: 0; + margin-right: 3px; + margin-left: 3px; + text-indent: -999px; + cursor: pointer; + background-color: #fff; + background-clip: padding-box; + border: 0; + border-top: 10px solid transparent; + border-bottom: 10px solid transparent; + opacity: 0.5; + transition: opacity 0.6s ease; } + @media (prefers-reduced-motion: reduce) { + .carousel-indicators [data-bs-target] { + transition: none; } } + .carousel-indicators .active { + opacity: 1; } + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 1.25rem; + left: 15%; + padding-top: 1.25rem; + padding-bottom: 1.25rem; + color: #fff; + text-align: center; } + +.carousel-dark .carousel-control-prev-icon, +.carousel-dark .carousel-control-next-icon { + filter: invert(1) grayscale(100); } + +.carousel-dark .carousel-indicators [data-bs-target] { + background-color: #000; } + +.carousel-dark .carousel-caption { + color: #000; } + +[data-bs-theme="dark"] .carousel .carousel-control-prev-icon, +[data-bs-theme="dark"] .carousel .carousel-control-next-icon, [data-bs-theme="dark"].carousel .carousel-control-prev-icon, +[data-bs-theme="dark"].carousel .carousel-control-next-icon { + filter: invert(1) grayscale(100); } + +[data-bs-theme="dark"] .carousel .carousel-indicators [data-bs-target], [data-bs-theme="dark"].carousel .carousel-indicators [data-bs-target] { + background-color: #000; } + +[data-bs-theme="dark"] .carousel .carousel-caption, [data-bs-theme="dark"].carousel .carousel-caption { + color: #000; } + +.spinner-grow, +.spinner-border { + display: inline-block; + width: var(--bs-spinner-width); + height: var(--bs-spinner-height); + vertical-align: var(--bs-spinner-vertical-align); + border-radius: 50%; + animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name); } + +@keyframes spinner-border { + to { + transform: rotate(360deg) /* rtl:ignore */; } } + +.spinner-border { + --bs-spinner-width: 2rem; + --bs-spinner-height: 2rem; + --bs-spinner-vertical-align: -0.125em; + --bs-spinner-border-width: 0.25em; + --bs-spinner-animation-speed: 0.75s; + --bs-spinner-animation-name: spinner-border; + border: var(--bs-spinner-border-width) solid currentcolor; + border-right-color: transparent; } + +.spinner-border-sm { + --bs-spinner-width: 1rem; + --bs-spinner-height: 1rem; + --bs-spinner-border-width: 0.2em; } + +@keyframes spinner-grow { + 0% { + transform: scale(0); } + 50% { + opacity: 1; + transform: none; } } + +.spinner-grow { + --bs-spinner-width: 2rem; + --bs-spinner-height: 2rem; + --bs-spinner-vertical-align: -0.125em; + --bs-spinner-animation-speed: 0.75s; + --bs-spinner-animation-name: spinner-grow; + background-color: currentcolor; + opacity: 0; } + +.spinner-grow-sm { + --bs-spinner-width: 1rem; + --bs-spinner-height: 1rem; } + +@media (prefers-reduced-motion: reduce) { + .spinner-border, + .spinner-grow { + --bs-spinner-animation-speed: 1.5s; } } + +.offcanvas, .offcanvas-xxl, .offcanvas-xl, .offcanvas-lg, .offcanvas-md, .offcanvas-sm { + --bs-offcanvas-zindex: 1045; + --bs-offcanvas-width: 332px; + --bs-offcanvas-height: 30vh; + --bs-offcanvas-padding-x: 1rem; + --bs-offcanvas-padding-y: 1rem; + --bs-offcanvas-color: var(--bs-body-color); + --bs-offcanvas-bg: var(--bs-body-bg); + --bs-offcanvas-border-width: var(--bs-border-width); + --bs-offcanvas-border-color: var(--bs-border-color-translucent); + --bs-offcanvas-box-shadow: var(--bs-box-shadow-sm); + --bs-offcanvas-transition: transform 0.3s ease-in-out; + --bs-offcanvas-title-line-height: 1.5; } + +@media (max-width: 575.98px) { + .offcanvas-sm { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: var(--bs-offcanvas-transition); } } + @media (max-width: 575.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-sm { + transition: none; } } +@media (max-width: 575.98px) { + .offcanvas-sm.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-sm.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-sm.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-sm.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-sm.showing, .offcanvas-sm.show:not(.hiding) { + transform: none; } + .offcanvas-sm.showing, .offcanvas-sm.hiding, .offcanvas-sm.show { + visibility: visible; } } + +@media (min-width: 576px) { + .offcanvas-sm { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-sm .offcanvas-header { + display: none; } + .offcanvas-sm .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 767.98px) { + .offcanvas-md { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: var(--bs-offcanvas-transition); } } + @media (max-width: 767.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-md { + transition: none; } } +@media (max-width: 767.98px) { + .offcanvas-md.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-md.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-md.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-md.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-md.showing, .offcanvas-md.show:not(.hiding) { + transform: none; } + .offcanvas-md.showing, .offcanvas-md.hiding, .offcanvas-md.show { + visibility: visible; } } + +@media (min-width: 768px) { + .offcanvas-md { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-md .offcanvas-header { + display: none; } + .offcanvas-md .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 991.98px) { + .offcanvas-lg { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: var(--bs-offcanvas-transition); } } + @media (max-width: 991.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-lg { + transition: none; } } +@media (max-width: 991.98px) { + .offcanvas-lg.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-lg.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-lg.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-lg.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-lg.showing, .offcanvas-lg.show:not(.hiding) { + transform: none; } + .offcanvas-lg.showing, .offcanvas-lg.hiding, .offcanvas-lg.show { + visibility: visible; } } + +@media (min-width: 992px) { + .offcanvas-lg { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-lg .offcanvas-header { + display: none; } + .offcanvas-lg .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 1199.98px) { + .offcanvas-xl { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: var(--bs-offcanvas-transition); } } + @media (max-width: 1199.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-xl { + transition: none; } } +@media (max-width: 1199.98px) { + .offcanvas-xl.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-xl.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-xl.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-xl.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-xl.showing, .offcanvas-xl.show:not(.hiding) { + transform: none; } + .offcanvas-xl.showing, .offcanvas-xl.hiding, .offcanvas-xl.show { + visibility: visible; } } + +@media (min-width: 1200px) { + .offcanvas-xl { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-xl .offcanvas-header { + display: none; } + .offcanvas-xl .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +@media (max-width: 1399.98px) { + .offcanvas-xxl { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: var(--bs-offcanvas-transition); } } + @media (max-width: 1399.98px) and (prefers-reduced-motion: reduce) { + .offcanvas-xxl { + transition: none; } } +@media (max-width: 1399.98px) { + .offcanvas-xxl.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas-xxl.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas-xxl.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas-xxl.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas-xxl.showing, .offcanvas-xxl.show:not(.hiding) { + transform: none; } + .offcanvas-xxl.showing, .offcanvas-xxl.hiding, .offcanvas-xxl.show { + visibility: visible; } } + +@media (min-width: 1400px) { + .offcanvas-xxl { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color: transparent !important; } + .offcanvas-xxl .offcanvas-header { + display: none; } + .offcanvas-xxl .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color: transparent !important; } } + +.offcanvas { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition: var(--bs-offcanvas-transition); } + @media (prefers-reduced-motion: reduce) { + .offcanvas { + transition: none; } } + .offcanvas.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(-100%); } + .offcanvas.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateX(100%); } + .offcanvas.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(-100%); } + .offcanvas.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform: translateY(100%); } + .offcanvas.showing, .offcanvas.show:not(.hiding) { + transform: none; } + .offcanvas.showing, .offcanvas.hiding, .offcanvas.show { + visibility: visible; } + +.offcanvas-backdrop { + position: fixed; + top: 0; + left: 0; + z-index: 1040; + width: 100vw; + height: 100vh; + background-color: #000; } + .offcanvas-backdrop.fade { + opacity: 0; } + .offcanvas-backdrop.show { + opacity: 0.5; } + +.offcanvas-header { + display: flex; + align-items: center; + padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x); } + .offcanvas-header .btn-close { + padding: calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5); + margin: calc(-.5 * var(--bs-offcanvas-padding-y)) calc(-.5 * var(--bs-offcanvas-padding-x)) calc(-.5 * var(--bs-offcanvas-padding-y)) auto; } + +.offcanvas-title { + margin-bottom: 0; + line-height: var(--bs-offcanvas-title-line-height); } + +.offcanvas-body { + flex-grow: 1; + padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x); + overflow-y: auto; } + +.placeholder { + display: inline-block; + min-height: 1em; + vertical-align: middle; + cursor: wait; + background-color: currentcolor; + opacity: 0.5; } + .placeholder.btn::before, .search-form .placeholder.search-submit::before, .comment-form input.placeholder[type="submit"]::before { + display: inline-block; + content: ""; } + +.placeholder-xs { + min-height: .6em; } + +.placeholder-sm { + min-height: .8em; } + +.placeholder-lg { + min-height: 1.2em; } + +.placeholder-glow .placeholder { + animation: placeholder-glow 2s ease-in-out infinite; } + +@keyframes placeholder-glow { + 50% { + opacity: 0.2; } } + +.placeholder-wave { + mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%); + mask-size: 200% 100%; + animation: placeholder-wave 2s linear infinite; } + +@keyframes placeholder-wave { + 100% { + mask-position: -200% 0%; } } + +.align-baseline { + vertical-align: baseline !important; } + +.align-top { + vertical-align: top !important; } + +.align-middle { + vertical-align: middle !important; } + +.align-bottom { + vertical-align: bottom !important; } + +.align-text-bottom { + vertical-align: text-bottom !important; } + +.align-text-top { + vertical-align: text-top !important; } + +.float-start { + float: left !important; } + +.float-end { + float: right !important; } + +.float-none { + float: none !important; } + +.object-fit-contain { + object-fit: contain !important; } + +.object-fit-cover { + object-fit: cover !important; } + +.object-fit-fill { + object-fit: fill !important; } + +.object-fit-scale { + object-fit: scale-down !important; } + +.object-fit-none { + object-fit: none !important; } + +.opacity-0 { + opacity: 0 !important; } + +.opacity-25 { + opacity: 0.25 !important; } + +.opacity-50 { + opacity: 0.5 !important; } + +.opacity-75 { + opacity: 0.75 !important; } + +.opacity-100 { + opacity: 1 !important; } + +.overflow-auto { + overflow: auto !important; } + +.overflow-hidden { + overflow: hidden !important; } + +.overflow-visible { + overflow: visible !important; } + +.overflow-scroll { + overflow: scroll !important; } + +.overflow-x-auto { + overflow-x: auto !important; } + +.overflow-x-hidden { + overflow-x: hidden !important; } + +.overflow-x-visible { + overflow-x: visible !important; } + +.overflow-x-scroll { + overflow-x: scroll !important; } + +.overflow-y-auto { + overflow-y: auto !important; } + +.overflow-y-hidden { + overflow-y: hidden !important; } + +.overflow-y-visible { + overflow-y: visible !important; } + +.overflow-y-scroll { + overflow-y: scroll !important; } + +.d-inline { + display: inline !important; } + +.d-inline-block { + display: inline-block !important; } + +.d-block { + display: block !important; } + +.d-grid { + display: grid !important; } + +.d-inline-grid { + display: inline-grid !important; } + +.d-table { + display: table !important; } + +.d-table-row { + display: table-row !important; } + +.d-table-cell { + display: table-cell !important; } + +.d-flex { + display: flex !important; } + +.d-inline-flex { + display: inline-flex !important; } + +.d-none { + display: none !important; } + +.shadow { + box-shadow: var(--bs-box-shadow) !important; } + +.shadow-sm { + box-shadow: var(--bs-box-shadow-sm) !important; } + +.shadow-lg { + box-shadow: var(--bs-box-shadow-lg) !important; } + +.shadow-none { + box-shadow: none !important; } + +.focus-ring-primary { + --bs-focus-ring-color: rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-secondary { + --bs-focus-ring-color: rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-success { + --bs-focus-ring-color: rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-info { + --bs-focus-ring-color: rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-warning { + --bs-focus-ring-color: rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-danger { + --bs-focus-ring-color: rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-light { + --bs-focus-ring-color: rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity)); } + +.focus-ring-dark { + --bs-focus-ring-color: rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity)); } + +.position-static { + position: static !important; } + +.position-relative { + position: relative !important; } + +.position-absolute { + position: absolute !important; } + +.position-fixed { + position: fixed !important; } + +.position-sticky { + position: sticky !important; } + +.top-0 { + top: 0 !important; } + +.top-50 { + top: 50% !important; } + +.top-100 { + top: 100% !important; } + +.bottom-0 { + bottom: 0 !important; } + +.bottom-50 { + bottom: 50% !important; } + +.bottom-100 { + bottom: 100% !important; } + +.start-0 { + left: 0 !important; } + +.start-50 { + left: 50% !important; } + +.start-100 { + left: 100% !important; } + +.end-0 { + right: 0 !important; } + +.end-50 { + right: 50% !important; } + +.end-100 { + right: 100% !important; } + +.translate-middle { + transform: translate(-50%, -50%) !important; } + +.translate-middle-x { + transform: translateX(-50%) !important; } + +.translate-middle-y { + transform: translateY(-50%) !important; } + +.border { + border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-0 { + border: 0 !important; } + +.border-top { + border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-top-0 { + border-top: 0 !important; } + +.border-end { + border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-end-0 { + border-right: 0 !important; } + +.border-bottom { + border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-bottom-0 { + border-bottom: 0 !important; } + +.border-start { + border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important; } + +.border-start-0 { + border-left: 0 !important; } + +.border-primary { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important; } + +.border-secondary { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important; } + +.border-success { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important; } + +.border-info { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important; } + +.border-warning { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important; } + +.border-danger { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important; } + +.border-light { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important; } + +.border-dark { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important; } + +.border-black { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-black-rgb), var(--bs-border-opacity)) !important; } + +.border-white { + --bs-border-opacity: 1; + border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important; } + +.border-primary-subtle { + border-color: var(--bs-primary-border-subtle) !important; } + +.border-secondary-subtle { + border-color: var(--bs-secondary-border-subtle) !important; } + +.border-success-subtle { + border-color: var(--bs-success-border-subtle) !important; } + +.border-info-subtle { + border-color: var(--bs-info-border-subtle) !important; } + +.border-warning-subtle { + border-color: var(--bs-warning-border-subtle) !important; } + +.border-danger-subtle { + border-color: var(--bs-danger-border-subtle) !important; } + +.border-light-subtle { + border-color: var(--bs-light-border-subtle) !important; } + +.border-dark-subtle { + border-color: var(--bs-dark-border-subtle) !important; } + +.border-1 { + border-width: 1px !important; } + +.border-2 { + border-width: 2px !important; } + +.border-3 { + border-width: 3px !important; } + +.border-4 { + border-width: 4px !important; } + +.border-5 { + border-width: 5px !important; } + +.border-opacity-10 { + --bs-border-opacity: 0.1; } + +.border-opacity-25 { + --bs-border-opacity: 0.25; } + +.border-opacity-50 { + --bs-border-opacity: 0.5; } + +.border-opacity-75 { + --bs-border-opacity: 0.75; } + +.border-opacity-100 { + --bs-border-opacity: 1; } + +.w-25 { + width: 25% !important; } + +.w-50 { + width: 50% !important; } + +.w-75 { + width: 75% !important; } + +.w-100 { + width: 100% !important; } + +.w-auto { + width: auto !important; } + +.mw-100 { + max-width: 100% !important; } + +.vw-100 { + width: 100vw !important; } + +.min-vw-100 { + min-width: 100vw !important; } + +.h-25 { + height: 25% !important; } + +.h-50 { + height: 50% !important; } + +.h-75 { + height: 75% !important; } + +.h-100 { + height: 100% !important; } + +.h-auto { + height: auto !important; } + +.mh-100 { + max-height: 100% !important; } + +.vh-100 { + height: 100vh !important; } + +.min-vh-100 { + min-height: 100vh !important; } + +.flex-fill { + flex: 1 1 auto !important; } + +.flex-row { + flex-direction: row !important; } + +.flex-column { + flex-direction: column !important; } + +.flex-row-reverse { + flex-direction: row-reverse !important; } + +.flex-column-reverse { + flex-direction: column-reverse !important; } + +.flex-grow-0 { + flex-grow: 0 !important; } + +.flex-grow-1 { + flex-grow: 1 !important; } + +.flex-shrink-0 { + flex-shrink: 0 !important; } + +.flex-shrink-1 { + flex-shrink: 1 !important; } + +.flex-wrap { + flex-wrap: wrap !important; } + +.flex-nowrap { + flex-wrap: nowrap !important; } + +.flex-wrap-reverse { + flex-wrap: wrap-reverse !important; } + +.justify-content-start { + justify-content: flex-start !important; } + +.justify-content-end { + justify-content: flex-end !important; } + +.justify-content-center { + justify-content: center !important; } + +.justify-content-between { + justify-content: space-between !important; } + +.justify-content-around { + justify-content: space-around !important; } + +.justify-content-evenly { + justify-content: space-evenly !important; } + +.align-items-start { + align-items: flex-start !important; } + +.align-items-end { + align-items: flex-end !important; } + +.align-items-center { + align-items: center !important; } + +.align-items-baseline { + align-items: baseline !important; } + +.align-items-stretch { + align-items: stretch !important; } + +.align-content-start { + align-content: flex-start !important; } + +.align-content-end { + align-content: flex-end !important; } + +.align-content-center { + align-content: center !important; } + +.align-content-between { + align-content: space-between !important; } + +.align-content-around { + align-content: space-around !important; } + +.align-content-stretch { + align-content: stretch !important; } + +.align-self-auto { + align-self: auto !important; } + +.align-self-start { + align-self: flex-start !important; } + +.align-self-end { + align-self: flex-end !important; } + +.align-self-center { + align-self: center !important; } + +.align-self-baseline { + align-self: baseline !important; } + +.align-self-stretch { + align-self: stretch !important; } + +.order-first { + order: -1 !important; } + +.order-0 { + order: 0 !important; } + +.order-1 { + order: 1 !important; } + +.order-2 { + order: 2 !important; } + +.order-3 { + order: 3 !important; } + +.order-4 { + order: 4 !important; } + +.order-5 { + order: 5 !important; } + +.order-last { + order: 6 !important; } + +.m-0 { + margin: 0 !important; } + +.m-1 { + margin: 0.25rem !important; } + +.m-2 { + margin: 0.5rem !important; } + +.m-3 { + margin: 1rem !important; } + +.m-4 { + margin: 1.5rem !important; } + +.m-5 { + margin: 3rem !important; } + +.m-auto { + margin: auto !important; } + +.mx-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + +.mx-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + +.mx-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + +.mx-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + +.mx-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + +.mx-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + +.mx-auto { + margin-right: auto !important; + margin-left: auto !important; } + +.my-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + +.my-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + +.my-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + +.my-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + +.my-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + +.my-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + +.my-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + +.mt-0 { + margin-top: 0 !important; } + +.mt-1 { + margin-top: 0.25rem !important; } + +.mt-2 { + margin-top: 0.5rem !important; } + +.mt-3 { + margin-top: 1rem !important; } + +.mt-4 { + margin-top: 1.5rem !important; } + +.mt-5 { + margin-top: 3rem !important; } + +.mt-auto { + margin-top: auto !important; } + +.me-0 { + margin-right: 0 !important; } + +.me-1 { + margin-right: 0.25rem !important; } + +.me-2 { + margin-right: 0.5rem !important; } + +.me-3 { + margin-right: 1rem !important; } + +.me-4 { + margin-right: 1.5rem !important; } + +.me-5 { + margin-right: 3rem !important; } + +.me-auto { + margin-right: auto !important; } + +.mb-0 { + margin-bottom: 0 !important; } + +.mb-1 { + margin-bottom: 0.25rem !important; } + +.mb-2 { + margin-bottom: 0.5rem !important; } + +.mb-3 { + margin-bottom: 1rem !important; } + +.mb-4 { + margin-bottom: 1.5rem !important; } + +.mb-5 { + margin-bottom: 3rem !important; } + +.mb-auto { + margin-bottom: auto !important; } + +.ms-0 { + margin-left: 0 !important; } + +.ms-1 { + margin-left: 0.25rem !important; } + +.ms-2 { + margin-left: 0.5rem !important; } + +.ms-3 { + margin-left: 1rem !important; } + +.ms-4 { + margin-left: 1.5rem !important; } + +.ms-5 { + margin-left: 3rem !important; } + +.ms-auto { + margin-left: auto !important; } + +.m-n1 { + margin: -0.25rem !important; } + +.m-n2 { + margin: -0.5rem !important; } + +.m-n3 { + margin: -1rem !important; } + +.m-n4 { + margin: -1.5rem !important; } + +.m-n5 { + margin: -3rem !important; } + +.mx-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + +.mx-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + +.mx-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + +.mx-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + +.mx-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + +.my-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + +.my-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + +.my-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + +.my-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + +.my-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + +.mt-n1 { + margin-top: -0.25rem !important; } + +.mt-n2 { + margin-top: -0.5rem !important; } + +.mt-n3 { + margin-top: -1rem !important; } + +.mt-n4 { + margin-top: -1.5rem !important; } + +.mt-n5 { + margin-top: -3rem !important; } + +.me-n1 { + margin-right: -0.25rem !important; } + +.me-n2 { + margin-right: -0.5rem !important; } + +.me-n3 { + margin-right: -1rem !important; } + +.me-n4 { + margin-right: -1.5rem !important; } + +.me-n5 { + margin-right: -3rem !important; } + +.mb-n1 { + margin-bottom: -0.25rem !important; } + +.mb-n2 { + margin-bottom: -0.5rem !important; } + +.mb-n3 { + margin-bottom: -1rem !important; } + +.mb-n4 { + margin-bottom: -1.5rem !important; } + +.mb-n5 { + margin-bottom: -3rem !important; } + +.ms-n1 { + margin-left: -0.25rem !important; } + +.ms-n2 { + margin-left: -0.5rem !important; } + +.ms-n3 { + margin-left: -1rem !important; } + +.ms-n4 { + margin-left: -1.5rem !important; } + +.ms-n5 { + margin-left: -3rem !important; } + +.p-0 { + padding: 0 !important; } + +.p-1 { + padding: 0.25rem !important; } + +.p-2 { + padding: 0.5rem !important; } + +.p-3 { + padding: 1rem !important; } + +.p-4 { + padding: 1.5rem !important; } + +.p-5 { + padding: 3rem !important; } + +.px-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + +.px-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + +.px-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + +.px-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + +.px-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + +.px-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + +.py-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + +.py-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + +.py-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + +.py-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + +.py-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + +.py-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + +.pt-0 { + padding-top: 0 !important; } + +.pt-1 { + padding-top: 0.25rem !important; } + +.pt-2 { + padding-top: 0.5rem !important; } + +.pt-3 { + padding-top: 1rem !important; } + +.pt-4 { + padding-top: 1.5rem !important; } + +.pt-5 { + padding-top: 3rem !important; } + +.pe-0 { + padding-right: 0 !important; } + +.pe-1 { + padding-right: 0.25rem !important; } + +.pe-2 { + padding-right: 0.5rem !important; } + +.pe-3 { + padding-right: 1rem !important; } + +.pe-4 { + padding-right: 1.5rem !important; } + +.pe-5 { + padding-right: 3rem !important; } + +.pb-0 { + padding-bottom: 0 !important; } + +.pb-1 { + padding-bottom: 0.25rem !important; } + +.pb-2 { + padding-bottom: 0.5rem !important; } + +.pb-3 { + padding-bottom: 1rem !important; } + +.pb-4 { + padding-bottom: 1.5rem !important; } + +.pb-5 { + padding-bottom: 3rem !important; } + +.ps-0 { + padding-left: 0 !important; } + +.ps-1 { + padding-left: 0.25rem !important; } + +.ps-2 { + padding-left: 0.5rem !important; } + +.ps-3 { + padding-left: 1rem !important; } + +.ps-4 { + padding-left: 1.5rem !important; } + +.ps-5 { + padding-left: 3rem !important; } + +.gap-0 { + gap: 0 !important; } + +.gap-1 { + gap: 0.25rem !important; } + +.gap-2 { + gap: 0.5rem !important; } + +.gap-3 { + gap: 1rem !important; } + +.gap-4 { + gap: 1.5rem !important; } + +.gap-5 { + gap: 3rem !important; } + +.row-gap-0 { + row-gap: 0 !important; } + +.row-gap-1 { + row-gap: 0.25rem !important; } + +.row-gap-2 { + row-gap: 0.5rem !important; } + +.row-gap-3 { + row-gap: 1rem !important; } + +.row-gap-4 { + row-gap: 1.5rem !important; } + +.row-gap-5 { + row-gap: 3rem !important; } + +.column-gap-0 { + column-gap: 0 !important; } + +.column-gap-1 { + column-gap: 0.25rem !important; } + +.column-gap-2 { + column-gap: 0.5rem !important; } + +.column-gap-3 { + column-gap: 1rem !important; } + +.column-gap-4 { + column-gap: 1.5rem !important; } + +.column-gap-5 { + column-gap: 3rem !important; } + +.font-monospace { + font-family: var(--bs-font-monospace) !important; } + +.fs-1 { + font-size: calc(1.375rem + 1.5vw) !important; } + +.fs-2 { + font-size: calc(1.325rem + 0.9vw) !important; } + +.fs-3 { + font-size: calc(1.3rem + 0.6vw) !important; } + +.fs-4 { + font-size: calc(1.275rem + 0.3vw) !important; } + +.fs-5 { + font-size: 1.25rem !important; } + +.fs-6 { + font-size: 1rem !important; } + +.fst-italic { + font-style: italic !important; } + +.fst-normal { + font-style: normal !important; } + +.fw-lighter { + font-weight: lighter !important; } + +.fw-light { + font-weight: 300 !important; } + +.fw-normal { + font-weight: 400 !important; } + +.fw-medium { + font-weight: 500 !important; } + +.fw-semibold { + font-weight: 600 !important; } + +.fw-bold { + font-weight: 700 !important; } + +.fw-bolder { + font-weight: bolder !important; } + +.lh-1 { + line-height: 1 !important; } + +.lh-sm { + line-height: 1.25 !important; } + +.lh-base { + line-height: 1.5 !important; } + +.lh-lg { + line-height: 2 !important; } + +.text-start { + text-align: left !important; } + +.text-end { + text-align: right !important; } + +.text-center { + text-align: center !important; } + +.text-decoration-none { + text-decoration: none !important; } + +.text-decoration-underline { + text-decoration: underline !important; } + +.text-decoration-line-through { + text-decoration: line-through !important; } + +.text-lowercase { + text-transform: lowercase !important; } + +.text-uppercase { + text-transform: uppercase !important; } + +.text-capitalize { + text-transform: capitalize !important; } + +.text-wrap { + white-space: normal !important; } + +.text-nowrap { + white-space: nowrap !important; } + +/* rtl:begin:remove */ +.text-break { + word-wrap: break-word !important; + word-break: break-word !important; } + +/* rtl:end:remove */ +.text-primary { + --bs-text-opacity: 1; + color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important; } + +.text-secondary { + --bs-text-opacity: 1; + color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important; } + +.text-success { + --bs-text-opacity: 1; + color: rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important; } + +.text-info { + --bs-text-opacity: 1; + color: rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important; } + +.text-warning { + --bs-text-opacity: 1; + color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important; } + +.text-danger { + --bs-text-opacity: 1; + color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important; } + +.text-light { + --bs-text-opacity: 1; + color: rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important; } + +.text-dark { + --bs-text-opacity: 1; + color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important; } + +.text-black { + --bs-text-opacity: 1; + color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important; } + +.text-white { + --bs-text-opacity: 1; + color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important; } + +.text-body { + --bs-text-opacity: 1; + color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important; } + +.text-muted { + --bs-text-opacity: 1; + color: var(--bs-secondary-color) !important; } + +.text-black-50 { + --bs-text-opacity: 1; + color: rgba(0, 0, 0, 0.5) !important; } + +.text-white-50 { + --bs-text-opacity: 1; + color: rgba(255, 255, 255, 0.5) !important; } + +.text-body-secondary { + --bs-text-opacity: 1; + color: var(--bs-secondary-color) !important; } + +.text-body-tertiary { + --bs-text-opacity: 1; + color: var(--bs-tertiary-color) !important; } + +.text-body-emphasis { + --bs-text-opacity: 1; + color: var(--bs-emphasis-color) !important; } + +.text-reset { + --bs-text-opacity: 1; + color: inherit !important; } + +.text-opacity-25 { + --bs-text-opacity: 0.25; } + +.text-opacity-50 { + --bs-text-opacity: 0.5; } + +.text-opacity-75 { + --bs-text-opacity: 0.75; } + +.text-opacity-100 { + --bs-text-opacity: 1; } + +.text-primary-emphasis { + color: var(--bs-primary-text-emphasis) !important; } + +.text-secondary-emphasis { + color: var(--bs-secondary-text-emphasis) !important; } + +.text-success-emphasis { + color: var(--bs-success-text-emphasis) !important; } + +.text-info-emphasis { + color: var(--bs-info-text-emphasis) !important; } + +.text-warning-emphasis { + color: var(--bs-warning-text-emphasis) !important; } + +.text-danger-emphasis { + color: var(--bs-danger-text-emphasis) !important; } + +.text-light-emphasis { + color: var(--bs-light-text-emphasis) !important; } + +.text-dark-emphasis { + color: var(--bs-dark-text-emphasis) !important; } + +.link-opacity-10 { + --bs-link-opacity: 0.1; } + +.link-opacity-10-hover:hover { + --bs-link-opacity: 0.1; } + +.link-opacity-25 { + --bs-link-opacity: 0.25; } + +.link-opacity-25-hover:hover { + --bs-link-opacity: 0.25; } + +.link-opacity-50 { + --bs-link-opacity: 0.5; } + +.link-opacity-50-hover:hover { + --bs-link-opacity: 0.5; } + +.link-opacity-75 { + --bs-link-opacity: 0.75; } + +.link-opacity-75-hover:hover { + --bs-link-opacity: 0.75; } + +.link-opacity-100 { + --bs-link-opacity: 1; } + +.link-opacity-100-hover:hover { + --bs-link-opacity: 1; } + +.link-offset-1 { + text-underline-offset: 0.125em !important; } + +.link-offset-1-hover:hover { + text-underline-offset: 0.125em !important; } + +.link-offset-2 { + text-underline-offset: 0.25em !important; } + +.link-offset-2-hover:hover { + text-underline-offset: 0.25em !important; } + +.link-offset-3 { + text-underline-offset: 0.375em !important; } + +.link-offset-3-hover:hover { + text-underline-offset: 0.375em !important; } + +.link-underline-primary { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-secondary { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-success { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-info { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-warning { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-danger { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-light { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline-dark { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity)) !important; } + +.link-underline { + --bs-link-underline-opacity: 1; + text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important; } + +.link-underline-opacity-0 { + --bs-link-underline-opacity: 0; } + +.link-underline-opacity-0-hover:hover { + --bs-link-underline-opacity: 0; } + +.link-underline-opacity-10 { + --bs-link-underline-opacity: 0.1; } + +.link-underline-opacity-10-hover:hover { + --bs-link-underline-opacity: 0.1; } + +.link-underline-opacity-25 { + --bs-link-underline-opacity: 0.25; } + +.link-underline-opacity-25-hover:hover { + --bs-link-underline-opacity: 0.25; } + +.link-underline-opacity-50 { + --bs-link-underline-opacity: 0.5; } + +.link-underline-opacity-50-hover:hover { + --bs-link-underline-opacity: 0.5; } + +.link-underline-opacity-75 { + --bs-link-underline-opacity: 0.75; } + +.link-underline-opacity-75-hover:hover { + --bs-link-underline-opacity: 0.75; } + +.link-underline-opacity-100 { + --bs-link-underline-opacity: 1; } + +.link-underline-opacity-100-hover:hover { + --bs-link-underline-opacity: 1; } + +.bg-primary { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important; } + +.bg-secondary { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important; } + +.bg-success { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important; } + +.bg-info { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important; } + +.bg-warning { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important; } + +.bg-danger { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important; } + +.bg-light { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important; } + +.bg-dark { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important; } + +.bg-black { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important; } + +.bg-white { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important; } + +.bg-body { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important; } + +.bg-transparent { + --bs-bg-opacity: 1; + background-color: transparent !important; } + +.bg-body-secondary { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important; } + +.bg-body-tertiary { + --bs-bg-opacity: 1; + background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important; } + +.bg-opacity-10 { + --bs-bg-opacity: 0.1; } + +.bg-opacity-25 { + --bs-bg-opacity: 0.25; } + +.bg-opacity-50 { + --bs-bg-opacity: 0.5; } + +.bg-opacity-75 { + --bs-bg-opacity: 0.75; } + +.bg-opacity-100 { + --bs-bg-opacity: 1; } + +.bg-primary-subtle { + background-color: var(--bs-primary-bg-subtle) !important; } + +.bg-secondary-subtle { + background-color: var(--bs-secondary-bg-subtle) !important; } + +.bg-success-subtle { + background-color: var(--bs-success-bg-subtle) !important; } + +.bg-info-subtle { + background-color: var(--bs-info-bg-subtle) !important; } + +.bg-warning-subtle { + background-color: var(--bs-warning-bg-subtle) !important; } + +.bg-danger-subtle { + background-color: var(--bs-danger-bg-subtle) !important; } + +.bg-light-subtle { + background-color: var(--bs-light-bg-subtle) !important; } + +.bg-dark-subtle { + background-color: var(--bs-dark-bg-subtle) !important; } + +.bg-gradient { + background-image: var(--bs-gradient) !important; } + +.user-select-all { + user-select: all !important; } + +.user-select-auto { + user-select: auto !important; } + +.user-select-none { + user-select: none !important; } + +.pe-none { + pointer-events: none !important; } + +.pe-auto { + pointer-events: auto !important; } + +.rounded { + border-radius: var(--bs-border-radius) !important; } + +.rounded-0 { + border-radius: 0 !important; } + +.rounded-1 { + border-radius: var(--bs-border-radius-sm) !important; } + +.rounded-2 { + border-radius: var(--bs-border-radius) !important; } + +.rounded-3 { + border-radius: var(--bs-border-radius-lg) !important; } + +.rounded-4 { + border-radius: var(--bs-border-radius-xl) !important; } + +.rounded-5 { + border-radius: var(--bs-border-radius-xxl) !important; } + +.rounded-circle { + border-radius: 50% !important; } + +.rounded-pill { + border-radius: var(--bs-border-radius-pill) !important; } + +.rounded-top { + border-top-left-radius: var(--bs-border-radius) !important; + border-top-right-radius: var(--bs-border-radius) !important; } + +.rounded-top-0 { + border-top-left-radius: 0 !important; + border-top-right-radius: 0 !important; } + +.rounded-top-1 { + border-top-left-radius: var(--bs-border-radius-sm) !important; + border-top-right-radius: var(--bs-border-radius-sm) !important; } + +.rounded-top-2 { + border-top-left-radius: var(--bs-border-radius) !important; + border-top-right-radius: var(--bs-border-radius) !important; } + +.rounded-top-3 { + border-top-left-radius: var(--bs-border-radius-lg) !important; + border-top-right-radius: var(--bs-border-radius-lg) !important; } + +.rounded-top-4 { + border-top-left-radius: var(--bs-border-radius-xl) !important; + border-top-right-radius: var(--bs-border-radius-xl) !important; } + +.rounded-top-5 { + border-top-left-radius: var(--bs-border-radius-xxl) !important; + border-top-right-radius: var(--bs-border-radius-xxl) !important; } + +.rounded-top-circle { + border-top-left-radius: 50% !important; + border-top-right-radius: 50% !important; } + +.rounded-top-pill { + border-top-left-radius: var(--bs-border-radius-pill) !important; + border-top-right-radius: var(--bs-border-radius-pill) !important; } + +.rounded-end { + border-top-right-radius: var(--bs-border-radius) !important; + border-bottom-right-radius: var(--bs-border-radius) !important; } + +.rounded-end-0 { + border-top-right-radius: 0 !important; + border-bottom-right-radius: 0 !important; } + +.rounded-end-1 { + border-top-right-radius: var(--bs-border-radius-sm) !important; + border-bottom-right-radius: var(--bs-border-radius-sm) !important; } + +.rounded-end-2 { + border-top-right-radius: var(--bs-border-radius) !important; + border-bottom-right-radius: var(--bs-border-radius) !important; } + +.rounded-end-3 { + border-top-right-radius: var(--bs-border-radius-lg) !important; + border-bottom-right-radius: var(--bs-border-radius-lg) !important; } + +.rounded-end-4 { + border-top-right-radius: var(--bs-border-radius-xl) !important; + border-bottom-right-radius: var(--bs-border-radius-xl) !important; } + +.rounded-end-5 { + border-top-right-radius: var(--bs-border-radius-xxl) !important; + border-bottom-right-radius: var(--bs-border-radius-xxl) !important; } + +.rounded-end-circle { + border-top-right-radius: 50% !important; + border-bottom-right-radius: 50% !important; } + +.rounded-end-pill { + border-top-right-radius: var(--bs-border-radius-pill) !important; + border-bottom-right-radius: var(--bs-border-radius-pill) !important; } + +.rounded-bottom { + border-bottom-right-radius: var(--bs-border-radius) !important; + border-bottom-left-radius: var(--bs-border-radius) !important; } + +.rounded-bottom-0 { + border-bottom-right-radius: 0 !important; + border-bottom-left-radius: 0 !important; } + +.rounded-bottom-1 { + border-bottom-right-radius: var(--bs-border-radius-sm) !important; + border-bottom-left-radius: var(--bs-border-radius-sm) !important; } + +.rounded-bottom-2 { + border-bottom-right-radius: var(--bs-border-radius) !important; + border-bottom-left-radius: var(--bs-border-radius) !important; } + +.rounded-bottom-3 { + border-bottom-right-radius: var(--bs-border-radius-lg) !important; + border-bottom-left-radius: var(--bs-border-radius-lg) !important; } + +.rounded-bottom-4 { + border-bottom-right-radius: var(--bs-border-radius-xl) !important; + border-bottom-left-radius: var(--bs-border-radius-xl) !important; } + +.rounded-bottom-5 { + border-bottom-right-radius: var(--bs-border-radius-xxl) !important; + border-bottom-left-radius: var(--bs-border-radius-xxl) !important; } + +.rounded-bottom-circle { + border-bottom-right-radius: 50% !important; + border-bottom-left-radius: 50% !important; } + +.rounded-bottom-pill { + border-bottom-right-radius: var(--bs-border-radius-pill) !important; + border-bottom-left-radius: var(--bs-border-radius-pill) !important; } + +.rounded-start { + border-bottom-left-radius: var(--bs-border-radius) !important; + border-top-left-radius: var(--bs-border-radius) !important; } + +.rounded-start-0 { + border-bottom-left-radius: 0 !important; + border-top-left-radius: 0 !important; } + +.rounded-start-1 { + border-bottom-left-radius: var(--bs-border-radius-sm) !important; + border-top-left-radius: var(--bs-border-radius-sm) !important; } + +.rounded-start-2 { + border-bottom-left-radius: var(--bs-border-radius) !important; + border-top-left-radius: var(--bs-border-radius) !important; } + +.rounded-start-3 { + border-bottom-left-radius: var(--bs-border-radius-lg) !important; + border-top-left-radius: var(--bs-border-radius-lg) !important; } + +.rounded-start-4 { + border-bottom-left-radius: var(--bs-border-radius-xl) !important; + border-top-left-radius: var(--bs-border-radius-xl) !important; } + +.rounded-start-5 { + border-bottom-left-radius: var(--bs-border-radius-xxl) !important; + border-top-left-radius: var(--bs-border-radius-xxl) !important; } + +.rounded-start-circle { + border-bottom-left-radius: 50% !important; + border-top-left-radius: 50% !important; } + +.rounded-start-pill { + border-bottom-left-radius: var(--bs-border-radius-pill) !important; + border-top-left-radius: var(--bs-border-radius-pill) !important; } + +.visible { + visibility: visible !important; } + +.invisible { + visibility: hidden !important; } + +.z-n1 { + z-index: -1 !important; } + +.z-0 { + z-index: 0 !important; } + +.z-1 { + z-index: 1 !important; } + +.z-2 { + z-index: 2 !important; } + +.z-3 { + z-index: 3 !important; } + +@media (min-width: 576px) { + .float-sm-start { + float: left !important; } + .float-sm-end { + float: right !important; } + .float-sm-none { + float: none !important; } + .object-fit-sm-contain { + object-fit: contain !important; } + .object-fit-sm-cover { + object-fit: cover !important; } + .object-fit-sm-fill { + object-fit: fill !important; } + .object-fit-sm-scale { + object-fit: scale-down !important; } + .object-fit-sm-none { + object-fit: none !important; } + .d-sm-inline { + display: inline !important; } + .d-sm-inline-block { + display: inline-block !important; } + .d-sm-block { + display: block !important; } + .d-sm-grid { + display: grid !important; } + .d-sm-inline-grid { + display: inline-grid !important; } + .d-sm-table { + display: table !important; } + .d-sm-table-row { + display: table-row !important; } + .d-sm-table-cell { + display: table-cell !important; } + .d-sm-flex { + display: flex !important; } + .d-sm-inline-flex { + display: inline-flex !important; } + .d-sm-none { + display: none !important; } + .flex-sm-fill { + flex: 1 1 auto !important; } + .flex-sm-row { + flex-direction: row !important; } + .flex-sm-column { + flex-direction: column !important; } + .flex-sm-row-reverse { + flex-direction: row-reverse !important; } + .flex-sm-column-reverse { + flex-direction: column-reverse !important; } + .flex-sm-grow-0 { + flex-grow: 0 !important; } + .flex-sm-grow-1 { + flex-grow: 1 !important; } + .flex-sm-shrink-0 { + flex-shrink: 0 !important; } + .flex-sm-shrink-1 { + flex-shrink: 1 !important; } + .flex-sm-wrap { + flex-wrap: wrap !important; } + .flex-sm-nowrap { + flex-wrap: nowrap !important; } + .flex-sm-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-sm-start { + justify-content: flex-start !important; } + .justify-content-sm-end { + justify-content: flex-end !important; } + .justify-content-sm-center { + justify-content: center !important; } + .justify-content-sm-between { + justify-content: space-between !important; } + .justify-content-sm-around { + justify-content: space-around !important; } + .justify-content-sm-evenly { + justify-content: space-evenly !important; } + .align-items-sm-start { + align-items: flex-start !important; } + .align-items-sm-end { + align-items: flex-end !important; } + .align-items-sm-center { + align-items: center !important; } + .align-items-sm-baseline { + align-items: baseline !important; } + .align-items-sm-stretch { + align-items: stretch !important; } + .align-content-sm-start { + align-content: flex-start !important; } + .align-content-sm-end { + align-content: flex-end !important; } + .align-content-sm-center { + align-content: center !important; } + .align-content-sm-between { + align-content: space-between !important; } + .align-content-sm-around { + align-content: space-around !important; } + .align-content-sm-stretch { + align-content: stretch !important; } + .align-self-sm-auto { + align-self: auto !important; } + .align-self-sm-start { + align-self: flex-start !important; } + .align-self-sm-end { + align-self: flex-end !important; } + .align-self-sm-center { + align-self: center !important; } + .align-self-sm-baseline { + align-self: baseline !important; } + .align-self-sm-stretch { + align-self: stretch !important; } + .order-sm-first { + order: -1 !important; } + .order-sm-0 { + order: 0 !important; } + .order-sm-1 { + order: 1 !important; } + .order-sm-2 { + order: 2 !important; } + .order-sm-3 { + order: 3 !important; } + .order-sm-4 { + order: 4 !important; } + .order-sm-5 { + order: 5 !important; } + .order-sm-last { + order: 6 !important; } + .m-sm-0 { + margin: 0 !important; } + .m-sm-1 { + margin: 0.25rem !important; } + .m-sm-2 { + margin: 0.5rem !important; } + .m-sm-3 { + margin: 1rem !important; } + .m-sm-4 { + margin: 1.5rem !important; } + .m-sm-5 { + margin: 3rem !important; } + .m-sm-auto { + margin: auto !important; } + .mx-sm-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-sm-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-sm-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-sm-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-sm-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-sm-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-sm-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-sm-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-sm-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-sm-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-sm-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-sm-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-sm-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-sm-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-sm-0 { + margin-top: 0 !important; } + .mt-sm-1 { + margin-top: 0.25rem !important; } + .mt-sm-2 { + margin-top: 0.5rem !important; } + .mt-sm-3 { + margin-top: 1rem !important; } + .mt-sm-4 { + margin-top: 1.5rem !important; } + .mt-sm-5 { + margin-top: 3rem !important; } + .mt-sm-auto { + margin-top: auto !important; } + .me-sm-0 { + margin-right: 0 !important; } + .me-sm-1 { + margin-right: 0.25rem !important; } + .me-sm-2 { + margin-right: 0.5rem !important; } + .me-sm-3 { + margin-right: 1rem !important; } + .me-sm-4 { + margin-right: 1.5rem !important; } + .me-sm-5 { + margin-right: 3rem !important; } + .me-sm-auto { + margin-right: auto !important; } + .mb-sm-0 { + margin-bottom: 0 !important; } + .mb-sm-1 { + margin-bottom: 0.25rem !important; } + .mb-sm-2 { + margin-bottom: 0.5rem !important; } + .mb-sm-3 { + margin-bottom: 1rem !important; } + .mb-sm-4 { + margin-bottom: 1.5rem !important; } + .mb-sm-5 { + margin-bottom: 3rem !important; } + .mb-sm-auto { + margin-bottom: auto !important; } + .ms-sm-0 { + margin-left: 0 !important; } + .ms-sm-1 { + margin-left: 0.25rem !important; } + .ms-sm-2 { + margin-left: 0.5rem !important; } + .ms-sm-3 { + margin-left: 1rem !important; } + .ms-sm-4 { + margin-left: 1.5rem !important; } + .ms-sm-5 { + margin-left: 3rem !important; } + .ms-sm-auto { + margin-left: auto !important; } + .m-sm-n1 { + margin: -0.25rem !important; } + .m-sm-n2 { + margin: -0.5rem !important; } + .m-sm-n3 { + margin: -1rem !important; } + .m-sm-n4 { + margin: -1.5rem !important; } + .m-sm-n5 { + margin: -3rem !important; } + .mx-sm-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-sm-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-sm-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-sm-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-sm-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-sm-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-sm-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-sm-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-sm-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-sm-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-sm-n1 { + margin-top: -0.25rem !important; } + .mt-sm-n2 { + margin-top: -0.5rem !important; } + .mt-sm-n3 { + margin-top: -1rem !important; } + .mt-sm-n4 { + margin-top: -1.5rem !important; } + .mt-sm-n5 { + margin-top: -3rem !important; } + .me-sm-n1 { + margin-right: -0.25rem !important; } + .me-sm-n2 { + margin-right: -0.5rem !important; } + .me-sm-n3 { + margin-right: -1rem !important; } + .me-sm-n4 { + margin-right: -1.5rem !important; } + .me-sm-n5 { + margin-right: -3rem !important; } + .mb-sm-n1 { + margin-bottom: -0.25rem !important; } + .mb-sm-n2 { + margin-bottom: -0.5rem !important; } + .mb-sm-n3 { + margin-bottom: -1rem !important; } + .mb-sm-n4 { + margin-bottom: -1.5rem !important; } + .mb-sm-n5 { + margin-bottom: -3rem !important; } + .ms-sm-n1 { + margin-left: -0.25rem !important; } + .ms-sm-n2 { + margin-left: -0.5rem !important; } + .ms-sm-n3 { + margin-left: -1rem !important; } + .ms-sm-n4 { + margin-left: -1.5rem !important; } + .ms-sm-n5 { + margin-left: -3rem !important; } + .p-sm-0 { + padding: 0 !important; } + .p-sm-1 { + padding: 0.25rem !important; } + .p-sm-2 { + padding: 0.5rem !important; } + .p-sm-3 { + padding: 1rem !important; } + .p-sm-4 { + padding: 1.5rem !important; } + .p-sm-5 { + padding: 3rem !important; } + .px-sm-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-sm-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-sm-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-sm-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-sm-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-sm-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-sm-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-sm-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-sm-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-sm-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-sm-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-sm-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-sm-0 { + padding-top: 0 !important; } + .pt-sm-1 { + padding-top: 0.25rem !important; } + .pt-sm-2 { + padding-top: 0.5rem !important; } + .pt-sm-3 { + padding-top: 1rem !important; } + .pt-sm-4 { + padding-top: 1.5rem !important; } + .pt-sm-5 { + padding-top: 3rem !important; } + .pe-sm-0 { + padding-right: 0 !important; } + .pe-sm-1 { + padding-right: 0.25rem !important; } + .pe-sm-2 { + padding-right: 0.5rem !important; } + .pe-sm-3 { + padding-right: 1rem !important; } + .pe-sm-4 { + padding-right: 1.5rem !important; } + .pe-sm-5 { + padding-right: 3rem !important; } + .pb-sm-0 { + padding-bottom: 0 !important; } + .pb-sm-1 { + padding-bottom: 0.25rem !important; } + .pb-sm-2 { + padding-bottom: 0.5rem !important; } + .pb-sm-3 { + padding-bottom: 1rem !important; } + .pb-sm-4 { + padding-bottom: 1.5rem !important; } + .pb-sm-5 { + padding-bottom: 3rem !important; } + .ps-sm-0 { + padding-left: 0 !important; } + .ps-sm-1 { + padding-left: 0.25rem !important; } + .ps-sm-2 { + padding-left: 0.5rem !important; } + .ps-sm-3 { + padding-left: 1rem !important; } + .ps-sm-4 { + padding-left: 1.5rem !important; } + .ps-sm-5 { + padding-left: 3rem !important; } + .gap-sm-0 { + gap: 0 !important; } + .gap-sm-1 { + gap: 0.25rem !important; } + .gap-sm-2 { + gap: 0.5rem !important; } + .gap-sm-3 { + gap: 1rem !important; } + .gap-sm-4 { + gap: 1.5rem !important; } + .gap-sm-5 { + gap: 3rem !important; } + .row-gap-sm-0 { + row-gap: 0 !important; } + .row-gap-sm-1 { + row-gap: 0.25rem !important; } + .row-gap-sm-2 { + row-gap: 0.5rem !important; } + .row-gap-sm-3 { + row-gap: 1rem !important; } + .row-gap-sm-4 { + row-gap: 1.5rem !important; } + .row-gap-sm-5 { + row-gap: 3rem !important; } + .column-gap-sm-0 { + column-gap: 0 !important; } + .column-gap-sm-1 { + column-gap: 0.25rem !important; } + .column-gap-sm-2 { + column-gap: 0.5rem !important; } + .column-gap-sm-3 { + column-gap: 1rem !important; } + .column-gap-sm-4 { + column-gap: 1.5rem !important; } + .column-gap-sm-5 { + column-gap: 3rem !important; } + .text-sm-start { + text-align: left !important; } + .text-sm-end { + text-align: right !important; } + .text-sm-center { + text-align: center !important; } } + +@media (min-width: 768px) { + .float-md-start { + float: left !important; } + .float-md-end { + float: right !important; } + .float-md-none { + float: none !important; } + .object-fit-md-contain { + object-fit: contain !important; } + .object-fit-md-cover { + object-fit: cover !important; } + .object-fit-md-fill { + object-fit: fill !important; } + .object-fit-md-scale { + object-fit: scale-down !important; } + .object-fit-md-none { + object-fit: none !important; } + .d-md-inline { + display: inline !important; } + .d-md-inline-block { + display: inline-block !important; } + .d-md-block { + display: block !important; } + .d-md-grid { + display: grid !important; } + .d-md-inline-grid { + display: inline-grid !important; } + .d-md-table { + display: table !important; } + .d-md-table-row { + display: table-row !important; } + .d-md-table-cell { + display: table-cell !important; } + .d-md-flex { + display: flex !important; } + .d-md-inline-flex { + display: inline-flex !important; } + .d-md-none { + display: none !important; } + .flex-md-fill { + flex: 1 1 auto !important; } + .flex-md-row { + flex-direction: row !important; } + .flex-md-column { + flex-direction: column !important; } + .flex-md-row-reverse { + flex-direction: row-reverse !important; } + .flex-md-column-reverse { + flex-direction: column-reverse !important; } + .flex-md-grow-0 { + flex-grow: 0 !important; } + .flex-md-grow-1 { + flex-grow: 1 !important; } + .flex-md-shrink-0 { + flex-shrink: 0 !important; } + .flex-md-shrink-1 { + flex-shrink: 1 !important; } + .flex-md-wrap { + flex-wrap: wrap !important; } + .flex-md-nowrap { + flex-wrap: nowrap !important; } + .flex-md-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-md-start { + justify-content: flex-start !important; } + .justify-content-md-end { + justify-content: flex-end !important; } + .justify-content-md-center { + justify-content: center !important; } + .justify-content-md-between { + justify-content: space-between !important; } + .justify-content-md-around { + justify-content: space-around !important; } + .justify-content-md-evenly { + justify-content: space-evenly !important; } + .align-items-md-start { + align-items: flex-start !important; } + .align-items-md-end { + align-items: flex-end !important; } + .align-items-md-center { + align-items: center !important; } + .align-items-md-baseline { + align-items: baseline !important; } + .align-items-md-stretch { + align-items: stretch !important; } + .align-content-md-start { + align-content: flex-start !important; } + .align-content-md-end { + align-content: flex-end !important; } + .align-content-md-center { + align-content: center !important; } + .align-content-md-between { + align-content: space-between !important; } + .align-content-md-around { + align-content: space-around !important; } + .align-content-md-stretch { + align-content: stretch !important; } + .align-self-md-auto { + align-self: auto !important; } + .align-self-md-start { + align-self: flex-start !important; } + .align-self-md-end { + align-self: flex-end !important; } + .align-self-md-center { + align-self: center !important; } + .align-self-md-baseline { + align-self: baseline !important; } + .align-self-md-stretch { + align-self: stretch !important; } + .order-md-first { + order: -1 !important; } + .order-md-0 { + order: 0 !important; } + .order-md-1 { + order: 1 !important; } + .order-md-2 { + order: 2 !important; } + .order-md-3 { + order: 3 !important; } + .order-md-4 { + order: 4 !important; } + .order-md-5 { + order: 5 !important; } + .order-md-last { + order: 6 !important; } + .m-md-0 { + margin: 0 !important; } + .m-md-1 { + margin: 0.25rem !important; } + .m-md-2 { + margin: 0.5rem !important; } + .m-md-3 { + margin: 1rem !important; } + .m-md-4 { + margin: 1.5rem !important; } + .m-md-5 { + margin: 3rem !important; } + .m-md-auto { + margin: auto !important; } + .mx-md-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-md-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-md-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-md-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-md-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-md-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-md-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-md-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-md-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-md-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-md-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-md-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-md-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-md-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-md-0 { + margin-top: 0 !important; } + .mt-md-1 { + margin-top: 0.25rem !important; } + .mt-md-2 { + margin-top: 0.5rem !important; } + .mt-md-3 { + margin-top: 1rem !important; } + .mt-md-4 { + margin-top: 1.5rem !important; } + .mt-md-5 { + margin-top: 3rem !important; } + .mt-md-auto { + margin-top: auto !important; } + .me-md-0 { + margin-right: 0 !important; } + .me-md-1 { + margin-right: 0.25rem !important; } + .me-md-2 { + margin-right: 0.5rem !important; } + .me-md-3 { + margin-right: 1rem !important; } + .me-md-4 { + margin-right: 1.5rem !important; } + .me-md-5 { + margin-right: 3rem !important; } + .me-md-auto { + margin-right: auto !important; } + .mb-md-0 { + margin-bottom: 0 !important; } + .mb-md-1 { + margin-bottom: 0.25rem !important; } + .mb-md-2 { + margin-bottom: 0.5rem !important; } + .mb-md-3 { + margin-bottom: 1rem !important; } + .mb-md-4 { + margin-bottom: 1.5rem !important; } + .mb-md-5 { + margin-bottom: 3rem !important; } + .mb-md-auto { + margin-bottom: auto !important; } + .ms-md-0 { + margin-left: 0 !important; } + .ms-md-1 { + margin-left: 0.25rem !important; } + .ms-md-2 { + margin-left: 0.5rem !important; } + .ms-md-3 { + margin-left: 1rem !important; } + .ms-md-4 { + margin-left: 1.5rem !important; } + .ms-md-5 { + margin-left: 3rem !important; } + .ms-md-auto { + margin-left: auto !important; } + .m-md-n1 { + margin: -0.25rem !important; } + .m-md-n2 { + margin: -0.5rem !important; } + .m-md-n3 { + margin: -1rem !important; } + .m-md-n4 { + margin: -1.5rem !important; } + .m-md-n5 { + margin: -3rem !important; } + .mx-md-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-md-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-md-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-md-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-md-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-md-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-md-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-md-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-md-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-md-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-md-n1 { + margin-top: -0.25rem !important; } + .mt-md-n2 { + margin-top: -0.5rem !important; } + .mt-md-n3 { + margin-top: -1rem !important; } + .mt-md-n4 { + margin-top: -1.5rem !important; } + .mt-md-n5 { + margin-top: -3rem !important; } + .me-md-n1 { + margin-right: -0.25rem !important; } + .me-md-n2 { + margin-right: -0.5rem !important; } + .me-md-n3 { + margin-right: -1rem !important; } + .me-md-n4 { + margin-right: -1.5rem !important; } + .me-md-n5 { + margin-right: -3rem !important; } + .mb-md-n1 { + margin-bottom: -0.25rem !important; } + .mb-md-n2 { + margin-bottom: -0.5rem !important; } + .mb-md-n3 { + margin-bottom: -1rem !important; } + .mb-md-n4 { + margin-bottom: -1.5rem !important; } + .mb-md-n5 { + margin-bottom: -3rem !important; } + .ms-md-n1 { + margin-left: -0.25rem !important; } + .ms-md-n2 { + margin-left: -0.5rem !important; } + .ms-md-n3 { + margin-left: -1rem !important; } + .ms-md-n4 { + margin-left: -1.5rem !important; } + .ms-md-n5 { + margin-left: -3rem !important; } + .p-md-0 { + padding: 0 !important; } + .p-md-1 { + padding: 0.25rem !important; } + .p-md-2 { + padding: 0.5rem !important; } + .p-md-3 { + padding: 1rem !important; } + .p-md-4 { + padding: 1.5rem !important; } + .p-md-5 { + padding: 3rem !important; } + .px-md-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-md-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-md-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-md-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-md-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-md-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-md-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-md-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-md-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-md-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-md-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-md-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-md-0 { + padding-top: 0 !important; } + .pt-md-1 { + padding-top: 0.25rem !important; } + .pt-md-2 { + padding-top: 0.5rem !important; } + .pt-md-3 { + padding-top: 1rem !important; } + .pt-md-4 { + padding-top: 1.5rem !important; } + .pt-md-5 { + padding-top: 3rem !important; } + .pe-md-0 { + padding-right: 0 !important; } + .pe-md-1 { + padding-right: 0.25rem !important; } + .pe-md-2 { + padding-right: 0.5rem !important; } + .pe-md-3 { + padding-right: 1rem !important; } + .pe-md-4 { + padding-right: 1.5rem !important; } + .pe-md-5 { + padding-right: 3rem !important; } + .pb-md-0 { + padding-bottom: 0 !important; } + .pb-md-1 { + padding-bottom: 0.25rem !important; } + .pb-md-2 { + padding-bottom: 0.5rem !important; } + .pb-md-3 { + padding-bottom: 1rem !important; } + .pb-md-4 { + padding-bottom: 1.5rem !important; } + .pb-md-5 { + padding-bottom: 3rem !important; } + .ps-md-0 { + padding-left: 0 !important; } + .ps-md-1 { + padding-left: 0.25rem !important; } + .ps-md-2 { + padding-left: 0.5rem !important; } + .ps-md-3 { + padding-left: 1rem !important; } + .ps-md-4 { + padding-left: 1.5rem !important; } + .ps-md-5 { + padding-left: 3rem !important; } + .gap-md-0 { + gap: 0 !important; } + .gap-md-1 { + gap: 0.25rem !important; } + .gap-md-2 { + gap: 0.5rem !important; } + .gap-md-3 { + gap: 1rem !important; } + .gap-md-4 { + gap: 1.5rem !important; } + .gap-md-5 { + gap: 3rem !important; } + .row-gap-md-0 { + row-gap: 0 !important; } + .row-gap-md-1 { + row-gap: 0.25rem !important; } + .row-gap-md-2 { + row-gap: 0.5rem !important; } + .row-gap-md-3 { + row-gap: 1rem !important; } + .row-gap-md-4 { + row-gap: 1.5rem !important; } + .row-gap-md-5 { + row-gap: 3rem !important; } + .column-gap-md-0 { + column-gap: 0 !important; } + .column-gap-md-1 { + column-gap: 0.25rem !important; } + .column-gap-md-2 { + column-gap: 0.5rem !important; } + .column-gap-md-3 { + column-gap: 1rem !important; } + .column-gap-md-4 { + column-gap: 1.5rem !important; } + .column-gap-md-5 { + column-gap: 3rem !important; } + .text-md-start { + text-align: left !important; } + .text-md-end { + text-align: right !important; } + .text-md-center { + text-align: center !important; } } + +@media (min-width: 992px) { + .float-lg-start { + float: left !important; } + .float-lg-end { + float: right !important; } + .float-lg-none { + float: none !important; } + .object-fit-lg-contain { + object-fit: contain !important; } + .object-fit-lg-cover { + object-fit: cover !important; } + .object-fit-lg-fill { + object-fit: fill !important; } + .object-fit-lg-scale { + object-fit: scale-down !important; } + .object-fit-lg-none { + object-fit: none !important; } + .d-lg-inline { + display: inline !important; } + .d-lg-inline-block { + display: inline-block !important; } + .d-lg-block { + display: block !important; } + .d-lg-grid { + display: grid !important; } + .d-lg-inline-grid { + display: inline-grid !important; } + .d-lg-table { + display: table !important; } + .d-lg-table-row { + display: table-row !important; } + .d-lg-table-cell { + display: table-cell !important; } + .d-lg-flex { + display: flex !important; } + .d-lg-inline-flex { + display: inline-flex !important; } + .d-lg-none { + display: none !important; } + .flex-lg-fill { + flex: 1 1 auto !important; } + .flex-lg-row { + flex-direction: row !important; } + .flex-lg-column { + flex-direction: column !important; } + .flex-lg-row-reverse { + flex-direction: row-reverse !important; } + .flex-lg-column-reverse { + flex-direction: column-reverse !important; } + .flex-lg-grow-0 { + flex-grow: 0 !important; } + .flex-lg-grow-1 { + flex-grow: 1 !important; } + .flex-lg-shrink-0 { + flex-shrink: 0 !important; } + .flex-lg-shrink-1 { + flex-shrink: 1 !important; } + .flex-lg-wrap { + flex-wrap: wrap !important; } + .flex-lg-nowrap { + flex-wrap: nowrap !important; } + .flex-lg-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-lg-start { + justify-content: flex-start !important; } + .justify-content-lg-end { + justify-content: flex-end !important; } + .justify-content-lg-center { + justify-content: center !important; } + .justify-content-lg-between { + justify-content: space-between !important; } + .justify-content-lg-around { + justify-content: space-around !important; } + .justify-content-lg-evenly { + justify-content: space-evenly !important; } + .align-items-lg-start { + align-items: flex-start !important; } + .align-items-lg-end { + align-items: flex-end !important; } + .align-items-lg-center { + align-items: center !important; } + .align-items-lg-baseline { + align-items: baseline !important; } + .align-items-lg-stretch { + align-items: stretch !important; } + .align-content-lg-start { + align-content: flex-start !important; } + .align-content-lg-end { + align-content: flex-end !important; } + .align-content-lg-center { + align-content: center !important; } + .align-content-lg-between { + align-content: space-between !important; } + .align-content-lg-around { + align-content: space-around !important; } + .align-content-lg-stretch { + align-content: stretch !important; } + .align-self-lg-auto { + align-self: auto !important; } + .align-self-lg-start { + align-self: flex-start !important; } + .align-self-lg-end { + align-self: flex-end !important; } + .align-self-lg-center { + align-self: center !important; } + .align-self-lg-baseline { + align-self: baseline !important; } + .align-self-lg-stretch { + align-self: stretch !important; } + .order-lg-first { + order: -1 !important; } + .order-lg-0 { + order: 0 !important; } + .order-lg-1 { + order: 1 !important; } + .order-lg-2 { + order: 2 !important; } + .order-lg-3 { + order: 3 !important; } + .order-lg-4 { + order: 4 !important; } + .order-lg-5 { + order: 5 !important; } + .order-lg-last { + order: 6 !important; } + .m-lg-0 { + margin: 0 !important; } + .m-lg-1 { + margin: 0.25rem !important; } + .m-lg-2 { + margin: 0.5rem !important; } + .m-lg-3 { + margin: 1rem !important; } + .m-lg-4 { + margin: 1.5rem !important; } + .m-lg-5 { + margin: 3rem !important; } + .m-lg-auto { + margin: auto !important; } + .mx-lg-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-lg-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-lg-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-lg-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-lg-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-lg-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-lg-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-lg-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-lg-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-lg-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-lg-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-lg-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-lg-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-lg-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-lg-0 { + margin-top: 0 !important; } + .mt-lg-1 { + margin-top: 0.25rem !important; } + .mt-lg-2 { + margin-top: 0.5rem !important; } + .mt-lg-3 { + margin-top: 1rem !important; } + .mt-lg-4 { + margin-top: 1.5rem !important; } + .mt-lg-5 { + margin-top: 3rem !important; } + .mt-lg-auto { + margin-top: auto !important; } + .me-lg-0 { + margin-right: 0 !important; } + .me-lg-1 { + margin-right: 0.25rem !important; } + .me-lg-2 { + margin-right: 0.5rem !important; } + .me-lg-3 { + margin-right: 1rem !important; } + .me-lg-4 { + margin-right: 1.5rem !important; } + .me-lg-5 { + margin-right: 3rem !important; } + .me-lg-auto { + margin-right: auto !important; } + .mb-lg-0 { + margin-bottom: 0 !important; } + .mb-lg-1 { + margin-bottom: 0.25rem !important; } + .mb-lg-2 { + margin-bottom: 0.5rem !important; } + .mb-lg-3 { + margin-bottom: 1rem !important; } + .mb-lg-4 { + margin-bottom: 1.5rem !important; } + .mb-lg-5 { + margin-bottom: 3rem !important; } + .mb-lg-auto { + margin-bottom: auto !important; } + .ms-lg-0 { + margin-left: 0 !important; } + .ms-lg-1 { + margin-left: 0.25rem !important; } + .ms-lg-2 { + margin-left: 0.5rem !important; } + .ms-lg-3 { + margin-left: 1rem !important; } + .ms-lg-4 { + margin-left: 1.5rem !important; } + .ms-lg-5 { + margin-left: 3rem !important; } + .ms-lg-auto { + margin-left: auto !important; } + .m-lg-n1 { + margin: -0.25rem !important; } + .m-lg-n2 { + margin: -0.5rem !important; } + .m-lg-n3 { + margin: -1rem !important; } + .m-lg-n4 { + margin: -1.5rem !important; } + .m-lg-n5 { + margin: -3rem !important; } + .mx-lg-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-lg-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-lg-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-lg-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-lg-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-lg-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-lg-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-lg-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-lg-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-lg-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-lg-n1 { + margin-top: -0.25rem !important; } + .mt-lg-n2 { + margin-top: -0.5rem !important; } + .mt-lg-n3 { + margin-top: -1rem !important; } + .mt-lg-n4 { + margin-top: -1.5rem !important; } + .mt-lg-n5 { + margin-top: -3rem !important; } + .me-lg-n1 { + margin-right: -0.25rem !important; } + .me-lg-n2 { + margin-right: -0.5rem !important; } + .me-lg-n3 { + margin-right: -1rem !important; } + .me-lg-n4 { + margin-right: -1.5rem !important; } + .me-lg-n5 { + margin-right: -3rem !important; } + .mb-lg-n1 { + margin-bottom: -0.25rem !important; } + .mb-lg-n2 { + margin-bottom: -0.5rem !important; } + .mb-lg-n3 { + margin-bottom: -1rem !important; } + .mb-lg-n4 { + margin-bottom: -1.5rem !important; } + .mb-lg-n5 { + margin-bottom: -3rem !important; } + .ms-lg-n1 { + margin-left: -0.25rem !important; } + .ms-lg-n2 { + margin-left: -0.5rem !important; } + .ms-lg-n3 { + margin-left: -1rem !important; } + .ms-lg-n4 { + margin-left: -1.5rem !important; } + .ms-lg-n5 { + margin-left: -3rem !important; } + .p-lg-0 { + padding: 0 !important; } + .p-lg-1 { + padding: 0.25rem !important; } + .p-lg-2 { + padding: 0.5rem !important; } + .p-lg-3 { + padding: 1rem !important; } + .p-lg-4 { + padding: 1.5rem !important; } + .p-lg-5 { + padding: 3rem !important; } + .px-lg-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-lg-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-lg-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-lg-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-lg-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-lg-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-lg-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-lg-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-lg-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-lg-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-lg-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-lg-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-lg-0 { + padding-top: 0 !important; } + .pt-lg-1 { + padding-top: 0.25rem !important; } + .pt-lg-2 { + padding-top: 0.5rem !important; } + .pt-lg-3 { + padding-top: 1rem !important; } + .pt-lg-4 { + padding-top: 1.5rem !important; } + .pt-lg-5 { + padding-top: 3rem !important; } + .pe-lg-0 { + padding-right: 0 !important; } + .pe-lg-1 { + padding-right: 0.25rem !important; } + .pe-lg-2 { + padding-right: 0.5rem !important; } + .pe-lg-3 { + padding-right: 1rem !important; } + .pe-lg-4 { + padding-right: 1.5rem !important; } + .pe-lg-5 { + padding-right: 3rem !important; } + .pb-lg-0 { + padding-bottom: 0 !important; } + .pb-lg-1 { + padding-bottom: 0.25rem !important; } + .pb-lg-2 { + padding-bottom: 0.5rem !important; } + .pb-lg-3 { + padding-bottom: 1rem !important; } + .pb-lg-4 { + padding-bottom: 1.5rem !important; } + .pb-lg-5 { + padding-bottom: 3rem !important; } + .ps-lg-0 { + padding-left: 0 !important; } + .ps-lg-1 { + padding-left: 0.25rem !important; } + .ps-lg-2 { + padding-left: 0.5rem !important; } + .ps-lg-3 { + padding-left: 1rem !important; } + .ps-lg-4 { + padding-left: 1.5rem !important; } + .ps-lg-5 { + padding-left: 3rem !important; } + .gap-lg-0 { + gap: 0 !important; } + .gap-lg-1 { + gap: 0.25rem !important; } + .gap-lg-2 { + gap: 0.5rem !important; } + .gap-lg-3 { + gap: 1rem !important; } + .gap-lg-4 { + gap: 1.5rem !important; } + .gap-lg-5 { + gap: 3rem !important; } + .row-gap-lg-0 { + row-gap: 0 !important; } + .row-gap-lg-1 { + row-gap: 0.25rem !important; } + .row-gap-lg-2 { + row-gap: 0.5rem !important; } + .row-gap-lg-3 { + row-gap: 1rem !important; } + .row-gap-lg-4 { + row-gap: 1.5rem !important; } + .row-gap-lg-5 { + row-gap: 3rem !important; } + .column-gap-lg-0 { + column-gap: 0 !important; } + .column-gap-lg-1 { + column-gap: 0.25rem !important; } + .column-gap-lg-2 { + column-gap: 0.5rem !important; } + .column-gap-lg-3 { + column-gap: 1rem !important; } + .column-gap-lg-4 { + column-gap: 1.5rem !important; } + .column-gap-lg-5 { + column-gap: 3rem !important; } + .text-lg-start { + text-align: left !important; } + .text-lg-end { + text-align: right !important; } + .text-lg-center { + text-align: center !important; } } + +@media (min-width: 1200px) { + .float-xl-start { + float: left !important; } + .float-xl-end { + float: right !important; } + .float-xl-none { + float: none !important; } + .object-fit-xl-contain { + object-fit: contain !important; } + .object-fit-xl-cover { + object-fit: cover !important; } + .object-fit-xl-fill { + object-fit: fill !important; } + .object-fit-xl-scale { + object-fit: scale-down !important; } + .object-fit-xl-none { + object-fit: none !important; } + .d-xl-inline { + display: inline !important; } + .d-xl-inline-block { + display: inline-block !important; } + .d-xl-block { + display: block !important; } + .d-xl-grid { + display: grid !important; } + .d-xl-inline-grid { + display: inline-grid !important; } + .d-xl-table { + display: table !important; } + .d-xl-table-row { + display: table-row !important; } + .d-xl-table-cell { + display: table-cell !important; } + .d-xl-flex { + display: flex !important; } + .d-xl-inline-flex { + display: inline-flex !important; } + .d-xl-none { + display: none !important; } + .flex-xl-fill { + flex: 1 1 auto !important; } + .flex-xl-row { + flex-direction: row !important; } + .flex-xl-column { + flex-direction: column !important; } + .flex-xl-row-reverse { + flex-direction: row-reverse !important; } + .flex-xl-column-reverse { + flex-direction: column-reverse !important; } + .flex-xl-grow-0 { + flex-grow: 0 !important; } + .flex-xl-grow-1 { + flex-grow: 1 !important; } + .flex-xl-shrink-0 { + flex-shrink: 0 !important; } + .flex-xl-shrink-1 { + flex-shrink: 1 !important; } + .flex-xl-wrap { + flex-wrap: wrap !important; } + .flex-xl-nowrap { + flex-wrap: nowrap !important; } + .flex-xl-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-xl-start { + justify-content: flex-start !important; } + .justify-content-xl-end { + justify-content: flex-end !important; } + .justify-content-xl-center { + justify-content: center !important; } + .justify-content-xl-between { + justify-content: space-between !important; } + .justify-content-xl-around { + justify-content: space-around !important; } + .justify-content-xl-evenly { + justify-content: space-evenly !important; } + .align-items-xl-start { + align-items: flex-start !important; } + .align-items-xl-end { + align-items: flex-end !important; } + .align-items-xl-center { + align-items: center !important; } + .align-items-xl-baseline { + align-items: baseline !important; } + .align-items-xl-stretch { + align-items: stretch !important; } + .align-content-xl-start { + align-content: flex-start !important; } + .align-content-xl-end { + align-content: flex-end !important; } + .align-content-xl-center { + align-content: center !important; } + .align-content-xl-between { + align-content: space-between !important; } + .align-content-xl-around { + align-content: space-around !important; } + .align-content-xl-stretch { + align-content: stretch !important; } + .align-self-xl-auto { + align-self: auto !important; } + .align-self-xl-start { + align-self: flex-start !important; } + .align-self-xl-end { + align-self: flex-end !important; } + .align-self-xl-center { + align-self: center !important; } + .align-self-xl-baseline { + align-self: baseline !important; } + .align-self-xl-stretch { + align-self: stretch !important; } + .order-xl-first { + order: -1 !important; } + .order-xl-0 { + order: 0 !important; } + .order-xl-1 { + order: 1 !important; } + .order-xl-2 { + order: 2 !important; } + .order-xl-3 { + order: 3 !important; } + .order-xl-4 { + order: 4 !important; } + .order-xl-5 { + order: 5 !important; } + .order-xl-last { + order: 6 !important; } + .m-xl-0 { + margin: 0 !important; } + .m-xl-1 { + margin: 0.25rem !important; } + .m-xl-2 { + margin: 0.5rem !important; } + .m-xl-3 { + margin: 1rem !important; } + .m-xl-4 { + margin: 1.5rem !important; } + .m-xl-5 { + margin: 3rem !important; } + .m-xl-auto { + margin: auto !important; } + .mx-xl-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-xl-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-xl-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-xl-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-xl-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-xl-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-xl-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-xl-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-xl-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-xl-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-xl-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-xl-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-xl-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-xl-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-xl-0 { + margin-top: 0 !important; } + .mt-xl-1 { + margin-top: 0.25rem !important; } + .mt-xl-2 { + margin-top: 0.5rem !important; } + .mt-xl-3 { + margin-top: 1rem !important; } + .mt-xl-4 { + margin-top: 1.5rem !important; } + .mt-xl-5 { + margin-top: 3rem !important; } + .mt-xl-auto { + margin-top: auto !important; } + .me-xl-0 { + margin-right: 0 !important; } + .me-xl-1 { + margin-right: 0.25rem !important; } + .me-xl-2 { + margin-right: 0.5rem !important; } + .me-xl-3 { + margin-right: 1rem !important; } + .me-xl-4 { + margin-right: 1.5rem !important; } + .me-xl-5 { + margin-right: 3rem !important; } + .me-xl-auto { + margin-right: auto !important; } + .mb-xl-0 { + margin-bottom: 0 !important; } + .mb-xl-1 { + margin-bottom: 0.25rem !important; } + .mb-xl-2 { + margin-bottom: 0.5rem !important; } + .mb-xl-3 { + margin-bottom: 1rem !important; } + .mb-xl-4 { + margin-bottom: 1.5rem !important; } + .mb-xl-5 { + margin-bottom: 3rem !important; } + .mb-xl-auto { + margin-bottom: auto !important; } + .ms-xl-0 { + margin-left: 0 !important; } + .ms-xl-1 { + margin-left: 0.25rem !important; } + .ms-xl-2 { + margin-left: 0.5rem !important; } + .ms-xl-3 { + margin-left: 1rem !important; } + .ms-xl-4 { + margin-left: 1.5rem !important; } + .ms-xl-5 { + margin-left: 3rem !important; } + .ms-xl-auto { + margin-left: auto !important; } + .m-xl-n1 { + margin: -0.25rem !important; } + .m-xl-n2 { + margin: -0.5rem !important; } + .m-xl-n3 { + margin: -1rem !important; } + .m-xl-n4 { + margin: -1.5rem !important; } + .m-xl-n5 { + margin: -3rem !important; } + .mx-xl-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-xl-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-xl-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-xl-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-xl-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-xl-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-xl-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-xl-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-xl-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-xl-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-xl-n1 { + margin-top: -0.25rem !important; } + .mt-xl-n2 { + margin-top: -0.5rem !important; } + .mt-xl-n3 { + margin-top: -1rem !important; } + .mt-xl-n4 { + margin-top: -1.5rem !important; } + .mt-xl-n5 { + margin-top: -3rem !important; } + .me-xl-n1 { + margin-right: -0.25rem !important; } + .me-xl-n2 { + margin-right: -0.5rem !important; } + .me-xl-n3 { + margin-right: -1rem !important; } + .me-xl-n4 { + margin-right: -1.5rem !important; } + .me-xl-n5 { + margin-right: -3rem !important; } + .mb-xl-n1 { + margin-bottom: -0.25rem !important; } + .mb-xl-n2 { + margin-bottom: -0.5rem !important; } + .mb-xl-n3 { + margin-bottom: -1rem !important; } + .mb-xl-n4 { + margin-bottom: -1.5rem !important; } + .mb-xl-n5 { + margin-bottom: -3rem !important; } + .ms-xl-n1 { + margin-left: -0.25rem !important; } + .ms-xl-n2 { + margin-left: -0.5rem !important; } + .ms-xl-n3 { + margin-left: -1rem !important; } + .ms-xl-n4 { + margin-left: -1.5rem !important; } + .ms-xl-n5 { + margin-left: -3rem !important; } + .p-xl-0 { + padding: 0 !important; } + .p-xl-1 { + padding: 0.25rem !important; } + .p-xl-2 { + padding: 0.5rem !important; } + .p-xl-3 { + padding: 1rem !important; } + .p-xl-4 { + padding: 1.5rem !important; } + .p-xl-5 { + padding: 3rem !important; } + .px-xl-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-xl-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-xl-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-xl-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-xl-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-xl-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-xl-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-xl-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-xl-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-xl-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-xl-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-xl-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-xl-0 { + padding-top: 0 !important; } + .pt-xl-1 { + padding-top: 0.25rem !important; } + .pt-xl-2 { + padding-top: 0.5rem !important; } + .pt-xl-3 { + padding-top: 1rem !important; } + .pt-xl-4 { + padding-top: 1.5rem !important; } + .pt-xl-5 { + padding-top: 3rem !important; } + .pe-xl-0 { + padding-right: 0 !important; } + .pe-xl-1 { + padding-right: 0.25rem !important; } + .pe-xl-2 { + padding-right: 0.5rem !important; } + .pe-xl-3 { + padding-right: 1rem !important; } + .pe-xl-4 { + padding-right: 1.5rem !important; } + .pe-xl-5 { + padding-right: 3rem !important; } + .pb-xl-0 { + padding-bottom: 0 !important; } + .pb-xl-1 { + padding-bottom: 0.25rem !important; } + .pb-xl-2 { + padding-bottom: 0.5rem !important; } + .pb-xl-3 { + padding-bottom: 1rem !important; } + .pb-xl-4 { + padding-bottom: 1.5rem !important; } + .pb-xl-5 { + padding-bottom: 3rem !important; } + .ps-xl-0 { + padding-left: 0 !important; } + .ps-xl-1 { + padding-left: 0.25rem !important; } + .ps-xl-2 { + padding-left: 0.5rem !important; } + .ps-xl-3 { + padding-left: 1rem !important; } + .ps-xl-4 { + padding-left: 1.5rem !important; } + .ps-xl-5 { + padding-left: 3rem !important; } + .gap-xl-0 { + gap: 0 !important; } + .gap-xl-1 { + gap: 0.25rem !important; } + .gap-xl-2 { + gap: 0.5rem !important; } + .gap-xl-3 { + gap: 1rem !important; } + .gap-xl-4 { + gap: 1.5rem !important; } + .gap-xl-5 { + gap: 3rem !important; } + .row-gap-xl-0 { + row-gap: 0 !important; } + .row-gap-xl-1 { + row-gap: 0.25rem !important; } + .row-gap-xl-2 { + row-gap: 0.5rem !important; } + .row-gap-xl-3 { + row-gap: 1rem !important; } + .row-gap-xl-4 { + row-gap: 1.5rem !important; } + .row-gap-xl-5 { + row-gap: 3rem !important; } + .column-gap-xl-0 { + column-gap: 0 !important; } + .column-gap-xl-1 { + column-gap: 0.25rem !important; } + .column-gap-xl-2 { + column-gap: 0.5rem !important; } + .column-gap-xl-3 { + column-gap: 1rem !important; } + .column-gap-xl-4 { + column-gap: 1.5rem !important; } + .column-gap-xl-5 { + column-gap: 3rem !important; } + .text-xl-start { + text-align: left !important; } + .text-xl-end { + text-align: right !important; } + .text-xl-center { + text-align: center !important; } } + +@media (min-width: 1400px) { + .float-xxl-start { + float: left !important; } + .float-xxl-end { + float: right !important; } + .float-xxl-none { + float: none !important; } + .object-fit-xxl-contain { + object-fit: contain !important; } + .object-fit-xxl-cover { + object-fit: cover !important; } + .object-fit-xxl-fill { + object-fit: fill !important; } + .object-fit-xxl-scale { + object-fit: scale-down !important; } + .object-fit-xxl-none { + object-fit: none !important; } + .d-xxl-inline { + display: inline !important; } + .d-xxl-inline-block { + display: inline-block !important; } + .d-xxl-block { + display: block !important; } + .d-xxl-grid { + display: grid !important; } + .d-xxl-inline-grid { + display: inline-grid !important; } + .d-xxl-table { + display: table !important; } + .d-xxl-table-row { + display: table-row !important; } + .d-xxl-table-cell { + display: table-cell !important; } + .d-xxl-flex { + display: flex !important; } + .d-xxl-inline-flex { + display: inline-flex !important; } + .d-xxl-none { + display: none !important; } + .flex-xxl-fill { + flex: 1 1 auto !important; } + .flex-xxl-row { + flex-direction: row !important; } + .flex-xxl-column { + flex-direction: column !important; } + .flex-xxl-row-reverse { + flex-direction: row-reverse !important; } + .flex-xxl-column-reverse { + flex-direction: column-reverse !important; } + .flex-xxl-grow-0 { + flex-grow: 0 !important; } + .flex-xxl-grow-1 { + flex-grow: 1 !important; } + .flex-xxl-shrink-0 { + flex-shrink: 0 !important; } + .flex-xxl-shrink-1 { + flex-shrink: 1 !important; } + .flex-xxl-wrap { + flex-wrap: wrap !important; } + .flex-xxl-nowrap { + flex-wrap: nowrap !important; } + .flex-xxl-wrap-reverse { + flex-wrap: wrap-reverse !important; } + .justify-content-xxl-start { + justify-content: flex-start !important; } + .justify-content-xxl-end { + justify-content: flex-end !important; } + .justify-content-xxl-center { + justify-content: center !important; } + .justify-content-xxl-between { + justify-content: space-between !important; } + .justify-content-xxl-around { + justify-content: space-around !important; } + .justify-content-xxl-evenly { + justify-content: space-evenly !important; } + .align-items-xxl-start { + align-items: flex-start !important; } + .align-items-xxl-end { + align-items: flex-end !important; } + .align-items-xxl-center { + align-items: center !important; } + .align-items-xxl-baseline { + align-items: baseline !important; } + .align-items-xxl-stretch { + align-items: stretch !important; } + .align-content-xxl-start { + align-content: flex-start !important; } + .align-content-xxl-end { + align-content: flex-end !important; } + .align-content-xxl-center { + align-content: center !important; } + .align-content-xxl-between { + align-content: space-between !important; } + .align-content-xxl-around { + align-content: space-around !important; } + .align-content-xxl-stretch { + align-content: stretch !important; } + .align-self-xxl-auto { + align-self: auto !important; } + .align-self-xxl-start { + align-self: flex-start !important; } + .align-self-xxl-end { + align-self: flex-end !important; } + .align-self-xxl-center { + align-self: center !important; } + .align-self-xxl-baseline { + align-self: baseline !important; } + .align-self-xxl-stretch { + align-self: stretch !important; } + .order-xxl-first { + order: -1 !important; } + .order-xxl-0 { + order: 0 !important; } + .order-xxl-1 { + order: 1 !important; } + .order-xxl-2 { + order: 2 !important; } + .order-xxl-3 { + order: 3 !important; } + .order-xxl-4 { + order: 4 !important; } + .order-xxl-5 { + order: 5 !important; } + .order-xxl-last { + order: 6 !important; } + .m-xxl-0 { + margin: 0 !important; } + .m-xxl-1 { + margin: 0.25rem !important; } + .m-xxl-2 { + margin: 0.5rem !important; } + .m-xxl-3 { + margin: 1rem !important; } + .m-xxl-4 { + margin: 1.5rem !important; } + .m-xxl-5 { + margin: 3rem !important; } + .m-xxl-auto { + margin: auto !important; } + .mx-xxl-0 { + margin-right: 0 !important; + margin-left: 0 !important; } + .mx-xxl-1 { + margin-right: 0.25rem !important; + margin-left: 0.25rem !important; } + .mx-xxl-2 { + margin-right: 0.5rem !important; + margin-left: 0.5rem !important; } + .mx-xxl-3 { + margin-right: 1rem !important; + margin-left: 1rem !important; } + .mx-xxl-4 { + margin-right: 1.5rem !important; + margin-left: 1.5rem !important; } + .mx-xxl-5 { + margin-right: 3rem !important; + margin-left: 3rem !important; } + .mx-xxl-auto { + margin-right: auto !important; + margin-left: auto !important; } + .my-xxl-0 { + margin-top: 0 !important; + margin-bottom: 0 !important; } + .my-xxl-1 { + margin-top: 0.25rem !important; + margin-bottom: 0.25rem !important; } + .my-xxl-2 { + margin-top: 0.5rem !important; + margin-bottom: 0.5rem !important; } + .my-xxl-3 { + margin-top: 1rem !important; + margin-bottom: 1rem !important; } + .my-xxl-4 { + margin-top: 1.5rem !important; + margin-bottom: 1.5rem !important; } + .my-xxl-5 { + margin-top: 3rem !important; + margin-bottom: 3rem !important; } + .my-xxl-auto { + margin-top: auto !important; + margin-bottom: auto !important; } + .mt-xxl-0 { + margin-top: 0 !important; } + .mt-xxl-1 { + margin-top: 0.25rem !important; } + .mt-xxl-2 { + margin-top: 0.5rem !important; } + .mt-xxl-3 { + margin-top: 1rem !important; } + .mt-xxl-4 { + margin-top: 1.5rem !important; } + .mt-xxl-5 { + margin-top: 3rem !important; } + .mt-xxl-auto { + margin-top: auto !important; } + .me-xxl-0 { + margin-right: 0 !important; } + .me-xxl-1 { + margin-right: 0.25rem !important; } + .me-xxl-2 { + margin-right: 0.5rem !important; } + .me-xxl-3 { + margin-right: 1rem !important; } + .me-xxl-4 { + margin-right: 1.5rem !important; } + .me-xxl-5 { + margin-right: 3rem !important; } + .me-xxl-auto { + margin-right: auto !important; } + .mb-xxl-0 { + margin-bottom: 0 !important; } + .mb-xxl-1 { + margin-bottom: 0.25rem !important; } + .mb-xxl-2 { + margin-bottom: 0.5rem !important; } + .mb-xxl-3 { + margin-bottom: 1rem !important; } + .mb-xxl-4 { + margin-bottom: 1.5rem !important; } + .mb-xxl-5 { + margin-bottom: 3rem !important; } + .mb-xxl-auto { + margin-bottom: auto !important; } + .ms-xxl-0 { + margin-left: 0 !important; } + .ms-xxl-1 { + margin-left: 0.25rem !important; } + .ms-xxl-2 { + margin-left: 0.5rem !important; } + .ms-xxl-3 { + margin-left: 1rem !important; } + .ms-xxl-4 { + margin-left: 1.5rem !important; } + .ms-xxl-5 { + margin-left: 3rem !important; } + .ms-xxl-auto { + margin-left: auto !important; } + .m-xxl-n1 { + margin: -0.25rem !important; } + .m-xxl-n2 { + margin: -0.5rem !important; } + .m-xxl-n3 { + margin: -1rem !important; } + .m-xxl-n4 { + margin: -1.5rem !important; } + .m-xxl-n5 { + margin: -3rem !important; } + .mx-xxl-n1 { + margin-right: -0.25rem !important; + margin-left: -0.25rem !important; } + .mx-xxl-n2 { + margin-right: -0.5rem !important; + margin-left: -0.5rem !important; } + .mx-xxl-n3 { + margin-right: -1rem !important; + margin-left: -1rem !important; } + .mx-xxl-n4 { + margin-right: -1.5rem !important; + margin-left: -1.5rem !important; } + .mx-xxl-n5 { + margin-right: -3rem !important; + margin-left: -3rem !important; } + .my-xxl-n1 { + margin-top: -0.25rem !important; + margin-bottom: -0.25rem !important; } + .my-xxl-n2 { + margin-top: -0.5rem !important; + margin-bottom: -0.5rem !important; } + .my-xxl-n3 { + margin-top: -1rem !important; + margin-bottom: -1rem !important; } + .my-xxl-n4 { + margin-top: -1.5rem !important; + margin-bottom: -1.5rem !important; } + .my-xxl-n5 { + margin-top: -3rem !important; + margin-bottom: -3rem !important; } + .mt-xxl-n1 { + margin-top: -0.25rem !important; } + .mt-xxl-n2 { + margin-top: -0.5rem !important; } + .mt-xxl-n3 { + margin-top: -1rem !important; } + .mt-xxl-n4 { + margin-top: -1.5rem !important; } + .mt-xxl-n5 { + margin-top: -3rem !important; } + .me-xxl-n1 { + margin-right: -0.25rem !important; } + .me-xxl-n2 { + margin-right: -0.5rem !important; } + .me-xxl-n3 { + margin-right: -1rem !important; } + .me-xxl-n4 { + margin-right: -1.5rem !important; } + .me-xxl-n5 { + margin-right: -3rem !important; } + .mb-xxl-n1 { + margin-bottom: -0.25rem !important; } + .mb-xxl-n2 { + margin-bottom: -0.5rem !important; } + .mb-xxl-n3 { + margin-bottom: -1rem !important; } + .mb-xxl-n4 { + margin-bottom: -1.5rem !important; } + .mb-xxl-n5 { + margin-bottom: -3rem !important; } + .ms-xxl-n1 { + margin-left: -0.25rem !important; } + .ms-xxl-n2 { + margin-left: -0.5rem !important; } + .ms-xxl-n3 { + margin-left: -1rem !important; } + .ms-xxl-n4 { + margin-left: -1.5rem !important; } + .ms-xxl-n5 { + margin-left: -3rem !important; } + .p-xxl-0 { + padding: 0 !important; } + .p-xxl-1 { + padding: 0.25rem !important; } + .p-xxl-2 { + padding: 0.5rem !important; } + .p-xxl-3 { + padding: 1rem !important; } + .p-xxl-4 { + padding: 1.5rem !important; } + .p-xxl-5 { + padding: 3rem !important; } + .px-xxl-0 { + padding-right: 0 !important; + padding-left: 0 !important; } + .px-xxl-1 { + padding-right: 0.25rem !important; + padding-left: 0.25rem !important; } + .px-xxl-2 { + padding-right: 0.5rem !important; + padding-left: 0.5rem !important; } + .px-xxl-3 { + padding-right: 1rem !important; + padding-left: 1rem !important; } + .px-xxl-4 { + padding-right: 1.5rem !important; + padding-left: 1.5rem !important; } + .px-xxl-5 { + padding-right: 3rem !important; + padding-left: 3rem !important; } + .py-xxl-0 { + padding-top: 0 !important; + padding-bottom: 0 !important; } + .py-xxl-1 { + padding-top: 0.25rem !important; + padding-bottom: 0.25rem !important; } + .py-xxl-2 { + padding-top: 0.5rem !important; + padding-bottom: 0.5rem !important; } + .py-xxl-3 { + padding-top: 1rem !important; + padding-bottom: 1rem !important; } + .py-xxl-4 { + padding-top: 1.5rem !important; + padding-bottom: 1.5rem !important; } + .py-xxl-5 { + padding-top: 3rem !important; + padding-bottom: 3rem !important; } + .pt-xxl-0 { + padding-top: 0 !important; } + .pt-xxl-1 { + padding-top: 0.25rem !important; } + .pt-xxl-2 { + padding-top: 0.5rem !important; } + .pt-xxl-3 { + padding-top: 1rem !important; } + .pt-xxl-4 { + padding-top: 1.5rem !important; } + .pt-xxl-5 { + padding-top: 3rem !important; } + .pe-xxl-0 { + padding-right: 0 !important; } + .pe-xxl-1 { + padding-right: 0.25rem !important; } + .pe-xxl-2 { + padding-right: 0.5rem !important; } + .pe-xxl-3 { + padding-right: 1rem !important; } + .pe-xxl-4 { + padding-right: 1.5rem !important; } + .pe-xxl-5 { + padding-right: 3rem !important; } + .pb-xxl-0 { + padding-bottom: 0 !important; } + .pb-xxl-1 { + padding-bottom: 0.25rem !important; } + .pb-xxl-2 { + padding-bottom: 0.5rem !important; } + .pb-xxl-3 { + padding-bottom: 1rem !important; } + .pb-xxl-4 { + padding-bottom: 1.5rem !important; } + .pb-xxl-5 { + padding-bottom: 3rem !important; } + .ps-xxl-0 { + padding-left: 0 !important; } + .ps-xxl-1 { + padding-left: 0.25rem !important; } + .ps-xxl-2 { + padding-left: 0.5rem !important; } + .ps-xxl-3 { + padding-left: 1rem !important; } + .ps-xxl-4 { + padding-left: 1.5rem !important; } + .ps-xxl-5 { + padding-left: 3rem !important; } + .gap-xxl-0 { + gap: 0 !important; } + .gap-xxl-1 { + gap: 0.25rem !important; } + .gap-xxl-2 { + gap: 0.5rem !important; } + .gap-xxl-3 { + gap: 1rem !important; } + .gap-xxl-4 { + gap: 1.5rem !important; } + .gap-xxl-5 { + gap: 3rem !important; } + .row-gap-xxl-0 { + row-gap: 0 !important; } + .row-gap-xxl-1 { + row-gap: 0.25rem !important; } + .row-gap-xxl-2 { + row-gap: 0.5rem !important; } + .row-gap-xxl-3 { + row-gap: 1rem !important; } + .row-gap-xxl-4 { + row-gap: 1.5rem !important; } + .row-gap-xxl-5 { + row-gap: 3rem !important; } + .column-gap-xxl-0 { + column-gap: 0 !important; } + .column-gap-xxl-1 { + column-gap: 0.25rem !important; } + .column-gap-xxl-2 { + column-gap: 0.5rem !important; } + .column-gap-xxl-3 { + column-gap: 1rem !important; } + .column-gap-xxl-4 { + column-gap: 1.5rem !important; } + .column-gap-xxl-5 { + column-gap: 3rem !important; } + .text-xxl-start { + text-align: left !important; } + .text-xxl-end { + text-align: right !important; } + .text-xxl-center { + text-align: center !important; } } + +@media (min-width: 1200px) { + .fs-1 { + font-size: 2.5rem !important; } + .fs-2 { + font-size: 2rem !important; } + .fs-3 { + font-size: 1.75rem !important; } + .fs-4 { + font-size: 1.5rem !important; } } + +@media print { + .d-print-inline { + display: inline !important; } + .d-print-inline-block { + display: inline-block !important; } + .d-print-block { + display: block !important; } + .d-print-grid { + display: grid !important; } + .d-print-inline-grid { + display: inline-grid !important; } + .d-print-table { + display: table !important; } + .d-print-table-row { + display: table-row !important; } + .d-print-table-cell { + display: table-cell !important; } + .d-print-flex { + display: flex !important; } + .d-print-inline-flex { + display: inline-flex !important; } + .d-print-none { + display: none !important; } } + +/* jost-regular - latin */ +@font-face { + font-family: Jost; + font-style: normal; + font-weight: 400; + font-display: swap; + src: local("Jost Regular Regular"), local("Jost-Regular"), local("Jost* Book"), local("Jost-Book"), url("fonts/vendor/jost/jost-v4-latin-regular.woff2") format("woff2"), url("fonts/vendor/jost/jost-v4-latin-regular.woff") format("woff"); + /* Chrome 6+, Firefox 3.6+, IE 9+, Safari 5.1+ */ } + +/* jost-500 - latin */ +@font-face { + font-family: Jost; + font-style: normal; + font-weight: 500; + font-display: swap; + src: local("Jost Regular Medium"), local("JostRoman-Medium"), local("Jost* Medium"), local("Jost-Medium"), url("fonts/vendor/jost/jost-v4-latin-500.woff2") format("woff2"), url("fonts/vendor/jost/jost-v4-latin-500.woff") format("woff"); + /* Chrome 6+, Firefox 3.6+, IE 9+, Safari 5.1+ */ } + +/* jost-700 - latin */ +@font-face { + font-family: Jost; + font-style: normal; + font-weight: 700; + font-display: swap; + src: local("Jost Regular Bold"), local("JostRoman-Bold"), local("Jost* Bold"), local("Jost-Bold"), url("fonts/vendor/jost/jost-v4-latin-700.woff2") format("woff2"), url("fonts/vendor/jost/jost-v4-latin-700.woff") format("woff"); + /* Chrome 6+, Firefox 3.6+, IE 9+, Safari 5.1+ */ } + +/* jost-italic - latin */ +@font-face { + font-family: Jost; + font-style: italic; + font-weight: 400; + font-display: swap; + src: local("Jost Italic Italic"), local("Jost-Italic"), local("Jost* BookItalic"), local("Jost-BookItalic"), url("fonts/vendor/jost/jost-v4-latin-italic.woff2") format("woff2"), url("fonts/vendor/jost/jost-v4-latin-italic.woff") format("woff"); + /* Chrome 6+, Firefox 3.6+, IE 9+, Safari 5.1+ */ } + +/* jost-500italic - latin */ +@font-face { + font-family: Jost; + font-style: italic; + font-weight: 500; + font-display: swap; + src: local("Jost Italic Medium Italic"), local("JostItalic-Medium"), local("Jost* Medium Italic"), local("Jost-MediumItalic"), url("fonts/vendor/jost/jost-v4-latin-500italic.woff2") format("woff2"), url("fonts/vendor/jost/jost-v4-latin-500italic.woff") format("woff"); + /* Chrome 6+, Firefox 3.6+, IE 9+, Safari 5.1+ */ } + +/* jost-700italic - latin */ +@font-face { + font-family: Jost; + font-style: italic; + font-weight: 700; + font-display: swap; + src: local("Jost Italic Bold Italic"), local("JostItalic-Bold"), local("Jost* Bold Italic"), local("Jost-BoldItalic"), url("fonts/vendor/jost/jost-v4-latin-700italic.woff2") format("woff2"), url("fonts/vendor/jost/jost-v4-latin-700italic.woff") format("woff"); + /* Chrome 6+, Firefox 3.6+, IE 9+, Safari 5.1+ */ } + +/* Show the sun icon if the bs theme is dark */ +html[data-bs-theme="dark"] .icon-tabler-sun { + display: block; } + +html[data-bs-theme="dark"] .icon-tabler-moon { + display: none; } + +/* Show the moon icon if the bs theme is light */ +html[data-bs-theme="light"] .icon-tabler-sun { + display: none; } + +html[data-bs-theme="light"] .icon-tabler-moon { + display: block; } + +/* +.section:not(body.section) { + padding-top: 5rem; + padding-bottom: 5rem; +} + +.section-lg { + padding-top: 7rem; + padding-bottom: 7rem; +} +*/ +/* +.highlight .chroma { + padding: 1rem; + border-radius: var(--bs-border-radius); +} +*/ +.privacy .content, +.terms .content, +.about .content, +.contributors .content, +.blog .content, +.page .content, +.error404 .content, +.docs.list .content, +.tutorial.list .content, +.showcase.list .content, +.categories.list .content, +.tags.list .content, +.list.section .content { + padding-top: 1rem; + padding-bottom: 3rem; } + +.content img { + max-width: 100%; } + +h6, +.h6, +h5, +.h5, +h4, +.h4, +h3, +.h3, +h2, +.h2, +h1, +.h1 { + margin-top: 2rem; + margin-bottom: 1rem; } + +/* +body.docs, +body.blog { + padding-top: 0; + padding-bottom: 0; +} +*/ +@media (min-width: 768px) { + body { + font-size: 1.125rem; + /* + padding-top: 4rem !important; + */ } + h1, + h2, + h3, + h4, + h5, + h6, + .h1, + .h2, + .h3, + .h4, + .h5, + .h6 { + margin-bottom: 1.125rem; } } + +.home h1, .home .h1 { + /* font-size: calc(1.375rem + 1.5vw); */ + font-size: calc(1.875rem + 1.5vw); + margin-top: -1rem; } + +a:hover, +a:focus { + text-decoration: underline; } + +.docs-navigation .card { + transition: transform 0.3s; } + +.docs-navigation .card:hover { + transform: scale(1.025); } + +a.btn:hover, .search-form a.search-submit:hover, +a.btn:focus, +.search-form a.search-submit:focus { + text-decoration: none; } + +.section { + padding-top: 5rem; + padding-bottom: 5rem; } + +body.section { + padding-top: 0; + padding-bottom: 0; } + +.section-md { + padding-top: 3rem; + padding-bottom: 3rem; } + +.section-sm { + padding-top: 1rem; + padding-bottom: 1rem; } + +/* +.section svg { + display: inline-block; + width: 2rem; + height: 2rem; + vertical-align: text-top; +} +*/ +/* +body { + padding-top: 3.5625rem; +} +*/ +.docs-sidebar { + order: 2; } + +@media (min-width: 992px) { + .docs-sidebar { + order: 0; + border-right: 1px solid #e9ecef; } + @supports (position: -webkit-sticky) or (position: sticky) { + .docs-sidebar { + position: -webkit-sticky; + position: sticky; + top: 4.25rem; + z-index: 1000; + height: calc(100vh - 4.25rem); } + .docs-sidebar-offset { + top: 4.5rem; + height: calc(100vh - 4.5rem); } + .docs-sidebar-top { + position: static; } } } + +@media (min-width: 1200px) { + .docs-sidebar { + flex: 0 1 320px; } } + +.docs-links { + padding-bottom: 5rem; } + +@media (min-width: 992px) { + @supports (position: -webkit-sticky) or (position: sticky) { + .docs-links { + max-height: calc(100vh - 4rem); + overflow-y: scroll; } } } + +@media (min-width: 992px) { + .docs-links { + display: block; + width: auto; + margin-right: -1.5rem; + padding-bottom: 4rem; } } + +.docs-toc { + order: 2; } + +@supports (position: -webkit-sticky) or (position: sticky) { + .docs-toc { + position: -webkit-sticky; + position: sticky; + top: 4.25rem; + height: calc(100vh - 4.25rem); + overflow-y: auto; } + .docs-toc-offset { + top: 4.5rem; + height: calc(100vh - 4.5rem); } + .docs-toc-top { + position: static; } } + +.docs-content { + padding-bottom: 3rem; + order: 1; } + +.docs-navigation { + border-top: 1px solid #e9ecef; + margin-top: 2rem; + margin-bottom: 0; + padding-top: 2rem; } + +.docs-navigation a { + font-size: 0.9rem; } + +@media (min-width: 992px) { + .docs-navigation { + margin-bottom: -1rem; } + .docs-navigation a { + font-size: 1rem; } } + +.docs-navigation a:hover, +.docs-navigation a:focus { + text-decoration: none; } + +.navbar a:hover, +.navbar a:focus { + text-decoration: none; } + +#TableOfContents ul, +#toc ul { + padding-left: 0; + list-style: none; } + +#toc a.active { + color: #5d2f86; + font-weight: 500; } + +.section-features { + padding-top: 2rem; } + +.bg-dots { + background-image: radial-gradient(#dee2e6 15%, transparent 15%); + background-position: 0 0; + background-size: 1rem 1rem; + -webkit-mask: linear-gradient(to top, #fff, transparent); + mask: linear-gradient(to top, #fff, transparent); + width: 100%; + height: 11rem; + margin-top: -10rem; + z-index: -1; } + +.bg-dots-md { + margin-top: -11rem; } + +.bg-dots-lg { + margin-top: -12rem; } + +.gradient-text { + background-color: #5d2f86; + background-image: linear-gradient(90deg, #5d2f86, #b3c7ff 50%, var(--sl-color-blue)); + background-size: 100%; + background-repeat: repeat; + -webkit-background-clip: text; + -moz-background-clip: text; + -webkit-text-fill-color: transparent; + -moz-text-fill-color: transparent; } + +.katex { + font-size: 1.125rem; } + +.card-bar { + border-top: 4px solid; + border-image-source: linear-gradient(90deg, #5d2f86, #b3c7ff 50%, var(--sl-color-blue)); + border-image-slice: 1; } + +.modal-backdrop { + background-color: #fff; } + +.modal-backdrop.show { + opacity: 0.7; } + +@media (min-width: 768px) { + .modal-backdrop.show { + opacity: 0; } } + +sup[id] { + scroll-margin-top: 4.5rem; } + +div.footnotes { + font-size: 0.875rem; } + +a.footnote-backref { + text-decoration: none; } + +li input[type="checkbox"] { + margin: 0.25rem; + border: 1px solid #ced4da; } + +li input[type="checkbox"]:disabled { + pointer-events: none; + filter: none; + opacity: 1; } + +li input[type="checkbox"]:checked { + background-color: #5d2f86; + border-color: #5d2f86; } + +[data-bs-theme="dark"] li input[type="checkbox"] { + border: 1px solid #6c757d; } + +[data-bs-theme="dark"] li input[type="checkbox"]:checked { + background-color: #b3c7ff; + border-color: #b3c7ff; + --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%231d2d35' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e"); } + +.content .svg-inline { + margin-bottom: 1.5rem; } + +.content .svg-inline:not(.svg-inline-custom) { + height: 1.875rem; + width: 1.875rem; + stroke-width: 1.5; } + +/* +.content .alert .icon { + stroke-width: 1; + margin-bottom: 0; + margin-right: 0.5rem; +} +*/ +.logo-netlify-large-fullcolor-darkmode { + display: none; } + +[data-bs-theme="dark"] .logo-netlify-large-fullcolor-lightmode { + display: none; } + +[data-bs-theme="dark"] .logo-netlify-large-fullcolor-darkmode { + display: block; } + +.svg-lightmode { + display: block; } + +.svg-darkmode { + display: none; } + +.svg-monochrome path { + fill: #1d2d35; } + +[data-bs-theme="dark"] .svg-lightmode { + display: none; } + +[data-bs-theme="dark"] .svg-darkmode { + display: block; } + +[data-bs-theme="dark"] .netlify-logo path, +[data-bs-theme="dark"] .netlify-monogram path { + fill: #fff; } + +[data-bs-theme="dark"] .svg-monochrome path { + fill: var(--sl-color-gray-1); } + +hr { + border-color: #808080; } + +[data-bs-theme="dark"] hr { + border-color: var(--sl-color-gray-3); } + +.container-fw { + min-width: 0; } + +.card-nav { + column-gap: 1rem; } + +.card-nav .card { + margin: 0.5rem 0; } + +.card-nav .card:hover { + border: 1px solid #d9d9d9; + background-color: var(--sl-color-gray-7); } + +[data-bs-theme="dark"] .card-nav .card { + border: 1px solid #353841; } + +[data-bs-theme="dark"] .card-nav .card:hover { + border: 1px solid #888c96; + background-color: var(--sl-color-gray-6); } + +.highlight > .chroma { + border: 1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); } + +/* Background */ +.bg { + background-color: var(--sl-color-gray-7); } + +/* PreWrapper */ +.chroma { + background-color: var(--sl-color-gray-7); } + +/* Other */ +/* Error */ +.chroma .err { + color: inherit; } + +/* CodeLine */ +/* LineLink */ +.chroma .lnlinks { + outline: none; + text-decoration: none; + color: inherit; } + +/* LineTableTD */ +.chroma .lntd { + vertical-align: top; + padding: 0; + margin: 0; + border: 0; } + +/* LineTable */ +.chroma .lntable { + border-spacing: 0; + padding: 0; + margin: 0; + border: 0; } + +/* LineHighlight */ +.chroma .hl { + background-color: #0000001a; } + +.chroma .hl { + border-inline-start: 0.15rem solid #00000055; + margin-left: -1rem; + margin-right: -1rem; + padding-left: 1rem; + padding-right: 1rem; } + .chroma .hl .ln { + margin-left: -0.15rem; } + +/* LineNumbersTable */ +.chroma .lnt { + white-space: pre; + -webkit-user-select: none; + user-select: none; + margin-right: 0.4em; + padding: 0 0.4em 0 0.4em; + color: #7f7f7f; } + +/* LineNumbers */ +.chroma .ln { + white-space: pre; + -webkit-user-select: none; + user-select: none; + margin-right: 0.4em; + padding: 0 0.4em 0 0.4em; + color: #7f7f7f; } + +/* Line */ +.chroma .line { + display: flex; } + +/* Keyword */ +.chroma .k { + color: #000000; + font-weight: bold; } + +/* KeywordConstant */ +.chroma .kc { + color: #000000; + font-weight: bold; } + +/* KeywordDeclaration */ +.chroma .kd { + color: #000000; + font-weight: bold; } + +/* KeywordNamespace */ +.chroma .kn { + color: #000000; + font-weight: bold; } + +/* KeywordPseudo */ +.chroma .kp { + color: #000000; + font-weight: bold; } + +/* KeywordReserved */ +.chroma .kr { + color: #000000; + font-weight: bold; } + +/* KeywordType */ +.chroma .kt { + color: #445588; + font-weight: bold; } + +/* Name */ +/* NameAttribute */ +.chroma .na { + color: #008080; } + +/* NameBuiltin */ +.chroma .nb { + color: #0086b3; } + +/* NameBuiltinPseudo */ +.chroma .bp { + color: #999999; } + +/* NameClass */ +.chroma .nc { + color: #445588; + font-weight: bold; } + +/* NameConstant */ +.chroma .no { + color: #008080; } + +/* NameDecorator */ +.chroma .nd { + color: #3c5d5d; + font-weight: bold; } + +/* NameEntity */ +.chroma .ni { + color: #800080; } + +/* NameException */ +.chroma .ne { + color: #990000; + font-weight: bold; } + +/* NameFunction */ +.chroma .nf { + color: #990000; + font-weight: bold; } + +/* NameFunctionMagic */ +/* NameLabel */ +.chroma .nl { + color: #990000; + font-weight: bold; } + +/* NameNamespace */ +.chroma .nn { + color: #555555; } + +/* NameOther */ +/* NameProperty */ +/* NameTag */ +.chroma .nt { + color: #000080; } + +/* NameVariable */ +.chroma .nv { + color: #008080; } + +/* NameVariableClass */ +.chroma .vc { + color: #008080; } + +/* NameVariableGlobal */ +.chroma .vg { + color: #008080; } + +/* NameVariableInstance */ +.chroma .vi { + color: #008080; } + +/* NameVariableMagic */ +/* Literal */ +/* LiteralDate */ +/* LiteralString */ +.chroma .s { + color: #dd1144; } + +/* LiteralStringAffix */ +.chroma .sa { + color: #dd1144; } + +/* LiteralStringBacktick */ +.chroma .sb { + color: #dd1144; } + +/* LiteralStringChar */ +.chroma .sc { + color: #dd1144; } + +/* LiteralStringDelimiter */ +.chroma .dl { + color: #dd1144; } + +/* LiteralStringDoc */ +.chroma .sd { + color: #dd1144; } + +/* LiteralStringDouble */ +.chroma .s2 { + color: #dd1144; } + +/* LiteralStringEscape */ +.chroma .se { + color: #dd1144; } + +/* LiteralStringHeredoc */ +.chroma .sh { + color: #dd1144; } + +/* LiteralStringInterpol */ +.chroma .si { + color: #dd1144; } + +/* LiteralStringOther */ +.chroma .sx { + color: #dd1144; } + +/* LiteralStringRegex */ +.chroma .sr { + color: #009926; } + +/* LiteralStringSingle */ +.chroma .s1 { + color: #dd1144; } + +/* LiteralStringSymbol */ +.chroma .ss { + color: #990073; } + +/* LiteralNumber */ +.chroma .m { + color: #009999; } + +/* LiteralNumberBin */ +.chroma .mb { + color: #009999; } + +/* LiteralNumberFloat */ +.chroma .mf { + color: #009999; } + +/* LiteralNumberHex */ +.chroma .mh { + color: #009999; } + +/* LiteralNumberInteger */ +.chroma .mi { + color: #009999; } + +/* LiteralNumberIntegerLong */ +.chroma .il { + color: #009999; } + +/* LiteralNumberOct */ +.chroma .mo { + color: #009999; } + +/* Operator */ +.chroma .o { + color: #000000; + font-weight: bold; } + +/* OperatorWord */ +.chroma .ow { + color: #000000; + font-weight: bold; } + +/* Punctuation */ +/* Comment */ +.chroma .c { + color: #999988; + font-style: italic; } + +/* CommentHashbang */ +.chroma .ch { + color: #999988; + font-style: italic; } + +/* CommentMultiline */ +.chroma .cm { + color: #999988; + font-style: italic; } + +/* CommentSingle */ +.chroma .c1 { + color: #999988; + font-style: italic; } + +/* CommentSpecial */ +.chroma .cs { + color: #999999; + font-weight: bold; + font-style: italic; } + +/* CommentPreproc */ +.chroma .cp { + color: #999999; + font-weight: bold; + font-style: italic; } + +/* CommentPreprocFile */ +.chroma .cpf { + color: #999999; + font-weight: bold; + font-style: italic; } + +/* Generic */ +/* GenericDeleted */ +.chroma .gd { + color: #000000; + background-color: #ffdddd; } + +/* GenericEmph */ +.chroma .ge { + color: inherit; + font-style: italic; } + +/* GenericError */ +.chroma .gr { + color: #aa0000; } + +/* GenericHeading */ +.chroma .gh { + color: #999999; } + +/* GenericInserted */ +.chroma .gi { + color: #000000; + background-color: #ddffdd; } + +/* GenericOutput */ +.chroma .go { + color: #888888; } + +/* GenericPrompt */ +.chroma .gp { + color: #555555; } + +/* GenericStrong */ +.chroma .gs { + font-weight: bold; } + +/* GenericSubheading */ +.chroma .gu { + color: #aaaaaa; } + +/* GenericTraceback */ +.chroma .gt { + color: #aa0000; } + +/* GenericUnderline */ +.chroma .gl { + text-decoration: underline; } + +/* TextWhitespace */ +.chroma .w { + color: #bbbbbb; } + +[data-bs-theme="dark"] { + /* Background */ + /* PreWrapper */ + /* Other */ + /* Error */ + /* CodeLine */ + /* LineLink */ + /* LineTableTD */ + /* LineTable */ + /* LineHighlight */ + /* LineNumbersTable */ + /* LineNumbers */ + /* Line */ + /* Keyword */ + /* KeywordConstant */ + /* KeywordDeclaration */ + /* KeywordNamespace */ + /* KeywordPseudo */ + /* KeywordReserved */ + /* KeywordType */ + /* Name */ + /* NameAttribute */ + /* NameBuiltin */ + /* NameBuiltinPseudo */ + /* NameClass */ + /* NameConstant */ + /* NameDecorator */ + /* NameEntity */ + /* NameException */ + /* NameFunction */ + /* NameFunctionMagic */ + /* NameLabel */ + /* NameNamespace */ + /* NameOther */ + /* NameProperty */ + /* NameTag */ + /* NameVariable */ + /* NameVariableClass */ + /* NameVariableGlobal */ + /* NameVariableInstance */ + /* NameVariableMagic */ + /* Literal */ + /* LiteralDate */ + /* LiteralString */ + /* LiteralStringAffix */ + /* LiteralStringBacktick */ + /* LiteralStringChar */ + /* LiteralStringDelimiter */ + /* LiteralStringDoc */ + /* LiteralStringDouble */ + /* LiteralStringEscape */ + /* LiteralStringHeredoc */ + /* LiteralStringInterpol */ + /* LiteralStringOther */ + /* LiteralStringRegex */ + /* LiteralStringSingle */ + /* LiteralStringSymbol */ + /* LiteralNumber */ + /* LiteralNumberBin */ + /* LiteralNumberFloat */ + /* LiteralNumberHex */ + /* LiteralNumberInteger */ + /* LiteralNumberIntegerLong */ + /* LiteralNumberOct */ + /* Operator */ + /* OperatorWord */ + /* Punctuation */ + /* Comment */ + /* CommentHashbang */ + /* CommentMultiline */ + /* CommentSingle */ + /* CommentSpecial */ + /* CommentPreproc */ + /* CommentPreprocFile */ + /* Generic */ + /* GenericDeleted */ + /* GenericEmph */ + /* GenericError */ + /* GenericHeading */ + /* GenericInserted */ + /* GenericOutput */ + /* GenericPrompt */ + /* GenericStrong */ + /* GenericSubheading */ + /* GenericTraceback */ + /* GenericUnderline */ + /* TextWhitespace */ } + [data-bs-theme="dark"] .highlight > .chroma { + border: 1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); } + [data-bs-theme="dark"] .bg { + color: #c9d1d9; + background-color: var(--sl-color-gray-6); } + [data-bs-theme="dark"] .chroma { + color: #c9d1d9; + background-color: var(--sl-color-gray-6); } + [data-bs-theme="dark"] .chroma .err { + color: inherit; } + [data-bs-theme="dark"] .chroma .lnlinks { + outline: none; + text-decoration: none; + color: inherit; } + [data-bs-theme="dark"] .chroma .lntd { + vertical-align: top; + padding: 0; + margin: 0; + border: 0; } + [data-bs-theme="dark"] .chroma .lntable { + border-spacing: 0; + padding: 0; + margin: 0; + border: 0; } + [data-bs-theme="dark"] .chroma .hl { + background-color: #ffffff17; } + [data-bs-theme="dark"] .chroma .hl { + border-inline-start: 0.15rem solid #ffffff40; + margin-left: -1rem; + margin-right: -1rem; + padding-left: 1rem; + padding-right: 1rem; } + [data-bs-theme="dark"] .chroma .hl .ln { + margin-left: -0.15rem; } + [data-bs-theme="dark"] .chroma .lnt { + white-space: pre; + -webkit-user-select: none; + user-select: none; + margin-right: 0.4em; + padding: 0 0.4em 0 0.4em; + color: #64686c; } + [data-bs-theme="dark"] .chroma .ln { + white-space: pre; + -webkit-user-select: none; + user-select: none; + margin-right: 0.4em; + padding: 0 0.4em 0 0.4em; + color: #6e7681; } + [data-bs-theme="dark"] .chroma .line { + display: flex; } + [data-bs-theme="dark"] .chroma .k { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .kc { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .kd { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .kn { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .kp { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .kr { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .kt { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .na { + color: #d2a8ff; } + [data-bs-theme="dark"] .chroma .nc { + color: #f0883e; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .no { + color: #79c0ff; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .nd { + color: #d2a8ff; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .ni { + color: #ffa657; } + [data-bs-theme="dark"] .chroma .ne { + color: #f0883e; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .nf { + color: #d2a8ff; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .nl { + color: #79c0ff; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .nn { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .py { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .nt { + color: #7ee787; } + [data-bs-theme="dark"] .chroma .nv { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .l { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .ld { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .s { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .sa { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .sb { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .sc { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .dl { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .sd { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .s2 { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .se { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .sh { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .si { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .sx { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .sr { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .s1 { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .ss { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .m { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .mb { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .mf { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .mh { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .mi { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .il { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .mo { + color: #a5d6ff; } + [data-bs-theme="dark"] .chroma .o { + color: inherit; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .ow { + color: #ff7b72; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .c { + color: #8b949e; + font-style: italic; } + [data-bs-theme="dark"] .chroma .ch { + color: #8b949e; + font-style: italic; } + [data-bs-theme="dark"] .chroma .cm { + color: #8b949e; + font-style: italic; } + [data-bs-theme="dark"] .chroma .c1 { + color: #8b949e; + font-style: italic; } + [data-bs-theme="dark"] .chroma .cs { + color: #8b949e; + font-weight: bold; + font-style: italic; } + [data-bs-theme="dark"] .chroma .cp { + color: #8b949e; + font-weight: bold; + font-style: italic; } + [data-bs-theme="dark"] .chroma .cpf { + color: #8b949e; + font-weight: bold; + font-style: italic; } + [data-bs-theme="dark"] .chroma .gd { + color: #ffa198; + background-color: #490202; } + [data-bs-theme="dark"] .chroma .ge { + font-style: italic; } + [data-bs-theme="dark"] .chroma .gr { + color: #ffa198; } + [data-bs-theme="dark"] .chroma .gh { + color: #79c0ff; + font-weight: bold; } + [data-bs-theme="dark"] .chroma .gi { + color: #56d364; + background-color: #0f5323; } + [data-bs-theme="dark"] .chroma .go { + color: #8b949e; } + [data-bs-theme="dark"] .chroma .gp { + color: #8b949e; } + [data-bs-theme="dark"] .chroma .gs { + font-weight: bold; } + [data-bs-theme="dark"] .chroma .gu { + color: #79c0ff; } + [data-bs-theme="dark"] .chroma .gt { + color: #ff7b72; } + [data-bs-theme="dark"] .chroma .gl { + text-decoration: underline; } + [data-bs-theme="dark"] .chroma .w { + color: #6e7681; } + +/** Theme styles */ +[data-bs-theme="dark"] { + /* +.dropdown-menu { + @extend .dropdown-menu-dark; +} +*/ + /* +.navbar-light .navbar-brand { + color: $navbar-dark-color !important; +} +*/ + /* +.navbar-form::after { + color: $gray-600; + border: 1px solid $gray-800; +} +*/ + /* +pre code::-webkit-scrollbar-thumb { + background: $gray-400; +} + +code:not(.hljs) { + background: $body-overlay-dark; + color: $body-color-dark; +} + +pre code:hover { + scrollbar-width: thin; + scrollbar-color: $border-dark transparent; +} + +pre code::-webkit-scrollbar-thumb:hover { + background: $gray-500; +} +*/ + /* +.dropdown-toggle:focus, +.doks-sidebar-toggle:focus { + box-shadow: 0 0 0 0.2rem $focus-color-dark; +} +*/ + /* +@include media-breakpoint-up(md) { + .alert-dismissible .btn-close { + background-size: 1.25rem; + } +} +*/ + /* +.btn-close:focus { + box-shadow: 0 0 0 0.2rem $focus-color-dark; +} +*/ } + [data-bs-theme="dark"] h1, [data-bs-theme="dark"] .h1, + [data-bs-theme="dark"] h2, + [data-bs-theme="dark"] .h2, + [data-bs-theme="dark"] h3, + [data-bs-theme="dark"] .h3, + [data-bs-theme="dark"] h4, + [data-bs-theme="dark"] .h4 { + color: white; } + [data-bs-theme="dark"] body { + background: #17181c; + color: #c1c3c8; } + [data-bs-theme="dark"] a { + color: #b3c7ff; } + [data-bs-theme="dark"] .callout a { + color: inherit; } + [data-bs-theme="dark"] a.text- { + color: #c1c3c8 !important; } + [data-bs-theme="dark"] .btn-primary { + --bs-btn-color: #000; + --bs-btn-bg: #b3c7ff; + --bs-btn-border-color: #b3c7ff; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #becfff; + --bs-btn-hover-border-color: #bacdff; + --bs-btn-focus-shadow-rgb: 152, 169, 217; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #c2d2ff; + --bs-btn-active-border-color: #bacdff; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #b3c7ff; + --bs-btn-disabled-border-color: #b3c7ff; + color: #17181c; } + [data-bs-theme="dark"] .btn-outline-primary { + --bs-btn-color: #b3c7ff; + --bs-btn-border-color: #b3c7ff; + --bs-btn-hover-color: #b3c7ff; + --bs-btn-hover-bg: #b3c7ff; + --bs-btn-hover-border-color: #b3c7ff; + --bs-btn-focus-shadow-rgb: 178.5, 198.9, 255; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #b3c7ff; + --bs-btn-active-border-color: #b3c7ff; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #b3c7ff; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #b3c7ff; + --bs-gradient: none; + color: #b3c7ff; } + [data-bs-theme="dark"] .btn-outline-primary:hover { + color: #17181c; } + [data-bs-theme="dark"] .btn-doks-light { + color: #c1c3c8; } + [data-bs-theme="dark"] .show > .btn-doks-light, + [data-bs-theme="dark"] .btn-doks-light:hover, + [data-bs-theme="dark"] .btn-doks-light:active { + color: #b3c7ff; } + [data-bs-theme="dark"] .btn-menu svg { + color: #c1c3c8; } + [data-bs-theme="dark"] .doks-sidebar-toggle { + color: #c1c3c8; } + [data-bs-theme="dark"] .btn-menu:hover, + [data-bs-theme="dark"] .btn-doks-light:hover, + [data-bs-theme="dark"] .doks-sidebar-toggle:hover { + background: transparent; } + [data-bs-theme="dark"] .navbar, + [data-bs-theme="dark"] .doks-subnavbar { + background-color: rgba(23, 24, 28, 0.95); + border-bottom: 1px solid #23262f; } + [data-bs-theme="dark"] body.home .navbar { + border-bottom: 0; } + [data-bs-theme="dark"] .offcanvas-header { + border-bottom: 1px solid #343a40; } + [data-bs-theme="dark"] .offcanvas .nav-link, [data-bs-theme="dark"] .offcanvas .banner .nav a, .banner .nav [data-bs-theme="dark"] .offcanvas a { + color: #c1c3c8; } + [data-bs-theme="dark"] .offcanvas .nav-link:hover, [data-bs-theme="dark"] .offcanvas .banner .nav a:hover, .banner .nav [data-bs-theme="dark"] .offcanvas a:hover, + [data-bs-theme="dark"] .offcanvas .nav-link:focus, + [data-bs-theme="dark"] .offcanvas .banner .nav a:focus, + .banner .nav [data-bs-theme="dark"] .offcanvas a:focus { + color: #b3c7ff; } + [data-bs-theme="dark"] .offcanvas .nav-link.active, [data-bs-theme="dark"] .offcanvas .banner .nav a.active, .banner .nav [data-bs-theme="dark"] .offcanvas a.active { + color: #b3c7ff; } + [data-bs-theme="dark"] .navbar-light .navbar-nav .nav-link, [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav a, .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav a { + color: #c1c3c8; } + [data-bs-theme="dark"] .navbar-light .navbar-nav .nav-link:hover, [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav a:hover, .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav a:hover, + [data-bs-theme="dark"] .navbar-light .navbar-nav .nav-link:focus, + [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav a:focus, + .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav a:focus { + color: #b3c7ff; } + [data-bs-theme="dark"] .navbar-light .navbar-nav .nav-link.disabled, [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav a.disabled, .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav a.disabled { + color: rgba(255, 255, 255, 0.25); } + [data-bs-theme="dark"] .navbar-light .navbar-nav .show > .nav-link, [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav .show > a, .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav .show > a, + [data-bs-theme="dark"] .navbar-light .navbar-nav .active > .nav-link, + [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav .active > a, + .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav .active > a, + [data-bs-theme="dark"] .navbar-light .navbar-nav .nav-link.show, + [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav a.show, + .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav a.show, + [data-bs-theme="dark"] .navbar-light .navbar-nav .nav-link.active, + [data-bs-theme="dark"] .navbar-light .navbar-nav .banner .nav a.active, + .banner .nav [data-bs-theme="dark"] .navbar-light .navbar-nav a.active { + color: #b3c7ff; } + [data-bs-theme="dark"] .navbar-light .navbar-text { + color: #c1c3c8; } + [data-bs-theme="dark"] .alert-primary a { + color: #17181c; } + [data-bs-theme="dark"] .alert-doks { + background: #23262f; + color: #c1c3c8; } + [data-bs-theme="dark"] .alert-doks a { + color: #b3c7ff; } + [data-bs-theme="dark"] .page-links a { + color: #c1c3c8; } + [data-bs-theme="dark"] .btn-toggle-nav a { + color: #c1c3c8; } + [data-bs-theme="dark"] .showcase-meta a { + color: #c1c3c8; } + [data-bs-theme="dark"] .showcase-meta a:hover, + [data-bs-theme="dark"] .showcase-meta a:focus { + color: #b3c7ff; } + [data-bs-theme="dark"] .docs-link:hover, + [data-bs-theme="dark"] .docs-link.active, + [data-bs-theme="dark"] .page-links a:hover { + text-decoration: none; + color: #b3c7ff; } + [data-bs-theme="dark"] .btn-toggle { + color: #c1c3c8; + background-color: transparent; + border: 0; } + [data-bs-theme="dark"] .btn-toggle:hover, + [data-bs-theme="dark"] .btn-toggle:focus { + color: #c1c3c8; } + [data-bs-theme="dark"] .btn-toggle::before { + width: 1.25em; + line-height: 0; + content: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%28222, 226, 230, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e"); + transition: transform 0.35s ease; + transform-origin: 0.5em 50%; + margin-bottom: 0.125rem; } + [data-bs-theme="dark"] .btn-toggle[aria-expanded="true"] { + color: #c1c3c8; } + [data-bs-theme="dark"] .btn-toggle[aria-expanded="true"]::before { + transform: rotate(90deg); } + [data-bs-theme="dark"] .btn-toggle-nav a:hover, + [data-bs-theme="dark"] .btn-toggle-nav a:focus { + color: #b3c7ff; } + [data-bs-theme="dark"] .btn-toggle-nav a.active { + color: #b3c7ff; } + [data-bs-theme="dark"] .navbar-light .navbar-text a { + color: #b3c7ff; } + [data-bs-theme="dark"] .docs-links h3.sidebar-link a, [data-bs-theme="dark"] .docs-links .sidebar-link.h3 a, + [data-bs-theme="dark"] .page-links h3.sidebar-link a, + [data-bs-theme="dark"] .page-links .sidebar-link.h3 a { + color: #c1c3c8; } + [data-bs-theme="dark"] .navbar-light .navbar-text a:hover, + [data-bs-theme="dark"] .navbar-light .navbar-text a:focus { + color: #b3c7ff; } + [data-bs-theme="dark"] .navbar .btn-link { + color: #c1c3c8; } + [data-bs-theme="dark"] .content .btn-link { + color: #b3c7ff; } + [data-bs-theme="dark"] .content .btn-link:hover { + color: #b3c7ff; } + [data-bs-theme="dark"] .content img[src^="https://latex.codecogs.com/svg.latex"] { + filter: invert(1); } + [data-bs-theme="dark"] .navbar .btn-link:hover { + color: #b3c7ff; } + [data-bs-theme="dark"] .navbar .btn-link:active { + color: #b3c7ff; } + [data-bs-theme="dark"] .form-control.is-search, [data-bs-theme="dark"] .search-form .is-search.search-field, .search-form [data-bs-theme="dark"] .is-search.search-field, [data-bs-theme="dark"] .comment-form input.is-search[type="text"], .comment-form [data-bs-theme="dark"] input.is-search[type="text"], + [data-bs-theme="dark"] .comment-form input.is-search[type="email"], + .comment-form [data-bs-theme="dark"] input.is-search[type="email"], + [data-bs-theme="dark"] .comment-form input.is-search[type="url"], + .comment-form [data-bs-theme="dark"] input.is-search[type="url"], + [data-bs-theme="dark"] .comment-form textarea.is-search, + .comment-form [data-bs-theme="dark"] textarea.is-search { + background: #23262f; + border: 1px solid transparent; + color: #dee2e6; + /* + background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='20' height='20' viewBox='0 0 24 24' fill='none' stroke='%236c757d' stroke-width='2' stroke-linecap='round' stroke-linejoin='round' class='feather feather-search'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E"); + background-repeat: no-repeat; + background-position: right calc(0.375em + 0.1875rem) center; + background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); + */ } + [data-bs-theme="dark"] .form-control.is-search:focus, [data-bs-theme="dark"] .search-form .is-search.search-field:focus, .search-form [data-bs-theme="dark"] .is-search.search-field:focus, [data-bs-theme="dark"] .comment-form input.is-search[type="text"]:focus, .comment-form [data-bs-theme="dark"] input.is-search[type="text"]:focus, + [data-bs-theme="dark"] .comment-form input.is-search[type="email"]:focus, + .comment-form [data-bs-theme="dark"] input.is-search[type="email"]:focus, + [data-bs-theme="dark"] .comment-form input.is-search[type="url"]:focus, + .comment-form [data-bs-theme="dark"] input.is-search[type="url"]:focus, + [data-bs-theme="dark"] .comment-form textarea.is-search:focus, + .comment-form [data-bs-theme="dark"] textarea.is-search:focus { + border: 1px solid #b3c7ff; } + [data-bs-theme="dark"] .doks-search::after { + color: #dee2e6; + border: 1px solid #495057; } + [data-bs-theme="dark"] .text-dark { + color: #c1c3c8 !important; } + [data-bs-theme="dark"] .form-control, [data-bs-theme="dark"] .search-form .search-field, .search-form [data-bs-theme="dark"] .search-field, [data-bs-theme="dark"] .comment-form input[type="text"], .comment-form [data-bs-theme="dark"] input[type="text"], + [data-bs-theme="dark"] .comment-form input[type="email"], + .comment-form [data-bs-theme="dark"] input[type="email"], + [data-bs-theme="dark"] .comment-form input[type="url"], + .comment-form [data-bs-theme="dark"] input[type="url"], + [data-bs-theme="dark"] .comment-form textarea, + .comment-form [data-bs-theme="dark"] textarea { + color: #dee2e6; } + [data-bs-theme="dark"] .form-control::placeholder, [data-bs-theme="dark"] .search-form .search-field::placeholder, .search-form [data-bs-theme="dark"] .search-field::placeholder, [data-bs-theme="dark"] .comment-form input[type="text"]::placeholder, .comment-form [data-bs-theme="dark"] input[type="text"]::placeholder, + [data-bs-theme="dark"] .comment-form input[type="email"]::placeholder, + .comment-form [data-bs-theme="dark"] input[type="email"]::placeholder, + [data-bs-theme="dark"] .comment-form input[type="url"]::placeholder, + .comment-form [data-bs-theme="dark"] input[type="url"]::placeholder, + [data-bs-theme="dark"] .comment-form textarea::placeholder, + .comment-form [data-bs-theme="dark"] textarea::placeholder { + color: #ced4da; + opacity: 1; } + [data-bs-theme="dark"] .border-top { + border-top: 1px solid #23262f !important; } + @media (min-width: 992px) { + [data-bs-theme="dark"] .docs-sidebar { + order: 0; + border-right: 1px solid #23262f; } } + [data-bs-theme="dark"] .docs-navigation { + border-top: 1px solid #23262f; } + [data-bs-theme="dark"] blockquote { + border-left: 3px solid #23262f; } + [data-bs-theme="dark"] .footer { + border-top: 1px solid #23262f; } + [data-bs-theme="dark"] .docs-links, + [data-bs-theme="dark"] .docs-toc { + scrollbar-width: thin; + scrollbar-color: #17181c #17181c; } + [data-bs-theme="dark"] .docs-links::-webkit-scrollbar, + [data-bs-theme="dark"] .docs-toc::-webkit-scrollbar { + width: 5px; } + [data-bs-theme="dark"] .docs-links::-webkit-scrollbar-track, + [data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-track { + background: #17181c; } + [data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb, + [data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb { + background: #17181c; } + [data-bs-theme="dark"] .docs-links:hover, + [data-bs-theme="dark"] .docs-toc:hover { + scrollbar-width: thin; + scrollbar-color: #23262f #17181c; } + [data-bs-theme="dark"] .docs-links:hover::-webkit-scrollbar-thumb, + [data-bs-theme="dark"] .docs-toc:hover::-webkit-scrollbar-thumb { + background: #23262f; } + [data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb:hover, + [data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb:hover { + background: #23262f; } + [data-bs-theme="dark"] .docs-links h3:not(:first-child), [data-bs-theme="dark"] .docs-links .h3:not(:first-child) { + border-top: 1px solid #23262f; } + [data-bs-theme="dark"] a.docs-link { + color: #c1c3c8; } + [data-bs-theme="dark"] .page-links li:not(:first-child) { + border-top: 1px dashed #23262f; } + [data-bs-theme="dark"] .card { + background: #17181c; + border: 1px solid #23262f; } + [data-bs-theme="dark"] .card.bg-light { + background: #23262f !important; } + [data-bs-theme="dark"] .navbar .menu-icon .navicon { + background: #c1c3c8; } + [data-bs-theme="dark"] .navbar .menu-icon .navicon::before, + [data-bs-theme="dark"] .navbar .menu-icon .navicon::after { + background: #c1c3c8; } + [data-bs-theme="dark"] .logo-light { + display: none !important; } + [data-bs-theme="dark"] .logo-dark { + display: inline-block !important; } + [data-bs-theme="dark"] .bg-light { + background: #141518 !important; } + [data-bs-theme="dark"] .bg-dots { + background-image: radial-gradient(#414349 15%, transparent 15%); } + [data-bs-theme="dark"] .text-muted { + color: #adafb6 !important; } + [data-bs-theme="dark"] .alert-primary { + background: #b3c7ff; + color: #17181c; } + [data-bs-theme="dark"] .figure-caption { + color: #c1c3c8; } + [data-bs-theme="dark"] .copy-status::after { + content: "Copy"; + display: block; + color: #c1c3c8; } + [data-bs-theme="dark"] .copy-status:hover::after { + content: "Copy"; + display: block; + color: #b3c7ff; } + [data-bs-theme="dark"] .copy-status:focus::after, + [data-bs-theme="dark"] .copy-status:active::after { + content: "Copied"; + display: block; + color: #b3c7ff; } + [data-bs-theme="dark"] .offcanvas { + background-color: #17181c; } + [data-bs-theme="dark"] .alert-dismissible .btn-close { + background-image: url("data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0IiBmaWxsPSJub25lIiBzdHJva2U9IiNkZWUyZTYiIHN0cm9rZS13aWR0aD0iMiIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbGluZWpvaW49InJvdW5kIiBjbGFzcz0iZmVhdGhlciBmZWF0aGVyLXgiPjxsaW5lIHgxPSIxOCIgeTE9IjYiIHgyPSI2IiB5Mj0iMTgiPjwvbGluZT48bGluZSB4MT0iNiIgeTE9IjYiIHgyPSIxOCIgeTI9IjE4Ij48L2xpbmU+PC9zdmc+"); + background-size: 1.5rem; } + [data-bs-theme="dark"] .dropdown-item { + color: #17181c; } + [data-bs-theme="dark"] hr.text-black-50 { + color: #6c757d !important; } + [data-bs-theme="dark"] .email-form .form-control, [data-bs-theme="dark"] .email-form .search-form .search-field, .search-form [data-bs-theme="dark"] .email-form .search-field, [data-bs-theme="dark"] .email-form .comment-form input[type="text"], .comment-form [data-bs-theme="dark"] .email-form input[type="text"], + [data-bs-theme="dark"] .email-form .comment-form input[type="email"], + .comment-form [data-bs-theme="dark"] .email-form input[type="email"], + [data-bs-theme="dark"] .email-form .comment-form input[type="url"], + .comment-form [data-bs-theme="dark"] .email-form input[type="url"], + [data-bs-theme="dark"] .email-form .comment-form textarea, + .comment-form [data-bs-theme="dark"] .email-form textarea { + background: #23262f; + border: 1px solid transparent; } + [data-bs-theme="dark"] .email-form .form-control:focus, [data-bs-theme="dark"] .email-form .search-form .search-field:focus, .search-form [data-bs-theme="dark"] .email-form .search-field:focus, [data-bs-theme="dark"] .email-form .comment-form input[type="text"]:focus, .comment-form [data-bs-theme="dark"] .email-form input[type="text"]:focus, + [data-bs-theme="dark"] .email-form .comment-form input[type="email"]:focus, + .comment-form [data-bs-theme="dark"] .email-form input[type="email"]:focus, + [data-bs-theme="dark"] .email-form .comment-form input[type="url"]:focus, + .comment-form [data-bs-theme="dark"] .email-form input[type="url"]:focus, + [data-bs-theme="dark"] .email-form .comment-form textarea:focus, + .comment-form [data-bs-theme="dark"] .email-form textarea:focus { + border: 1px solid #b3c7ff; } + [data-bs-theme="dark"] .page-link { + color: #b3c7ff; + background-color: transparent; + border: var(--bs-border-width) solid #23262f; } + [data-bs-theme="dark"] .page-link:hover { + color: #17181c; + background-color: #c1c3c8; + border-color: #c1c3c8; } + [data-bs-theme="dark"] .page-link:focus { + color: #17181c; + background-color: #c1c3c8; } + [data-bs-theme="dark"] .page-item.active .page-link { + color: #17181c; + background-color: #b3c7ff; + border-color: #b3c7ff; } + [data-bs-theme="dark"] .page-item.disabled .page-link { + color: var(--bs-secondary-color); + background-color: #23262f; + border-color: #23262f; } + [data-bs-theme="dark"] .dropdown-menu { + background: #23262f; } + [data-bs-theme="dark"] .dropdown-menu .dropdown-item { + color: #c1c3c8; } + [data-bs-theme="dark"] .dropdown-menu .dropdown-item.untranslated { + color: #6c757d; + text-decoration: line-through; } + [data-bs-theme="dark"] .dropdown-menu .dropdown-item.untranslated:focus-visible, [data-bs-theme="dark"] .dropdown-menu .dropdown-item.untranslated:hover { + background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-home' width='24' height='24' viewBox='0 0 24 24' stroke-width='2' stroke='%23b3c7ff' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'/%3E%3Cpath d='M5 12l-2 0l9 -9l9 9l-2 0' /%3E%3Cpath d='M5 12v7a2 2 0 0 0 2 2h10a2 2 0 0 0 2 -2v-7' /%3E%3Cpath d='M9 21v-6a2 2 0 0 1 2 -2h2a2 2 0 0 1 2 2v6' /%3E%3C/svg%3E"); + background-repeat: no-repeat; + background-position: right 1rem top 0.6rem; + background-size: 0.9rem 0.9rem; + text-decoration: unset; } + [data-bs-theme="dark"] .dropdown-menu .dropdown-item:hover { + color: #b3c7ff; + background: #17181c; } + [data-bs-theme="dark"] .dropdown-menu .dropdown-item.active, + [data-bs-theme="dark"] .dropdown-menu .dropdown-item:focus { + color: #b3c7ff; + background: #17181c; } + [data-bs-theme="dark"] .navbar .dropdown-item.current, + [data-bs-theme="dark"] .doks-subnavbar .dropdown-item.current { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23dee2e6' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right 1rem top 0.6rem; + background-size: 0.75rem 0.75rem; } + [data-bs-theme="dark"] details { + border: 1px solid #23262f; } + [data-bs-theme="dark"] summary:hover { + background: #23262f; } + [data-bs-theme="dark"] details[open] > summary { + border-bottom: 1px solid #23262f; } + [data-bs-theme="dark"] details summary::after { + content: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%28222, 226, 230, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e"); } + [data-bs-theme="dark"] #toc a.active { + color: #b3c7ff; } + [data-bs-theme="dark"] .btn-light { + color: #b3c7ff; + background: #23262f; + border: 1px solid #23262f; } + [data-bs-theme="dark"] table th { + color: white; } + [data-bs-theme="dark"] .table-dark, [data-bs-theme="dark"] table, + [data-bs-theme="dark"] [data-bs-theme="dark"] table { + --bs-table-color: inherit; + --bs-table-bg: $body-bg-dark; + background: #17181c; + border-color: #23262f; } + +.alert { + font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + font-size: 0.875rem; } + +.alert-icon { + margin-right: 0.75rem; } + +.docs main .alert { + margin: 2rem -1.5rem; } + +.alert .alert-link { + text-decoration: underline; } + +.alert-doks { + background: #fbf7f0; + color: #1d2d35; } + +/* +.alert-light { + color: #215888; + background: linear-gradient(-45deg, rgb(212, 245, 255), rgb(234, 250, 255), rgb(234, 250, 255), #d3f6ef); +} + +.alert-light .alert-link { + color: #215888; +} +*/ +.alert-white { + background-color: rgba(255, 255, 255, 0.95); } + +.alert-primary { + color: #fff; + background-color: #5d2f86; } + +.alert a { + text-decoration: underline; } + +.alert-primary .alert-link { + color: #fff; } + +/* +.alert-primary { + color: #084298; + background-color: #cfe2ff; + border-color: #b6d4fe; +} + +.alert-primary .alert-link { + color: #06357a; +} +*/ +.alert-secondary { + color: #41464b; + background-color: #e2e3e5; + border-color: #d3d6d8; } + +.alert-secondary .alert-link { + color: #34383c; } + +.alert-success { + color: #0f5132; + background-color: #d1e7dd; + border-color: #badbcc; } + +.alert-success .alert-link { + color: #0c4128; } + +.alert-info { + color: #055160; + background-color: #cff4fc; + border-color: #b6effb; } + +.alert-info .alert-link { + color: #04414d; } + +.alert-warning { + color: #664d03; + background-color: #fff3cd; + border-color: #ffecb5; } + +.alert-warning .alert-link { + color: #523e02; } + +.alert-danger { + color: #842029; + background-color: #f8d7da; + border-color: #f5c2c7; } + +.alert-danger .alert-link { + color: #6a1a21; } + +.alert-light { + color: #636464; + background-color: #fefefe; + border-color: #fdfdfe; } + +.alert-light .alert-link { + color: #4f5050; } + +.alert-dark { + color: #141619; + background-color: #d3d3d4; + border-color: #bcbebf; } + +.alert-dark .alert-link { + color: #101214; } + +.alert .alert-link:hover, +.alert .alert-link:focus { + text-decoration: none; } + +.alert-text { + margin-right: -3rem; + font-size: 1rem; } + +.alert-dismissible .btn-close { + position: absolute; + top: 50%; + transform: translateY(-50%); + right: 1rem; + z-index: 2; + padding: 0.5rem; + background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='32' height='32' viewBox='0 0 24 24' fill='none' stroke='currentColor' stroke-width='2' stroke-linecap='round' stroke-linejoin='round' class='feather feather-x'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E"); + background-size: 1.5rem; + filter: invert(1) grayscale(100%) brightness(200%); } + +.btn-close:focus, +.btn-close:active { + outline: none; + box-shadow: none; } + +@media (min-width: 768px) { + .alert-dismissible .btn-close { + background-size: 1.5rem; } } + +[data-global-alert="closed"] #announcement { + display: none; } + +.alert code { + background: #f6ecdc; + color: #1d2d35; + padding: 0.25rem 0.5rem; } + +.navbar .btn-link { + color: rgba(var(--bs-emphasis-color-rgb), 0.65); + padding: 0.4375rem 0; } + +#mode { + padding: 0.5rem; } + +.btn-link:focus { + outline: 0; + box-shadow: none; } + +#navigation { + margin-left: 1.25rem; } + +@media (min-width: 992px) { + #mode { + margin-left: 0.5rem; + margin-right: 0.25rem; } + .navbar .btn-link { + padding: 0.5625em 0.25rem 0.5rem 0.125rem; } } + +.navbar .btn-link:hover { + color: rgba(var(--bs-emphasis-color-rgb), 0.8); } + +.navbar .btn-link:active { + color: rgba(var(--bs-emphasis-color-rgb), 1); } + +body .toggle-dark { + display: block; } + +body .toggle-light { + display: none; } + +[data-dark-mode] body .toggle-light { + display: block; } + +[data-dark-mode] body .toggle-dark { + display: none; } + +.collapsible-sidebar { + margin: 2.125rem 0; } + +.btn-toggle { + display: inline-flex; + align-items: center; + padding: 0.25rem 0.5rem 0.25rem 0; + font-weight: 700; + font-size: 1rem; + text-transform: uppercase; + color: #1d2d35; + background-color: transparent; + border: 0; } + +.btn-toggle:hover, +.btn-toggle:focus { + color: #1d2d35; + background-color: transparent; + outline: 0; + box-shadow: none; } + +.btn-toggle::before { + width: 1.25em; + line-height: 0; + content: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%2829, 45, 53, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e"); + transition: transform 0.35s ease; + transform-origin: 0.5em 50%; + margin-bottom: 0.125rem; } + +.btn-toggle[aria-expanded="true"] { + color: #1d2d35; } + +.btn-toggle[aria-expanded="true"]::before { + transform: rotate(90deg); } + +.btn-toggle-nav a { + display: inline-flex; + padding: 0.1875rem 0.5rem; + margin-top: 0.125rem; + margin-left: 1.25rem; + text-decoration: none; } + +.btn-toggle-nav a:hover, +.btn-toggle-nav a:focus { + background-color: transparent; + color: #5d2f86; } + +.btn-toggle-nav a.active { + color: #5d2f86; } + +@media (max-width: 991.98px) { + .dropdown-menu { + width: 100%; + position: static; } } + +/* +@include media-breakpoint-up(lg) { + .dropdown-menu { + width: auto; + } +} +*/ +.btn-dropdown { + border: 0; } + +@media (max-width: 991.98px) { + .btn-dropdown { + width: 100%; + text-align: left; + padding-left: 0; + padding-right: 0; } } + +.navbar .dropdown-item.current { + font-weight: 600; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23292b2c' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right 1rem top 0.6rem; + background-size: 0.75rem 0.75rem; } + @media (max-width: 991.98px) { + .navbar .dropdown-item.current { + background-position: right 0.375rem top 0.6rem; } } +.btn-close { + background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='32' height='32' viewBox='0 0 24 24' fill='none' stroke='currentColor' stroke-width='2' stroke-linecap='round' stroke-linejoin='round' class='feather feather-x'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E"); + background-size: 1.5rem; } + +.offcanvas-header .btn-close { + margin-right: 0 !important; } + +.dropdown-toggle::after { + display: none; } + +.dropdown-caret { + margin-left: -0.1875rem; } + +.dropdown-menu .dropdown-item.untranslated { + color: #6c757d; + text-decoration: line-through; } + .dropdown-menu .dropdown-item.untranslated:focus-visible, .dropdown-menu .dropdown-item.untranslated:hover { + background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-home' width='24' height='24' viewBox='0 0 24 24' stroke-width='2' stroke='%235d2f86' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'/%3E%3Cpath d='M5 12l-2 0l9 -9l9 9l-2 0' /%3E%3Cpath d='M5 12v7a2 2 0 0 0 2 2h10a2 2 0 0 0 2 -2v-7' /%3E%3Cpath d='M9 21v-6a2 2 0 0 1 2 -2h2a2 2 0 0 1 2 2v6' /%3E%3C/svg%3E"); + background-repeat: no-repeat; + background-position: right 1rem top 0.6rem; + background-size: 0.9rem 0.9rem; + text-decoration: unset; } + +.dropdown-menu .dropdown-item:hover { + color: #5d2f86; } + +.dropdown-menu span.dropdown-item.current:hover { + color: unset; } + +.clipboard { + position: relative; + float: right; } + +.btn-clipboard { + transition: opacity 0.25s ease-in-out; + opacity: 0; + position: absolute; + right: 0.5rem; + top: 0.5rem; + line-height: 1; + padding: 0.3125rem 0.3125rem 0.1875rem; + background-color: transparent; + border-color: transparent; } + @media (max-width: 767.98px) { + .btn-clipboard { + position: absolute; + right: -0.5rem; + top: 0.5rem; } } +.btn-clipboard::after { + width: 22px; + height: 22px; + display: inline-block; + content: ""; + -webkit-mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + -webkit-mask-size: cover; + mask-size: cover; + background-color: #495057; } + +.btn-clipboard:hover { + border-color: transparent; } + +.btn-clipboard:hover::after { + width: 22px; + height: 22px; + display: inline-block; + content: ""; + -webkit-mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + -webkit-mask-size: cover; + mask-size: cover; + background-color: #212529; } + +.btn-clipboard:focus, +.btn-clipboard:active { + border-color: transparent !important; } + +.btn-clipboard:focus::after, +.btn-clipboard:active::after { + width: 22px; + height: 22px; + display: inline-block; + content: ""; + -webkit-mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + -webkit-mask-size: cover; + mask-size: cover; + background-color: #212529; } + +[data-bs-theme="dark"] .btn-clipboard { + background-color: transparent; + border-color: transparent; } + +[data-bs-theme="dark"] .btn-clipboard::after { + background-color: #ced4da; } + +[data-bs-theme="dark"] .btn-clipboard:hover { + border-color: transparent; } + +[data-bs-theme="dark"] .btn-clipboard:hover::after { + background-color: #e9ecef; } + +[data-bs-theme="dark"] .btn-clipboard:focus, +[data-bs-theme="dark"] .btn-clipboard:active { + border-color: transparent; } + +[data-bs-theme="dark"] .btn-clipboard:focus::after, +[data-bs-theme="dark"] .btn-clipboard:active::after { + background-color: #e9ecef; } + +.highlight { + position: relative; } + +@media (min-width: 768px) { + .highlight:hover .btn-clipboard { + opacity: 1; } } + +#toTop { + opacity: 0; + transition: opacity 0.3s ease-in-out; } + +#toTop.fade { + opacity: 1; } + +.btn-cta { + padding-left: 2rem; + padding-right: 2rem; } + +.callout { + --bs-link-color-rgb: var(--callout-link); + --bs-code-color: var(--callout-code-color); + color: var(--callout-color, inherit); + background-color: var(--callout-bg, var(--bs-gray-100)); + border-left: 0.25rem solid var(--callout-border, var(--bs-gray-300)); + border-radius: 0; + /* + code { + background: transparent; + color: inherit; + } + */ } + .callout a { + text-decoration: underline; } + .callout .highlight { + background-color: rgba(0, 0, 0, 0.05); } + .callout .callout-icon.svg-inline { + flex-shrink: 0; + height: calc(1.5 * 1.125rem); } + .callout .callout-title { + font-weight: 700; } + +.callout-content { + min-width: 0; } + +.callout.callout-note { + border-color: var(--sl-color-blue); + background-color: var(--sl-color-blue-high); + /* + code:not(:where(.not-content *)) { + background: tint-color($info, 80%); + } + */ } + .callout.callout-note .callout-icon, + .callout.callout-note .callout-title, + .callout.callout-note .callout-body a { + color: var(--sl-color-blue-low); } + .callout.callout-note .callout-body, + .callout.callout-note .callout-body a:hover, + .callout.callout-note .callout-body a:active { + color: var(--sl-color-white); } + +.callout.callout-tip { + border-color: var(--sl-color-purple); + background-color: var(--sl-color-purple-high); + /* + code:not(:where(.not-content *)) { + background: tint-color($purple, 80%); + } + */ } + .callout.callout-tip .callout-icon, + .callout.callout-tip .callout-title, + .callout.callout-tip .callout-body a { + color: var(--sl-color-purple-low); } + .callout.callout-tip .callout-body, + .callout.callout-tip .callout-body a:hover, + .callout.callout-tip .callout-body a:active { + color: var(--sl-color-white); } + +.callout.callout-caution { + border-color: var(--sl-color-orange); + background-color: var(--sl-color-orange-high); + /* + code:not(:where(.not-content *)) { + background: tint-color($yellow, 80%); + } + */ } + .callout.callout-caution .callout-icon, + .callout.callout-caution .callout-title, + .callout.callout-caution .callout-body a { + color: var(--sl-color-orange-low); } + .callout.callout-caution .callout-body, + .callout.callout-caution .callout-body a:hover, + .callout.callout-caution .callout-body a:active { + color: var(--sl-color-white); } + +.callout.callout-danger { + border-color: var(--sl-color-red); + background-color: var(--sl-color-red-high); + /* + code:not(:where(.not-content *)) { + background: tint-color($red, 80%); + } + */ } + .callout.callout-danger .callout-icon, + .callout.callout-danger .callout-title, + .callout.callout-danger .callout-body a { + color: var(--sl-color-red-low); } + .callout.callout-danger .callout-body, + .callout.callout-danger .callout-body a:hover, + .callout.callout-danger .callout-body a:active { + color: var(--sl-color-white); } + +/* +.callout.callout-light code { + background: var(--sl-color-gray-1); +} +*/ +[data-bs-theme="dark"] .callout { + color: var(--sl-color-gray-1); } + +[data-bs-theme="dark"] .callout.callout-note { + border-color: var(--sl-color-blue); + background-color: var(--sl-color-blue-low); } + [data-bs-theme="dark"] .callout.callout-note .callout-icon, + [data-bs-theme="dark"] .callout.callout-note .callout-title, + [data-bs-theme="dark"] .callout.callout-note .callout-body a { + color: var(--sl-color-blue-high); } + [data-bs-theme="dark"] .callout.callout-note .callout-body, + [data-bs-theme="dark"] .callout.callout-note .callout-body a:hover, + [data-bs-theme="dark"] .callout.callout-note .callout-body a:active { + color: var(--sl-color-white); } + [data-bs-theme="dark"] .callout.callout-note code:not(:where(.not-content *)) { + color: var(--ec-codeFg); } + +[data-bs-theme="dark"] .callout.callout-tip { + border-color: var(--sl-color-purple); + background-color: var(--sl-color-purple-low); } + [data-bs-theme="dark"] .callout.callout-tip .callout-icon, + [data-bs-theme="dark"] .callout.callout-tip .callout-title, + [data-bs-theme="dark"] .callout.callout-tip .callout-body a { + color: var(--sl-color-purple-high); } + [data-bs-theme="dark"] .callout.callout-tip .callout-body, + [data-bs-theme="dark"] .callout.callout-tip .callout-body a:hover, + [data-bs-theme="dark"] .callout.callout-tip .callout-body a:active { + color: var(--sl-color-white); } + [data-bs-theme="dark"] .callout.callout-tip code:not(:where(.not-content *)) { + color: var(--ec-codeFg); } + +[data-bs-theme="dark"] .callout.callout-caution { + border-color: var(--sl-color-orange); + background-color: var(--sl-color-orange-low); } + [data-bs-theme="dark"] .callout.callout-caution .callout-icon, + [data-bs-theme="dark"] .callout.callout-caution .callout-title, + [data-bs-theme="dark"] .callout.callout-caution .callout-body a { + color: var(--sl-color-orange-high); } + [data-bs-theme="dark"] .callout.callout-caution .callout-body, + [data-bs-theme="dark"] .callout.callout-caution .callout-body a:hover, + [data-bs-theme="dark"] .callout.callout-caution .callout-body a:active { + color: var(--sl-color-white); } + [data-bs-theme="dark"] .callout.callout-caution code:not(:where(.not-content *)) { + color: var(--ec-codeFg); } + +[data-bs-theme="dark"] .callout.callout-danger { + border-color: var(--sl-color-red); + background-color: var(--sl-color-red-low); } + [data-bs-theme="dark"] .callout.callout-danger .callout-icon, + [data-bs-theme="dark"] .callout.callout-danger .callout-title, + [data-bs-theme="dark"] .callout.callout-danger .callout-body a { + color: var(--sl-color-red-high); } + [data-bs-theme="dark"] .callout.callout-danger .callout-body, + [data-bs-theme="dark"] .callout.callout-danger .callout-body a:hover, + [data-bs-theme="dark"] .callout.callout-danger .callout-body a:active { + color: var(--sl-color-white); } + [data-bs-theme="dark"] .callout.callout-danger code:not(:where(.not-content *)) { + color: var(--ec-codeFg); } + +.expressive-code { + font-family: var(--ec-uiFontFml); + font-size: var(--ec-uiFontSize); + line-height: var(--ec-uiLineHt); + text-size-adjust: none; + -webkit-text-size-adjust: none; + margin: 1.5rem 0; } + +.expressive-code *:not(path) { + all: revert; + box-sizing: border-box; } + +.expressive-code pre { + display: flex; + margin: 0; + padding: 0; + border: var(--ec-brdWd) solid var(--ec-brdCol); + border-radius: calc(var(--ec-brdRad) + var(--ec-brdWd)); + background: var(--ec-codeBg); } + +.expressive-code pre:focus-visible { + outline: 3px solid var(--ec-focusBrd); + outline-offset: -3px; } + +.expressive-code pre > code { + all: unset; + display: block; + flex: 1 0 100%; + padding: var(--ec-codePadBlk) 0; + color: var(--ec-codeFg); + font-family: var(--ec-codeFontFml); + font-size: var(--ec-codeFontSize); + line-height: var(--ec-codeLineHt); } + +.expressive-code pre { + overflow-x: auto; } + +.expressive-code pre::-webkit-scrollbar, +.expressive-code pre::-webkit-scrollbar-track { + background-color: inherit; + border-radius: calc(var(--ec-brdRad) + var(--ec-brdWd)); + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.expressive-code pre::-webkit-scrollbar-thumb { + background-color: var(--ec-sbThumbCol); + border: 4px solid transparent; + background-clip: content-box; + border-radius: 10px; } + +.expressive-code pre::-webkit-scrollbar-thumb:hover { + background-color: var(--ec-sbThumbHoverCol); } + +.expressive-code .ec-line { + padding-inline: var(--ec-codePadInl); + padding-inline-end: calc(2rem + var(--ec-codePadInl)); + direction: ltr; + unicode-bidi: isolate; } + +.expressive-code .sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border-width: 0; } + +.expressive-code .ec-line.mark { + --tmLineBgCol: var(--ec-tm-markBg); + --tmLineBrdCol: var(--ec-tm-markBrdCol); } + +.expressive-code .ec-line.ins { + --tmLineBgCol: var(--ec-tm-insBg); + --tmLineBrdCol: var(--ec-tm-insBrdCol); } + +.expressive-code .ec-line.ins::before { + content: var(--ec-tm-insDiffIndContent); + color: var(--ec-tm-insDiffIndCol); } + +.expressive-code .ec-line.del { + --tmLineBgCol: var(--ec-tm-delBg); + --tmLineBrdCol: var(--ec-tm-delBrdCol); } + +.expressive-code .ec-line.del::before { + content: var(--ec-tm-delDiffIndContent); + color: var(--ec-tm-delDiffIndCol); } + +.expressive-code .ec-line.mark, +.expressive-code .ec-line.ins, +.expressive-code .ec-line.del { + position: relative; + background: var(--tmLineBgCol); + min-width: calc(100% - var(--ec-tm-lineMarkerAccentMarg)); + margin-inline-start: var(--ec-tm-lineMarkerAccentMarg); + border-inline-start: var(--ec-tm-lineMarkerAccentWd) solid var(--tmLineBrdCol); + padding-inline-start: calc(var(--ec-codePadInl) - var(--ec-tm-lineMarkerAccentMarg) - var(--ec-tm-lineMarkerAccentWd)) !important; } + +.expressive-code .ec-line.mark::before, +.expressive-code .ec-line.ins::before, +.expressive-code .ec-line.del::before { + position: absolute; + left: var(--ec-tm-lineDiffIndMargLeft); } + +.expressive-code .ec-line mark, .expressive-code .ec-line .mark { + --tmInlineBgCol: var(--ec-tm-markBg); + --tmInlineBrdCol: var(--ec-tm-markBrdCol); } + +.expressive-code .ec-line ins { + --tmInlineBgCol: var(--ec-tm-insBg); + --tmInlineBrdCol: var(--ec-tm-insBrdCol); } + +.expressive-code .ec-line del { + --tmInlineBgCol: var(--ec-tm-delBg); + --tmInlineBrdCol: var(--ec-tm-delBrdCol); } + +.expressive-code .ec-line mark, .expressive-code .ec-line .mark, +.expressive-code .ec-line ins, +.expressive-code .ec-line del { + all: unset; + display: inline-block; + position: relative; + --tmBrdL: var(--ec-tm-inlMarkerBrdWd); + --tmBrdR: var(--ec-tm-inlMarkerBrdWd); + --tmRadL: var(--ec-tm-inlMarkerBrdRad); + --tmRadR: var(--ec-tm-inlMarkerBrdRad); + margin-inline: 0.025rem; + padding-inline: var(--ec-tm-inlMarkerPad); + border-radius: var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL); + background: var(--tmInlineBgCol); + background-clip: padding-box; } + +.expressive-code .ec-line mark.open-start, .expressive-code .ec-line .open-start.mark, +.expressive-code .ec-line ins.open-start, +.expressive-code .ec-line del.open-start { + margin-inline-start: 0; + padding-inline-start: 0; + --tmBrdL: 0px; + --tmRadL: 0; } + +.expressive-code .ec-line mark.open-end, .expressive-code .ec-line .open-end.mark, +.expressive-code .ec-line ins.open-end, +.expressive-code .ec-line del.open-end { + margin-inline-end: 0; + padding-inline-end: 0; + --tmBrdR: 0px; + --tmRadR: 0; } + +.expressive-code .ec-line mark::before, .expressive-code .ec-line .mark::before, +.expressive-code .ec-line ins::before, +.expressive-code .ec-line del::before { + content: ""; + position: absolute; + pointer-events: none; + display: inline-block; + inset: 0; + border-radius: var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL); + border: var(--ec-tm-inlMarkerBrdWd) solid var(--tmInlineBrdCol); + border-inline-width: var(--tmBrdL) var(--tmBrdR); } + +.expressive-code .frame { + all: unset; + position: relative; + display: block; + --header-border-radius: calc(var(--ec-brdRad) + var(--ec-brdWd)); + --tab-border-radius: calc(var(--ec-frm-edTabBrdRad) + var(--ec-brdWd)); + --button-spacing: 0.4rem; + --code-background: var(--ec-frm-edBg); + border-radius: var(--header-border-radius); + box-shadow: var(--ec-frm-frameBoxShdCssVal); } + +.expressive-code .frame .header { + display: none; + z-index: 1; + position: relative; + border-radius: var(--header-border-radius) var(--header-border-radius) 0 0; } + +.expressive-code .frame.has-title pre, +.expressive-code .frame.has-title code, +.expressive-code .frame.is-terminal pre, +.expressive-code .frame.is-terminal code { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.expressive-code .frame .title:empty:before { + content: "\a0"; } + +.expressive-code .frame.has-title:not(.is-terminal) { + --button-spacing: calc(1.9rem + 2 * (var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt))); } + +.expressive-code .frame.has-title:not(.is-terminal) .title { + position: relative; + color: var(--ec-frm-edActTabFg); + background: var(--ec-frm-edActTabBg); + background-clip: padding-box; + margin-block-start: var(--ec-frm-edTabsMargBlkStart); + padding: calc(var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)) var(--ec-uiPadInl); + border: var(--ec-brdWd) solid var(--ec-frm-edActTabBrdCol); + border-radius: var(--tab-border-radius) var(--tab-border-radius) 0 0; + border-bottom: none; + overflow: hidden; } + +.expressive-code .frame.has-title:not(.is-terminal) .title::after { + content: ""; + position: absolute; + pointer-events: none; + inset: 0; + border-top: var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndTopCol); + border-bottom: var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndBtmCol); } + +.expressive-code .frame.has-title:not(.is-terminal) .header { + display: flex; + background: linear-gradient(to top, var(--ec-frm-edTabBarBrdBtmCol) var(--ec-brdWd), transparent var(--ec-brdWd)), linear-gradient(var(--ec-frm-edTabBarBg), var(--ec-frm-edTabBarBg)); + background-repeat: no-repeat; + padding-inline-start: var(--ec-frm-edTabsMargInlStart); } + +.expressive-code .frame.has-title:not(.is-terminal) .header::before { + content: ""; + position: absolute; + pointer-events: none; + inset: 0; + border: var(--ec-brdWd) solid var(--ec-frm-edTabBarBrdCol); + border-radius: inherit; + border-bottom: none; } + +.expressive-code .frame.is-terminal { + --button-spacing: calc(1.9rem + var(--ec-brdWd) + 2 * var(--ec-uiPadBlk)); + --code-background: var(--ec-frm-trmBg); } + +.expressive-code .frame.is-terminal .header { + display: flex; + align-items: center; + justify-content: center; + padding-block: var(--ec-uiPadBlk); + padding-block-end: calc(var(--ec-uiPadBlk) + var(--ec-brdWd)); + position: relative; + font-weight: 500; + letter-spacing: 0.025ch; + color: var(--ec-frm-trmTtbFg); + background: var(--ec-frm-trmTtbBg); + border: var(--ec-brdWd) solid var(--ec-brdCol); + border-bottom: none; } + +.expressive-code .frame.is-terminal .header::before { + content: ""; + position: absolute; + pointer-events: none; + left: var(--ec-uiPadInl); + width: 2.1rem; + height: 0.56rem; + line-height: 0; + background-color: var(--ec-frm-trmTtbDotsFg); + opacity: var(--ec-frm-trmTtbDotsOpa); + -webkit-mask-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E"); + -webkit-mask-repeat: no-repeat; + mask-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E"); + mask-repeat: no-repeat; } + +.expressive-code .frame.is-terminal .header::after { + content: ""; + position: absolute; + pointer-events: none; + inset: 0; + border-bottom: var(--ec-brdWd) solid var(--ec-frm-trmTtbBrdBtmCol); } + +.expressive-code .frame pre { + background: var(--code-background); } + +.expressive-code .copy { + display: flex; + gap: 0.25rem; + flex-direction: row; + position: absolute; + inset-block-start: calc(var(--ec-brdWd) + var(--button-spacing)); + inset-inline-end: calc(var(--ec-brdWd) + var(--ec-uiPadInl) / 2); + direction: ltr; + unicode-bidi: isolate; } + +.expressive-code .copy button { + position: relative; + align-self: flex-end; + margin: 0; + padding: 0; + border: none; + border-radius: 0.2rem; + z-index: 1; + cursor: pointer; + transition-property: opacity, background, border-color; + transition-duration: 0.2s; + transition-timing-function: cubic-bezier(0.25, 0.46, 0.45, 0.94); + width: 2.5rem; + height: 2.5rem; + background: var(--code-background); + opacity: 0.75; } + +.expressive-code .copy button div { + position: absolute; + inset: 0; + border-radius: inherit; + background: var(--ec-frm-inlBtnBg); + opacity: var(--ec-frm-inlBtnBgIdleOpa); + transition-property: inherit; + transition-duration: inherit; + transition-timing-function: inherit; } + +.expressive-code .copy button::before { + content: ""; + position: absolute; + pointer-events: none; + inset: 0; + border-radius: inherit; + border: var(--ec-brdWd) solid var(--ec-frm-inlBtnBrd); + opacity: var(--ec-frm-inlBtnBrdOpa); } + +.expressive-code .copy button::after { + content: ""; + position: absolute; + pointer-events: none; + inset: 0; + background-color: var(--ec-frm-inlBtnFg); + -webkit-mask-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E"); + -webkit-mask-repeat: no-repeat; + mask-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E"); + mask-repeat: no-repeat; + margin: 0.475rem; + line-height: 0; } + +.expressive-code .copy button:focus::after, +.expressive-code .copy button:active::after { + display: inline-block; + content: ""; + -webkit-mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + mask: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%; + -webkit-mask-size: cover; + mask-size: cover; + margin: 0.2375rem; } + +.expressive-code .copy button:hover, +.expressive-code .copy button:focus:focus-visible { + opacity: 1; } + +.expressive-code .copy button:hover div, +.expressive-code .copy button:focus:focus-visible div { + opacity: var(--ec-frm-inlBtnBgHoverOrFocusOpa); } + +.expressive-code .copy button:active { + opacity: 1; } + +.expressive-code .copy button:active div { + opacity: var(--ec-frm-inlBtnBgActOpa); } + +.expressive-code .copy .feedback { + --tooltip-arrow-size: 0.35rem; + --tooltip-bg: var(--ec-frm-tooltipSuccessBg); + color: var(--ec-frm-tooltipSuccessFg); + pointer-events: none; + user-select: none; + -webkit-user-select: none; + position: relative; + align-self: center; + background-color: var(--tooltip-bg); + z-index: 99; + padding: 0.125rem 0.75rem; + border-radius: 0.2rem; + margin-inline-end: var(--tooltip-arrow-size); + opacity: 0; + transition-property: opacity, transform; + transition-duration: 0.2s; + transition-timing-function: ease-in-out; + transform: translate3d(0, 0.25rem, 0); } + +.expressive-code .copy .feedback::after { + content: ""; + position: absolute; + pointer-events: none; + top: calc(50% - var(--tooltip-arrow-size)); + inset-inline-end: calc(-2 * (var(--tooltip-arrow-size) - 0.5px)); + border: var(--tooltip-arrow-size) solid transparent; + border-inline-start-color: var(--tooltip-bg); } + +.expressive-code .copy .feedback.show { + opacity: 1; + transform: translate3d(0, 0, 0); } + +@media (hover: hover) { + .expressive-code .copy button { + opacity: 0; + width: 2rem; + height: 2rem; } + .expressive-code .frame:hover .copy button:not(:hover), + .expressive-code .frame:focus-within :focus-visible ~ .copy button:not(:hover), + .expressive-code .frame .copy .feedback.show ~ button:not(:hover) { + opacity: 0.75; } } + +:root { + --ec-brdRad: 0px; + --ec-brdWd: 1px; + --ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-codeFontFml: var(--__sl-font-mono); + --ec-codeFontSize: var(--sl-text-code); + --ec-codeFontWg: 400; + --ec-codeLineHt: var(--sl-line-height); + --ec-codePadBlk: 0; + --ec-codePadInl: 1rem; + --ec-codeBg: #011627; + --ec-codeFg: #d6deeb; + --ec-codeSelBg: #1d3b53; + --ec-uiFontFml: var(--__sl-font); + --ec-uiFontSize: 0.9rem; + --ec-uiFontWg: 400; + --ec-uiLineHt: 1.65; + --ec-uiPadBlk: 0.25rem; + --ec-uiPadInl: 1rem; + --ec-uiSelBg: #234d708c; + --ec-uiSelFg: #ffffff; + --ec-focusBrd: #122d42; + --ec-sbThumbCol: #ffffff17; + --ec-sbThumbHoverCol: #ffffff49; + --ec-tm-lineMarkerAccentMarg: 0rem; + --ec-tm-lineMarkerAccentWd: 0.15rem; + --ec-tm-lineDiffIndMargLeft: 0.25rem; + --ec-tm-inlMarkerBrdWd: 1.5px; + --ec-tm-inlMarkerBrdRad: 0.2rem; + --ec-tm-inlMarkerPad: 0.15rem; + --ec-tm-insDiffIndContent: "+"; + --ec-tm-delDiffIndContent: "-"; + --ec-tm-markBg: #ffffff17; + --ec-tm-markBrdCol: #ffffff40; + --ec-tm-insBg: #1e571599; + --ec-tm-insBrdCol: #487f3bd0; + --ec-tm-insDiffIndCol: #79b169d0; + --ec-tm-delBg: #862d2799; + --ec-tm-delBrdCol: #b4554bd0; + --ec-tm-delDiffIndCol: #ed8779d0; + --ec-frm-shdCol: #011627; + --ec-frm-frameBoxShdCssVal: none; + --ec-frm-edActTabBg: var(--sl-color-gray-6); + --ec-frm-edActTabFg: var(--sl-color-text); + --ec-frm-edActTabBrdCol: transparent; + --ec-frm-edActTabIndHt: 1px; + --ec-frm-edActTabIndTopCol: var(--sl-color-accent-high); + --ec-frm-edActTabIndBtmCol: transparent; + --ec-frm-edTabsMargInlStart: 0; + --ec-frm-edTabsMargBlkStart: 0; + --ec-frm-edTabBrdRad: 0px; + --ec-frm-edTabBarBg: var(--sl-color-black); + --ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-edBg: var(--sl-color-gray-6); + --ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-trmTtbDotsOpa: 0.75; + --ec-frm-trmTtbBg: var(--sl-color-black); + --ec-frm-trmTtbFg: var(--sl-color-text); + --ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + --ec-frm-trmBg: var(--sl-color-gray-6); + --ec-frm-inlBtnFg: var(--sl-color-text); + --ec-frm-inlBtnBg: var(--sl-color-text); + --ec-frm-inlBtnBgIdleOpa: 0; + --ec-frm-inlBtnBgHoverOrFocusOpa: 0.2; + --ec-frm-inlBtnBgActOpa: 0.3; + --ec-frm-inlBtnBrd: var(--sl-color-text); + --ec-frm-inlBtnBrdOpa: 0.4; + --ec-frm-tooltipSuccessBg: #158744; + --ec-frm-tooltipSuccessFg: white; } + +.expressive-code .ec-line span[style^="--"]:not([class]) { + color: var(0, inherit); + font-style: var(0fs, inherit); + font-weight: var(0fw, inherit); + text-decoration: var(0td, inherit); } + +@media (prefers-color-scheme: light) { + :root:not([data-bs-theme="dark"]) { + --ec-codeBg: #fbfbfb; + --ec-codeFg: #403f53; + --ec-codeSelBg: #e0e0e0; + --ec-uiSelBg: #d3e8f8; + --ec-uiSelFg: #403f53; + --ec-focusBrd: #93a1a1; + --ec-sbThumbCol: #0000001a; + --ec-sbThumbHoverCol: #0000005c; + --ec-tm-markBg: #0000001a; + --ec-tm-markBrdCol: #00000055; + --ec-tm-insBg: #8ec77d99; + --ec-tm-insDiffIndCol: #336a28d0; + --ec-tm-delBg: #ff9c8e99; + --ec-tm-delDiffIndCol: #9d4138d0; + --ec-frm-shdCol: #d9d9d9; + --ec-frm-edActTabBg: var(--sl-color-gray-7); + --ec-frm-edActTabIndTopCol: #5d2f86; + --ec-frm-edTabBarBg: var(--sl-color-gray-6); + --ec-frm-edBg: var(--sl-color-gray-7); + --ec-frm-trmTtbBg: var(--sl-color-gray-6); + --ec-frm-trmBg: var(--sl-color-gray-7); + --ec-frm-tooltipSuccessBg: #078662; } + :root:not([data-bs-theme="dark"]) .expressive-code .ec-line span[style^="--"]:not([class]) { + color: var(1, inherit); + font-style: var(1fs, inherit); + font-weight: var(1fw, inherit); + text-decoration: var(1td, inherit); } } + +:root[data-bs-theme="light"] .expressive-code, +.expressive-code[data-bs-theme="light"] { + --ec-codeBg: #fbfbfb; + --ec-codeFg: #403f53; + --ec-codeSelBg: #e0e0e0; + --ec-uiSelBg: #d3e8f8; + --ec-uiSelFg: #403f53; + --ec-focusBrd: #93a1a1; + --ec-sbThumbCol: #0000001a; + --ec-sbThumbHoverCol: #0000005c; + --ec-tm-markBg: #0000001a; + --ec-tm-markBrdCol: #00000055; + --ec-tm-insBg: #8ec77d99; + --ec-tm-insDiffIndCol: #336a28d0; + --ec-tm-delBg: #ff9c8e99; + --ec-tm-delDiffIndCol: #9d4138d0; + --ec-frm-shdCol: #d9d9d9; + --ec-frm-edActTabBg: var(--sl-color-gray-7); + --ec-frm-edActTabIndTopCol: #5d2f86; + --ec-frm-edTabBarBg: var(--sl-color-gray-6); + --ec-frm-edBg: var(--sl-color-gray-7); + --ec-frm-trmTtbBg: var(--sl-color-gray-6); + --ec-frm-trmBg: var(--sl-color-gray-7); + --ec-frm-tooltipSuccessBg: #078662; } + +:root[data-bs-theme="light"] .expressive-code .ec-line span[style^="--"]:not([class]), +.expressive-code[data-bs-theme="light"] .ec-line span[style^="--"]:not([class]) { + color: var(1, inherit); + font-style: var(1fs, inherit); + font-weight: var(1fw, inherit); + text-decoration: var(1td, inherit); } + +pre, +code, +kbd, +samp { + font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + font-size: 0.875rem; } + +code:not(:where(.not-content *)) { + background-color: var(--sl-color-gray-6); + margin-block: -0.125rem; + padding: 0.125rem 0.375rem; + color: inherit; } + +[data-bs-theme="dark"] code:not(:where(.not-content *)) { + background-color: var(--sl-color-gray-5); } + +/* +code { + background: $db-khaki-100; + + // background: $db-gray-200; + color: $db-bluishCyan-100; + padding: 0.25rem 0.5rem; +} + +pre { + margin: 2rem 0; +} + +pre code { + display: block; + overflow-x: auto; + line-height: $line-height-base; + padding: 1.25rem 1.5rem; + tab-size: 4; + scrollbar-width: thin; + scrollbar-color: transparent transparent; +} + +.hljs { + padding: 1.5rem !important; +} + +@include media-breakpoint-down(sm) { + pre, + code, + kbd, + samp { + border-radius: 0; + } + + pre { + margin: 2rem -1.5rem; + } +} + +pre code::-webkit-scrollbar { + height: 5px; +} + +pre code::-webkit-scrollbar-thumb { + background: $gray-400; +} + +pre code:hover { + scrollbar-width: thin; + scrollbar-color: $gray-500 transparent; +} + +pre code::-webkit-scrollbar-thumb:hover { + background: $gray-500; +} + +code.language-mermaid { + background: none; +} + +.line .ln { + margin-right: 1rem; +} + +.line.hl { + color: var(--sl-color-blue); +} + +@include color-mode(dark) { + .line.hl { + color: $yellow-100; + } +} +*/ +.math-block { + display: block; + margin: 2rem 0; + overflow-x: auto; } + +.math-inline { + display: inline; } + +[data-bs-theme="dark"] .math-inline img, +[data-bs-theme="dark"] .math-block img { + filter: invert(1); } + +img.diagram { + height: auto; + width: 100%; + margin: 1rem 0 2rem; } + +img.diagram-kroki-mermaid { + background: #fff; } + +/* Applies when there are no line numbers, or when line numbers are inline. */ +.highlight > pre { + padding: 0.875rem 1rem; } + +/* Applies when line numbers are in a table cell. */ +.highlight div { + padding: 0; } + +/* Applies to all. */ +.highlight > .chroma { + overflow-x: auto; + border: 1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); + /* add border-radius and box-shadow here */ } + +/* Applies when line numbers are inline */ +.chroma .ln { + padding: 0 0.5rem 0 0; } + +.chroma .hl { + border-inline-start: 0.15rem solid #0005; + margin-left: -1rem; + margin-right: -1rem; + padding-left: 1rem; + padding-right: 1rem; } + .chroma .hl .ln { + margin-left: -0.15rem; } + +/* Applies when using an external style sheet */ +.highlight .chroma .lntable .lnt, +.highlight .chroma .lntable .hl { + display: flex; } + +/* Applies when highlihting using table */ +.chroma .lntd:first-child { + padding: 0; } + .chroma .lntd:first-child .lnt { + padding-left: 1rem; } + +.chroma .lntd:nth-child(2) { + padding: 0; } + +/* Applies when using an external style sheet */ +.highlight .chroma .lntable .lntd + .lntd { + width: 100%; } + +[data-bs-theme="dark"] .chroma .ln { + padding: 0 0.5em 0 0; } + +/* LineTableTD */ +.chroma .lntd pre { + padding: 1rem 0; + margin-bottom: 0; } + +.highlight > .chroma::-webkit-scrollbar, +.highlight > .chroma::-webkit-scrollbar-track { + background-color: inherit; + border-radius: 1px; + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.highlight > .chroma::-webkit-scrollbar-thumb { + background-color: #dddee0; + border: 4px solid transparent; + background-clip: content-box; + border-radius: 10px; } + +.highlight > .chroma::-webkit-scrollbar-thumb:hover { + background-color: #9d9e9f; } + +[data-bs-theme="dark"] .highlight > .chroma::-webkit-scrollbar-thumb { + background-color: #ffffff17; } + +[data-bs-theme="dark"] .highlight > .chroma::-webkit-scrollbar-thumb:hover { + background-color: #ffffff49; } + +/* +.chroma .hl { + background-color: #0000001a +} +*/ +[data-bs-theme="dark"] { + /* + .chroma .hl { + background-color: #ffffff17; + } + */ } + [data-bs-theme="dark"] .highlight > .chroma { + border: 1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%); } + [data-bs-theme="dark"] .chroma .hl { + border-inline-start: 0.15rem solid #ffffff40; + margin-left: -1rem; + margin-right: -1rem; + padding-left: 1rem; + padding-right: 1rem; } + [data-bs-theme="dark"] .chroma .hl .ln { + margin-left: -0.15rem; } + +.comment-list ol { + list-style: none; } + +blockquote { + margin-bottom: 1rem; + font-size: 1.25rem; + border-left: 3px solid #dee2e6; + padding-left: 1rem; } + +details { + display: block; + position: relative; + border: 1px solid #e9ecef; + border-radius: 0.25rem; + padding: 0.5rem 1rem 0; + margin: 0.5rem 0; } + +/* +details summary { + &::marker { + content: ""; + } +} +*/ +summary { + list-style: none; + display: inline-block; + width: calc(100% + 2rem); + margin: -0.5rem -1rem 0; + padding: 0.5rem 1rem; } + +summary::-webkit-details-marker { + display: none; } + +summary:hover { + background: #f8f9fa; } + +details summary::after { + display: inline-block; + content: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%2829, 45, 53, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e"); + transition: transform 0.35s ease; + transform-origin: center center; + position: absolute; + right: 1rem; } + +details[open] > summary::after { + transform: rotate(90deg); } + +/* +details summary > * { + display: inline-block; +} +*/ +details[open] { + padding: 0.5rem 1rem; } + +details[open] > summary { + border-bottom: 1px solid #dee2e6; + margin-bottom: 0.5rem; } + +details h2, details .h2, +details h3, +details .h3, +details h4, +details .h4 { + margin: 1rem 0 0.5rem; } + +details p:last-child { + margin-bottom: 0; } + +details ul, +details ol { + margin-bottom: 0; } + +details pre { + margin: 0 0 1rem; } + +/** Search form */ +.search-form label { + font-weight: normal; } + +img { + max-width: 100%; + height: auto; } + +img[data-sizes="auto"] { + display: block; } + +img, +picture { + font-size: 0; } + +figcaption { + font-size: 1rem; + margin-top: 0.5rem; + font-style: italic; } + +.content .gitpod-mark-monochrome.icon { + margin-bottom: 0.125rem; + margin-right: 0.5rem; } + +.blur-up { + filter: blur(5px); + transition: filter 400ms; } + +.blur-up.lazyloaded { + filter: unset; } + +.mermaid { + margin: 1.5rem 0; + padding: 1.5rem; } + +.mermaid svg { + height: auto; } + +.search-form .form-control:focus, .search-form .comment-form input[type="text"]:focus, .comment-form .search-form input[type="text"]:focus, +.search-form .comment-form input[type="email"]:focus, +.comment-form .search-form input[type="email"]:focus, +.search-form .comment-form input[type="url"]:focus, +.comment-form .search-form input[type="url"]:focus, +.search-form .comment-form textarea:focus, +.comment-form .search-form textarea:focus, .search-form .search-field:focus { + border: 2px solid #5d2f86; } + +[data-bs-theme="dark"] .search-form .form-control:focus, [data-bs-theme="dark"] .search-form .comment-form input[type="text"]:focus, .comment-form [data-bs-theme="dark"] .search-form input[type="text"]:focus, +[data-bs-theme="dark"] .search-form .comment-form input[type="email"]:focus, +.comment-form [data-bs-theme="dark"] .search-form input[type="email"]:focus, +[data-bs-theme="dark"] .search-form .comment-form input[type="url"]:focus, +.comment-form [data-bs-theme="dark"] .search-form input[type="url"]:focus, +[data-bs-theme="dark"] .search-form .comment-form textarea:focus, +.comment-form [data-bs-theme="dark"] .search-form textarea:focus, [data-bs-theme="dark"] .search-form .search-field:focus { + border: 2px solid #b3c7ff; } + +[data-bs-theme="dark"] .search-form .btn-link { + color: #b3c7ff; } + +.search-form .btn-link, +.modal-body p.message, +.modal-footer { + font-size: 0.875rem; } + +.modal-body::-webkit-scrollbar { + width: 0.25rem; } + +.modal-body::-webkit-scrollbar-track { + background-color: #f1f1f1; } + +.modal-body::-webkit-scrollbar-thumb { + background-color: #c1c1c1; } + +[data-bs-theme="dark"] .modal-body::-webkit-scrollbar-track { + background-color: #424242; } + +[data-bs-theme="dark"] .modal-body::-webkit-scrollbar-thumb { + background-color: #686868; } + +@media (min-width: 768px) { + #searchModal .modal-dialog { + max-height: 40rem; } } + +.search-result h2, .search-result .h2 { + margin-top: 0; } + +.search-result a:focus { + /* + border-color: transparent; + box-shadow: 0; + */ + outline: 0 none; } + +.search-result .content { + margin-top: 0.5rem; + padding-top: 0 !important; + padding-bottom: 0 !important; } + +.search-result .card .content p { + margin-bottom: 0; } + +.search-result .card .content a { + position: relative; + z-index: 1; } + +.search-result:hover .card, +.search-result.selected .card { + background-color: #5d2f86; + color: #fff; } + .search-result:hover .card .content a, + .search-result.selected .card .content a { + color: #fff; + text-decoration: underline; } + +[data-bs-theme="dark"] .search-result:hover .card, +[data-bs-theme="dark"] .search-result.selected .card { + background-color: #b3c7ff; + color: #23262f; } + [data-bs-theme="dark"] .search-result:hover .card .content a, + [data-bs-theme="dark"] .search-result.selected .card .content a { + color: #23262f; + text-decoration: underline; } + +[data-bs-theme="dark"] .search-result:hover .card h2, [data-bs-theme="dark"] .search-result:hover .card .h2, +[data-bs-theme="dark"] .search-result.selected .card h2, +[data-bs-theme="dark"] .search-result.selected .card .h2 { + color: #17181c; } + +.search-result .submitted { + font-size: 0.875rem; + margin-top: 0.5rem; } + +.navbar-form { + position: relative; } + +#suggestions { + position: absolute; + right: 0; + margin-top: 0.5rem; + width: calc(100vw - 3rem); + max-width: calc(400px - 3rem); + z-index: 1000; } + @media (min-width: 768px) { + #suggestions { + right: -2rem; } } + @media (min-width: 992px) { + #suggestions { + right: 0; } } +#suggestions a, +.suggestion__no-results { + padding: 0.75rem; + margin: 0 0.5rem; } + +#suggestions a { + display: block; + text-decoration: none; } + +#suggestions a:focus { + background: #f8f9fa; + outline: 0; } + +#suggestions div:not(:first-child) { + border-top: 1px dashed #e9ecef; } + +#suggestions div:first-child { + margin-top: 0.5rem; } + +#suggestions div:last-child { + margin-bottom: 0.5rem; } + +#suggestions a:hover { + background: #f8f9fa; } + +#suggestions span { + display: flex; + font-size: 1rem; } + +.suggestion__title { + font-weight: 700; + color: #b3c7ff; } + +.suggestion__description, +.suggestion__no-results { + color: #495057; } + +@media (min-width: 992px) { + #suggestions { + width: 31.125rem; + max-width: 31.125rem; } + #suggestions a { + display: flex; } + .suggestion__title { + width: 9rem; + padding-right: 1rem; + border-right: 1px solid #e9ecef; + display: inline-block; + text-align: right; } + .suggestion__description { + width: 19rem; + padding-left: 1rem; } } + +.section-nav { + padding-top: 2rem; } + .section-nav details { + border: 0; + padding: 0; + margin: 0.5rem 0; } + .section-nav details[open] { + padding: 0; } + .section-nav summary { + width: 100%; + padding: 0; + margin: 0; + font-weight: 700; } + .section-nav summary:hover { + background: none; } + .section-nav details[open] > summary { + border-bottom: 0; + margin-bottom: 0; } + .section-nav ul.list-nested details { + padding-left: 1rem; + margin-top: 0.5rem; } + .section-nav ul.list-nested li { + margin: 0; } + .section-nav a { + display: block; + margin: 0.5rem 0; + color: #1d2d35; + font-size: 1rem; + text-decoration: none; } + .section-nav a:hover, + .section-nav a:active { + color: #5d2f86; } + .section-nav li.active a { + color: #5d2f86; + font-weight: 500; } + .section-nav ul.list-nested li a { + padding-left: 1rem; } + .section-nav ul.list-nested { + border-left: 1px solid #e9ecef; } + +[data-bs-theme="dark"] .section-nav ul.list-nested { + border-left: 1px solid #23262f; } + +[data-bs-theme="dark"] .section-nav a { + color: #c1c3c8; } + +[data-bs-theme="dark"] .section-nav a:hover, +[data-bs-theme="dark"] .section-nav a:active { + color: var(--sl-color-text-accent); } + +[data-bs-theme="dark"] .section-nav li.active a { + color: var(--sl-color-text-accent); + font-weight: 500; } + +[data-bs-theme="dark"] .section-nav summary { + color: #fff; } + +table { + margin: 3rem 0; } + +.nav-tabs { + border-bottom: 0.0625rem solid #d8dee4; + margin-bottom: 1rem; } + +.nav-tabs .nav-link, .nav-tabs .banner .nav a, .banner .nav .nav-tabs a { + margin-bottom: -0.0625rem !important; + background: none; + border: 0; + border-top-left-radius: 0; + border-top-right-radius: 0; + color: inherit; } + +.nav-tabs .nav-link:hover, .nav-tabs .banner .nav a:hover, .banner .nav .nav-tabs a:hover, +.nav-tabs .nav-link:focus, +.nav-tabs .banner .nav a:focus, +.banner .nav .nav-tabs a:focus { + isolation: isolate; + border-color: transparent; + color: var(--bs-emphasis-color); } + +.nav-tabs .nav-link.active, .nav-tabs .banner .nav a.active, .banner .nav .nav-tabs a.active, +.nav-tabs .nav-item.show .nav-link, +.nav-tabs .nav-item.show .banner .nav a, +.banner .nav .nav-tabs .nav-item.show a, +.nav-tabs .banner .nav li.show .nav-link, +.nav-tabs .banner .nav li.show a, +.banner .nav .nav-tabs li.show .nav-link, +.banner .nav .nav-tabs li.show a { + background-color: transparent; + border-color: transparent; + border-bottom: 0.125rem solid #5d2f86; } + +[data-bs-theme="dark"] .nav-tabs { + border-bottom: 0.0625rem solid #343a40; } + +[data-bs-theme="dark"] .nav-tabs .nav-link.active, [data-bs-theme="dark"] .nav-tabs .banner .nav a.active, .banner .nav [data-bs-theme="dark"] .nav-tabs a.active, +[data-bs-theme="dark"] .nav-tabs .nav-item.show .nav-link, +[data-bs-theme="dark"] .nav-tabs .nav-item.show .banner .nav a, +.banner .nav [data-bs-theme="dark"] .nav-tabs .nav-item.show a, +[data-bs-theme="dark"] .nav-tabs .banner .nav li.show .nav-link, +[data-bs-theme="dark"] .nav-tabs .banner .nav li.show a, +.banner .nav [data-bs-theme="dark"] .nav-tabs li.show .nav-link, +.banner .nav [data-bs-theme="dark"] .nav-tabs li.show a { + border-bottom: 0.125rem solid #b3c7ff; } + +.footer { + border-top: 1px solid #e9ecef; + padding-top: 1.125rem; + padding-bottom: 1.125rem; } + .footer ul { + margin-bottom: 0; } + .footer li { + font-size: 0.875rem; + margin-bottom: 0; } + .footer .list-inline-item:not(:last-child) { + margin-right: 1rem; } + +@media (max-width: 991.98px) { + .footer .col-lg-8 { + margin-top: 0.25rem; + margin-bottom: 0.25rem; } } + +@media (min-width: 768px) { + .footer li { + font-size: 1rem; } } + +.fixed-bottom-right { + position: fixed; + right: 0; + bottom: 0; + z-index: 1000; } + +.navbar-text { + margin-left: 1rem; } + +.navbar-brand { + font-weight: 700; } + +.navbar-brand svg { + margin-right: 0.25rem; } + +[data-bs-theme="dark"] .navbar-brand { + color: inherit; } + +/* +.navbar-light .navbar-brand, +.navbar-light .navbar-brand:hover, +.navbar-light .navbar-brand:active { + color: $body-color; +} + +.navbar-light .navbar-nav .active .nav-link { + color: $primary; +} +*/ +.navbar { + z-index: 1000; + background-color: rgba(255, 255, 255, 0.95); + border-bottom: 1px solid #e9ecef; + /* + margin-top: 4px; + */ } + +@media (min-width: 992px) { + .navbar { + z-index: 1025; + /* + padding-top: 0.25rem; + padding-bottom: 0.25rem; + */ } } + +@media (min-width: 768px) { + .navbar-brand { + font-size: 1.375rem; } + .navbar-text { + margin-left: 1.25rem; } } + +/* +.navbar-nav { + flex-direction: row; +} +*/ +.nav-item, .banner .nav li { + margin-left: 0; } + +@media (max-width: 991.98px) { + .navbar .icon-tabler-chevron-down { + display: block; + float: right; + transform: rotate(270deg); + transition: transform 0.35s ease; } + .navbar .dropdown-toggle[aria-expanded="true"] .icon-tabler-chevron-down { + transform: rotate(360deg); } + .navbar-nav .dropdown-menu { + border: 0; } + /* + .navbar-nav .nav-item { + border-bottom: 1px solid rgba(52, 56, 65, 0.5); + font-family: $headings-font-family; + padding-top: 0.75rem; + padding-bottom: 0.75rem; + } + */ + .navbar-nav .nav-link, .navbar-nav .banner .nav a, .banner .nav .navbar-nav a { + font-weight: 400; } + .navbar-nav .dropdown-item { + font-weight: 300; } + .dropdown-toggle svg { + margin-top: 0.25rem; + margin-left: 0; } } + +@media (min-width: 768px) { + .nav-item, .banner .nav li { + margin-left: 0.5rem; } } + +/* +@include media-breakpoint-down(sm) { + .nav-item:first-child { + margin-left: 0; + } +} +*/ +/* +@include media-breakpoint-down(md) { + .navbar .container { + padding-left: 1.5rem; + padding-right: 1.5rem; + } +} +*/ +.break { + flex-basis: 100%; + height: 0; } + +span#doks-language-current { + margin-left: 0.1rem; } + +button#doks-languages { + margin: 0.25rem 0 0; } + @media (min-width: 992px) { + button#doks-languages { + margin: 0.25rem 0.5rem 0 0.25rem; } } +button#doks-versions { + margin: 0.25rem 0 0; } + @media (min-width: 992px) { + button#doks-versions { + margin: 0.25rem 0.5rem 0 0.25rem; } } +@media (max-width: 575.98px) { + .navbar .offcanvas.offcanvas-start, + .navbar .offcanvas.offcanvas-end { + width: 80vw; } } + +.offcanvas-header { + border-bottom: 1px solid #dee2e6; + padding-top: 1.0625rem; + padding-bottom: 0.8125rem; } + +h5.offcanvas-title, .offcanvas-title.h5 { + margin: 0; + color: inherit; } + +.offcanvas .nav-link, .offcanvas .banner .nav a, .banner .nav .offcanvas a { + color: #1d2d35; } + +/* +.doks-subnavbar { + background-color: rgba(255, 255, 255, 0.95); + border-bottom: 1px solid $gray-200; +} + +.doks-subnavbar .nav-link { + padding: 0.5rem 1.5rem 0.5rem 0; +} + +.doks-subnavbar .nav-link:first-child { + padding: 0.5rem 1.5rem 0.5rem 0; +} +*/ +.offcanvas .nav-link:hover, .offcanvas .banner .nav a:hover, .banner .nav .offcanvas a:hover, +.offcanvas .nav-link:focus, +.offcanvas .banner .nav a:focus, +.banner .nav .offcanvas a:focus { + color: #5d2f86; } + +.offcanvas .nav-link.active, .offcanvas .banner .nav a.active, .banner .nav .offcanvas a.active { + color: #5d2f86; } + +/* +.navbar { + background-color: rgba(255, 255, 255, 0.95); + border-bottom: 1px solid $gray-200; + margin-top: 4px; +} +*/ +.header-bar { + border-top: 4px solid; + border-image-source: linear-gradient(83.21deg, #ffe000 0%, #e55235 100%); + border-image-slice: 1; } + +[data-bs-theme="dark"] .header-bar { + border-top: 4px solid; + border-image-source: linear-gradient(83.21deg, var(--sl-color-accent) 0%, var(--sl-color-green) 100%); + border-image-slice: 1; } + +.offcanvas .header-bar { + margin-bottom: -4px; } + +.home .navbar { + border-bottom: 0; } + +/* +.navbar-form { + position: relative; + margin-top: 0.25rem; +} +*/ +@media (min-width: 992px) { + .navbar-brand { + margin-right: 0.75rem !important; } + .main-nav .nav-item:first-child .nav-link, .main-nav .banner .nav li:first-child .nav-link, .banner .nav .main-nav li:first-child .nav-link, .main-nav .nav-item:first-child .banner .nav a, .banner .nav .main-nav .nav-item:first-child a, .main-nav .banner .nav li:first-child a, .banner .nav .main-nav li:first-child a, + .social-nav .nav-item:first-child .nav-link, + .social-nav .banner .nav li:first-child .nav-link, + .banner .nav .social-nav li:first-child .nav-link, + .social-nav .nav-item:first-child .banner .nav a, + .banner .nav .social-nav .nav-item:first-child a, + .social-nav .banner .nav li:first-child a, + .banner .nav .social-nav li:first-child a { + padding-left: 0; } + .main-nav .nav-item:last-child .nav-link, .main-nav .banner .nav li:last-child .nav-link, .banner .nav .main-nav li:last-child .nav-link, .main-nav .nav-item:last-child .banner .nav a, .banner .nav .main-nav .nav-item:last-child a, .main-nav .banner .nav li:last-child a, .banner .nav .main-nav li:last-child a, + .social-nav .nav-item:last-child .nav-link, + .social-nav .banner .nav li:last-child .nav-link, + .banner .nav .social-nav li:last-child .nav-link, + .social-nav .nav-item:last-child .banner .nav a, + .banner .nav .social-nav .nav-item:last-child a, + .social-nav .banner .nav li:last-child a, + .banner .nav .social-nav li:last-child a { + padding-right: 0; } + /* + .doks-search { + max-width: 20rem; + margin-top: 0.125rem; + margin-bottom: 0.125rem; + } + */ + /* + .navbar-form { + margin-top: 0; + margin-left: 6rem; + margin-right: 1.5rem; + } + */ } + +.form-control.is-search, .comment-form input.is-search[type="text"], +.comment-form input.is-search[type="email"], +.comment-form input.is-search[type="url"], +.comment-form textarea.is-search, .search-form .is-search.search-field { + padding-right: 4rem; + border: 1px solid transparent; + background: #f8f9fa; } + @media (min-width: 768px) { + .form-control.is-search, .comment-form input.is-search[type="text"], + .comment-form input.is-search[type="email"], + .comment-form input.is-search[type="url"], + .comment-form textarea.is-search, .search-form .is-search.search-field { + width: calc(100% + 2rem); } } + @media (min-width: 992px) { + .form-control.is-search, .comment-form input.is-search[type="text"], + .comment-form input.is-search[type="email"], + .comment-form input.is-search[type="url"], + .comment-form textarea.is-search, .search-form .is-search.search-field { + width: 100%; } } +.form-control.is-search:focus, .comment-form input.is-search[type="text"]:focus, +.comment-form input.is-search[type="email"]:focus, +.comment-form input.is-search[type="url"]:focus, +.comment-form textarea.is-search:focus, .search-form .is-search.search-field:focus { + border: 1px solid #5d2f86; } + +/* +.doks-search::after { + position: absolute; + top: 0.4625rem; + right: 0.5375rem; + display: flex; + align-items: center; + justify-content: center; + height: 1.5rem; + padding-right: 0.3125rem; + padding-left: 0.3125rem; + font-size: $font-size-base * 0.75; + color: $gray-700; + content: "Ctrl + /"; + border: 1px solid $gray-300; + border-radius: 0.25rem; + + @include media-breakpoint-up(md) { + right: -1.4625rem; + } + + @include media-breakpoint-up(lg) { + right: 0.3125rem; + } +} +*/ +/* +@include media-breakpoint-up(lg) { + .navbar-form { + margin-left: 15rem; + } +} + +@include media-breakpoint-up(xl) { + .navbar-form { + margin-left: 30rem; + } +} +*/ +/* +.form-control.is-search { +*/ +/* + padding-right: calc(1.5em + 0.75rem); + */ +/* + padding-right: 2.5rem; + background: $gray-100; + border: 0; + */ +/* + background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='20' height='20' viewBox='0 0 24 24' fill='none' stroke='%236c757d' stroke-width='2' stroke-linecap='round' stroke-linejoin='round' class='feather feather-search'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E"); + background-repeat: no-repeat; + background-position: right calc(0.375em + 0.1875rem) center; + background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); + */ +/* +} +*/ +/* +.navbar-form::after { + position: absolute; + top: 0.4625rem; + right: 0.5375rem; + display: flex; + align-items: center; + justify-content: center; + height: 1.5rem; + padding-right: 0.4375rem; + padding-left: 0.4375rem; + font-size: $font-size-base * 0.75; + color: $gray-700; + content: "/"; + border: 1px solid $gray-300; + border-radius: 0.25rem; +} +*/ +/*! purgecss start ignore */ +/* +.algolia-autocomplete { + display: flex !important; +} + +.algolia-autocomplete .ds-dropdown-menu { + box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; +} + +@include media-breakpoint-down(sm) { + .algolia-autocomplete .ds-dropdown-menu { + max-width: 512px !important; + min-width: 312px !important; + width: auto !important; + } + + .algolia-autocomplete .algolia-docsearch-suggestion .algolia-docsearch-suggestion--subcategory-column { + font-weight: normal; + } + + .algolia-autocomplete .algolia-docsearch-suggestion .algolia-docsearch-suggestion--subcategory-column::after { + content: "/"; + margin-right: 0.25rem; + } +} + +.algolia-autocomplete .algolia-docsearch-suggestion--category-header { + color: $link-color-dark; +} + +.algolia-autocomplete .algolia-docsearch-suggestion--title { + margin-bottom: 0; +} + +.algolia-autocomplete .algolia-docsearch-suggestion--highlight { + padding: 0 0.05em; +} + +.algolia-autocomplete .algolia-docsearch-footer { + margin-top: 1rem; + margin-right: 0.5rem; + margin-bottom: 0.5rem; +} +*/ +/*! purgecss end ignore */ +/* + * Source: https://medium.com/creative-technology-concepts-code/responsive-mobile-dropdown-navigation-using-css-only-7218e4498a99 +*/ +/* Style the menu icon for the dropdown */ +.navbar .menu-icon { + cursor: pointer; + /* display: inline-block; */ + /* float: right; */ + padding: 1.125rem 0.625rem; + margin: 0 0 0 -0.625rem; + /* position: relative; */ + user-select: none; } + +.navbar .menu-icon .navicon { + background: rgba(var(--bs-emphasis-color-rgb), 0.65); + display: block; + height: 2px; + position: relative; + transition: background 0.2s ease-out; + width: 18px; } + +.navbar .menu-icon .navicon::before, +.navbar .menu-icon .navicon::after { + background: rgba(var(--bs-emphasis-color-rgb), 0.65); + content: ""; + display: block; + height: 100%; + position: absolute; + transition: all 0.2s ease-out; + width: 100%; } + +.navbar .menu-icon .navicon::before { + top: 5px; } + +.navbar .menu-icon .navicon::after { + top: -5px; } + +/* Add the icon and menu animations when the checkbox is clicked */ +.navbar .menu-btn { + display: none; } + +.navbar .menu-btn:checked ~ .navbar-collapse { + display: block; + max-height: 100vh; } + +.navbar .menu-btn:checked ~ .menu-icon .navicon { + background: transparent; } + +.navbar .menu-btn:checked ~ .menu-icon .navicon::before { + transform: rotate(-45deg); } + +.navbar .menu-btn:checked ~ .menu-icon .navicon::after { + transform: rotate(45deg); } + +.navbar .menu-btn:checked ~ .menu-icon:not(.steps) .navicon::before, +.navbar .menu-btn:checked ~ .menu-icon:not(.steps) .navicon::after { + top: 0; } + +.btn-menu { + margin-left: 1rem; + border: transparent; } + +.btn-doks-light { + border: transparent; } + +.btn-menu, +.doks-sidebar-toggle { + padding-right: 0.25rem; + padding-left: 0.25rem; + margin-right: -0.5rem; } + +.btn-menu:hover, +.btn-doks-light:hover, +.doks-sidebar-toggle:hover { + background: transparent; + border: transparent; } + +.btn-menu:focus, +.btn-doks-light:focus, +.doks-sidebar-toggle:focus, +.doks-mode-toggle:focus { + outline: 0; + border: transparent; } + +.doks-sidebar-toggle .doks-collapse, +.doks-toc-toggle .doks-collapse { + display: none; } + +.doks-sidebar-toggle:not(.collapsed) .doks-expand, +.doks-toc-toggle:not(.collapsed) .doks-expand { + display: none; } + +.doks-sidebar-toggle:not(.collapsed) .doks-collapse, +.doks-toc-toggle:not(.collapsed) .doks-collapse { + display: inline-block; } + +.navbar-light .navbar-brand, +.navbar-light .navbar-brand:hover, +.navbar-light .navbar-brand:active { + color: #1d2d35; } + +.navbar-light .navbar-nav .active .nav-link, .navbar-light .navbar-nav .active .banner .nav a, .banner .nav .navbar-light .navbar-nav .active a { + color: #5d2f86; } + +.dropdown-divider { + border-top: 1px dashed #e9ecef; } + +.dropdown-item:hover { + background: #f8f9fa; } + +.dropdown-item:active { + color: inherit; } + +.social-link { + padding-right: 0.375rem; + padding-left: 0.375rem; } + +@media (max-width: 991.98px) { + #buttonColorMode { + margin: 0.5rem 0; } + #socialMenu { + margin: 0.5rem 0 0.5rem -0.25rem; } + .navbar-nav { + margin-top: 1rem; } + .dropdown-menu { + box-shadow: none !important; + background: transparent !important; + border-radius: 0 !important; + padding: 0; + margin-bottom: 0.25rem; } + .dropdown-item { + padding: 0.375rem 1rem 0.375rem 0; } + .nav-item .nav-link, .banner .nav li .nav-link, .nav-item .banner .nav a, .banner .nav .nav-item a, .banner .nav li a { + font-weight: 400; + font-size: 1.125rem; } + .btn-dropdown { + font-weight: 400; + font-size: 1.125rem; } } + +/* +@include media-breakpoint-up(lg) { + // Source: https://bootstrap-menu.com/detail-basic-hover.html + .navbar .nav-item .dropdown-menu { + display: none; + } + + .navbar .nav-item:hover .dropdown-menu { + display: block; + } +} +*/ +.modal-backdrop, +.offcanvas-backdrop { + visibility: hidden; + background: rgba(23, 24, 28, 0.5); + opacity: 0; } + +[data-bs-theme="dark"] .modal-backdrop, +[data-bs-theme="dark"] .offcanvas-backdrop { + visibility: hidden; + background: rgba(23, 24, 28, 0.5); + opacity: 0; } + +.modal-backdrop.show, +.offcanvas-backdrop.show { + visibility: visible; + opacity: 1; + -webkit-backdrop-filter: blur(8px); + backdrop-filter: blur(8px); } + +.showing, +.hiding { + -webkit-transition: none; + transition: none; + display: none; } + +.offcanvas-top.h-auto { + bottom: initial; } + +.navbar > .container, +.navbar > .container-fluid, +.navbar > .container-sm, +.navbar > .container-md, +.navbar > .container-lg, +.navbar > .container-xl, +.navbar > .container-xxl { + padding-right: 0.75rem; } + +.docs-content > h2[id]::before, .docs-content > [id].h2::before, +.docs-content > h3[id]::before, +.docs-content > [id].h3::before, +.docs-content > h4[id]::before, +.docs-content > [id].h4::before { + display: block; + height: 6rem; + margin-top: -6rem; + content: ""; } + +.docs-content ul, +.docs-content ol { + margin-bottom: 1rem; } + +.anchor { + visibility: hidden; + margin-left: 0.375rem; } + +.edit-page a, +.last-modified a { + color: var(--sl-color-gray-3); } + +h1:hover a, .h1:hover a, +h2:hover a, +.h2:hover a, +h3:hover a, +.h3:hover a, +h4:hover a, +.h4:hover a { + visibility: visible; + text-decoration: none; } + +.card-list { + margin-top: 2.25rem; } + +.page-footer-meta { + margin-top: 2rem; + margin-bottom: 2rem; } + +.edit-page, +.last-modified { + font-size: 0.875rem; + margin-top: 0.25rem; + margin-bottom: 0.25rem; } + +@media (min-width: 768px) { + .edit-page, + .last-modified { + font-size: 1rem; + margin-top: 0.75rem; + margin-bottom: 0.25rem; } } + +.edit-page a:hover, +.last-modified a:hover { + color: var(--sl-color-gray-4); + text-decoration: none; } + +[data-bs-theme="dark"] .edit-page a:hover, +[data-bs-theme="dark"] .last-modified a:hover { + color: var(--sl-color-gray-2); } + +.edit-page svg, +.last-modified svg { + margin-right: 0.25rem; + margin-bottom: 0.25rem; } + +p.meta { + margin-top: 0.5rem; + font-size: 1rem; } + +.breadcrumb { + margin-top: 2.25rem; + font-size: 1rem; } + +.toc-mobile { + margin-top: 2rem; + margin-bottom: 2rem; } + +.page-link:hover { + text-decoration: none; } + +.row-about { + padding-top: 5rem; + padding-bottom: 5rem; } + @media (min-width: 992px) { + .row-about { + padding-top: 7rem; + padding-bottom: 7rem; } } +.row-about h1, .row-about .h1 { + margin-top: 1rem; } + +ul li { + margin: 0.25rem 0; } + +.list-contributors { + margin-left: 1.25rem; } + +.list-contributors li { + margin: 0.25rem 0 0.25rem -1.5rem; + padding: 0.25rem; + background-color: #fff; + border-radius: 50%; } + +[data-bs-theme="dark"] .list-contributors li { + background-color: #212529; } + +ul.list-toolbox li { + position: relative; + margin: 0.25rem 0; } + ul.list-toolbox li::before { + background: none; + content: "🧰"; + height: 1rem; + width: 1rem; + position: absolute; + left: -2rem; + top: 0; } + +ul.list-books li { + position: relative; + margin: 0.25rem 0; } + ul.list-books li::before { + background: none; + content: "📚"; + height: 1rem; + width: 1rem; + position: absolute; + left: -2rem; + top: 0; } + +ul.list-speech-balloon li { + position: relative; + margin: 0.25rem 0; } + ul.list-speech-balloon li::before { + background: none; + content: "💬"; + height: 1rem; + width: 1rem; + position: absolute; + left: -2rem; + top: 0; } + +ul.list-package li { + position: relative; + margin: 0.25rem 0; } + ul.list-package li::before { + background: none; + content: "📦"; + height: 1rem; + width: 1rem; + position: absolute; + left: -2rem; + top: 0; } + +ul.list-star li { + position: relative; + margin: 0.25rem 0; } + ul.list-star li::before { + background: none; + content: "⭐"; + height: 1rem; + width: 1rem; + position: absolute; + left: -2rem; + top: 0; } + +.page-nav .card .icon-tabler-arrow-left { + margin-right: 0.75rem; } + +.page-nav .card .icon-tabler-arrow-right { + margin-left: 0.75rem; } + +.page-nav .card:hover { + border: 1px solid #d9d9d9; } + +[data-bs-theme="dark"] .page-nav .card { + border: 1px solid #353841; } + +[data-bs-theme="dark"] .page-nav .card:hover { + border: 1px solid #888c96; } + +.container-fw { + max-width: 1200px; } + .container-fw .docs-toc { + margin-left: 3rem; } + +.home .card, +.contributors.list .card, +.blog.list .card, +.blog.single .card, +.categories.list .card, +.tags.list .card { + margin-top: 2rem; + margin-bottom: 2rem; + transition: transform 0.3s; } + +.home .content .card:hover, +.contributors.list .content .card:hover, +.blog.list .content .card:hover, +.blog.single .content .card:hover, +.categories.list .content .card:hover, +.tags.list .content .card:hover { + transform: scale(1.025); } + +.contributors.list .card.card-terms:hover, +.categories.list .card.card-terms:hover, +.tags.list .card.card-terms:hover { + transform: none; } + +.home .content .card-body, +.contributors.list .content .card-body, +.blog.list .content .card-body, +.blog.single .content .card-body, +.categories.list .content .card-body, +.tags.list .content .card-body { + padding: 0 2rem 1rem; } + +.contributors.list .card-terms .card-body, +.categories.list .card-terms .card-body, +.tags.list .card-terms .card-body { + padding: 1rem; } + +.blog-header { + text-align: center; + margin-bottom: 2rem; } + +.blog-footer { + text-align: center; } + +.related-posts { + margin-top: 4rem; } + +h2.section-title, .section-title.h2 { + margin-bottom: 1.25rem; } + +.img-post-single { + margin-bottom: 2rem; } + +.pagination { + display: flex; + justify-content: center; } + +.page-item:first-child, +.page-item:last-child, +.page-item.disabled { + display: none; } + +.page-item a { + margin-left: 0.5rem; + margin-right: 0.5rem; + padding-left: 0.875rem; + padding-right: 0.875rem; } + +.page-item a[aria-label="Previous"], +.page-item a[aria-label="Next"] { + border-radius: 50%; } + +.tag-list-single { + margin-top: 3rem; + margin-bottom: 1rem; } + +.section-related { + padding-top: 1.5rem; + padding-bottom: 1.5rem; } + +.contributor-image { + text-align: center; + margin-top: 2.5rem; } + +span.reading-time { + margin-left: 2rem; } + span.reading-time svg { + margin-right: 0.3rem; + vertical-align: -0.4rem; } + +.docs-links, +.docs-toc { + scrollbar-width: thin; + scrollbar-color: #fff #fff; } + +.docs-links::-webkit-scrollbar, +.docs-toc::-webkit-scrollbar { + width: 5px; } + +.docs-links::-webkit-scrollbar-track, +.docs-toc::-webkit-scrollbar-track { + background: #fff; } + +.docs-links::-webkit-scrollbar-thumb, +.docs-toc::-webkit-scrollbar-thumb { + background: #fff; } + +.docs-links:hover, +.docs-toc:hover { + scrollbar-width: thin; + scrollbar-color: #e9ecef #fff; } + +.docs-links:hover::-webkit-scrollbar-thumb, +.docs-toc:hover::-webkit-scrollbar-thumb { + background: #e9ecef; } + +.docs-links::-webkit-scrollbar-thumb:hover, +.docs-toc::-webkit-scrollbar-thumb:hover { + background: #e9ecef; } + +.docs-links h3, .docs-links .h3, +.page-links h3, +.page-links .h3 { + font-size: 1.125rem; + margin: 1.25rem 0 0.5rem; + padding: 1.5rem 0 0; } + +@media (min-width: 992px) { + .docs-links h3, .docs-links .h3, + .page-links h3, + .page-links .h3 { + margin: 1.125rem 1.5rem 0.75rem 0; + padding: 1.375rem 0 0; } } + +.docs-links h3:not(:first-child), .docs-links .h3:not(:first-child) { + border-top: 1px solid #e9ecef; } + +a.docs-link { + color: #1d2d35; + display: block; + padding: 0.125rem 0; + font-size: 1rem; } + +.page-links li { + margin-top: 0.375rem; + padding-top: 0.375rem; } + +.page-links li ul li { + border-top: none; + padding-left: 1rem; + margin-top: 0.125rem; + padding-top: 0.125rem; } + +.page-links li:not(:first-child) { + border-top: 1px dashed #e9ecef; } + +.page-links a { + color: #1d2d35; + display: block; + padding: 0.125rem 0; + font-size: 0.9375rem; + text-decoration: none; } + +.docs-link:hover, +.docs-link.active, +.page-links a:hover, +.page-links a.active { + text-decoration: none; + color: #5d2f86; } + +.nav-link.active, .banner .nav a.active, +.dropdown-menu-main .dropdown-item.active, +.docs-link.active { + font-weight: 500; } + +.docs-links h3.sidebar-link, .docs-links .sidebar-link.h3, +.page-links h3.sidebar-link, +.page-links .sidebar-link.h3 { + text-transform: none; + font-size: 1.125rem; + font-weight: normal; } + +.docs-links h3.sidebar-link a, .docs-links .sidebar-link.h3 a, +.page-links h3.sidebar-link a, +.page-links .sidebar-link.h3 a { + color: #1d2d35; } + +.docs-links h3.sidebar-link a:hover, .docs-links .sidebar-link.h3 a:hover, +.page-links h3.sidebar-link a:hover, +.page-links .sidebar-link.h3 a:hover { + text-decoration: underline; } + +/* +body { + background-color: {{ site.Params.doks.backGround }}; +} +*/ +a.CTAbutton { + background-color: var(--sl-color-purple-low); + display: inline-block; + width: 200px; + border-radius: 5px; + padding: 10px; + color: var(--sl-color-gray-1); + text-transform: uppercase; } + +/*# sourceMappingURL=main.css.map */ \ No newline at end of file diff --git a/public/main.e28529c7be9ecda8ce19eac1174bca0d6f2153f0711f154ca27317330d3f0085350487d79841146fa897321b65f8f7d4a783d14c4a5829172cc3c9a243115e50.css b/public/main.e28529c7be9ecda8ce19eac1174bca0d6f2153f0711f154ca27317330d3f0085350487d79841146fa897321b65f8f7d4a783d14c4a5829172cc3c9a243115e50.css new file mode 100644 index 0000000..d21f0ba --- /dev/null +++ b/public/main.e28529c7be9ecda8ce19eac1174bca0d6f2153f0711f154ca27317330d3f0085350487d79841146fa897321b65f8f7d4a783d14c4a5829172cc3c9a243115e50.css @@ -0,0 +1 @@ +:root[data-bs-theme="light"],[data-bs-theme="light"] ::backdrop{--sl-color-white: hsl(224, 10%, 10%);--sl-color-gray-1: hsl(224, 14%, 16%);--sl-color-gray-2: hsl(224, 10%, 23%);--sl-color-gray-3: hsl(224, 7%, 36%);--sl-color-gray-4: hsl(224, 6%, 56%);--sl-color-gray-5: hsl(224, 6%, 77%);--sl-color-gray-6: hsl(224, 20%, 94%);--sl-color-gray-7: hsl(224, 19%, 97%);--sl-color-black: hsl(0, 0%, 100%)}:root,::backdrop{--sl-color-white: hsl(0, 0%, 100%);--sl-color-gray-1: hsl(224, 20%, 94%);--sl-color-gray-2: hsl(224, 6%, 77%);--sl-color-gray-3: hsl(224, 6%, 56%);--sl-color-gray-4: hsl(224, 7%, 36%);--sl-color-gray-5: hsl(224, 10%, 23%);--sl-color-gray-6: hsl(224, 14%, 16%);--sl-color-black: hsl(224, 10%, 10%);--sl-hue-orange: 41;--sl-color-orange-low: hsl(var(--sl-hue-orange), 39%, 22%);--sl-color-orange: hsl(var(--sl-hue-orange), 82%, 63%);--sl-color-orange-high: hsl(var(--sl-hue-orange), 82%, 87%);--sl-hue-green: 101;--sl-color-green-low: hsl(var(--sl-hue-green), 39%, 22%);--sl-color-green: hsl(var(--sl-hue-green), 82%, 63%);--sl-color-green-high: hsl(var(--sl-hue-green), 82%, 80%);--sl-hue-blue: 234;--sl-color-blue-low: hsl(var(--sl-hue-blue), 54%, 20%);--sl-color-blue: hsl(var(--sl-hue-blue), 100%, 60%);--sl-color-blue-high: hsl(var(--sl-hue-blue), 100%, 87%);--sl-hue-purple: 281;--sl-color-purple-low: hsl(var(--sl-hue-purple), 39%, 22%);--sl-color-purple: hsl(var(--sl-hue-purple), 82%, 63%);--sl-color-purple-high: hsl(var(--sl-hue-purple), 82%, 89%);--sl-hue-red: 339;--sl-color-red-low: hsl(var(--sl-hue-red), 39%, 22%);--sl-color-red: hsl(var(--sl-hue-red), 82%, 63%);--sl-color-red-high: hsl(var(--sl-hue-red), 82%, 87%);--sl-color-accent-low: hsl(224, 54%, 20%);--sl-color-accent: hsl(224, 100%, 60%);--sl-color-accent-high: hsl(224, 100%, 85%);--sl-color-text: var(--sl-color-gray-2);--sl-color-text-accent: var(--sl-color-accent-high);--sl-color-text-invert: var(--sl-color-accent-low);--sl-color-bg: var(--sl-color-black);--sl-color-bg-nav: var(--sl-color-gray-6);--sl-color-bg-sidebar: var(--sl-color-gray-6);--sl-color-bg-inline-code: var(--sl-color-gray-5);--sl-color-hairline-light: var(--sl-color-gray-5);--sl-color-hairline: var(--sl-color-gray-6);--sl-color-hairline-shade: var(--sl-color-black);--sl-color-backdrop-overlay: hsla(223, 13%, 10%, 0.66);--sl-shadow-sm: 0px 1px 1px hsla(0, 0%, 0%, 0.12), 0px 2px 1px hsla(0, 0%, 0%, 0.24);--sl-shadow-md: 0px 8px 4px hsla(0, 0%, 0%, 0.08), 0px 5px 2px hsla(0, 0%, 0%, 0.08), 0px 3px 2px hsla(0, 0%, 0%, 0.12), 0px 1px 1px hsla(0, 0%, 0%, 0.15);--sl-shadow-lg: 0px 25px 7px hsla(0, 0%, 0%, 0.03), 0px 16px 6px hsla(0, 0%, 0%, 0.1), 0px 9px 5px hsla(223, 13%, 10%, 0.33), 0px 4px 4px hsla(0, 0%, 0%, 0.75), 0px 4px 2px hsla(0, 0%, 0%, 0.25);--sl-text-xs: 0.8125rem;--sl-text-sm: 0.875rem;--sl-text-base: 1rem;--sl-text-lg: 1.125rem;--sl-text-xl: 1.25rem;--sl-text-2xl: 1.5rem;--sl-text-3xl: 1.8125rem;--sl-text-4xl: 2.1875rem;--sl-text-5xl: 2.625rem;--sl-text-6xl: 4rem;--sl-text-body: var(--sl-text-base);--sl-text-body-sm: var(--sl-text-xs);--sl-text-code: var(--sl-text-sm);--sl-text-code-sm: var(--sl-text-xs);--sl-text-h1: var(--sl-text-4xl);--sl-text-h2: var(--sl-text-3xl);--sl-text-h3: var(--sl-text-2xl);--sl-text-h4: var(--sl-text-xl);--sl-text-h5: var(--sl-text-lg);--sl-line-height: 1.8;--sl-line-height-headings: 1.2;--sl-font-system: ui-sans-serif, system-ui, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--sl-font-system-mono: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--__sl-font: var(--sl-font, ""), var(--sl-font-system);--__sl-font-mono: var(--sl-font-mono, ""), var(--sl-font-system-mono);--sl-nav-height: 3.5rem;--sl-nav-pad-x: 1rem;--sl-nav-pad-y: 0.75rem;--sl-mobile-toc-height: 3rem;--sl-sidebar-width: 18.75rem;--sl-sidebar-pad-x: 1rem;--sl-content-width: 45rem;--sl-content-pad-x: 1rem;--sl-menu-button-size: 2rem;--sl-nav-gap: var(--sl-content-pad-x);--sl-outline-offset-inside: -0.1875rem;--sl-z-index-toc: 4;--sl-z-index-menu: 5;--sl-z-index-navbar: 10;--sl-z-index-skiplink: 20}:root{--purple-hsl: 255, 60%, 60%;--overlay-blurple: hsla(var(--purple-hsl), 0.2)}:root{--ec-brdRad: 0px;--ec-brdWd: 1px;--ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-codeFontFml: var(--__sl-font-mono);--ec-codeFontSize: var(--sl-text-code);--ec-codeFontWg: 400;--ec-codeLineHt: var(--sl-line-height);--ec-codePadBlk: 0.75rem;--ec-codePadInl: 1rem;--ec-codeBg: #011627;--ec-codeFg: #d6deeb;--ec-codeSelBg: #1d3b53;--ec-uiFontFml: var(--__sl-font);--ec-uiFontSize: 0.9rem;--ec-uiFontWg: 400;--ec-uiLineHt: 1.65;--ec-uiPadBlk: 0.25rem;--ec-uiPadInl: 1rem;--ec-uiSelBg: #234d708c;--ec-uiSelFg: #ffffff;--ec-focusBrd: #122d42;--ec-sbThumbCol: #ffffff17;--ec-sbThumbHoverCol: #ffffff49;--ec-tm-lineMarkerAccentMarg: 0rem;--ec-tm-lineMarkerAccentWd: 0.15rem;--ec-tm-lineDiffIndMargLeft: 0.25rem;--ec-tm-inlMarkerBrdWd: 1.5px;--ec-tm-inlMarkerBrdRad: 0.2rem;--ec-tm-inlMarkerPad: 0.15rem;--ec-tm-insDiffIndContent: "+";--ec-tm-delDiffIndContent: "-";--ec-tm-markBg: #ffffff17;--ec-tm-markBrdCol: #ffffff40;--ec-tm-insBg: #1e571599;--ec-tm-insBrdCol: #487f3bd0;--ec-tm-insDiffIndCol: #79b169d0;--ec-tm-delBg: #862d2799;--ec-tm-delBrdCol: #b4554bd0;--ec-tm-delDiffIndCol: #ed8779d0;--ec-frm-shdCol: #011627;--ec-frm-frameBoxShdCssVal: none;--ec-frm-edActTabBg: var(--sl-color-gray-6);--ec-frm-edActTabFg: var(--sl-color-text);--ec-frm-edActTabBrdCol: transparent;--ec-frm-edActTabIndHt: 1px;--ec-frm-edActTabIndTopCol: var(--sl-color-accent-high);--ec-frm-edActTabIndBtmCol: transparent;--ec-frm-edTabsMargInlStart: 0;--ec-frm-edTabsMargBlkStart: 0;--ec-frm-edTabBrdRad: 0px;--ec-frm-edTabBarBg: var(--sl-color-black);--ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edBg: var(--sl-color-gray-6);--ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmTtbDotsOpa: 0.75;--ec-frm-trmTtbBg: var(--sl-color-black);--ec-frm-trmTtbFg: var(--sl-color-text);--ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmBg: var(--sl-color-gray-6);--ec-frm-inlBtnFg: var(--sl-color-text);--ec-frm-inlBtnBg: var(--sl-color-text);--ec-frm-inlBtnBgIdleOpa: 0;--ec-frm-inlBtnBgHoverOrFocusOpa: 0.2;--ec-frm-inlBtnBgActOpa: 0.3;--ec-frm-inlBtnBrd: var(--sl-color-text);--ec-frm-inlBtnBrdOpa: 0.4;--ec-frm-tooltipSuccessBg: #158744;--ec-frm-tooltipSuccessFg: white}:root,[data-bs-theme="light"]{--bs-blue: #3347ff;--bs-indigo: #6610f2;--bs-purple: #bd53ee;--bs-pink: #d63384;--bs-red: #ee5389;--bs-orange: #fd7e14;--bs-yellow: #eebd53;--bs-green: #84ee53;--bs-teal: #20c997;--bs-cyan: #0dcaf0;--bs-black: #000;--bs-white: #fff;--bs-gray: #6c757d;--bs-gray-dark: #343a40;--bs-gray-100: #f8f9fa;--bs-gray-200: #e9ecef;--bs-gray-300: #dee2e6;--bs-gray-400: #ced4da;--bs-gray-500: #adb5bd;--bs-gray-600: #6c757d;--bs-gray-700: #495057;--bs-gray-800: #343a40;--bs-gray-900: #212529;--bs-primary: #5d2f86;--bs-secondary: #6c757d;--bs-success: #84ee53;--bs-info: #3347ff;--bs-warning: #eebd53;--bs-danger: #ee5389;--bs-light: #f8f9fa;--bs-dark: #212529;--bs-primary-rgb: 93,47,134;--bs-secondary-rgb: 108,117,125;--bs-success-rgb: 132.2821,238.017,83.283;--bs-info-rgb: 51,71.4,255;--bs-warning-rgb: 238.017,189.0179,83.283;--bs-danger-rgb: 238.017,83.283,137.4399;--bs-light-rgb: 248,249,250;--bs-dark-rgb: 33,37,41;--bs-primary-text-emphasis: #251336;--bs-secondary-text-emphasis: #2b2f32;--bs-success-text-emphasis: #355f21;--bs-info-text-emphasis: #141d66;--bs-warning-text-emphasis: #5f4c21;--bs-danger-text-emphasis: #5f2137;--bs-light-text-emphasis: #495057;--bs-dark-text-emphasis: #495057;--bs-primary-bg-subtle: #dfd5e7;--bs-secondary-bg-subtle: #e2e3e5;--bs-success-bg-subtle: #e6fcdd;--bs-info-bg-subtle: #d6daff;--bs-warning-bg-subtle: #fcf2dd;--bs-danger-bg-subtle: #fcdde7;--bs-light-bg-subtle: #fcfcfd;--bs-dark-bg-subtle: #ced4da;--bs-primary-border-subtle: #beaccf;--bs-secondary-border-subtle: #c4c8cb;--bs-success-border-subtle: #cef8ba;--bs-info-border-subtle: #adb6ff;--bs-warning-border-subtle: #f8e5ba;--bs-danger-border-subtle: #f8bad0;--bs-light-border-subtle: #e9ecef;--bs-dark-border-subtle: #adb5bd;--bs-white-rgb: 255,255,255;--bs-black-rgb: 0,0,0;--bs-font-sans-serif: "Jost", system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--bs-gradient: linear-gradient(180deg, rgba(255,255,255,0.15), rgba(255,255,255,0));--bs-body-font-family: var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight: 400;--bs-body-line-height: 1.5;--bs-body-color: #1d2d35;--bs-body-color-rgb: 29,45,53;--bs-body-bg: #fff;--bs-body-bg-rgb: 255,255,255;--bs-emphasis-color: #000;--bs-emphasis-color-rgb: 0,0,0;--bs-secondary-color: rgba(29,45,53,0.75);--bs-secondary-color-rgb: 29,45,53;--bs-secondary-bg: #e9ecef;--bs-secondary-bg-rgb: 233,236,239;--bs-tertiary-color: rgba(29,45,53,0.5);--bs-tertiary-color-rgb: 29,45,53;--bs-tertiary-bg: #f8f9fa;--bs-tertiary-bg-rgb: 248,249,250;--bs-heading-color: inherit;--bs-link-color: #5d2f86;--bs-link-color-rgb: 93,47,134;--bs-link-decoration: none;--bs-link-hover-color: #4a266b;--bs-link-hover-color-rgb: 74,38,107;--bs-link-hover-decoration: underline;--bs-code-color: #d63384;--bs-highlight-color: #1d2d35;--bs-highlight-bg: #fcf2dd;--bs-border-width: 1px;--bs-border-style: solid;--bs-border-color: #dee2e6;--bs-border-color-translucent: rgba(0,0,0,0.175);--bs-border-radius: .375rem;--bs-border-radius-sm: .25rem;--bs-border-radius-lg: .5rem;--bs-border-radius-xl: 1rem;--bs-border-radius-xxl: 2rem;--bs-border-radius-2xl: var(--bs-border-radius-xxl);--bs-border-radius-pill: 50rem;--bs-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15);--bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0,0,0,0.075);--bs-box-shadow-lg: 0 1rem 3rem rgba(0,0,0,0.175);--bs-box-shadow-inset: inset 0 1px 2px rgba(0,0,0,0.075);--bs-focus-ring-width: .25rem;--bs-focus-ring-opacity: .25;--bs-focus-ring-color: rgba(93,47,134,0.25);--bs-form-valid-color: #84ee53;--bs-form-valid-border-color: #84ee53;--bs-form-invalid-color: #ee5389;--bs-form-invalid-border-color: #ee5389}[data-bs-theme="dark"]{color-scheme:dark;--bs-body-color: #c1c3c8;--bs-body-color-rgb: 192.831,194.7078,199.869;--bs-body-bg: #17181c;--bs-body-bg-rgb: 22.95,24.31,28.05;--bs-emphasis-color: #fff;--bs-emphasis-color-rgb: 255,255,255;--bs-secondary-color: rgba(193,195,200,0.75);--bs-secondary-color-rgb: 192.831,194.7078,199.869;--bs-secondary-bg: #343a40;--bs-secondary-bg-rgb: 52,58,64;--bs-tertiary-color: rgba(193,195,200,0.5);--bs-tertiary-color-rgb: 192.831,194.7078,199.869;--bs-tertiary-bg: #2b3035;--bs-tertiary-bg-rgb: 43,48,53;--bs-primary-text-emphasis: #9e82b6;--bs-secondary-text-emphasis: #a7acb1;--bs-success-text-emphasis: #b5f598;--bs-info-text-emphasis: #8591ff;--bs-warning-text-emphasis: #f5d798;--bs-danger-text-emphasis: #f598b8;--bs-light-text-emphasis: #f8f9fa;--bs-dark-text-emphasis: #dee2e6;--bs-primary-bg-subtle: #13091b;--bs-secondary-bg-subtle: #161719;--bs-success-bg-subtle: #1a3011;--bs-info-bg-subtle: #0a0e33;--bs-warning-bg-subtle: #302611;--bs-danger-bg-subtle: #30111b;--bs-light-bg-subtle: #23262f;--bs-dark-bg-subtle: #1a1d20;--bs-primary-border-subtle: #381c50;--bs-secondary-border-subtle: #41464b;--bs-success-border-subtle: #4f8f32;--bs-info-border-subtle: #1f2b99;--bs-warning-border-subtle: #8f7132;--bs-danger-border-subtle: #8f3252;--bs-light-border-subtle: #353841;--bs-dark-border-subtle: #343a40;--bs-heading-color: #fff;--bs-link-color: #b3c7ff;--bs-link-hover-color: #c2d2ff;--bs-link-color-rgb: 178.5,198.9,255;--bs-link-hover-color-rgb: 194,210,255;--bs-code-color: #e685b5;--bs-highlight-color: #c1c3c8;--bs-highlight-bg: #5f4c21;--bs-border-color: #495057;--bs-border-color-translucent: rgba(255,255,255,0.15);--bs-form-valid-color: #b5f598;--bs-form-valid-border-color: #b5f598;--bs-form-invalid-color: #f598b8;--bs-form-invalid-border-color: #f598b8}*,*::before,*::after{box-sizing:border-box}@media (prefers-reduced-motion: no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:0;margin-bottom:.5rem;font-weight:700;line-height:1.2;color:var(--bs-heading-color)}h1,.h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width: 1200px){h1,.h1{font-size:2.5rem}}h2,.h2{font-size:calc(1.325rem + .9vw)}@media (min-width: 1200px){h2,.h2{font-size:2rem}}h3,.h3{font-size:calc(1.3rem + .6vw)}@media (min-width: 1200px){h3,.h3{font-size:1.75rem}}h4,.h4{font-size:calc(1.275rem + .3vw)}@media (min-width: 1200px){h4,.h4{font-size:1.5rem}}h5,.h5{font-size:1.25rem}p{margin-top:0;margin-bottom:1rem}ol,ul{padding-left:2rem}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}strong{font-weight:bolder}small,.small{font-size:.875em}mark,.mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}a{color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));text-decoration:none}a:hover{--bs-link-color-rgb: var(--bs-link-hover-color-rgb);text-decoration:underline}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}pre,code,kbd,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}th{text-align:inherit;text-align:-webkit-match-parent}thead,tbody,tr,td,th{border-color:inherit;border-style:solid;border-width:0}button{border-radius:0}button:focus:not(:focus-visible){outline:0}input,button{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button{text-transform:none}[list]:not([type="date"]):not([type="datetime-local"]):not([type="month"]):not([type="week"]):not([type="time"])::-webkit-calendar-picker-indicator{display:none !important}button,[type="button"],[type="reset"],[type="submit"]{-webkit-appearance:button}button:not(:disabled),[type="button"]:not(:disabled),[type="reset"]:not(:disabled),[type="submit"]:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-text,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type="search"]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}summary{display:list-item;cursor:pointer}[hidden]{display:none !important}.lead{font-size:1.25rem;font-weight:400}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.img-fluid{max-width:100%;height:auto}.figure{display:inline-block}.container,.container-fluid,.container-lg{--bs-gutter-x: 3rem;--bs-gutter-y: 0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width: 576px){.container{max-width:540px}}@media (min-width: 768px){.container{max-width:720px}}@media (min-width: 992px){.container-lg,.container{max-width:960px}}@media (min-width: 1200px){.container-lg,.container{max-width:1240px}}@media (min-width: 1400px){.container-lg,.container{max-width:1320px}}:root{--bs-breakpoint-xs: 0;--bs-breakpoint-sm: 576px;--bs-breakpoint-md: 768px;--bs-breakpoint-lg: 992px;--bs-breakpoint-xl: 1200px;--bs-breakpoint-xxl: 1400px}.row{--bs-gutter-x: 3rem;--bs-gutter-y: 0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}@media (min-width: 768px){.col-md-12{flex:0 0 auto;width:75%}}@media (min-width: 992px){.col-lg-5{flex:0 0 auto;width:31.25%}.col-lg-8{flex:0 0 auto;width:50%}.col-lg-9{flex:0 0 auto;width:56.25%}.col-lg-10{flex:0 0 auto;width:62.5%}.col-lg-11{flex:0 0 auto;width:68.75%}.col-lg-12{flex:0 0 auto;width:75%}}@media (min-width: 1200px){.col-xl-3{flex:0 0 auto;width:18.75%}.col-xl-4{flex:0 0 auto;width:25%}.col-xl-8{flex:0 0 auto;width:50%}.col-xl-9{flex:0 0 auto;width:56.25%}}.sticky-top{position:sticky;top:0;z-index:1020}.visually-hidden{width:1px !important;height:1px !important;padding:0 !important;margin:-1px !important;overflow:hidden !important;clip:rect(0, 0, 0, 0) !important;white-space:nowrap !important;border:0 !important}.visually-hidden:not(caption){position:absolute !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.table,table{--bs-table-color-type: initial;--bs-table-bg-type: initial;--bs-table-color-state: initial;--bs-table-bg-state: initial;--bs-table-color: var(--bs-emphasis-color);--bs-table-bg: var(--bs-body-bg);--bs-table-border-color: var(--bs-border-color);--bs-table-accent-bg: rgba(0,0,0,0);--bs-table-striped-color: var(--bs-emphasis-color);--bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color: var(--bs-emphasis-color);--bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color: var(--bs-emphasis-color);--bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*,table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)))}.table>tbody,table>tbody{vertical-align:inherit}.table>thead,table>thead{vertical-align:bottom}[data-bs-theme="dark"] table{--bs-table-color: #fff;--bs-table-bg: #212529;--bs-table-border-color: #4d5154;--bs-table-striped-bg: #2c3034;--bs-table-striped-color: #fff;--bs-table-active-bg: #373b3e;--bs-table-active-color: #fff;--bs-table-hover-bg: #323539;--bs-table-hover-color: #fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}li input[type="checkbox"]{--bs-form-check-bg: var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;print-color-adjust:exact}li input[type="checkbox"]{border-radius:.25em}li input[type="radio"][type="checkbox"]{border-radius:50%}li input[type="checkbox"]:active{filter:brightness(90%)}li input[type="checkbox"]:focus{border-color:#ae97c3;outline:0;box-shadow:0 0 0 .25rem rgba(93,47,134,0.25)}li input[type="checkbox"]:checked{background-color:#5d2f86;border-color:#5d2f86}li input:checked[type="checkbox"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}li input[type="checkbox"]:checked[type="radio"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}li input[type="checkbox"]:indeterminate{background-color:#5d2f86;border-color:#5d2f86;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}li input[type="checkbox"]:disabled{pointer-events:none;filter:none;opacity:.5}.btn{--bs-btn-padding-x: .75rem;--bs-btn-padding-y: .375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight: 400;--bs-btn-line-height: 1.5;--bs-btn-color: var(--bs-body-color);--bs-btn-bg: transparent;--bs-btn-border-width: var(--bs-border-width);--bs-btn-border-color: transparent;--bs-btn-border-radius: var(--bs-border-radius);--bs-btn-hover-border-color: transparent;--bs-btn-box-shadow: inset 0 1px 0 rgba(255,255,255,0.15),0 1px 1px rgba(0,0,0,0.075);--bs-btn-disabled-opacity: .65;--bs-btn-focus-box-shadow: 0 0 0 0 rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);text-decoration:none;background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}:not(.btn-check)+.btn:active,.btn:first-child:active,.btn.active,.btn.show{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}:not(.btn-check)+.btn:active:focus-visible,.btn:first-child:active:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled,.btn.disabled{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color: #fff;--bs-btn-bg: #5d2f86;--bs-btn-border-color: #5d2f86;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #4f2872;--bs-btn-hover-border-color: #4a266b;--bs-btn-focus-shadow-rgb: 117,78,152;--bs-btn-active-color: #fff;--bs-btn-active-bg: #4a266b;--bs-btn-active-border-color: #462365;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #5d2f86;--bs-btn-disabled-border-color: #5d2f86}.btn-link{--bs-btn-font-weight: 400;--bs-btn-color: var(--bs-link-color);--bs-btn-bg: transparent;--bs-btn-border-color: transparent;--bs-btn-hover-color: var(--bs-link-hover-color);--bs-btn-hover-border-color: transparent;--bs-btn-active-color: var(--bs-link-hover-color);--bs-btn-active-border-color: transparent;--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-border-color: transparent;--bs-btn-box-shadow: 0 0 0 #000;--bs-btn-focus-shadow-rgb: 117,78,152;text-decoration:none}.btn-link:hover,.btn-link:focus-visible{text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.nav{--bs-nav-link-padding-x: 1rem;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-link-color);--bs-nav-link-hover-color: var(--bs-link-hover-color);--bs-nav-link-disabled-color: var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);background:none;border:0;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.nav-link{transition:none}}.nav-link:hover,.nav-link:focus{color:var(--bs-nav-link-hover-color);text-decoration:none}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(93,47,134,0.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.navbar{--bs-navbar-padding-x: 0;--bs-navbar-padding-y: .5rem;--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y: .3125rem;--bs-navbar-brand-margin-end: 1rem;--bs-navbar-brand-font-size: 1.25rem;--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x: .5rem;--bs-navbar-toggler-padding-y: .25rem;--bs-navbar-toggler-padding-x: .75rem;--bs-navbar-toggler-font-size: 1.25rem;--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2829,45,53,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius: var(--bs-border-radius);--bs-navbar-toggler-focus-width: 0;--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{color:var(--bs-navbar-brand-hover-color);text-decoration:none}.navbar-nav{--bs-nav-link-padding-x: 0;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-navbar-color);--bs-nav-link-hover-color: var(--bs-navbar-hover-color);--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}@media (min-width: 992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar[data-bs-theme="dark"]{--bs-navbar-color: #c1c3c8;--bs-navbar-hover-color: #b3c7ff;--bs-navbar-disabled-color: rgba(255,255,255,0.25);--bs-navbar-active-color: #b3c7ff;--bs-navbar-brand-color: #b3c7ff;--bs-navbar-brand-hover-color: #b3c7ff;--bs-navbar-toggler-border-color: rgba(255,255,255,0.1);--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23c1c3c8' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y: 1rem;--bs-card-spacer-x: 1rem;--bs-card-title-spacer-y: .5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width: var(--bs-border-width);--bs-card-border-color: #e9ecef;--bs-card-border-radius: var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y: .5rem;--bs-card-cap-padding-x: 1rem;--bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg: var(--bs-body-bg);--bs-card-img-overlay-padding: 1rem;--bs-card-group-margin: 1.5rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-text:last-child{margin-bottom:0}.breadcrumb{--bs-breadcrumb-padding-x: 0;--bs-breadcrumb-padding-y: 0;--bs-breadcrumb-margin-bottom: 1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color: var(--bs-secondary-color);--bs-breadcrumb-item-padding-x: .5rem;--bs-breadcrumb-item-active-color: var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);text-decoration:none;background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.page-link.active,.active>.page-link{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.page-link.disabled,.disabled>.page-link{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.modal-backdrop{--bs-backdrop-zindex: 1050;--bs-backdrop-bg: #000;--bs-backdrop-opacity: .5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}@keyframes spinner-border{to{transform:rotate(360deg) /* rtl:ignore */}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.offcanvas{--bs-offcanvas-zindex: 1045;--bs-offcanvas-width: 332px;--bs-offcanvas-height: 30vh;--bs-offcanvas-padding-x: 1rem;--bs-offcanvas-padding-y: 1rem;--bs-offcanvas-color: var(--bs-body-color);--bs-offcanvas-bg: var(--bs-body-bg);--bs-offcanvas-border-width: var(--bs-border-width);--bs-offcanvas-border-color: var(--bs-border-color-translucent);--bs-offcanvas-box-shadow: var(--bs-box-shadow-sm);--bs-offcanvas-transition: transform .3s ease-in-out;--bs-offcanvas-title-line-height: 1.5}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion: reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.showing,.offcanvas.show:not(.hiding){transform:none}.offcanvas.showing,.offcanvas.hiding,.offcanvas.show{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}@keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}.d-none{display:none !important}.position-relative{position:relative !important}.w-100{width:100% !important}.h-auto{height:auto !important}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-grow-1{flex-grow:1 !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.order-3{order:3 !important}.m-2{margin:.5rem !important}.mx-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-auto{margin-right:auto !important;margin-left:auto !important}.my-0{margin-top:0 !important;margin-bottom:0 !important}.my-3{margin-top:1rem !important;margin-bottom:1rem !important}.mt-1{margin-top:.25rem !important}.mt-4{margin-top:1.5rem !important}.me-2{margin-right:.5rem !important}.me-auto{margin-right:auto !important}.mb-3{margin-bottom:1rem !important}.mb-4{margin-bottom:1.5rem !important}.ms-2{margin-left:.5rem !important}.ms-auto{margin-left:auto !important}.mt-n3{margin-top:-1rem !important}.p-0{padding:0 !important}.p-2{padding:.5rem !important}.pt-4{padding-top:1.5rem !important}.pe-4{padding-right:1.5rem !important}.pb-2{padding-bottom:.5rem !important}.pb-3{padding-bottom:1rem !important}.pb-4{padding-bottom:1.5rem !important}.ps-3{padding-left:1rem !important}.text-start{text-align:left !important}.text-end{text-align:right !important}.text-center{text-align:center !important}.text-decoration-none{text-decoration:none !important}.text-nowrap{white-space:nowrap !important}.text-body{--bs-text-opacity: 1;color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important}.text-muted{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-body-secondary{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-reset{--bs-text-opacity: 1;color:inherit !important}.rounded-circle{border-radius:50% !important}@media (min-width: 576px){.flex-sm-row{flex-direction:row !important}}@media (min-width: 768px){.flex-md-row{flex-direction:row !important}}@media (min-width: 992px){.d-lg-block{display:block !important}.d-lg-none{display:none !important}.flex-lg-row{flex-direction:row !important}.order-lg-4{order:4 !important}.me-lg-1{margin-right:.25rem !important}.me-lg-3{margin-right:1rem !important}.ms-lg-2{margin-left:.5rem !important}.text-lg-start{text-align:left !important}.text-lg-end{text-align:right !important}}@media (min-width: 1200px){.d-xl-block{display:block !important}.d-xl-none{display:none !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.mx-xl-auto{margin-right:auto !important;margin-left:auto !important}}@font-face{font-family:Jost;font-style:normal;font-weight:400;font-display:swap;src:local("Jost Regular Regular"),local("Jost-Regular"),local("Jost* Book"),local("Jost-Book"),url("fonts/vendor/jost/jost-v4-latin-regular.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-regular.woff") format("woff")}@font-face{font-family:Jost;font-style:normal;font-weight:500;font-display:swap;src:local("Jost Regular Medium"),local("JostRoman-Medium"),local("Jost* Medium"),local("Jost-Medium"),url("fonts/vendor/jost/jost-v4-latin-500.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-500.woff") format("woff")}@font-face{font-family:Jost;font-style:normal;font-weight:700;font-display:swap;src:local("Jost Regular Bold"),local("JostRoman-Bold"),local("Jost* Bold"),local("Jost-Bold"),url("fonts/vendor/jost/jost-v4-latin-700.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-700.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:400;font-display:swap;src:local("Jost Italic Italic"),local("Jost-Italic"),local("Jost* BookItalic"),local("Jost-BookItalic"),url("fonts/vendor/jost/jost-v4-latin-italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-italic.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:500;font-display:swap;src:local("Jost Italic Medium Italic"),local("JostItalic-Medium"),local("Jost* Medium Italic"),local("Jost-MediumItalic"),url("fonts/vendor/jost/jost-v4-latin-500italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-500italic.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:700;font-display:swap;src:local("Jost Italic Bold Italic"),local("JostItalic-Bold"),local("Jost* Bold Italic"),local("Jost-BoldItalic"),url("fonts/vendor/jost/jost-v4-latin-700italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-700italic.woff") format("woff")}html[data-bs-theme="dark"] .icon-tabler-sun{display:block}html[data-bs-theme="dark"] .icon-tabler-moon{display:none}html[data-bs-theme="light"] .icon-tabler-sun{display:none}html[data-bs-theme="light"] .icon-tabler-moon{display:block}.privacy .content,.contributors .content,.blog .content,.error404 .content,.docs.list .content,.categories.list .content,.tags.list .content,.list.section .content{padding-top:1rem;padding-bottom:3rem}.content img{max-width:100%}h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:2rem;margin-bottom:1rem}@media (min-width: 768px){body{font-size:1.125rem}h1,h2,h3,h4,h5,.h1,.h2,.h3,.h4,.h5{margin-bottom:1.125rem}}.home h1,.home .h1{font-size:calc(1.875rem + 1.5vw);margin-top:-1rem}a:hover,a:focus{text-decoration:underline}a.btn:hover,a.btn:focus{text-decoration:none}.section{padding-top:5rem;padding-bottom:5rem}body.section{padding-top:0;padding-bottom:0}.section-md{padding-top:3rem;padding-bottom:3rem}.docs-sidebar{order:2}@media (min-width: 992px){.docs-sidebar{order:0;border-right:1px solid #e9ecef}@supports (position: sticky){.docs-sidebar{position:sticky;top:4.25rem;z-index:1000;height:calc(100vh - 4.25rem)}}}@media (min-width: 1200px){.docs-sidebar{flex:0 1 320px}}.docs-links{padding-bottom:5rem}@media (min-width: 992px){@supports (position: sticky){.docs-links{max-height:calc(100vh - 4rem);overflow-y:scroll}}}@media (min-width: 992px){.docs-links{display:block;width:auto;margin-right:-1.5rem;padding-bottom:4rem}}.docs-toc{order:2}@supports (position: sticky){.docs-toc{position:sticky;top:4.25rem;height:calc(100vh - 4.25rem);overflow-y:auto}}.docs-content{padding-bottom:3rem;order:1}.navbar a:hover,.navbar a:focus{text-decoration:none}#TableOfContents ul,#toc ul{padding-left:0;list-style:none}#toc a.active{color:#5d2f86;font-weight:500}.section-features{padding-top:2rem}.bg-dots{background-image:radial-gradient(#dee2e6 15%, transparent 15%);background-position:0 0;background-size:1rem 1rem;-webkit-mask:linear-gradient(to top, #fff, transparent);mask:linear-gradient(to top, #fff, transparent);width:100%;height:11rem;margin-top:-10rem;z-index:-1}.modal-backdrop{background-color:#fff}.modal-backdrop.show{opacity:0.7}@media (min-width: 768px){.modal-backdrop.show{opacity:0}}li input[type="checkbox"]{margin:0.25rem;border:1px solid #ced4da}li input[type="checkbox"]:disabled{pointer-events:none;filter:none;opacity:1}li input[type="checkbox"]:checked{background-color:#5d2f86;border-color:#5d2f86}[data-bs-theme="dark"] li input[type="checkbox"]{border:1px solid #6c757d}[data-bs-theme="dark"] li input[type="checkbox"]:checked{background-color:#b3c7ff;border-color:#b3c7ff;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%231d2d35' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.content .svg-inline{margin-bottom:1.5rem}.content .svg-inline:not(.svg-inline-custom){height:1.875rem;width:1.875rem;stroke-width:1.5}.card-nav{-moz-column-gap:1rem;column-gap:1rem}.card-nav .card{margin:0.5rem 0}.card-nav .card:hover{border:1px solid #d9d9d9;background-color:var(--sl-color-gray-7)}[data-bs-theme="dark"] .card-nav .card{border:1px solid #353841}[data-bs-theme="dark"] .card-nav .card:hover{border:1px solid #888c96;background-color:var(--sl-color-gray-6)}.highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}.bg{background-color:var(--sl-color-gray-7)}.chroma{background-color:var(--sl-color-gray-7)}.chroma .err{color:inherit}.chroma .lnlinks{outline:none;text-decoration:none;color:inherit}.chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}.chroma .lntable{border-spacing:0;padding:0;margin:0;border:0}.chroma .hl{background-color:#0000001a}.chroma .hl{border-inline-start:0.15rem solid #00000055;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}.chroma .hl .ln{margin-left:-0.15rem}.chroma .lnt{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#7f7f7f}.chroma .ln{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#7f7f7f}.chroma .line{display:flex}.chroma .k{color:#000000;font-weight:bold}.chroma .kc{color:#000000;font-weight:bold}.chroma .kd{color:#000000;font-weight:bold}.chroma .kn{color:#000000;font-weight:bold}.chroma .kp{color:#000000;font-weight:bold}.chroma .kr{color:#000000;font-weight:bold}.chroma .kt{color:#445588;font-weight:bold}.chroma .na{color:#008080}.chroma .nb{color:#0086b3}.chroma .bp{color:#999999}.chroma .nc{color:#445588;font-weight:bold}.chroma .no{color:#008080}.chroma .nd{color:#3c5d5d;font-weight:bold}.chroma .ni{color:#800080}.chroma .ne{color:#990000;font-weight:bold}.chroma .nf{color:#990000;font-weight:bold}.chroma .nl{color:#990000;font-weight:bold}.chroma .nn{color:#555555}.chroma .nt{color:#000080}.chroma .nv{color:#008080}.chroma .vc{color:#008080}.chroma .vg{color:#008080}.chroma .vi{color:#008080}.chroma .s{color:#dd1144}.chroma .sa{color:#dd1144}.chroma .sb{color:#dd1144}.chroma .sc{color:#dd1144}.chroma .dl{color:#dd1144}.chroma .sd{color:#dd1144}.chroma .s2{color:#dd1144}.chroma .se{color:#dd1144}.chroma .sh{color:#dd1144}.chroma .si{color:#dd1144}.chroma .sx{color:#dd1144}.chroma .sr{color:#009926}.chroma .s1{color:#dd1144}.chroma .ss{color:#990073}.chroma .m{color:#009999}.chroma .mb{color:#009999}.chroma .mf{color:#009999}.chroma .mh{color:#009999}.chroma .mi{color:#009999}.chroma .il{color:#009999}.chroma .mo{color:#009999}.chroma .o{color:#000000;font-weight:bold}.chroma .ow{color:#000000;font-weight:bold}.chroma .c{color:#999988;font-style:italic}.chroma .ch{color:#999988;font-style:italic}.chroma .cm{color:#999988;font-style:italic}.chroma .c1{color:#999988;font-style:italic}.chroma .cs{color:#999999;font-weight:bold;font-style:italic}.chroma .cp{color:#999999;font-weight:bold;font-style:italic}.chroma .cpf{color:#999999;font-weight:bold;font-style:italic}.chroma .gd{color:#000000;background-color:#ffdddd}.chroma .ge{color:inherit;font-style:italic}.chroma .gr{color:#aa0000}.chroma .gh{color:#999999}.chroma .gi{color:#000000;background-color:#ddffdd}.chroma .go{color:#888888}.chroma .gp{color:#555555}.chroma .gs{font-weight:bold}.chroma .gu{color:#aaaaaa}.chroma .gt{color:#aa0000}.chroma .gl{text-decoration:underline}.chroma .w{color:#bbbbbb}[data-bs-theme="dark"] .highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}[data-bs-theme="dark"] .bg{color:#c9d1d9;background-color:var(--sl-color-gray-6)}[data-bs-theme="dark"] .chroma{color:#c9d1d9;background-color:var(--sl-color-gray-6)}[data-bs-theme="dark"] .chroma .err{color:inherit}[data-bs-theme="dark"] .chroma .lnlinks{outline:none;text-decoration:none;color:inherit}[data-bs-theme="dark"] .chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}[data-bs-theme="dark"] .chroma .lntable{border-spacing:0;padding:0;margin:0;border:0}[data-bs-theme="dark"] .chroma .hl{background-color:#ffffff17}[data-bs-theme="dark"] .chroma .hl{border-inline-start:0.15rem solid #ffffff40;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}[data-bs-theme="dark"] .chroma .hl .ln{margin-left:-0.15rem}[data-bs-theme="dark"] .chroma .lnt{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#64686c}[data-bs-theme="dark"] .chroma .ln{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#6e7681}[data-bs-theme="dark"] .chroma .line{display:flex}[data-bs-theme="dark"] .chroma .k{color:#ff7b72}[data-bs-theme="dark"] .chroma .kc{color:#79c0ff}[data-bs-theme="dark"] .chroma .kd{color:#ff7b72}[data-bs-theme="dark"] .chroma .kn{color:#ff7b72}[data-bs-theme="dark"] .chroma .kp{color:#79c0ff}[data-bs-theme="dark"] .chroma .kr{color:#ff7b72}[data-bs-theme="dark"] .chroma .kt{color:#ff7b72}[data-bs-theme="dark"] .chroma .na{color:#d2a8ff}[data-bs-theme="dark"] .chroma .nc{color:#f0883e;font-weight:bold}[data-bs-theme="dark"] .chroma .no{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nd{color:#d2a8ff;font-weight:bold}[data-bs-theme="dark"] .chroma .ni{color:#ffa657}[data-bs-theme="dark"] .chroma .ne{color:#f0883e;font-weight:bold}[data-bs-theme="dark"] .chroma .nf{color:#d2a8ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nl{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nn{color:#ff7b72}[data-bs-theme="dark"] .chroma .py{color:#79c0ff}[data-bs-theme="dark"] .chroma .nt{color:#7ee787}[data-bs-theme="dark"] .chroma .nv{color:#79c0ff}[data-bs-theme="dark"] .chroma .l{color:#a5d6ff}[data-bs-theme="dark"] .chroma .ld{color:#79c0ff}[data-bs-theme="dark"] .chroma .s{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sa{color:#79c0ff}[data-bs-theme="dark"] .chroma .sb{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sc{color:#a5d6ff}[data-bs-theme="dark"] .chroma .dl{color:#79c0ff}[data-bs-theme="dark"] .chroma .sd{color:#a5d6ff}[data-bs-theme="dark"] .chroma .s2{color:#a5d6ff}[data-bs-theme="dark"] .chroma .se{color:#79c0ff}[data-bs-theme="dark"] .chroma .sh{color:#79c0ff}[data-bs-theme="dark"] .chroma .si{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sx{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sr{color:#79c0ff}[data-bs-theme="dark"] .chroma .s1{color:#a5d6ff}[data-bs-theme="dark"] .chroma .ss{color:#a5d6ff}[data-bs-theme="dark"] .chroma .m{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mb{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mf{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mh{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mi{color:#a5d6ff}[data-bs-theme="dark"] .chroma .il{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mo{color:#a5d6ff}[data-bs-theme="dark"] .chroma .o{color:inherit;font-weight:bold}[data-bs-theme="dark"] .chroma .ow{color:#ff7b72;font-weight:bold}[data-bs-theme="dark"] .chroma .c{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .ch{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .cm{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .c1{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .cs{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .cp{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .cpf{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .gd{color:#ffa198;background-color:#490202}[data-bs-theme="dark"] .chroma .ge{font-style:italic}[data-bs-theme="dark"] .chroma .gr{color:#ffa198}[data-bs-theme="dark"] .chroma .gh{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .gi{color:#56d364;background-color:#0f5323}[data-bs-theme="dark"] .chroma .go{color:#8b949e}[data-bs-theme="dark"] .chroma .gp{color:#8b949e}[data-bs-theme="dark"] .chroma .gs{font-weight:bold}[data-bs-theme="dark"] .chroma .gu{color:#79c0ff}[data-bs-theme="dark"] .chroma .gt{color:#ff7b72}[data-bs-theme="dark"] .chroma .gl{text-decoration:underline}[data-bs-theme="dark"] .chroma .w{color:#6e7681}[data-bs-theme="dark"] h1,[data-bs-theme="dark"] .h1,[data-bs-theme="dark"] h2,[data-bs-theme="dark"] .h2,[data-bs-theme="dark"] h3,[data-bs-theme="dark"] .h3,[data-bs-theme="dark"] h4,[data-bs-theme="dark"] .h4{color:#fff}[data-bs-theme="dark"] body{background:#17181c;color:#c1c3c8}[data-bs-theme="dark"] a{color:#b3c7ff}[data-bs-theme="dark"] .callout a{color:inherit}[data-bs-theme="dark"] .btn-primary{--bs-btn-color: #000;--bs-btn-bg: #b3c7ff;--bs-btn-border-color: #b3c7ff;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #becfff;--bs-btn-hover-border-color: #bacdff;--bs-btn-focus-shadow-rgb: 152,169,217;--bs-btn-active-color: #000;--bs-btn-active-bg: #c2d2ff;--bs-btn-active-border-color: #bacdff;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #b3c7ff;--bs-btn-disabled-border-color: #b3c7ff;color:#17181c}[data-bs-theme="dark"] .navbar{background-color:rgba(23,24,28,0.95);border-bottom:1px solid #23262f}[data-bs-theme="dark"] body.home .navbar{border-bottom:0}[data-bs-theme="dark"] .offcanvas-header{border-bottom:1px solid #343a40}[data-bs-theme="dark"] .offcanvas .nav-link{color:#c1c3c8}[data-bs-theme="dark"] .offcanvas .nav-link:hover,[data-bs-theme="dark"] .offcanvas .nav-link:focus{color:#b3c7ff}[data-bs-theme="dark"] .offcanvas .nav-link.active{color:#b3c7ff}[data-bs-theme="dark"] .page-links a{color:#c1c3c8}[data-bs-theme="dark"] .page-links a:hover{text-decoration:none;color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link{color:#c1c3c8}[data-bs-theme="dark"] .content .btn-link{color:#b3c7ff}[data-bs-theme="dark"] .content .btn-link:hover{color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link:hover{color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link:active{color:#b3c7ff}@media (min-width: 992px){[data-bs-theme="dark"] .docs-sidebar{order:0;border-right:1px solid #23262f}}[data-bs-theme="dark"] .footer{border-top:1px solid #23262f}[data-bs-theme="dark"] .docs-links,[data-bs-theme="dark"] .docs-toc{scrollbar-width:thin;scrollbar-color:#17181c #17181c}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar{width:5px}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-track,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-track{background:#17181c}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb{background:#17181c}[data-bs-theme="dark"] .docs-links:hover,[data-bs-theme="dark"] .docs-toc:hover{scrollbar-width:thin;scrollbar-color:#23262f #17181c}[data-bs-theme="dark"] .docs-links:hover::-webkit-scrollbar-thumb,[data-bs-theme="dark"] .docs-toc:hover::-webkit-scrollbar-thumb{background:#23262f}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb:hover,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb:hover{background:#23262f}[data-bs-theme="dark"] .docs-links h3:not(:first-child),[data-bs-theme="dark"] .docs-links .h3:not(:first-child){border-top:1px solid #23262f}[data-bs-theme="dark"] .page-links li:not(:first-child){border-top:1px dashed #23262f}[data-bs-theme="dark"] .card{background:#17181c;border:1px solid #23262f}[data-bs-theme="dark"] .bg-dots{background-image:radial-gradient(#414349 15%, transparent 15%)}[data-bs-theme="dark"] .text-muted{color:#adafb6 !important}[data-bs-theme="dark"] .offcanvas{background-color:#17181c}[data-bs-theme="dark"] .page-link{color:#b3c7ff;background-color:transparent;border:var(--bs-border-width) solid #23262f}[data-bs-theme="dark"] .page-link:hover{color:#17181c;background-color:#c1c3c8;border-color:#c1c3c8}[data-bs-theme="dark"] .page-link:focus{color:#17181c;background-color:#c1c3c8}[data-bs-theme="dark"] .page-item.active .page-link{color:#17181c;background-color:#b3c7ff;border-color:#b3c7ff}[data-bs-theme="dark"] .page-item.disabled .page-link{color:var(--bs-secondary-color);background-color:#23262f;border-color:#23262f}[data-bs-theme="dark"] details{border:1px solid #23262f}[data-bs-theme="dark"] summary:hover{background:#23262f}[data-bs-theme="dark"] details[open]>summary{border-bottom:1px solid #23262f}[data-bs-theme="dark"] details summary::after{content:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%28222, 226, 230, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e")}[data-bs-theme="dark"] #toc a.active{color:#b3c7ff}[data-bs-theme="dark"] table th{color:#fff}[data-bs-theme="dark"] table,[data-bs-theme="dark"] [data-bs-theme="dark"] table{--bs-table-color: inherit;--bs-table-bg: $body-bg-dark;background:#17181c;border-color:#23262f}.navbar .btn-link{color:rgba(var(--bs-emphasis-color-rgb), 0.65);padding:0.4375rem 0}.btn-link:focus{outline:0;box-shadow:none}@media (min-width: 992px){.navbar .btn-link{padding:0.5625em 0.25rem 0.5rem 0.125rem}}.navbar .btn-link:hover{color:rgba(var(--bs-emphasis-color-rgb), 0.8)}.navbar .btn-link:active{color:rgba(var(--bs-emphasis-color-rgb), 1)}.clipboard{position:relative;float:right}.btn-clipboard{transition:opacity 0.25s ease-in-out;opacity:0;position:absolute;right:0.5rem;top:0.5rem;line-height:1;padding:0.3125rem 0.3125rem 0.1875rem;background-color:transparent;border-color:transparent}@media (max-width: 767.98px){.btn-clipboard{position:absolute;right:-0.5rem;top:0.5rem}}.btn-clipboard::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#495057}.btn-clipboard:hover{border-color:transparent}.btn-clipboard:hover::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#212529}.btn-clipboard:focus,.btn-clipboard:active{border-color:transparent !important}.btn-clipboard:focus::after,.btn-clipboard:active::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#212529}[data-bs-theme="dark"] .btn-clipboard{background-color:transparent;border-color:transparent}[data-bs-theme="dark"] .btn-clipboard::after{background-color:#ced4da}[data-bs-theme="dark"] .btn-clipboard:hover{border-color:transparent}[data-bs-theme="dark"] .btn-clipboard:hover::after{background-color:#e9ecef}[data-bs-theme="dark"] .btn-clipboard:focus,[data-bs-theme="dark"] .btn-clipboard:active{border-color:transparent}[data-bs-theme="dark"] .btn-clipboard:focus::after,[data-bs-theme="dark"] .btn-clipboard:active::after{background-color:#e9ecef}.highlight{position:relative}@media (min-width: 768px){.highlight:hover .btn-clipboard{opacity:1}}#toTop{opacity:0;transition:opacity 0.3s ease-in-out}.callout{--bs-link-color-rgb: var(--callout-link);--bs-code-color: var(--callout-code-color);color:var(--callout-color, inherit);background-color:var(--callout-bg, var(--bs-gray-100));border-left:0.25rem solid var(--callout-border, var(--bs-gray-300));border-radius:0}.callout a{text-decoration:underline}.callout .highlight{background-color:rgba(0,0,0,0.05)}.callout .callout-icon.svg-inline{flex-shrink:0;height:calc(1.5 * 1.125rem)}.callout .callout-title{font-weight:700}.callout-content{min-width:0}.callout.callout-note{border-color:var(--sl-color-blue);background-color:var(--sl-color-blue-high)}.callout.callout-note .callout-icon,.callout.callout-note .callout-title,.callout.callout-note .callout-body a{color:var(--sl-color-blue-low)}.callout.callout-note .callout-body,.callout.callout-note .callout-body a:hover,.callout.callout-note .callout-body a:active{color:var(--sl-color-white)}.callout.callout-tip{border-color:var(--sl-color-purple);background-color:var(--sl-color-purple-high)}.callout.callout-tip .callout-icon,.callout.callout-tip .callout-title,.callout.callout-tip .callout-body a{color:var(--sl-color-purple-low)}.callout.callout-tip .callout-body,.callout.callout-tip .callout-body a:hover,.callout.callout-tip .callout-body a:active{color:var(--sl-color-white)}.callout.callout-danger{border-color:var(--sl-color-red);background-color:var(--sl-color-red-high)}.callout.callout-danger .callout-icon,.callout.callout-danger .callout-title,.callout.callout-danger .callout-body a{color:var(--sl-color-red-low)}.callout.callout-danger .callout-body,.callout.callout-danger .callout-body a:hover,.callout.callout-danger .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout{color:var(--sl-color-gray-1)}[data-bs-theme="dark"] .callout.callout-note{border-color:var(--sl-color-blue);background-color:var(--sl-color-blue-low)}[data-bs-theme="dark"] .callout.callout-note .callout-icon,[data-bs-theme="dark"] .callout.callout-note .callout-title,[data-bs-theme="dark"] .callout.callout-note .callout-body a{color:var(--sl-color-blue-high)}[data-bs-theme="dark"] .callout.callout-note .callout-body,[data-bs-theme="dark"] .callout.callout-note .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-note .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-note code:not(:where(.not-content *)){color:var(--ec-codeFg)}[data-bs-theme="dark"] .callout.callout-tip{border-color:var(--sl-color-purple);background-color:var(--sl-color-purple-low)}[data-bs-theme="dark"] .callout.callout-tip .callout-icon,[data-bs-theme="dark"] .callout.callout-tip .callout-title,[data-bs-theme="dark"] .callout.callout-tip .callout-body a{color:var(--sl-color-purple-high)}[data-bs-theme="dark"] .callout.callout-tip .callout-body,[data-bs-theme="dark"] .callout.callout-tip .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-tip .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-tip code:not(:where(.not-content *)){color:var(--ec-codeFg)}[data-bs-theme="dark"] .callout.callout-danger{border-color:var(--sl-color-red);background-color:var(--sl-color-red-low)}[data-bs-theme="dark"] .callout.callout-danger .callout-icon,[data-bs-theme="dark"] .callout.callout-danger .callout-title,[data-bs-theme="dark"] .callout.callout-danger .callout-body a{color:var(--sl-color-red-high)}[data-bs-theme="dark"] .callout.callout-danger .callout-body,[data-bs-theme="dark"] .callout.callout-danger .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-danger .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-danger code:not(:where(.not-content *)){color:var(--ec-codeFg)}.expressive-code{font-family:var(--ec-uiFontFml);font-size:var(--ec-uiFontSize);line-height:var(--ec-uiLineHt);-moz-text-size-adjust:none;text-size-adjust:none;-webkit-text-size-adjust:none;margin:1.5rem 0}.expressive-code *:not(path){all:revert;box-sizing:border-box}.expressive-code pre{display:flex;margin:0;padding:0;border:var(--ec-brdWd) solid var(--ec-brdCol);border-radius:calc(var(--ec-brdRad) + var(--ec-brdWd));background:var(--ec-codeBg)}.expressive-code pre:focus-visible{outline:3px solid var(--ec-focusBrd);outline-offset:-3px}.expressive-code pre>code{all:unset;display:block;flex:1 0 100%;padding:var(--ec-codePadBlk) 0;color:var(--ec-codeFg);font-family:var(--ec-codeFontFml);font-size:var(--ec-codeFontSize);line-height:var(--ec-codeLineHt)}.expressive-code pre{overflow-x:auto}.expressive-code pre::-webkit-scrollbar,.expressive-code pre::-webkit-scrollbar-track{background-color:inherit;border-radius:calc(var(--ec-brdRad) + var(--ec-brdWd));border-top-left-radius:0;border-top-right-radius:0}.expressive-code pre::-webkit-scrollbar-thumb{background-color:var(--ec-sbThumbCol);border:4px solid transparent;background-clip:content-box;border-radius:10px}.expressive-code pre::-webkit-scrollbar-thumb:hover{background-color:var(--ec-sbThumbHoverCol)}.expressive-code .ec-line{padding-inline:var(--ec-codePadInl);padding-inline-end:calc(2rem + var(--ec-codePadInl));direction:ltr;unicode-bidi:isolate}.expressive-code .sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);white-space:nowrap;border-width:0}.expressive-code .ec-line.mark{--tmLineBgCol: var(--ec-tm-markBg);--tmLineBrdCol: var(--ec-tm-markBrdCol)}.expressive-code .ec-line.ins{--tmLineBgCol: var(--ec-tm-insBg);--tmLineBrdCol: var(--ec-tm-insBrdCol)}.expressive-code .ec-line.ins::before{content:var(--ec-tm-insDiffIndContent);color:var(--ec-tm-insDiffIndCol)}.expressive-code .ec-line.del{--tmLineBgCol: var(--ec-tm-delBg);--tmLineBrdCol: var(--ec-tm-delBrdCol)}.expressive-code .ec-line.del::before{content:var(--ec-tm-delDiffIndContent);color:var(--ec-tm-delDiffIndCol)}.expressive-code .ec-line.mark,.expressive-code .ec-line.ins,.expressive-code .ec-line.del{position:relative;background:var(--tmLineBgCol);min-width:calc(100% - var(--ec-tm-lineMarkerAccentMarg));margin-inline-start:var(--ec-tm-lineMarkerAccentMarg);border-inline-start:var(--ec-tm-lineMarkerAccentWd) solid var(--tmLineBrdCol);padding-inline-start:calc(var(--ec-codePadInl) - var(--ec-tm-lineMarkerAccentMarg) - var(--ec-tm-lineMarkerAccentWd)) !important}.expressive-code .ec-line.mark::before,.expressive-code .ec-line.ins::before,.expressive-code .ec-line.del::before{position:absolute;left:var(--ec-tm-lineDiffIndMargLeft)}.expressive-code .ec-line mark,.expressive-code .ec-line .mark{--tmInlineBgCol: var(--ec-tm-markBg);--tmInlineBrdCol: var(--ec-tm-markBrdCol)}.expressive-code .ec-line ins{--tmInlineBgCol: var(--ec-tm-insBg);--tmInlineBrdCol: var(--ec-tm-insBrdCol)}.expressive-code .ec-line del{--tmInlineBgCol: var(--ec-tm-delBg);--tmInlineBrdCol: var(--ec-tm-delBrdCol)}.expressive-code .ec-line mark,.expressive-code .ec-line .mark,.expressive-code .ec-line ins,.expressive-code .ec-line del{all:unset;display:inline-block;position:relative;--tmBrdL: var(--ec-tm-inlMarkerBrdWd);--tmBrdR: var(--ec-tm-inlMarkerBrdWd);--tmRadL: var(--ec-tm-inlMarkerBrdRad);--tmRadR: var(--ec-tm-inlMarkerBrdRad);margin-inline:0.025rem;padding-inline:var(--ec-tm-inlMarkerPad);border-radius:var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL);background:var(--tmInlineBgCol);background-clip:padding-box}.expressive-code .ec-line mark.open-start,.expressive-code .ec-line .open-start.mark,.expressive-code .ec-line ins.open-start,.expressive-code .ec-line del.open-start{margin-inline-start:0;padding-inline-start:0;--tmBrdL: 0px;--tmRadL: 0}.expressive-code .ec-line mark.open-end,.expressive-code .ec-line .open-end.mark,.expressive-code .ec-line ins.open-end,.expressive-code .ec-line del.open-end{margin-inline-end:0;padding-inline-end:0;--tmBrdR: 0px;--tmRadR: 0}.expressive-code .ec-line mark::before,.expressive-code .ec-line .mark::before,.expressive-code .ec-line ins::before,.expressive-code .ec-line del::before{content:"";position:absolute;pointer-events:none;display:inline-block;inset:0;border-radius:var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL);border:var(--ec-tm-inlMarkerBrdWd) solid var(--tmInlineBrdCol);border-inline-width:var(--tmBrdL) var(--tmBrdR)}.expressive-code .frame{all:unset;position:relative;display:block;--header-border-radius: calc(var(--ec-brdRad) + var(--ec-brdWd));--tab-border-radius: calc(var(--ec-frm-edTabBrdRad) + var(--ec-brdWd));--button-spacing: 0.4rem;--code-background: var(--ec-frm-edBg);border-radius:var(--header-border-radius);box-shadow:var(--ec-frm-frameBoxShdCssVal)}.expressive-code .frame .header{display:none;z-index:1;position:relative;border-radius:var(--header-border-radius) var(--header-border-radius) 0 0}.expressive-code .frame.has-title pre,.expressive-code .frame.has-title code,.expressive-code .frame.is-terminal pre,.expressive-code .frame.is-terminal code{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.expressive-code .frame .title:empty:before{content:"\a0"}.expressive-code .frame.has-title:not(.is-terminal){--button-spacing: calc(1.9rem + 2 * (var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)))}.expressive-code .frame.has-title:not(.is-terminal) .title{position:relative;color:var(--ec-frm-edActTabFg);background:var(--ec-frm-edActTabBg);background-clip:padding-box;margin-block-start:var(--ec-frm-edTabsMargBlkStart);padding:calc(var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)) var(--ec-uiPadInl);border:var(--ec-brdWd) solid var(--ec-frm-edActTabBrdCol);border-radius:var(--tab-border-radius) var(--tab-border-radius) 0 0;border-bottom:none;overflow:hidden}.expressive-code .frame.has-title:not(.is-terminal) .title::after{content:"";position:absolute;pointer-events:none;inset:0;border-top:var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndTopCol);border-bottom:var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndBtmCol)}.expressive-code .frame.has-title:not(.is-terminal) .header{display:flex;background:linear-gradient(to top, var(--ec-frm-edTabBarBrdBtmCol) var(--ec-brdWd), transparent var(--ec-brdWd)),linear-gradient(var(--ec-frm-edTabBarBg), var(--ec-frm-edTabBarBg));background-repeat:no-repeat;padding-inline-start:var(--ec-frm-edTabsMargInlStart)}.expressive-code .frame.has-title:not(.is-terminal) .header::before{content:"";position:absolute;pointer-events:none;inset:0;border:var(--ec-brdWd) solid var(--ec-frm-edTabBarBrdCol);border-radius:inherit;border-bottom:none}.expressive-code .frame.is-terminal{--button-spacing: calc(1.9rem + var(--ec-brdWd) + 2 * var(--ec-uiPadBlk));--code-background: var(--ec-frm-trmBg)}.expressive-code .frame.is-terminal .header{display:flex;align-items:center;justify-content:center;padding-block:var(--ec-uiPadBlk);padding-block-end:calc(var(--ec-uiPadBlk) + var(--ec-brdWd));position:relative;font-weight:500;letter-spacing:0.025ch;color:var(--ec-frm-trmTtbFg);background:var(--ec-frm-trmTtbBg);border:var(--ec-brdWd) solid var(--ec-brdCol);border-bottom:none}.expressive-code .frame.is-terminal .header::before{content:"";position:absolute;pointer-events:none;left:var(--ec-uiPadInl);width:2.1rem;height:0.56rem;line-height:0;background-color:var(--ec-frm-trmTtbDotsFg);opacity:var(--ec-frm-trmTtbDotsOpa);-webkit-mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E");-webkit-mask-repeat:no-repeat;mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E");mask-repeat:no-repeat}.expressive-code .frame.is-terminal .header::after{content:"";position:absolute;pointer-events:none;inset:0;border-bottom:var(--ec-brdWd) solid var(--ec-frm-trmTtbBrdBtmCol)}.expressive-code .frame pre{background:var(--code-background)}.expressive-code .copy{display:flex;gap:0.25rem;flex-direction:row;position:absolute;inset-block-start:calc(var(--ec-brdWd) + var(--button-spacing));inset-inline-end:calc(var(--ec-brdWd) + var(--ec-uiPadInl) / 2);direction:ltr;unicode-bidi:isolate}.expressive-code .copy button{position:relative;align-self:flex-end;margin:0;padding:0;border:none;border-radius:0.2rem;z-index:1;cursor:pointer;transition-property:opacity, background, border-color;transition-duration:0.2s;transition-timing-function:cubic-bezier(0.25, 0.46, 0.45, 0.94);width:2.5rem;height:2.5rem;background:var(--code-background);opacity:0.75}.expressive-code .copy button div{position:absolute;inset:0;border-radius:inherit;background:var(--ec-frm-inlBtnBg);opacity:var(--ec-frm-inlBtnBgIdleOpa);transition-property:inherit;transition-duration:inherit;transition-timing-function:inherit}.expressive-code .copy button::before{content:"";position:absolute;pointer-events:none;inset:0;border-radius:inherit;border:var(--ec-brdWd) solid var(--ec-frm-inlBtnBrd);opacity:var(--ec-frm-inlBtnBrdOpa)}.expressive-code .copy button::after{content:"";position:absolute;pointer-events:none;inset:0;background-color:var(--ec-frm-inlBtnFg);-webkit-mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E");-webkit-mask-repeat:no-repeat;mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E");mask-repeat:no-repeat;margin:0.475rem;line-height:0}.expressive-code .copy button:focus::after,.expressive-code .copy button:active::after{display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;margin:0.2375rem}.expressive-code .copy button:hover,.expressive-code .copy button:focus:focus-visible{opacity:1}.expressive-code .copy button:hover div,.expressive-code .copy button:focus:focus-visible div{opacity:var(--ec-frm-inlBtnBgHoverOrFocusOpa)}.expressive-code .copy button:active{opacity:1}.expressive-code .copy button:active div{opacity:var(--ec-frm-inlBtnBgActOpa)}.expressive-code .copy .feedback{--tooltip-arrow-size: 0.35rem;--tooltip-bg: var(--ec-frm-tooltipSuccessBg);color:var(--ec-frm-tooltipSuccessFg);pointer-events:none;-moz-user-select:none;user-select:none;-webkit-user-select:none;position:relative;align-self:center;background-color:var(--tooltip-bg);z-index:99;padding:0.125rem 0.75rem;border-radius:0.2rem;margin-inline-end:var(--tooltip-arrow-size);opacity:0;transition-property:opacity, transform;transition-duration:0.2s;transition-timing-function:ease-in-out;transform:translate3d(0, 0.25rem, 0)}.expressive-code .copy .feedback::after{content:"";position:absolute;pointer-events:none;top:calc(50% - var(--tooltip-arrow-size));inset-inline-end:calc(-2 * (var(--tooltip-arrow-size) - 0.5px));border:var(--tooltip-arrow-size) solid transparent;border-inline-start-color:var(--tooltip-bg)}.expressive-code .copy .feedback.show{opacity:1;transform:translate3d(0, 0, 0)}@media (hover: hover){.expressive-code .copy button{opacity:0;width:2rem;height:2rem}.expressive-code .frame:hover .copy button:not(:hover),.expressive-code .frame:focus-within :focus-visible~.copy button:not(:hover),.expressive-code .frame .copy .feedback.show~button:not(:hover){opacity:0.75}}:root{--ec-brdRad: 0px;--ec-brdWd: 1px;--ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-codeFontFml: var(--__sl-font-mono);--ec-codeFontSize: var(--sl-text-code);--ec-codeFontWg: 400;--ec-codeLineHt: var(--sl-line-height);--ec-codePadBlk: 0;--ec-codePadInl: 1rem;--ec-codeBg: #011627;--ec-codeFg: #d6deeb;--ec-codeSelBg: #1d3b53;--ec-uiFontFml: var(--__sl-font);--ec-uiFontSize: 0.9rem;--ec-uiFontWg: 400;--ec-uiLineHt: 1.65;--ec-uiPadBlk: 0.25rem;--ec-uiPadInl: 1rem;--ec-uiSelBg: #234d708c;--ec-uiSelFg: #ffffff;--ec-focusBrd: #122d42;--ec-sbThumbCol: #ffffff17;--ec-sbThumbHoverCol: #ffffff49;--ec-tm-lineMarkerAccentMarg: 0rem;--ec-tm-lineMarkerAccentWd: 0.15rem;--ec-tm-lineDiffIndMargLeft: 0.25rem;--ec-tm-inlMarkerBrdWd: 1.5px;--ec-tm-inlMarkerBrdRad: 0.2rem;--ec-tm-inlMarkerPad: 0.15rem;--ec-tm-insDiffIndContent: "+";--ec-tm-delDiffIndContent: "-";--ec-tm-markBg: #ffffff17;--ec-tm-markBrdCol: #ffffff40;--ec-tm-insBg: #1e571599;--ec-tm-insBrdCol: #487f3bd0;--ec-tm-insDiffIndCol: #79b169d0;--ec-tm-delBg: #862d2799;--ec-tm-delBrdCol: #b4554bd0;--ec-tm-delDiffIndCol: #ed8779d0;--ec-frm-shdCol: #011627;--ec-frm-frameBoxShdCssVal: none;--ec-frm-edActTabBg: var(--sl-color-gray-6);--ec-frm-edActTabFg: var(--sl-color-text);--ec-frm-edActTabBrdCol: transparent;--ec-frm-edActTabIndHt: 1px;--ec-frm-edActTabIndTopCol: var(--sl-color-accent-high);--ec-frm-edActTabIndBtmCol: transparent;--ec-frm-edTabsMargInlStart: 0;--ec-frm-edTabsMargBlkStart: 0;--ec-frm-edTabBrdRad: 0px;--ec-frm-edTabBarBg: var(--sl-color-black);--ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edBg: var(--sl-color-gray-6);--ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmTtbDotsOpa: 0.75;--ec-frm-trmTtbBg: var(--sl-color-black);--ec-frm-trmTtbFg: var(--sl-color-text);--ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmBg: var(--sl-color-gray-6);--ec-frm-inlBtnFg: var(--sl-color-text);--ec-frm-inlBtnBg: var(--sl-color-text);--ec-frm-inlBtnBgIdleOpa: 0;--ec-frm-inlBtnBgHoverOrFocusOpa: 0.2;--ec-frm-inlBtnBgActOpa: 0.3;--ec-frm-inlBtnBrd: var(--sl-color-text);--ec-frm-inlBtnBrdOpa: 0.4;--ec-frm-tooltipSuccessBg: #158744;--ec-frm-tooltipSuccessFg: white}.expressive-code .ec-line span[style^="--"]:not([class]){color:var(0, inherit);font-style:var(0fs, inherit);font-weight:var(0fw, inherit);-webkit-text-decoration:var(0td, inherit);text-decoration:var(0td, inherit)}@media (prefers-color-scheme: light){:root:not([data-bs-theme="dark"]){--ec-codeBg: #fbfbfb;--ec-codeFg: #403f53;--ec-codeSelBg: #e0e0e0;--ec-uiSelBg: #d3e8f8;--ec-uiSelFg: #403f53;--ec-focusBrd: #93a1a1;--ec-sbThumbCol: #0000001a;--ec-sbThumbHoverCol: #0000005c;--ec-tm-markBg: #0000001a;--ec-tm-markBrdCol: #00000055;--ec-tm-insBg: #8ec77d99;--ec-tm-insDiffIndCol: #336a28d0;--ec-tm-delBg: #ff9c8e99;--ec-tm-delDiffIndCol: #9d4138d0;--ec-frm-shdCol: #d9d9d9;--ec-frm-edActTabBg: var(--sl-color-gray-7);--ec-frm-edActTabIndTopCol: #5d2f86;--ec-frm-edTabBarBg: var(--sl-color-gray-6);--ec-frm-edBg: var(--sl-color-gray-7);--ec-frm-trmTtbBg: var(--sl-color-gray-6);--ec-frm-trmBg: var(--sl-color-gray-7);--ec-frm-tooltipSuccessBg: #078662}:root:not([data-bs-theme="dark"]) .expressive-code .ec-line span[style^="--"]:not([class]){color:var(1, inherit);font-style:var(1fs, inherit);font-weight:var(1fw, inherit);-webkit-text-decoration:var(1td, inherit);text-decoration:var(1td, inherit)}}:root[data-bs-theme="light"] .expressive-code,.expressive-code[data-bs-theme="light"]{--ec-codeBg: #fbfbfb;--ec-codeFg: #403f53;--ec-codeSelBg: #e0e0e0;--ec-uiSelBg: #d3e8f8;--ec-uiSelFg: #403f53;--ec-focusBrd: #93a1a1;--ec-sbThumbCol: #0000001a;--ec-sbThumbHoverCol: #0000005c;--ec-tm-markBg: #0000001a;--ec-tm-markBrdCol: #00000055;--ec-tm-insBg: #8ec77d99;--ec-tm-insDiffIndCol: #336a28d0;--ec-tm-delBg: #ff9c8e99;--ec-tm-delDiffIndCol: #9d4138d0;--ec-frm-shdCol: #d9d9d9;--ec-frm-edActTabBg: var(--sl-color-gray-7);--ec-frm-edActTabIndTopCol: #5d2f86;--ec-frm-edTabBarBg: var(--sl-color-gray-6);--ec-frm-edBg: var(--sl-color-gray-7);--ec-frm-trmTtbBg: var(--sl-color-gray-6);--ec-frm-trmBg: var(--sl-color-gray-7);--ec-frm-tooltipSuccessBg: #078662}:root[data-bs-theme="light"] .expressive-code .ec-line span[style^="--"]:not([class]),.expressive-code[data-bs-theme="light"] .ec-line span[style^="--"]:not([class]){color:var(1, inherit);font-style:var(1fs, inherit);font-weight:var(1fw, inherit);-webkit-text-decoration:var(1td, inherit);text-decoration:var(1td, inherit)}pre,code,kbd,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:.875rem}code:not(:where(.not-content *)){background-color:var(--sl-color-gray-6);margin-block:-0.125rem;padding:0.125rem 0.375rem;color:inherit}[data-bs-theme="dark"] code:not(:where(.not-content *)){background-color:var(--sl-color-gray-5)}.math-block{display:block;margin:2rem 0;overflow-x:auto}.math-inline{display:inline}[data-bs-theme="dark"] .math-inline img,[data-bs-theme="dark"] .math-block img{filter:invert(1)}img.diagram{height:auto;width:100%;margin:1rem 0 2rem}img.diagram-kroki-mermaid{background:#fff}.highlight>pre{padding:0.875rem 1rem}.highlight div{padding:0}.highlight>.chroma{overflow-x:auto;border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}.chroma .ln{padding:0 0.5rem 0 0}.chroma .hl{border-inline-start:0.15rem solid #0005;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}.chroma .hl .ln{margin-left:-0.15rem}.highlight .chroma .lntable .lnt,.highlight .chroma .lntable .hl{display:flex}.chroma .lntd:first-child{padding:0}.chroma .lntd:first-child .lnt{padding-left:1rem}.chroma .lntd:nth-child(2){padding:0}.highlight .chroma .lntable .lntd+.lntd{width:100%}[data-bs-theme="dark"] .chroma .ln{padding:0 0.5em 0 0}.chroma .lntd pre{padding:1rem 0;margin-bottom:0}.highlight>.chroma::-webkit-scrollbar,.highlight>.chroma::-webkit-scrollbar-track{background-color:inherit;border-radius:1px;border-top-left-radius:0;border-top-right-radius:0}.highlight>.chroma::-webkit-scrollbar-thumb{background-color:#dddee0;border:4px solid transparent;background-clip:content-box;border-radius:10px}.highlight>.chroma::-webkit-scrollbar-thumb:hover{background-color:#9d9e9f}[data-bs-theme="dark"] .highlight>.chroma::-webkit-scrollbar-thumb{background-color:#ffffff17}[data-bs-theme="dark"] .highlight>.chroma::-webkit-scrollbar-thumb:hover{background-color:#ffffff49}[data-bs-theme="dark"] .highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}[data-bs-theme="dark"] .chroma .hl{border-inline-start:0.15rem solid #ffffff40;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}[data-bs-theme="dark"] .chroma .hl .ln{margin-left:-0.15rem}details{display:block;position:relative;border:1px solid #e9ecef;border-radius:0.25rem;padding:0.5rem 1rem 0;margin:0.5rem 0}summary{list-style:none;display:inline-block;width:calc(100% + 2rem);margin:-0.5rem -1rem 0;padding:0.5rem 1rem}summary::-webkit-details-marker{display:none}summary:hover{background:#f8f9fa}details summary::after{display:inline-block;content:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%2829, 45, 53, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e");transition:transform 0.35s ease;transform-origin:center center;position:absolute;right:1rem}details[open]>summary::after{transform:rotate(90deg)}details[open]{padding:0.5rem 1rem}details[open]>summary{border-bottom:1px solid #dee2e6;margin-bottom:0.5rem}details h2,details .h2,details h3,details .h3,details h4,details .h4{margin:1rem 0 0.5rem}details p:last-child{margin-bottom:0}details ul,details ol{margin-bottom:0}details pre{margin:0 0 1rem}img{max-width:100%;height:auto}img[data-sizes="auto"]{display:block}img{font-size:0}figcaption{font-size:1rem;margin-top:0.5rem;font-style:italic}.blur-up{filter:blur(5px);transition:filter 400ms}.blur-up.lazyloaded{filter:unset}.section-nav{padding-top:2rem}.section-nav details{border:0;padding:0;margin:0.5rem 0}.section-nav details[open]{padding:0}.section-nav summary{width:100%;padding:0;margin:0;font-weight:700}.section-nav summary:hover{background:none}.section-nav details[open]>summary{border-bottom:0;margin-bottom:0}.section-nav ul.list-nested details{padding-left:1rem;margin-top:0.5rem}.section-nav ul.list-nested li{margin:0}.section-nav a{display:block;margin:0.5rem 0;color:#1d2d35;font-size:1rem;text-decoration:none}.section-nav a:hover,.section-nav a:active{color:#5d2f86}.section-nav li.active a{color:#5d2f86;font-weight:500}.section-nav ul.list-nested li a{padding-left:1rem}.section-nav ul.list-nested{border-left:1px solid #e9ecef}[data-bs-theme="dark"] .section-nav ul.list-nested{border-left:1px solid #23262f}[data-bs-theme="dark"] .section-nav a{color:#c1c3c8}[data-bs-theme="dark"] .section-nav a:hover,[data-bs-theme="dark"] .section-nav a:active{color:var(--sl-color-text-accent)}[data-bs-theme="dark"] .section-nav li.active a{color:var(--sl-color-text-accent);font-weight:500}[data-bs-theme="dark"] .section-nav summary{color:#fff}table{margin:3rem 0}.footer{border-top:1px solid #e9ecef;padding-top:1.125rem;padding-bottom:1.125rem}.footer ul{margin-bottom:0}.footer li{font-size:.875rem;margin-bottom:0}.footer .list-inline-item:not(:last-child){margin-right:1rem}@media (max-width: 991.98px){.footer .col-lg-8{margin-top:0.25rem;margin-bottom:0.25rem}}@media (min-width: 768px){.footer li{font-size:1rem}}.fixed-bottom-right{position:fixed;right:0;bottom:0;z-index:1000}.navbar-brand{font-weight:700}.navbar-brand svg{margin-right:0.25rem}[data-bs-theme="dark"] .navbar-brand{color:inherit}.navbar{z-index:1000;background-color:rgba(255,255,255,0.95);border-bottom:1px solid #e9ecef}@media (min-width: 992px){.navbar{z-index:1025}}@media (min-width: 768px){.navbar-brand{font-size:1.375rem}}.nav-item{margin-left:0}@media (max-width: 991.98px){.navbar-nav .nav-link{font-weight:400}}@media (min-width: 768px){.nav-item{margin-left:0.5rem}}@media (max-width: 575.98px){.navbar .offcanvas.offcanvas-start,.navbar .offcanvas.offcanvas-end{width:80vw}}.offcanvas-header{border-bottom:1px solid #dee2e6;padding-top:1.0625rem;padding-bottom:0.8125rem}h5.offcanvas-title,.offcanvas-title.h5{margin:0;color:inherit}.offcanvas .nav-link{color:#1d2d35}.offcanvas .nav-link:hover,.offcanvas .nav-link:focus{color:#5d2f86}.offcanvas .nav-link.active{color:#5d2f86}.home .navbar{border-bottom:0}@media (min-width: 992px){.navbar-brand{margin-right:0.75rem !important}}.social-link{padding-right:0.375rem;padding-left:0.375rem}@media (max-width: 991.98px){#buttonColorMode{margin:0.5rem 0}#socialMenu{margin:0.5rem 0 0.5rem -0.25rem}.navbar-nav{margin-top:1rem}.nav-item .nav-link{font-weight:400;font-size:1.125rem}}.modal-backdrop,.offcanvas-backdrop{visibility:hidden;background:rgba(23,24,28,0.5);opacity:0}[data-bs-theme="dark"] .modal-backdrop,[data-bs-theme="dark"] .offcanvas-backdrop{visibility:hidden;background:rgba(23,24,28,0.5);opacity:0}.modal-backdrop.show,.offcanvas-backdrop.show{visibility:visible;opacity:1;-webkit-backdrop-filter:blur(8px);backdrop-filter:blur(8px)}.showing,.hiding{transition:none;display:none}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg{padding-right:0.75rem}.docs-content>h2[id]::before,.docs-content>[id].h2::before,.docs-content>h3[id]::before,.docs-content>[id].h3::before,.docs-content>h4[id]::before,.docs-content>[id].h4::before{display:block;height:6rem;margin-top:-6rem;content:""}.docs-content ul,.docs-content ol{margin-bottom:1rem}.anchor{visibility:hidden;margin-left:0.375rem}h1:hover a,.h1:hover a,h2:hover a,.h2:hover a,h3:hover a,.h3:hover a,h4:hover a,.h4:hover a{visibility:visible;text-decoration:none}.card-list{margin-top:2.25rem}.page-footer-meta{margin-top:2rem;margin-bottom:2rem}p.meta{margin-top:0.5rem;font-size:1rem}.breadcrumb{margin-top:2.25rem;font-size:1rem}.toc-mobile{margin-top:2rem;margin-bottom:2rem}.page-link:hover{text-decoration:none}ul li{margin:0.25rem 0}.page-nav .card .icon-tabler-arrow-left{margin-right:0.75rem}.page-nav .card .icon-tabler-arrow-right{margin-left:0.75rem}.page-nav .card:hover{border:1px solid #d9d9d9}[data-bs-theme="dark"] .page-nav .card{border:1px solid #353841}[data-bs-theme="dark"] .page-nav .card:hover{border:1px solid #888c96}.home .card,.contributors.list .card,.blog.list .card,.blog.single .card,.categories.list .card,.tags.list .card{margin-top:2rem;margin-bottom:2rem;transition:transform 0.3s}.home .content .card:hover,.contributors.list .content .card:hover,.blog.list .content .card:hover,.blog.single .content .card:hover,.categories.list .content .card:hover,.tags.list .content .card:hover{transform:scale(1.025)}.home .content .card-body,.contributors.list .content .card-body,.blog.list .content .card-body,.blog.single .content .card-body,.categories.list .content .card-body,.tags.list .content .card-body{padding:0 2rem 1rem}.blog-header{text-align:center;margin-bottom:2rem}.page-item:first-child,.page-item:last-child,.page-item.disabled{display:none}.page-item a{margin-left:0.5rem;margin-right:0.5rem;padding-left:0.875rem;padding-right:0.875rem}span.reading-time{margin-left:2rem}span.reading-time svg{margin-right:0.3rem;vertical-align:-0.4rem}.docs-links,.docs-toc{scrollbar-width:thin;scrollbar-color:#fff #fff}.docs-links::-webkit-scrollbar,.docs-toc::-webkit-scrollbar{width:5px}.docs-links::-webkit-scrollbar-track,.docs-toc::-webkit-scrollbar-track{background:#fff}.docs-links::-webkit-scrollbar-thumb,.docs-toc::-webkit-scrollbar-thumb{background:#fff}.docs-links:hover,.docs-toc:hover{scrollbar-width:thin;scrollbar-color:#e9ecef #fff}.docs-links:hover::-webkit-scrollbar-thumb,.docs-toc:hover::-webkit-scrollbar-thumb{background:#e9ecef}.docs-links::-webkit-scrollbar-thumb:hover,.docs-toc::-webkit-scrollbar-thumb:hover{background:#e9ecef}.docs-links h3,.docs-links .h3,.page-links h3,.page-links .h3{font-size:1.125rem;margin:1.25rem 0 0.5rem;padding:1.5rem 0 0}@media (min-width: 992px){.docs-links h3,.docs-links .h3,.page-links h3,.page-links .h3{margin:1.125rem 1.5rem 0.75rem 0;padding:1.375rem 0 0}}.docs-links h3:not(:first-child),.docs-links .h3:not(:first-child){border-top:1px solid #e9ecef}.page-links li{margin-top:0.375rem;padding-top:0.375rem}.page-links li ul li{border-top:none;padding-left:1rem;margin-top:0.125rem;padding-top:0.125rem}.page-links li:not(:first-child){border-top:1px dashed #e9ecef}.page-links a{color:#1d2d35;display:block;padding:0.125rem 0;font-size:.9375rem;text-decoration:none}.page-links a:hover,.page-links a.active{text-decoration:none;color:#5d2f86}.nav-link.active{font-weight:500}a.CTAbutton{background-color:var(--sl-color-purple-low);display:inline-block;width:200px;border-radius:5px;padding:10px;color:var(--sl-color-gray-1);text-transform:uppercase} diff --git a/public/privacy/index.html b/public/privacy/index.html index e20eb15..4520af4 100644 --- a/public/privacy/index.html +++ b/public/privacy/index.html @@ -1 +1 @@ -Privacy Policy |

Privacy Policy

Last updated on September 7, 2023

\ No newline at end of file +Privacy Policy |

Privacy Policy

Last updated on September 7, 2023

\ No newline at end of file diff --git a/public/tags/index.html b/public/tags/index.html index 5c8b57d..c1f5975 100644 --- a/public/tags/index.html +++ b/public/tags/index.html @@ -1 +1 @@ -Tags |

Tags

\ No newline at end of file +Tags |

Tags

\ No newline at end of file diff --git a/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.content b/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.content index a61c040..d21f0ba 100644 --- a/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.content +++ b/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.content @@ -1 +1 @@ -:root[data-bs-theme="light"],[data-bs-theme="light"] ::backdrop{--sl-color-white: hsl(224, 10%, 10%);--sl-color-gray-1: hsl(224, 14%, 16%);--sl-color-gray-2: hsl(224, 10%, 23%);--sl-color-gray-3: hsl(224, 7%, 36%);--sl-color-gray-4: hsl(224, 6%, 56%);--sl-color-gray-5: hsl(224, 6%, 77%);--sl-color-gray-6: hsl(224, 20%, 94%);--sl-color-gray-7: hsl(224, 19%, 97%);--sl-color-black: hsl(0, 0%, 100%)}:root,::backdrop{--sl-color-white: hsl(0, 0%, 100%);--sl-color-gray-1: hsl(224, 20%, 94%);--sl-color-gray-2: hsl(224, 6%, 77%);--sl-color-gray-3: hsl(224, 6%, 56%);--sl-color-gray-4: hsl(224, 7%, 36%);--sl-color-gray-5: hsl(224, 10%, 23%);--sl-color-gray-6: hsl(224, 14%, 16%);--sl-color-black: hsl(224, 10%, 10%);--sl-hue-orange: 41;--sl-color-orange-low: hsl(var(--sl-hue-orange), 39%, 22%);--sl-color-orange: hsl(var(--sl-hue-orange), 82%, 63%);--sl-color-orange-high: hsl(var(--sl-hue-orange), 82%, 87%);--sl-hue-green: 101;--sl-color-green-low: hsl(var(--sl-hue-green), 39%, 22%);--sl-color-green: hsl(var(--sl-hue-green), 82%, 63%);--sl-color-green-high: hsl(var(--sl-hue-green), 82%, 80%);--sl-hue-blue: 234;--sl-color-blue-low: hsl(var(--sl-hue-blue), 54%, 20%);--sl-color-blue: hsl(var(--sl-hue-blue), 100%, 60%);--sl-color-blue-high: hsl(var(--sl-hue-blue), 100%, 87%);--sl-hue-purple: 281;--sl-color-purple-low: hsl(var(--sl-hue-purple), 39%, 22%);--sl-color-purple: hsl(var(--sl-hue-purple), 82%, 63%);--sl-color-purple-high: hsl(var(--sl-hue-purple), 82%, 89%);--sl-hue-red: 339;--sl-color-red-low: hsl(var(--sl-hue-red), 39%, 22%);--sl-color-red: hsl(var(--sl-hue-red), 82%, 63%);--sl-color-red-high: hsl(var(--sl-hue-red), 82%, 87%);--sl-color-accent-low: hsl(224, 54%, 20%);--sl-color-accent: hsl(224, 100%, 60%);--sl-color-accent-high: hsl(224, 100%, 85%);--sl-color-text: var(--sl-color-gray-2);--sl-color-text-accent: var(--sl-color-accent-high);--sl-color-text-invert: var(--sl-color-accent-low);--sl-color-bg: var(--sl-color-black);--sl-color-bg-nav: var(--sl-color-gray-6);--sl-color-bg-sidebar: var(--sl-color-gray-6);--sl-color-bg-inline-code: var(--sl-color-gray-5);--sl-color-hairline-light: var(--sl-color-gray-5);--sl-color-hairline: var(--sl-color-gray-6);--sl-color-hairline-shade: var(--sl-color-black);--sl-color-backdrop-overlay: hsla(223, 13%, 10%, 0.66);--sl-shadow-sm: 0px 1px 1px hsla(0, 0%, 0%, 0.12), 0px 2px 1px hsla(0, 0%, 0%, 0.24);--sl-shadow-md: 0px 8px 4px hsla(0, 0%, 0%, 0.08), 0px 5px 2px hsla(0, 0%, 0%, 0.08), 0px 3px 2px hsla(0, 0%, 0%, 0.12), 0px 1px 1px hsla(0, 0%, 0%, 0.15);--sl-shadow-lg: 0px 25px 7px hsla(0, 0%, 0%, 0.03), 0px 16px 6px hsla(0, 0%, 0%, 0.1), 0px 9px 5px hsla(223, 13%, 10%, 0.33), 0px 4px 4px hsla(0, 0%, 0%, 0.75), 0px 4px 2px hsla(0, 0%, 0%, 0.25);--sl-text-xs: 0.8125rem;--sl-text-sm: 0.875rem;--sl-text-base: 1rem;--sl-text-lg: 1.125rem;--sl-text-xl: 1.25rem;--sl-text-2xl: 1.5rem;--sl-text-3xl: 1.8125rem;--sl-text-4xl: 2.1875rem;--sl-text-5xl: 2.625rem;--sl-text-6xl: 4rem;--sl-text-body: var(--sl-text-base);--sl-text-body-sm: var(--sl-text-xs);--sl-text-code: var(--sl-text-sm);--sl-text-code-sm: var(--sl-text-xs);--sl-text-h1: var(--sl-text-4xl);--sl-text-h2: var(--sl-text-3xl);--sl-text-h3: var(--sl-text-2xl);--sl-text-h4: var(--sl-text-xl);--sl-text-h5: var(--sl-text-lg);--sl-line-height: 1.8;--sl-line-height-headings: 1.2;--sl-font-system: ui-sans-serif, system-ui, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--sl-font-system-mono: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--__sl-font: var(--sl-font, ""), var(--sl-font-system);--__sl-font-mono: var(--sl-font-mono, ""), var(--sl-font-system-mono);--sl-nav-height: 3.5rem;--sl-nav-pad-x: 1rem;--sl-nav-pad-y: 0.75rem;--sl-mobile-toc-height: 3rem;--sl-sidebar-width: 18.75rem;--sl-sidebar-pad-x: 1rem;--sl-content-width: 45rem;--sl-content-pad-x: 1rem;--sl-menu-button-size: 2rem;--sl-nav-gap: var(--sl-content-pad-x);--sl-outline-offset-inside: -0.1875rem;--sl-z-index-toc: 4;--sl-z-index-menu: 5;--sl-z-index-navbar: 10;--sl-z-index-skiplink: 20}:root{--purple-hsl: 255, 60%, 60%;--overlay-blurple: hsla(var(--purple-hsl), 0.2)}:root{--ec-brdRad: 0px;--ec-brdWd: 1px;--ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-codeFontFml: var(--__sl-font-mono);--ec-codeFontSize: var(--sl-text-code);--ec-codeFontWg: 400;--ec-codeLineHt: var(--sl-line-height);--ec-codePadBlk: 0.75rem;--ec-codePadInl: 1rem;--ec-codeBg: #011627;--ec-codeFg: #d6deeb;--ec-codeSelBg: #1d3b53;--ec-uiFontFml: var(--__sl-font);--ec-uiFontSize: 0.9rem;--ec-uiFontWg: 400;--ec-uiLineHt: 1.65;--ec-uiPadBlk: 0.25rem;--ec-uiPadInl: 1rem;--ec-uiSelBg: #234d708c;--ec-uiSelFg: #ffffff;--ec-focusBrd: #122d42;--ec-sbThumbCol: #ffffff17;--ec-sbThumbHoverCol: #ffffff49;--ec-tm-lineMarkerAccentMarg: 0rem;--ec-tm-lineMarkerAccentWd: 0.15rem;--ec-tm-lineDiffIndMargLeft: 0.25rem;--ec-tm-inlMarkerBrdWd: 1.5px;--ec-tm-inlMarkerBrdRad: 0.2rem;--ec-tm-inlMarkerPad: 0.15rem;--ec-tm-insDiffIndContent: "+";--ec-tm-delDiffIndContent: "-";--ec-tm-markBg: #ffffff17;--ec-tm-markBrdCol: #ffffff40;--ec-tm-insBg: #1e571599;--ec-tm-insBrdCol: #487f3bd0;--ec-tm-insDiffIndCol: #79b169d0;--ec-tm-delBg: #862d2799;--ec-tm-delBrdCol: #b4554bd0;--ec-tm-delDiffIndCol: #ed8779d0;--ec-frm-shdCol: #011627;--ec-frm-frameBoxShdCssVal: none;--ec-frm-edActTabBg: var(--sl-color-gray-6);--ec-frm-edActTabFg: var(--sl-color-text);--ec-frm-edActTabBrdCol: transparent;--ec-frm-edActTabIndHt: 1px;--ec-frm-edActTabIndTopCol: var(--sl-color-accent-high);--ec-frm-edActTabIndBtmCol: transparent;--ec-frm-edTabsMargInlStart: 0;--ec-frm-edTabsMargBlkStart: 0;--ec-frm-edTabBrdRad: 0px;--ec-frm-edTabBarBg: var(--sl-color-black);--ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edBg: var(--sl-color-gray-6);--ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmTtbDotsOpa: 0.75;--ec-frm-trmTtbBg: var(--sl-color-black);--ec-frm-trmTtbFg: var(--sl-color-text);--ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmBg: var(--sl-color-gray-6);--ec-frm-inlBtnFg: var(--sl-color-text);--ec-frm-inlBtnBg: var(--sl-color-text);--ec-frm-inlBtnBgIdleOpa: 0;--ec-frm-inlBtnBgHoverOrFocusOpa: 0.2;--ec-frm-inlBtnBgActOpa: 0.3;--ec-frm-inlBtnBrd: var(--sl-color-text);--ec-frm-inlBtnBrdOpa: 0.4;--ec-frm-tooltipSuccessBg: #158744;--ec-frm-tooltipSuccessFg: white}:root,[data-bs-theme="light"]{--bs-blue: #3347ff;--bs-indigo: #6610f2;--bs-purple: #bd53ee;--bs-pink: #d63384;--bs-red: #ee5389;--bs-orange: #fd7e14;--bs-yellow: #eebd53;--bs-green: #84ee53;--bs-teal: #20c997;--bs-cyan: #0dcaf0;--bs-black: #000;--bs-white: #fff;--bs-gray: #6c757d;--bs-gray-dark: #343a40;--bs-gray-100: #f8f9fa;--bs-gray-200: #e9ecef;--bs-gray-300: #dee2e6;--bs-gray-400: #ced4da;--bs-gray-500: #adb5bd;--bs-gray-600: #6c757d;--bs-gray-700: #495057;--bs-gray-800: #343a40;--bs-gray-900: #212529;--bs-primary: #5d2f86;--bs-secondary: #6c757d;--bs-success: #84ee53;--bs-info: #3347ff;--bs-warning: #eebd53;--bs-danger: #ee5389;--bs-light: #f8f9fa;--bs-dark: #212529;--bs-primary-rgb: 93,47,134;--bs-secondary-rgb: 108,117,125;--bs-success-rgb: 132.2821,238.017,83.283;--bs-info-rgb: 51,71.4,255;--bs-warning-rgb: 238.017,189.0179,83.283;--bs-danger-rgb: 238.017,83.283,137.4399;--bs-light-rgb: 248,249,250;--bs-dark-rgb: 33,37,41;--bs-primary-text-emphasis: #251336;--bs-secondary-text-emphasis: #2b2f32;--bs-success-text-emphasis: #355f21;--bs-info-text-emphasis: #141d66;--bs-warning-text-emphasis: #5f4c21;--bs-danger-text-emphasis: #5f2137;--bs-light-text-emphasis: #495057;--bs-dark-text-emphasis: #495057;--bs-primary-bg-subtle: #dfd5e7;--bs-secondary-bg-subtle: #e2e3e5;--bs-success-bg-subtle: #e6fcdd;--bs-info-bg-subtle: #d6daff;--bs-warning-bg-subtle: #fcf2dd;--bs-danger-bg-subtle: #fcdde7;--bs-light-bg-subtle: #fcfcfd;--bs-dark-bg-subtle: #ced4da;--bs-primary-border-subtle: #beaccf;--bs-secondary-border-subtle: #c4c8cb;--bs-success-border-subtle: #cef8ba;--bs-info-border-subtle: #adb6ff;--bs-warning-border-subtle: #f8e5ba;--bs-danger-border-subtle: #f8bad0;--bs-light-border-subtle: #e9ecef;--bs-dark-border-subtle: #adb5bd;--bs-white-rgb: 255,255,255;--bs-black-rgb: 0,0,0;--bs-font-sans-serif: "Jost", system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--bs-gradient: linear-gradient(180deg, rgba(255,255,255,0.15), rgba(255,255,255,0));--bs-body-font-family: var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight: 400;--bs-body-line-height: 1.5;--bs-body-color: #1d2d35;--bs-body-color-rgb: 29,45,53;--bs-body-bg: #fff;--bs-body-bg-rgb: 255,255,255;--bs-emphasis-color: #000;--bs-emphasis-color-rgb: 0,0,0;--bs-secondary-color: rgba(29,45,53,0.75);--bs-secondary-color-rgb: 29,45,53;--bs-secondary-bg: #e9ecef;--bs-secondary-bg-rgb: 233,236,239;--bs-tertiary-color: rgba(29,45,53,0.5);--bs-tertiary-color-rgb: 29,45,53;--bs-tertiary-bg: #f8f9fa;--bs-tertiary-bg-rgb: 248,249,250;--bs-heading-color: inherit;--bs-link-color: #5d2f86;--bs-link-color-rgb: 93,47,134;--bs-link-decoration: none;--bs-link-hover-color: #4a266b;--bs-link-hover-color-rgb: 74,38,107;--bs-link-hover-decoration: underline;--bs-code-color: #d63384;--bs-highlight-color: #1d2d35;--bs-highlight-bg: #fcf2dd;--bs-border-width: 1px;--bs-border-style: solid;--bs-border-color: #dee2e6;--bs-border-color-translucent: rgba(0,0,0,0.175);--bs-border-radius: .375rem;--bs-border-radius-sm: .25rem;--bs-border-radius-lg: .5rem;--bs-border-radius-xl: 1rem;--bs-border-radius-xxl: 2rem;--bs-border-radius-2xl: var(--bs-border-radius-xxl);--bs-border-radius-pill: 50rem;--bs-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15);--bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0,0,0,0.075);--bs-box-shadow-lg: 0 1rem 3rem rgba(0,0,0,0.175);--bs-box-shadow-inset: inset 0 1px 2px rgba(0,0,0,0.075);--bs-focus-ring-width: .25rem;--bs-focus-ring-opacity: .25;--bs-focus-ring-color: rgba(93,47,134,0.25);--bs-form-valid-color: #84ee53;--bs-form-valid-border-color: #84ee53;--bs-form-invalid-color: #ee5389;--bs-form-invalid-border-color: #ee5389}[data-bs-theme="dark"]{color-scheme:dark;--bs-body-color: #c1c3c8;--bs-body-color-rgb: 192.831,194.7078,199.869;--bs-body-bg: #17181c;--bs-body-bg-rgb: 22.95,24.31,28.05;--bs-emphasis-color: #fff;--bs-emphasis-color-rgb: 255,255,255;--bs-secondary-color: rgba(193,195,200,0.75);--bs-secondary-color-rgb: 192.831,194.7078,199.869;--bs-secondary-bg: #343a40;--bs-secondary-bg-rgb: 52,58,64;--bs-tertiary-color: rgba(193,195,200,0.5);--bs-tertiary-color-rgb: 192.831,194.7078,199.869;--bs-tertiary-bg: #2b3035;--bs-tertiary-bg-rgb: 43,48,53;--bs-primary-text-emphasis: #9e82b6;--bs-secondary-text-emphasis: #a7acb1;--bs-success-text-emphasis: #b5f598;--bs-info-text-emphasis: #8591ff;--bs-warning-text-emphasis: #f5d798;--bs-danger-text-emphasis: #f598b8;--bs-light-text-emphasis: #f8f9fa;--bs-dark-text-emphasis: #dee2e6;--bs-primary-bg-subtle: #13091b;--bs-secondary-bg-subtle: #161719;--bs-success-bg-subtle: #1a3011;--bs-info-bg-subtle: #0a0e33;--bs-warning-bg-subtle: #302611;--bs-danger-bg-subtle: #30111b;--bs-light-bg-subtle: #23262f;--bs-dark-bg-subtle: #1a1d20;--bs-primary-border-subtle: #381c50;--bs-secondary-border-subtle: #41464b;--bs-success-border-subtle: #4f8f32;--bs-info-border-subtle: #1f2b99;--bs-warning-border-subtle: #8f7132;--bs-danger-border-subtle: #8f3252;--bs-light-border-subtle: #353841;--bs-dark-border-subtle: #343a40;--bs-heading-color: #fff;--bs-link-color: #b3c7ff;--bs-link-hover-color: #c2d2ff;--bs-link-color-rgb: 178.5,198.9,255;--bs-link-hover-color-rgb: 194,210,255;--bs-code-color: #e685b5;--bs-highlight-color: #c1c3c8;--bs-highlight-bg: #5f4c21;--bs-border-color: #495057;--bs-border-color-translucent: rgba(255,255,255,0.15);--bs-form-valid-color: #b5f598;--bs-form-valid-border-color: #b5f598;--bs-form-invalid-color: #f598b8;--bs-form-invalid-border-color: #f598b8}*,*::before,*::after{box-sizing:border-box}@media (prefers-reduced-motion: no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:0;margin-bottom:.5rem;font-weight:700;line-height:1.2;color:var(--bs-heading-color)}h1,.h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width: 1200px){h1,.h1{font-size:2.5rem}}h2,.h2{font-size:calc(1.325rem + .9vw)}@media (min-width: 1200px){h2,.h2{font-size:2rem}}h3,.h3{font-size:calc(1.3rem + .6vw)}@media (min-width: 1200px){h3,.h3{font-size:1.75rem}}h4,.h4{font-size:calc(1.275rem + .3vw)}@media (min-width: 1200px){h4,.h4{font-size:1.5rem}}h5,.h5{font-size:1.25rem}p{margin-top:0;margin-bottom:1rem}ol,ul{padding-left:2rem}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}strong{font-weight:bolder}small,.small{font-size:.875em}mark,.mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}a{color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));text-decoration:none}a:hover{--bs-link-color-rgb: var(--bs-link-hover-color-rgb);text-decoration:underline}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}pre,code,kbd,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}th{text-align:inherit;text-align:-webkit-match-parent}thead,tbody,tr,td,th{border-color:inherit;border-style:solid;border-width:0}button{border-radius:0}button:focus:not(:focus-visible){outline:0}input,button{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button{text-transform:none}[list]:not([type="date"]):not([type="datetime-local"]):not([type="month"]):not([type="week"]):not([type="time"])::-webkit-calendar-picker-indicator{display:none !important}button,[type="button"],[type="reset"],[type="submit"]{-webkit-appearance:button}button:not(:disabled),[type="button"]:not(:disabled),[type="reset"]:not(:disabled),[type="submit"]:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-text,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type="search"]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}summary{display:list-item;cursor:pointer}[hidden]{display:none !important}.lead{font-size:1.25rem;font-weight:400}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.img-fluid{max-width:100%;height:auto}.figure{display:inline-block}.container,.container-fluid,.container-lg{--bs-gutter-x: 3rem;--bs-gutter-y: 0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width: 576px){.container{max-width:540px}}@media (min-width: 768px){.container{max-width:720px}}@media (min-width: 992px){.container-lg,.container{max-width:960px}}@media (min-width: 1200px){.container-lg,.container{max-width:1240px}}@media (min-width: 1400px){.container-lg,.container{max-width:1320px}}:root{--bs-breakpoint-xs: 0;--bs-breakpoint-sm: 576px;--bs-breakpoint-md: 768px;--bs-breakpoint-lg: 992px;--bs-breakpoint-xl: 1200px;--bs-breakpoint-xxl: 1400px}.row{--bs-gutter-x: 3rem;--bs-gutter-y: 0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}@media (min-width: 768px){.col-md-12{flex:0 0 auto;width:75%}}@media (min-width: 992px){.col-lg-5{flex:0 0 auto;width:31.25%}.col-lg-8{flex:0 0 auto;width:50%}.col-lg-9{flex:0 0 auto;width:56.25%}.col-lg-10{flex:0 0 auto;width:62.5%}.col-lg-11{flex:0 0 auto;width:68.75%}.col-lg-12{flex:0 0 auto;width:75%}}@media (min-width: 1200px){.col-xl-3{flex:0 0 auto;width:18.75%}.col-xl-4{flex:0 0 auto;width:25%}.col-xl-8{flex:0 0 auto;width:50%}.col-xl-9{flex:0 0 auto;width:56.25%}}.sticky-top{position:sticky;top:0;z-index:1020}.visually-hidden{width:1px !important;height:1px !important;padding:0 !important;margin:-1px !important;overflow:hidden !important;clip:rect(0, 0, 0, 0) !important;white-space:nowrap !important;border:0 !important}.visually-hidden:not(caption){position:absolute !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.table,table{--bs-table-color-type: initial;--bs-table-bg-type: initial;--bs-table-color-state: initial;--bs-table-bg-state: initial;--bs-table-color: var(--bs-emphasis-color);--bs-table-bg: var(--bs-body-bg);--bs-table-border-color: var(--bs-border-color);--bs-table-accent-bg: rgba(0,0,0,0);--bs-table-striped-color: var(--bs-emphasis-color);--bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color: var(--bs-emphasis-color);--bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color: var(--bs-emphasis-color);--bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*,table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)))}.table>tbody,table>tbody{vertical-align:inherit}.table>thead,table>thead{vertical-align:bottom}[data-bs-theme="dark"] table{--bs-table-color: #fff;--bs-table-bg: #212529;--bs-table-border-color: #4d5154;--bs-table-striped-bg: #2c3034;--bs-table-striped-color: #fff;--bs-table-active-bg: #373b3e;--bs-table-active-color: #fff;--bs-table-hover-bg: #323539;--bs-table-hover-color: #fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}li input[type="checkbox"]{--bs-form-check-bg: var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;print-color-adjust:exact}li input[type="checkbox"]{border-radius:.25em}li input[type="radio"][type="checkbox"]{border-radius:50%}li input[type="checkbox"]:active{filter:brightness(90%)}li input[type="checkbox"]:focus{border-color:#ae97c3;outline:0;box-shadow:0 0 0 .25rem rgba(93,47,134,0.25)}li input[type="checkbox"]:checked{background-color:#5d2f86;border-color:#5d2f86}li input:checked[type="checkbox"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}li input[type="checkbox"]:checked[type="radio"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}li input[type="checkbox"]:indeterminate{background-color:#5d2f86;border-color:#5d2f86;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}li input[type="checkbox"]:disabled{pointer-events:none;filter:none;opacity:.5}.btn{--bs-btn-padding-x: .75rem;--bs-btn-padding-y: .375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight: 400;--bs-btn-line-height: 1.5;--bs-btn-color: var(--bs-body-color);--bs-btn-bg: transparent;--bs-btn-border-width: var(--bs-border-width);--bs-btn-border-color: transparent;--bs-btn-border-radius: var(--bs-border-radius);--bs-btn-hover-border-color: transparent;--bs-btn-box-shadow: inset 0 1px 0 rgba(255,255,255,0.15),0 1px 1px rgba(0,0,0,0.075);--bs-btn-disabled-opacity: .65;--bs-btn-focus-box-shadow: 0 0 0 0 rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);text-decoration:none;background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}:not(.btn-check)+.btn:active,.btn:first-child:active,.btn.active,.btn.show{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}:not(.btn-check)+.btn:active:focus-visible,.btn:first-child:active:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled,.btn.disabled{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color: #fff;--bs-btn-bg: #5d2f86;--bs-btn-border-color: #5d2f86;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #4f2872;--bs-btn-hover-border-color: #4a266b;--bs-btn-focus-shadow-rgb: 117,78,152;--bs-btn-active-color: #fff;--bs-btn-active-bg: #4a266b;--bs-btn-active-border-color: #462365;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #5d2f86;--bs-btn-disabled-border-color: #5d2f86}.btn-link{--bs-btn-font-weight: 400;--bs-btn-color: var(--bs-link-color);--bs-btn-bg: transparent;--bs-btn-border-color: transparent;--bs-btn-hover-color: var(--bs-link-hover-color);--bs-btn-hover-border-color: transparent;--bs-btn-active-color: var(--bs-link-hover-color);--bs-btn-active-border-color: transparent;--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-border-color: transparent;--bs-btn-box-shadow: 0 0 0 #000;--bs-btn-focus-shadow-rgb: 117,78,152;text-decoration:none}.btn-link:hover,.btn-link:focus-visible{text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.nav{--bs-nav-link-padding-x: 1rem;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-link-color);--bs-nav-link-hover-color: var(--bs-link-hover-color);--bs-nav-link-disabled-color: var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);background:none;border:0;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.nav-link{transition:none}}.nav-link:hover,.nav-link:focus{color:var(--bs-nav-link-hover-color);text-decoration:none}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(93,47,134,0.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.navbar{--bs-navbar-padding-x: 0;--bs-navbar-padding-y: .5rem;--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y: .3125rem;--bs-navbar-brand-margin-end: 1rem;--bs-navbar-brand-font-size: 1.25rem;--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x: .5rem;--bs-navbar-toggler-padding-y: .25rem;--bs-navbar-toggler-padding-x: .75rem;--bs-navbar-toggler-font-size: 1.25rem;--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2829,45,53,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius: var(--bs-border-radius);--bs-navbar-toggler-focus-width: 0;--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{color:var(--bs-navbar-brand-hover-color);text-decoration:none}.navbar-nav{--bs-nav-link-padding-x: 0;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-navbar-color);--bs-nav-link-hover-color: var(--bs-navbar-hover-color);--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}@media (min-width: 992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar[data-bs-theme="dark"]{--bs-navbar-color: #c1c3c8;--bs-navbar-hover-color: #b3c7ff;--bs-navbar-disabled-color: rgba(255,255,255,0.25);--bs-navbar-active-color: #b3c7ff;--bs-navbar-brand-color: #b3c7ff;--bs-navbar-brand-hover-color: #b3c7ff;--bs-navbar-toggler-border-color: rgba(255,255,255,0.1);--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23c1c3c8' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y: 1rem;--bs-card-spacer-x: 1rem;--bs-card-title-spacer-y: .5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width: var(--bs-border-width);--bs-card-border-color: #e9ecef;--bs-card-border-radius: var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y: .5rem;--bs-card-cap-padding-x: 1rem;--bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg: var(--bs-body-bg);--bs-card-img-overlay-padding: 1rem;--bs-card-group-margin: 1.5rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-text:last-child{margin-bottom:0}.breadcrumb{--bs-breadcrumb-padding-x: 0;--bs-breadcrumb-padding-y: 0;--bs-breadcrumb-margin-bottom: 1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color: var(--bs-secondary-color);--bs-breadcrumb-item-padding-x: .5rem;--bs-breadcrumb-item-active-color: var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);text-decoration:none;background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.page-link.active,.active>.page-link{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.page-link.disabled,.disabled>.page-link{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.modal-backdrop{--bs-backdrop-zindex: 1050;--bs-backdrop-bg: #000;--bs-backdrop-opacity: .5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}@keyframes spinner-border{to{transform:rotate(360deg) /* rtl:ignore */}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.offcanvas{--bs-offcanvas-zindex: 1045;--bs-offcanvas-width: 332px;--bs-offcanvas-height: 30vh;--bs-offcanvas-padding-x: 1rem;--bs-offcanvas-padding-y: 1rem;--bs-offcanvas-color: var(--bs-body-color);--bs-offcanvas-bg: var(--bs-body-bg);--bs-offcanvas-border-width: var(--bs-border-width);--bs-offcanvas-border-color: var(--bs-border-color-translucent);--bs-offcanvas-box-shadow: var(--bs-box-shadow-sm);--bs-offcanvas-transition: transform .3s ease-in-out;--bs-offcanvas-title-line-height: 1.5}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion: reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.showing,.offcanvas.show:not(.hiding){transform:none}.offcanvas.showing,.offcanvas.hiding,.offcanvas.show{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}@keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}.d-none{display:none !important}.position-relative{position:relative !important}.w-100{width:100% !important}.h-auto{height:auto !important}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-grow-1{flex-grow:1 !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.order-3{order:3 !important}.m-2{margin:.5rem !important}.mx-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-auto{margin-right:auto !important;margin-left:auto !important}.my-0{margin-top:0 !important;margin-bottom:0 !important}.my-3{margin-top:1rem !important;margin-bottom:1rem !important}.mt-1{margin-top:.25rem !important}.mt-4{margin-top:1.5rem !important}.me-2{margin-right:.5rem !important}.me-auto{margin-right:auto !important}.mb-3{margin-bottom:1rem !important}.mb-4{margin-bottom:1.5rem !important}.ms-2{margin-left:.5rem !important}.ms-auto{margin-left:auto !important}.mt-n3{margin-top:-1rem !important}.p-0{padding:0 !important}.p-2{padding:.5rem !important}.pt-4{padding-top:1.5rem !important}.pe-4{padding-right:1.5rem !important}.pb-2{padding-bottom:.5rem !important}.pb-3{padding-bottom:1rem !important}.pb-4{padding-bottom:1.5rem !important}.ps-3{padding-left:1rem !important}.text-start{text-align:left !important}.text-end{text-align:right !important}.text-center{text-align:center !important}.text-decoration-none{text-decoration:none !important}.text-nowrap{white-space:nowrap !important}.text-body{--bs-text-opacity: 1;color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important}.text-muted{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-body-secondary{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-reset{--bs-text-opacity: 1;color:inherit !important}.rounded-circle{border-radius:50% !important}@media (min-width: 576px){.flex-sm-row{flex-direction:row !important}}@media (min-width: 768px){.flex-md-row{flex-direction:row !important}}@media (min-width: 992px){.d-lg-block{display:block !important}.d-lg-none{display:none !important}.flex-lg-row{flex-direction:row !important}.order-lg-4{order:4 !important}.me-lg-1{margin-right:.25rem !important}.me-lg-3{margin-right:1rem !important}.ms-lg-2{margin-left:.5rem !important}.text-lg-start{text-align:left !important}.text-lg-end{text-align:right !important}}@media (min-width: 1200px){.d-xl-block{display:block !important}.d-xl-none{display:none !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.mx-xl-auto{margin-right:auto !important;margin-left:auto !important}}@font-face{font-family:Jost;font-style:normal;font-weight:400;font-display:swap;src:local("Jost Regular Regular"),local("Jost-Regular"),local("Jost* Book"),local("Jost-Book"),url("fonts/vendor/jost/jost-v4-latin-regular.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-regular.woff") format("woff")}@font-face{font-family:Jost;font-style:normal;font-weight:500;font-display:swap;src:local("Jost Regular Medium"),local("JostRoman-Medium"),local("Jost* Medium"),local("Jost-Medium"),url("fonts/vendor/jost/jost-v4-latin-500.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-500.woff") format("woff")}@font-face{font-family:Jost;font-style:normal;font-weight:700;font-display:swap;src:local("Jost Regular Bold"),local("JostRoman-Bold"),local("Jost* Bold"),local("Jost-Bold"),url("fonts/vendor/jost/jost-v4-latin-700.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-700.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:400;font-display:swap;src:local("Jost Italic Italic"),local("Jost-Italic"),local("Jost* BookItalic"),local("Jost-BookItalic"),url("fonts/vendor/jost/jost-v4-latin-italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-italic.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:500;font-display:swap;src:local("Jost Italic Medium Italic"),local("JostItalic-Medium"),local("Jost* Medium Italic"),local("Jost-MediumItalic"),url("fonts/vendor/jost/jost-v4-latin-500italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-500italic.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:700;font-display:swap;src:local("Jost Italic Bold Italic"),local("JostItalic-Bold"),local("Jost* Bold Italic"),local("Jost-BoldItalic"),url("fonts/vendor/jost/jost-v4-latin-700italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-700italic.woff") format("woff")}html[data-bs-theme="dark"] .icon-tabler-sun{display:block}html[data-bs-theme="dark"] .icon-tabler-moon{display:none}html[data-bs-theme="light"] .icon-tabler-sun{display:none}html[data-bs-theme="light"] .icon-tabler-moon{display:block}.privacy .content,.contributors .content,.blog .content,.error404 .content,.docs.list .content,.categories.list .content,.tags.list .content,.list.section .content{padding-top:1rem;padding-bottom:3rem}.content img{max-width:100%}h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:2rem;margin-bottom:1rem}@media (min-width: 768px){body{font-size:1.125rem}h1,h2,h3,h4,h5,.h1,.h2,.h3,.h4,.h5{margin-bottom:1.125rem}}.home h1,.home .h1{font-size:calc(1.875rem + 1.5vw);margin-top:-1rem}a:hover,a:focus{text-decoration:underline}a.btn:hover,a.btn:focus{text-decoration:none}.section{padding-top:5rem;padding-bottom:5rem}body.section{padding-top:0;padding-bottom:0}.section-md{padding-top:3rem;padding-bottom:3rem}.docs-sidebar{order:2}@media (min-width: 992px){.docs-sidebar{order:0;border-right:1px solid #e9ecef}@supports (position: sticky){.docs-sidebar{position:sticky;top:4.25rem;z-index:1000;height:calc(100vh - 4.25rem)}}}@media (min-width: 1200px){.docs-sidebar{flex:0 1 320px}}.docs-links{padding-bottom:5rem}@media (min-width: 992px){@supports (position: sticky){.docs-links{max-height:calc(100vh - 4rem);overflow-y:scroll}}}@media (min-width: 992px){.docs-links{display:block;width:auto;margin-right:-1.5rem;padding-bottom:4rem}}.docs-toc{order:2}@supports (position: sticky){.docs-toc{position:sticky;top:4.25rem;height:calc(100vh - 4.25rem);overflow-y:auto}}.docs-content{padding-bottom:3rem;order:1}.navbar a:hover,.navbar a:focus{text-decoration:none}#TableOfContents ul,#toc ul{padding-left:0;list-style:none}#toc a.active{color:#5d2f86;font-weight:500}.section-features{padding-top:2rem}.bg-dots{background-image:radial-gradient(#dee2e6 15%, transparent 15%);background-position:0 0;background-size:1rem 1rem;-webkit-mask:linear-gradient(to top, #fff, transparent);mask:linear-gradient(to top, #fff, transparent);width:100%;height:11rem;margin-top:-10rem;z-index:-1}.modal-backdrop{background-color:#fff}.modal-backdrop.show{opacity:0.7}@media (min-width: 768px){.modal-backdrop.show{opacity:0}}li input[type="checkbox"]{margin:0.25rem;border:1px solid #ced4da}li input[type="checkbox"]:disabled{pointer-events:none;filter:none;opacity:1}li input[type="checkbox"]:checked{background-color:#5d2f86;border-color:#5d2f86}[data-bs-theme="dark"] li input[type="checkbox"]{border:1px solid #6c757d}[data-bs-theme="dark"] li input[type="checkbox"]:checked{background-color:#b3c7ff;border-color:#b3c7ff;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%231d2d35' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.content .svg-inline{margin-bottom:1.5rem}.content .svg-inline:not(.svg-inline-custom){height:1.875rem;width:1.875rem;stroke-width:1.5}.card-nav{-moz-column-gap:1rem;column-gap:1rem}.card-nav .card{margin:0.5rem 0}.card-nav .card:hover{border:1px solid #d9d9d9;background-color:var(--sl-color-gray-7)}[data-bs-theme="dark"] .card-nav .card{border:1px solid #353841}[data-bs-theme="dark"] .card-nav .card:hover{border:1px solid #888c96;background-color:var(--sl-color-gray-6)}.highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}.bg{background-color:var(--sl-color-gray-7)}.chroma{background-color:var(--sl-color-gray-7)}.chroma .err{color:inherit}.chroma .lnlinks{outline:none;text-decoration:none;color:inherit}.chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}.chroma .lntable{border-spacing:0;padding:0;margin:0;border:0}.chroma .hl{background-color:#0000001a}.chroma .hl{border-inline-start:0.15rem solid #00000055;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}.chroma .hl .ln{margin-left:-0.15rem}.chroma .lnt{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#7f7f7f}.chroma .ln{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#7f7f7f}.chroma .line{display:flex}.chroma .k{color:#000000;font-weight:bold}.chroma .kc{color:#000000;font-weight:bold}.chroma .kd{color:#000000;font-weight:bold}.chroma .kn{color:#000000;font-weight:bold}.chroma .kp{color:#000000;font-weight:bold}.chroma .kr{color:#000000;font-weight:bold}.chroma .kt{color:#445588;font-weight:bold}.chroma .na{color:#008080}.chroma .nb{color:#0086b3}.chroma .bp{color:#999999}.chroma .nc{color:#445588;font-weight:bold}.chroma .no{color:#008080}.chroma .nd{color:#3c5d5d;font-weight:bold}.chroma .ni{color:#800080}.chroma .ne{color:#990000;font-weight:bold}.chroma .nf{color:#990000;font-weight:bold}.chroma .nl{color:#990000;font-weight:bold}.chroma .nn{color:#555555}.chroma .nt{color:#000080}.chroma .nv{color:#008080}.chroma .vc{color:#008080}.chroma .vg{color:#008080}.chroma .vi{color:#008080}.chroma .s{color:#dd1144}.chroma .sa{color:#dd1144}.chroma .sb{color:#dd1144}.chroma .sc{color:#dd1144}.chroma .dl{color:#dd1144}.chroma .sd{color:#dd1144}.chroma .s2{color:#dd1144}.chroma .se{color:#dd1144}.chroma .sh{color:#dd1144}.chroma .si{color:#dd1144}.chroma .sx{color:#dd1144}.chroma .sr{color:#009926}.chroma .s1{color:#dd1144}.chroma .ss{color:#990073}.chroma .m{color:#009999}.chroma .mb{color:#009999}.chroma .mf{color:#009999}.chroma .mh{color:#009999}.chroma .mi{color:#009999}.chroma .il{color:#009999}.chroma .mo{color:#009999}.chroma .o{color:#000000;font-weight:bold}.chroma .ow{color:#000000;font-weight:bold}.chroma .c{color:#999988;font-style:italic}.chroma .ch{color:#999988;font-style:italic}.chroma .cm{color:#999988;font-style:italic}.chroma .c1{color:#999988;font-style:italic}.chroma .cs{color:#999999;font-weight:bold;font-style:italic}.chroma .cp{color:#999999;font-weight:bold;font-style:italic}.chroma .cpf{color:#999999;font-weight:bold;font-style:italic}.chroma .gd{color:#000000;background-color:#ffdddd}.chroma .ge{color:inherit;font-style:italic}.chroma .gr{color:#aa0000}.chroma .gh{color:#999999}.chroma .gi{color:#000000;background-color:#ddffdd}.chroma .go{color:#888888}.chroma .gp{color:#555555}.chroma .gs{font-weight:bold}.chroma .gu{color:#aaaaaa}.chroma .gt{color:#aa0000}.chroma .gl{text-decoration:underline}.chroma .w{color:#bbbbbb}[data-bs-theme="dark"] .highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}[data-bs-theme="dark"] .bg{color:#c9d1d9;background-color:var(--sl-color-gray-6)}[data-bs-theme="dark"] .chroma{color:#c9d1d9;background-color:var(--sl-color-gray-6)}[data-bs-theme="dark"] .chroma .err{color:inherit}[data-bs-theme="dark"] .chroma .lnlinks{outline:none;text-decoration:none;color:inherit}[data-bs-theme="dark"] .chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}[data-bs-theme="dark"] .chroma .lntable{border-spacing:0;padding:0;margin:0;border:0}[data-bs-theme="dark"] .chroma .hl{background-color:#ffffff17}[data-bs-theme="dark"] .chroma .hl{border-inline-start:0.15rem solid #ffffff40;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}[data-bs-theme="dark"] .chroma .hl .ln{margin-left:-0.15rem}[data-bs-theme="dark"] .chroma .lnt{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#64686c}[data-bs-theme="dark"] .chroma .ln{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#6e7681}[data-bs-theme="dark"] .chroma .line{display:flex}[data-bs-theme="dark"] .chroma .k{color:#ff7b72}[data-bs-theme="dark"] .chroma .kc{color:#79c0ff}[data-bs-theme="dark"] .chroma .kd{color:#ff7b72}[data-bs-theme="dark"] .chroma .kn{color:#ff7b72}[data-bs-theme="dark"] .chroma .kp{color:#79c0ff}[data-bs-theme="dark"] .chroma .kr{color:#ff7b72}[data-bs-theme="dark"] .chroma .kt{color:#ff7b72}[data-bs-theme="dark"] .chroma .na{color:#d2a8ff}[data-bs-theme="dark"] .chroma .nc{color:#f0883e;font-weight:bold}[data-bs-theme="dark"] .chroma .no{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nd{color:#d2a8ff;font-weight:bold}[data-bs-theme="dark"] .chroma .ni{color:#ffa657}[data-bs-theme="dark"] .chroma .ne{color:#f0883e;font-weight:bold}[data-bs-theme="dark"] .chroma .nf{color:#d2a8ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nl{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nn{color:#ff7b72}[data-bs-theme="dark"] .chroma .py{color:#79c0ff}[data-bs-theme="dark"] .chroma .nt{color:#7ee787}[data-bs-theme="dark"] .chroma .nv{color:#79c0ff}[data-bs-theme="dark"] .chroma .l{color:#a5d6ff}[data-bs-theme="dark"] .chroma .ld{color:#79c0ff}[data-bs-theme="dark"] .chroma .s{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sa{color:#79c0ff}[data-bs-theme="dark"] .chroma .sb{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sc{color:#a5d6ff}[data-bs-theme="dark"] .chroma .dl{color:#79c0ff}[data-bs-theme="dark"] .chroma .sd{color:#a5d6ff}[data-bs-theme="dark"] .chroma .s2{color:#a5d6ff}[data-bs-theme="dark"] .chroma .se{color:#79c0ff}[data-bs-theme="dark"] .chroma .sh{color:#79c0ff}[data-bs-theme="dark"] .chroma .si{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sx{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sr{color:#79c0ff}[data-bs-theme="dark"] .chroma .s1{color:#a5d6ff}[data-bs-theme="dark"] .chroma .ss{color:#a5d6ff}[data-bs-theme="dark"] .chroma .m{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mb{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mf{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mh{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mi{color:#a5d6ff}[data-bs-theme="dark"] .chroma .il{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mo{color:#a5d6ff}[data-bs-theme="dark"] .chroma .o{color:inherit;font-weight:bold}[data-bs-theme="dark"] .chroma .ow{color:#ff7b72;font-weight:bold}[data-bs-theme="dark"] .chroma .c{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .ch{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .cm{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .c1{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .cs{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .cp{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .cpf{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .gd{color:#ffa198;background-color:#490202}[data-bs-theme="dark"] .chroma .ge{font-style:italic}[data-bs-theme="dark"] .chroma .gr{color:#ffa198}[data-bs-theme="dark"] .chroma .gh{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .gi{color:#56d364;background-color:#0f5323}[data-bs-theme="dark"] .chroma .go{color:#8b949e}[data-bs-theme="dark"] .chroma .gp{color:#8b949e}[data-bs-theme="dark"] .chroma .gs{font-weight:bold}[data-bs-theme="dark"] .chroma .gu{color:#79c0ff}[data-bs-theme="dark"] .chroma .gt{color:#ff7b72}[data-bs-theme="dark"] .chroma .gl{text-decoration:underline}[data-bs-theme="dark"] .chroma .w{color:#6e7681}[data-bs-theme="dark"] h1,[data-bs-theme="dark"] .h1,[data-bs-theme="dark"] h2,[data-bs-theme="dark"] .h2,[data-bs-theme="dark"] h3,[data-bs-theme="dark"] .h3,[data-bs-theme="dark"] h4,[data-bs-theme="dark"] .h4{color:#fff}[data-bs-theme="dark"] body{background:#17181c;color:#c1c3c8}[data-bs-theme="dark"] a{color:#b3c7ff}[data-bs-theme="dark"] .callout a{color:inherit}[data-bs-theme="dark"] .btn-primary{--bs-btn-color: #000;--bs-btn-bg: #b3c7ff;--bs-btn-border-color: #b3c7ff;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #becfff;--bs-btn-hover-border-color: #bacdff;--bs-btn-focus-shadow-rgb: 152,169,217;--bs-btn-active-color: #000;--bs-btn-active-bg: #c2d2ff;--bs-btn-active-border-color: #bacdff;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #b3c7ff;--bs-btn-disabled-border-color: #b3c7ff;color:#17181c}[data-bs-theme="dark"] .navbar{background-color:rgba(23,24,28,0.95);border-bottom:1px solid #23262f}[data-bs-theme="dark"] body.home .navbar{border-bottom:0}[data-bs-theme="dark"] .offcanvas-header{border-bottom:1px solid #343a40}[data-bs-theme="dark"] .offcanvas .nav-link{color:#c1c3c8}[data-bs-theme="dark"] .offcanvas .nav-link:hover,[data-bs-theme="dark"] .offcanvas .nav-link:focus{color:#b3c7ff}[data-bs-theme="dark"] .offcanvas .nav-link.active{color:#b3c7ff}[data-bs-theme="dark"] .page-links a{color:#c1c3c8}[data-bs-theme="dark"] .page-links a:hover{text-decoration:none;color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link{color:#c1c3c8}[data-bs-theme="dark"] .content .btn-link{color:#b3c7ff}[data-bs-theme="dark"] .content .btn-link:hover{color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link:hover{color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link:active{color:#b3c7ff}@media (min-width: 992px){[data-bs-theme="dark"] .docs-sidebar{order:0;border-right:1px solid #23262f}}[data-bs-theme="dark"] .footer{border-top:1px solid #23262f}[data-bs-theme="dark"] .docs-links,[data-bs-theme="dark"] .docs-toc{scrollbar-width:thin;scrollbar-color:#17181c #17181c}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar{width:5px}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-track,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-track{background:#17181c}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb{background:#17181c}[data-bs-theme="dark"] .docs-links:hover,[data-bs-theme="dark"] .docs-toc:hover{scrollbar-width:thin;scrollbar-color:#23262f #17181c}[data-bs-theme="dark"] .docs-links:hover::-webkit-scrollbar-thumb,[data-bs-theme="dark"] .docs-toc:hover::-webkit-scrollbar-thumb{background:#23262f}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb:hover,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb:hover{background:#23262f}[data-bs-theme="dark"] .docs-links h3:not(:first-child),[data-bs-theme="dark"] .docs-links .h3:not(:first-child){border-top:1px solid #23262f}[data-bs-theme="dark"] .page-links li:not(:first-child){border-top:1px dashed #23262f}[data-bs-theme="dark"] .card{background:#17181c;border:1px solid #23262f}[data-bs-theme="dark"] .bg-dots{background-image:radial-gradient(#414349 15%, transparent 15%)}[data-bs-theme="dark"] .text-muted{color:#adafb6 !important}[data-bs-theme="dark"] .offcanvas{background-color:#17181c}[data-bs-theme="dark"] .page-link{color:#b3c7ff;background-color:transparent;border:var(--bs-border-width) solid #23262f}[data-bs-theme="dark"] .page-link:hover{color:#17181c;background-color:#c1c3c8;border-color:#c1c3c8}[data-bs-theme="dark"] .page-link:focus{color:#17181c;background-color:#c1c3c8}[data-bs-theme="dark"] .page-item.active .page-link{color:#17181c;background-color:#b3c7ff;border-color:#b3c7ff}[data-bs-theme="dark"] .page-item.disabled .page-link{color:var(--bs-secondary-color);background-color:#23262f;border-color:#23262f}[data-bs-theme="dark"] details{border:1px solid #23262f}[data-bs-theme="dark"] summary:hover{background:#23262f}[data-bs-theme="dark"] details[open]>summary{border-bottom:1px solid #23262f}[data-bs-theme="dark"] details summary::after{content:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%28222, 226, 230, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e")}[data-bs-theme="dark"] #toc a.active{color:#b3c7ff}[data-bs-theme="dark"] table th{color:#fff}[data-bs-theme="dark"] table,[data-bs-theme="dark"] [data-bs-theme="dark"] table{--bs-table-color: inherit;--bs-table-bg: $body-bg-dark;background:#17181c;border-color:#23262f}.navbar .btn-link{color:rgba(var(--bs-emphasis-color-rgb), 0.65);padding:0.4375rem 0}.btn-link:focus{outline:0;box-shadow:none}@media (min-width: 992px){.navbar .btn-link{padding:0.5625em 0.25rem 0.5rem 0.125rem}}.navbar .btn-link:hover{color:rgba(var(--bs-emphasis-color-rgb), 0.8)}.navbar .btn-link:active{color:rgba(var(--bs-emphasis-color-rgb), 1)}.clipboard{position:relative;float:right}.btn-clipboard{transition:opacity 0.25s ease-in-out;opacity:0;position:absolute;right:0.5rem;top:0.5rem;line-height:1;padding:0.3125rem 0.3125rem 0.1875rem;background-color:transparent;border-color:transparent}@media (max-width: 767.98px){.btn-clipboard{position:absolute;right:-0.5rem;top:0.5rem}}.btn-clipboard::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#495057}.btn-clipboard:hover{border-color:transparent}.btn-clipboard:hover::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#212529}.btn-clipboard:focus,.btn-clipboard:active{border-color:transparent !important}.btn-clipboard:focus::after,.btn-clipboard:active::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#212529}[data-bs-theme="dark"] .btn-clipboard{background-color:transparent;border-color:transparent}[data-bs-theme="dark"] .btn-clipboard::after{background-color:#ced4da}[data-bs-theme="dark"] .btn-clipboard:hover{border-color:transparent}[data-bs-theme="dark"] .btn-clipboard:hover::after{background-color:#e9ecef}[data-bs-theme="dark"] .btn-clipboard:focus,[data-bs-theme="dark"] .btn-clipboard:active{border-color:transparent}[data-bs-theme="dark"] .btn-clipboard:focus::after,[data-bs-theme="dark"] .btn-clipboard:active::after{background-color:#e9ecef}.highlight{position:relative}@media (min-width: 768px){.highlight:hover .btn-clipboard{opacity:1}}#toTop{opacity:0;transition:opacity 0.3s ease-in-out}.callout{--bs-link-color-rgb: var(--callout-link);--bs-code-color: var(--callout-code-color);color:var(--callout-color, inherit);background-color:var(--callout-bg, var(--bs-gray-100));border-left:0.25rem solid var(--callout-border, var(--bs-gray-300));border-radius:0}.callout a{text-decoration:underline}.callout .highlight{background-color:rgba(0,0,0,0.05)}.callout .callout-icon.svg-inline{flex-shrink:0;height:calc(1.5 * 1.125rem)}.callout .callout-title{font-weight:700}.callout-content{min-width:0}.callout.callout-note{border-color:var(--sl-color-blue);background-color:var(--sl-color-blue-high)}.callout.callout-note .callout-icon,.callout.callout-note .callout-title,.callout.callout-note .callout-body a{color:var(--sl-color-blue-low)}.callout.callout-note .callout-body,.callout.callout-note .callout-body a:hover,.callout.callout-note .callout-body a:active{color:var(--sl-color-white)}.callout.callout-tip{border-color:var(--sl-color-purple);background-color:var(--sl-color-purple-high)}.callout.callout-tip .callout-icon,.callout.callout-tip .callout-title,.callout.callout-tip .callout-body a{color:var(--sl-color-purple-low)}.callout.callout-tip .callout-body,.callout.callout-tip .callout-body a:hover,.callout.callout-tip .callout-body a:active{color:var(--sl-color-white)}.callout.callout-danger{border-color:var(--sl-color-red);background-color:var(--sl-color-red-high)}.callout.callout-danger .callout-icon,.callout.callout-danger .callout-title,.callout.callout-danger .callout-body a{color:var(--sl-color-red-low)}.callout.callout-danger .callout-body,.callout.callout-danger .callout-body a:hover,.callout.callout-danger .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout{color:var(--sl-color-gray-1)}[data-bs-theme="dark"] .callout.callout-note{border-color:var(--sl-color-blue);background-color:var(--sl-color-blue-low)}[data-bs-theme="dark"] .callout.callout-note .callout-icon,[data-bs-theme="dark"] .callout.callout-note .callout-title,[data-bs-theme="dark"] .callout.callout-note .callout-body a{color:var(--sl-color-blue-high)}[data-bs-theme="dark"] .callout.callout-note .callout-body,[data-bs-theme="dark"] .callout.callout-note .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-note .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-note code:not(:where(.not-content *)){color:var(--ec-codeFg)}[data-bs-theme="dark"] .callout.callout-tip{border-color:var(--sl-color-purple);background-color:var(--sl-color-purple-low)}[data-bs-theme="dark"] .callout.callout-tip .callout-icon,[data-bs-theme="dark"] .callout.callout-tip .callout-title,[data-bs-theme="dark"] .callout.callout-tip .callout-body a{color:var(--sl-color-purple-high)}[data-bs-theme="dark"] .callout.callout-tip .callout-body,[data-bs-theme="dark"] .callout.callout-tip .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-tip .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-tip code:not(:where(.not-content *)){color:var(--ec-codeFg)}[data-bs-theme="dark"] .callout.callout-danger{border-color:var(--sl-color-red);background-color:var(--sl-color-red-low)}[data-bs-theme="dark"] .callout.callout-danger .callout-icon,[data-bs-theme="dark"] .callout.callout-danger .callout-title,[data-bs-theme="dark"] .callout.callout-danger .callout-body a{color:var(--sl-color-red-high)}[data-bs-theme="dark"] .callout.callout-danger .callout-body,[data-bs-theme="dark"] .callout.callout-danger .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-danger .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-danger code:not(:where(.not-content *)){color:var(--ec-codeFg)}.expressive-code{font-family:var(--ec-uiFontFml);font-size:var(--ec-uiFontSize);line-height:var(--ec-uiLineHt);-moz-text-size-adjust:none;text-size-adjust:none;-webkit-text-size-adjust:none;margin:1.5rem 0}.expressive-code *:not(path){all:revert;box-sizing:border-box}.expressive-code pre{display:flex;margin:0;padding:0;border:var(--ec-brdWd) solid var(--ec-brdCol);border-radius:calc(var(--ec-brdRad) + var(--ec-brdWd));background:var(--ec-codeBg)}.expressive-code pre:focus-visible{outline:3px solid var(--ec-focusBrd);outline-offset:-3px}.expressive-code pre>code{all:unset;display:block;flex:1 0 100%;padding:var(--ec-codePadBlk) 0;color:var(--ec-codeFg);font-family:var(--ec-codeFontFml);font-size:var(--ec-codeFontSize);line-height:var(--ec-codeLineHt)}.expressive-code pre{overflow-x:auto}.expressive-code pre::-webkit-scrollbar,.expressive-code pre::-webkit-scrollbar-track{background-color:inherit;border-radius:calc(var(--ec-brdRad) + var(--ec-brdWd));border-top-left-radius:0;border-top-right-radius:0}.expressive-code pre::-webkit-scrollbar-thumb{background-color:var(--ec-sbThumbCol);border:4px solid transparent;background-clip:content-box;border-radius:10px}.expressive-code pre::-webkit-scrollbar-thumb:hover{background-color:var(--ec-sbThumbHoverCol)}.expressive-code .ec-line{padding-inline:var(--ec-codePadInl);padding-inline-end:calc(2rem + var(--ec-codePadInl));direction:ltr;unicode-bidi:isolate}.expressive-code .sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);white-space:nowrap;border-width:0}.expressive-code .ec-line.mark{--tmLineBgCol: var(--ec-tm-markBg);--tmLineBrdCol: var(--ec-tm-markBrdCol)}.expressive-code .ec-line.ins{--tmLineBgCol: var(--ec-tm-insBg);--tmLineBrdCol: var(--ec-tm-insBrdCol)}.expressive-code .ec-line.ins::before{content:var(--ec-tm-insDiffIndContent);color:var(--ec-tm-insDiffIndCol)}.expressive-code .ec-line.del{--tmLineBgCol: var(--ec-tm-delBg);--tmLineBrdCol: var(--ec-tm-delBrdCol)}.expressive-code .ec-line.del::before{content:var(--ec-tm-delDiffIndContent);color:var(--ec-tm-delDiffIndCol)}.expressive-code .ec-line.mark,.expressive-code .ec-line.ins,.expressive-code .ec-line.del{position:relative;background:var(--tmLineBgCol);min-width:calc(100% - var(--ec-tm-lineMarkerAccentMarg));margin-inline-start:var(--ec-tm-lineMarkerAccentMarg);border-inline-start:var(--ec-tm-lineMarkerAccentWd) solid var(--tmLineBrdCol);padding-inline-start:calc(var(--ec-codePadInl) - var(--ec-tm-lineMarkerAccentMarg) - var(--ec-tm-lineMarkerAccentWd)) !important}.expressive-code .ec-line.mark::before,.expressive-code .ec-line.ins::before,.expressive-code .ec-line.del::before{position:absolute;left:var(--ec-tm-lineDiffIndMargLeft)}.expressive-code .ec-line mark,.expressive-code .ec-line .mark{--tmInlineBgCol: var(--ec-tm-markBg);--tmInlineBrdCol: var(--ec-tm-markBrdCol)}.expressive-code .ec-line ins{--tmInlineBgCol: var(--ec-tm-insBg);--tmInlineBrdCol: var(--ec-tm-insBrdCol)}.expressive-code .ec-line del{--tmInlineBgCol: var(--ec-tm-delBg);--tmInlineBrdCol: var(--ec-tm-delBrdCol)}.expressive-code .ec-line mark,.expressive-code .ec-line .mark,.expressive-code .ec-line ins,.expressive-code .ec-line del{all:unset;display:inline-block;position:relative;--tmBrdL: var(--ec-tm-inlMarkerBrdWd);--tmBrdR: var(--ec-tm-inlMarkerBrdWd);--tmRadL: var(--ec-tm-inlMarkerBrdRad);--tmRadR: var(--ec-tm-inlMarkerBrdRad);margin-inline:0.025rem;padding-inline:var(--ec-tm-inlMarkerPad);border-radius:var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL);background:var(--tmInlineBgCol);background-clip:padding-box}.expressive-code .ec-line mark.open-start,.expressive-code .ec-line .open-start.mark,.expressive-code .ec-line ins.open-start,.expressive-code .ec-line del.open-start{margin-inline-start:0;padding-inline-start:0;--tmBrdL: 0px;--tmRadL: 0}.expressive-code .ec-line mark.open-end,.expressive-code .ec-line .open-end.mark,.expressive-code .ec-line ins.open-end,.expressive-code .ec-line del.open-end{margin-inline-end:0;padding-inline-end:0;--tmBrdR: 0px;--tmRadR: 0}.expressive-code .ec-line mark::before,.expressive-code .ec-line .mark::before,.expressive-code .ec-line ins::before,.expressive-code .ec-line del::before{content:"";position:absolute;pointer-events:none;display:inline-block;inset:0;border-radius:var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL);border:var(--ec-tm-inlMarkerBrdWd) solid var(--tmInlineBrdCol);border-inline-width:var(--tmBrdL) var(--tmBrdR)}.expressive-code .frame{all:unset;position:relative;display:block;--header-border-radius: calc(var(--ec-brdRad) + var(--ec-brdWd));--tab-border-radius: calc(var(--ec-frm-edTabBrdRad) + var(--ec-brdWd));--button-spacing: 0.4rem;--code-background: var(--ec-frm-edBg);border-radius:var(--header-border-radius);box-shadow:var(--ec-frm-frameBoxShdCssVal)}.expressive-code .frame .header{display:none;z-index:1;position:relative;border-radius:var(--header-border-radius) var(--header-border-radius) 0 0}.expressive-code .frame.has-title pre,.expressive-code .frame.has-title code,.expressive-code .frame.is-terminal pre,.expressive-code .frame.is-terminal code{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.expressive-code .frame .title:empty:before{content:"\a0"}.expressive-code .frame.has-title:not(.is-terminal){--button-spacing: calc(1.9rem + 2 * (var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)))}.expressive-code .frame.has-title:not(.is-terminal) .title{position:relative;color:var(--ec-frm-edActTabFg);background:var(--ec-frm-edActTabBg);background-clip:padding-box;margin-block-start:var(--ec-frm-edTabsMargBlkStart);padding:calc(var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)) var(--ec-uiPadInl);border:var(--ec-brdWd) solid var(--ec-frm-edActTabBrdCol);border-radius:var(--tab-border-radius) var(--tab-border-radius) 0 0;border-bottom:none;overflow:hidden}.expressive-code .frame.has-title:not(.is-terminal) .title::after{content:"";position:absolute;pointer-events:none;inset:0;border-top:var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndTopCol);border-bottom:var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndBtmCol)}.expressive-code .frame.has-title:not(.is-terminal) .header{display:flex;background:linear-gradient(to top, var(--ec-frm-edTabBarBrdBtmCol) var(--ec-brdWd), transparent var(--ec-brdWd)),linear-gradient(var(--ec-frm-edTabBarBg), var(--ec-frm-edTabBarBg));background-repeat:no-repeat;padding-inline-start:var(--ec-frm-edTabsMargInlStart)}.expressive-code .frame.has-title:not(.is-terminal) .header::before{content:"";position:absolute;pointer-events:none;inset:0;border:var(--ec-brdWd) solid var(--ec-frm-edTabBarBrdCol);border-radius:inherit;border-bottom:none}.expressive-code .frame.is-terminal{--button-spacing: calc(1.9rem + var(--ec-brdWd) + 2 * var(--ec-uiPadBlk));--code-background: var(--ec-frm-trmBg)}.expressive-code .frame.is-terminal .header{display:flex;align-items:center;justify-content:center;padding-block:var(--ec-uiPadBlk);padding-block-end:calc(var(--ec-uiPadBlk) + var(--ec-brdWd));position:relative;font-weight:500;letter-spacing:0.025ch;color:var(--ec-frm-trmTtbFg);background:var(--ec-frm-trmTtbBg);border:var(--ec-brdWd) solid var(--ec-brdCol);border-bottom:none}.expressive-code .frame.is-terminal .header::before{content:"";position:absolute;pointer-events:none;left:var(--ec-uiPadInl);width:2.1rem;height:0.56rem;line-height:0;background-color:var(--ec-frm-trmTtbDotsFg);opacity:var(--ec-frm-trmTtbDotsOpa);-webkit-mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E");-webkit-mask-repeat:no-repeat;mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E");mask-repeat:no-repeat}.expressive-code .frame.is-terminal .header::after{content:"";position:absolute;pointer-events:none;inset:0;border-bottom:var(--ec-brdWd) solid var(--ec-frm-trmTtbBrdBtmCol)}.expressive-code .frame pre{background:var(--code-background)}.expressive-code .copy{display:flex;gap:0.25rem;flex-direction:row;position:absolute;inset-block-start:calc(var(--ec-brdWd) + var(--button-spacing));inset-inline-end:calc(var(--ec-brdWd) + var(--ec-uiPadInl) / 2);direction:ltr;unicode-bidi:isolate}.expressive-code .copy button{position:relative;align-self:flex-end;margin:0;padding:0;border:none;border-radius:0.2rem;z-index:1;cursor:pointer;transition-property:opacity, background, border-color;transition-duration:0.2s;transition-timing-function:cubic-bezier(0.25, 0.46, 0.45, 0.94);width:2.5rem;height:2.5rem;background:var(--code-background);opacity:0.75}.expressive-code .copy button div{position:absolute;inset:0;border-radius:inherit;background:var(--ec-frm-inlBtnBg);opacity:var(--ec-frm-inlBtnBgIdleOpa);transition-property:inherit;transition-duration:inherit;transition-timing-function:inherit}.expressive-code .copy button::before{content:"";position:absolute;pointer-events:none;inset:0;border-radius:inherit;border:var(--ec-brdWd) solid var(--ec-frm-inlBtnBrd);opacity:var(--ec-frm-inlBtnBrdOpa)}.expressive-code .copy button::after{content:"";position:absolute;pointer-events:none;inset:0;background-color:var(--ec-frm-inlBtnFg);-webkit-mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E");-webkit-mask-repeat:no-repeat;mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E");mask-repeat:no-repeat;margin:0.475rem;line-height:0}.expressive-code .copy button:focus::after,.expressive-code .copy button:active::after{display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;margin:0.2375rem}.expressive-code .copy button:hover,.expressive-code .copy button:focus:focus-visible{opacity:1}.expressive-code .copy button:hover div,.expressive-code .copy button:focus:focus-visible div{opacity:var(--ec-frm-inlBtnBgHoverOrFocusOpa)}.expressive-code .copy button:active{opacity:1}.expressive-code .copy button:active div{opacity:var(--ec-frm-inlBtnBgActOpa)}.expressive-code .copy .feedback{--tooltip-arrow-size: 0.35rem;--tooltip-bg: var(--ec-frm-tooltipSuccessBg);color:var(--ec-frm-tooltipSuccessFg);pointer-events:none;-moz-user-select:none;user-select:none;-webkit-user-select:none;position:relative;align-self:center;background-color:var(--tooltip-bg);z-index:99;padding:0.125rem 0.75rem;border-radius:0.2rem;margin-inline-end:var(--tooltip-arrow-size);opacity:0;transition-property:opacity, transform;transition-duration:0.2s;transition-timing-function:ease-in-out;transform:translate3d(0, 0.25rem, 0)}.expressive-code .copy .feedback::after{content:"";position:absolute;pointer-events:none;top:calc(50% - var(--tooltip-arrow-size));inset-inline-end:calc(-2 * (var(--tooltip-arrow-size) - 0.5px));border:var(--tooltip-arrow-size) solid transparent;border-inline-start-color:var(--tooltip-bg)}.expressive-code .copy .feedback.show{opacity:1;transform:translate3d(0, 0, 0)}@media (hover: hover){.expressive-code .copy button{opacity:0;width:2rem;height:2rem}.expressive-code .frame:hover .copy button:not(:hover),.expressive-code .frame:focus-within :focus-visible~.copy button:not(:hover),.expressive-code .frame .copy .feedback.show~button:not(:hover){opacity:0.75}}:root{--ec-brdRad: 0px;--ec-brdWd: 1px;--ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-codeFontFml: var(--__sl-font-mono);--ec-codeFontSize: var(--sl-text-code);--ec-codeFontWg: 400;--ec-codeLineHt: var(--sl-line-height);--ec-codePadBlk: 0;--ec-codePadInl: 1rem;--ec-codeBg: #011627;--ec-codeFg: #d6deeb;--ec-codeSelBg: #1d3b53;--ec-uiFontFml: var(--__sl-font);--ec-uiFontSize: 0.9rem;--ec-uiFontWg: 400;--ec-uiLineHt: 1.65;--ec-uiPadBlk: 0.25rem;--ec-uiPadInl: 1rem;--ec-uiSelBg: #234d708c;--ec-uiSelFg: #ffffff;--ec-focusBrd: #122d42;--ec-sbThumbCol: #ffffff17;--ec-sbThumbHoverCol: #ffffff49;--ec-tm-lineMarkerAccentMarg: 0rem;--ec-tm-lineMarkerAccentWd: 0.15rem;--ec-tm-lineDiffIndMargLeft: 0.25rem;--ec-tm-inlMarkerBrdWd: 1.5px;--ec-tm-inlMarkerBrdRad: 0.2rem;--ec-tm-inlMarkerPad: 0.15rem;--ec-tm-insDiffIndContent: "+";--ec-tm-delDiffIndContent: "-";--ec-tm-markBg: #ffffff17;--ec-tm-markBrdCol: #ffffff40;--ec-tm-insBg: #1e571599;--ec-tm-insBrdCol: #487f3bd0;--ec-tm-insDiffIndCol: #79b169d0;--ec-tm-delBg: #862d2799;--ec-tm-delBrdCol: #b4554bd0;--ec-tm-delDiffIndCol: #ed8779d0;--ec-frm-shdCol: #011627;--ec-frm-frameBoxShdCssVal: none;--ec-frm-edActTabBg: var(--sl-color-gray-6);--ec-frm-edActTabFg: var(--sl-color-text);--ec-frm-edActTabBrdCol: transparent;--ec-frm-edActTabIndHt: 1px;--ec-frm-edActTabIndTopCol: var(--sl-color-accent-high);--ec-frm-edActTabIndBtmCol: transparent;--ec-frm-edTabsMargInlStart: 0;--ec-frm-edTabsMargBlkStart: 0;--ec-frm-edTabBrdRad: 0px;--ec-frm-edTabBarBg: var(--sl-color-black);--ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edBg: var(--sl-color-gray-6);--ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmTtbDotsOpa: 0.75;--ec-frm-trmTtbBg: var(--sl-color-black);--ec-frm-trmTtbFg: var(--sl-color-text);--ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmBg: var(--sl-color-gray-6);--ec-frm-inlBtnFg: var(--sl-color-text);--ec-frm-inlBtnBg: var(--sl-color-text);--ec-frm-inlBtnBgIdleOpa: 0;--ec-frm-inlBtnBgHoverOrFocusOpa: 0.2;--ec-frm-inlBtnBgActOpa: 0.3;--ec-frm-inlBtnBrd: var(--sl-color-text);--ec-frm-inlBtnBrdOpa: 0.4;--ec-frm-tooltipSuccessBg: #158744;--ec-frm-tooltipSuccessFg: white}.expressive-code .ec-line span[style^="--"]:not([class]){color:var(0, inherit);font-style:var(0fs, inherit);font-weight:var(0fw, inherit);-webkit-text-decoration:var(0td, inherit);text-decoration:var(0td, inherit)}@media (prefers-color-scheme: light){:root:not([data-bs-theme="dark"]){--ec-codeBg: #fbfbfb;--ec-codeFg: #403f53;--ec-codeSelBg: #e0e0e0;--ec-uiSelBg: #d3e8f8;--ec-uiSelFg: #403f53;--ec-focusBrd: #93a1a1;--ec-sbThumbCol: #0000001a;--ec-sbThumbHoverCol: #0000005c;--ec-tm-markBg: #0000001a;--ec-tm-markBrdCol: #00000055;--ec-tm-insBg: #8ec77d99;--ec-tm-insDiffIndCol: #336a28d0;--ec-tm-delBg: #ff9c8e99;--ec-tm-delDiffIndCol: #9d4138d0;--ec-frm-shdCol: #d9d9d9;--ec-frm-edActTabBg: var(--sl-color-gray-7);--ec-frm-edActTabIndTopCol: #5d2f86;--ec-frm-edTabBarBg: var(--sl-color-gray-6);--ec-frm-edBg: var(--sl-color-gray-7);--ec-frm-trmTtbBg: var(--sl-color-gray-6);--ec-frm-trmBg: var(--sl-color-gray-7);--ec-frm-tooltipSuccessBg: #078662}:root:not([data-bs-theme="dark"]) .expressive-code .ec-line span[style^="--"]:not([class]){color:var(1, inherit);font-style:var(1fs, inherit);font-weight:var(1fw, inherit);-webkit-text-decoration:var(1td, inherit);text-decoration:var(1td, inherit)}}:root[data-bs-theme="light"] .expressive-code,.expressive-code[data-bs-theme="light"]{--ec-codeBg: #fbfbfb;--ec-codeFg: #403f53;--ec-codeSelBg: #e0e0e0;--ec-uiSelBg: #d3e8f8;--ec-uiSelFg: #403f53;--ec-focusBrd: #93a1a1;--ec-sbThumbCol: #0000001a;--ec-sbThumbHoverCol: #0000005c;--ec-tm-markBg: #0000001a;--ec-tm-markBrdCol: #00000055;--ec-tm-insBg: #8ec77d99;--ec-tm-insDiffIndCol: #336a28d0;--ec-tm-delBg: #ff9c8e99;--ec-tm-delDiffIndCol: #9d4138d0;--ec-frm-shdCol: #d9d9d9;--ec-frm-edActTabBg: var(--sl-color-gray-7);--ec-frm-edActTabIndTopCol: #5d2f86;--ec-frm-edTabBarBg: var(--sl-color-gray-6);--ec-frm-edBg: var(--sl-color-gray-7);--ec-frm-trmTtbBg: var(--sl-color-gray-6);--ec-frm-trmBg: var(--sl-color-gray-7);--ec-frm-tooltipSuccessBg: #078662}:root[data-bs-theme="light"] .expressive-code .ec-line span[style^="--"]:not([class]),.expressive-code[data-bs-theme="light"] .ec-line span[style^="--"]:not([class]){color:var(1, inherit);font-style:var(1fs, inherit);font-weight:var(1fw, inherit);-webkit-text-decoration:var(1td, inherit);text-decoration:var(1td, inherit)}pre,code,kbd,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:.875rem}code:not(:where(.not-content *)){background-color:var(--sl-color-gray-6);margin-block:-0.125rem;padding:0.125rem 0.375rem;color:inherit}[data-bs-theme="dark"] code:not(:where(.not-content *)){background-color:var(--sl-color-gray-5)}.math-block{display:block;margin:2rem 0;overflow-x:auto}.math-inline{display:inline}[data-bs-theme="dark"] .math-inline img,[data-bs-theme="dark"] .math-block img{filter:invert(1)}img.diagram{height:auto;width:100%;margin:1rem 0 2rem}img.diagram-kroki-mermaid{background:#fff}.highlight>pre{padding:0.875rem 1rem}.highlight div{padding:0}.highlight>.chroma{overflow-x:auto;border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}.chroma .ln{padding:0 0.5rem 0 0}.chroma .hl{border-inline-start:0.15rem solid #0005;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}.chroma .hl .ln{margin-left:-0.15rem}.highlight .chroma .lntable .lnt,.highlight .chroma .lntable .hl{display:flex}.chroma .lntd:first-child{padding:0}.chroma .lntd:first-child .lnt{padding-left:1rem}.chroma .lntd:nth-child(2){padding:0}.highlight .chroma .lntable .lntd+.lntd{width:100%}[data-bs-theme="dark"] .chroma .ln{padding:0 0.5em 0 0}.chroma .lntd pre{padding:1rem 0;margin-bottom:0}.highlight>.chroma::-webkit-scrollbar,.highlight>.chroma::-webkit-scrollbar-track{background-color:inherit;border-radius:1px;border-top-left-radius:0;border-top-right-radius:0}.highlight>.chroma::-webkit-scrollbar-thumb{background-color:#dddee0;border:4px solid transparent;background-clip:content-box;border-radius:10px}.highlight>.chroma::-webkit-scrollbar-thumb:hover{background-color:#9d9e9f}[data-bs-theme="dark"] .highlight>.chroma::-webkit-scrollbar-thumb{background-color:#ffffff17}[data-bs-theme="dark"] .highlight>.chroma::-webkit-scrollbar-thumb:hover{background-color:#ffffff49}[data-bs-theme="dark"] .highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}[data-bs-theme="dark"] .chroma .hl{border-inline-start:0.15rem solid #ffffff40;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}[data-bs-theme="dark"] .chroma .hl .ln{margin-left:-0.15rem}details{display:block;position:relative;border:1px solid #e9ecef;border-radius:0.25rem;padding:0.5rem 1rem 0;margin:0.5rem 0}summary{list-style:none;display:inline-block;width:calc(100% + 2rem);margin:-0.5rem -1rem 0;padding:0.5rem 1rem}summary::-webkit-details-marker{display:none}summary:hover{background:#f8f9fa}details summary::after{display:inline-block;content:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%2829, 45, 53, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e");transition:transform 0.35s ease;transform-origin:center center;position:absolute;right:1rem}details[open]>summary::after{transform:rotate(90deg)}details[open]{padding:0.5rem 1rem}details[open]>summary{border-bottom:1px solid #dee2e6;margin-bottom:0.5rem}details h2,details .h2,details h3,details .h3,details h4,details .h4{margin:1rem 0 0.5rem}details p:last-child{margin-bottom:0}details ul,details ol{margin-bottom:0}details pre{margin:0 0 1rem}img{max-width:100%;height:auto}img[data-sizes="auto"]{display:block}img{font-size:0}figcaption{font-size:1rem;margin-top:0.5rem;font-style:italic}.blur-up{filter:blur(5px);transition:filter 400ms}.blur-up.lazyloaded{filter:unset}.section-nav{padding-top:2rem}.section-nav details{border:0;padding:0;margin:0.5rem 0}.section-nav details[open]{padding:0}.section-nav summary{width:100%;padding:0;margin:0;font-weight:700}.section-nav summary:hover{background:none}.section-nav details[open]>summary{border-bottom:0;margin-bottom:0}.section-nav ul.list-nested details{padding-left:1rem;margin-top:0.5rem}.section-nav ul.list-nested li{margin:0}.section-nav a{display:block;margin:0.5rem 0;color:#1d2d35;font-size:1rem;text-decoration:none}.section-nav a:hover,.section-nav a:active{color:#5d2f86}.section-nav li.active a{color:#5d2f86;font-weight:500}.section-nav ul.list-nested li a{padding-left:1rem}.section-nav ul.list-nested{border-left:1px solid #e9ecef}[data-bs-theme="dark"] .section-nav ul.list-nested{border-left:1px solid #23262f}[data-bs-theme="dark"] .section-nav a{color:#c1c3c8}[data-bs-theme="dark"] .section-nav a:hover,[data-bs-theme="dark"] .section-nav a:active{color:var(--sl-color-text-accent)}[data-bs-theme="dark"] .section-nav li.active a{color:var(--sl-color-text-accent);font-weight:500}[data-bs-theme="dark"] .section-nav summary{color:#fff}table{margin:3rem 0}.footer{border-top:1px solid #e9ecef;padding-top:1.125rem;padding-bottom:1.125rem}.footer ul{margin-bottom:0}.footer li{font-size:.875rem;margin-bottom:0}.footer .list-inline-item:not(:last-child){margin-right:1rem}@media (max-width: 991.98px){.footer .col-lg-8{margin-top:0.25rem;margin-bottom:0.25rem}}@media (min-width: 768px){.footer li{font-size:1rem}}.fixed-bottom-right{position:fixed;right:0;bottom:0;z-index:1000}.navbar-brand{font-weight:700}.navbar-brand svg{margin-right:0.25rem}[data-bs-theme="dark"] .navbar-brand{color:inherit}.navbar{z-index:1000;background-color:rgba(255,255,255,0.95);border-bottom:1px solid #e9ecef}@media (min-width: 992px){.navbar{z-index:1025}}@media (min-width: 768px){.navbar-brand{font-size:1.375rem}}.nav-item{margin-left:0}@media (max-width: 991.98px){.navbar-nav .nav-link{font-weight:400}}@media (min-width: 768px){.nav-item{margin-left:0.5rem}}@media (max-width: 575.98px){.navbar .offcanvas.offcanvas-start,.navbar .offcanvas.offcanvas-end{width:80vw}}.offcanvas-header{border-bottom:1px solid #dee2e6;padding-top:1.0625rem;padding-bottom:0.8125rem}h5.offcanvas-title,.offcanvas-title.h5{margin:0;color:inherit}.offcanvas .nav-link{color:#1d2d35}.offcanvas .nav-link:hover,.offcanvas .nav-link:focus{color:#5d2f86}.offcanvas .nav-link.active{color:#5d2f86}.home .navbar{border-bottom:0}@media (min-width: 992px){.navbar-brand{margin-right:0.75rem !important}}.social-link{padding-right:0.375rem;padding-left:0.375rem}@media (max-width: 991.98px){#buttonColorMode{margin:0.5rem 0}#socialMenu{margin:0.5rem 0 0.5rem -0.25rem}.navbar-nav{margin-top:1rem}.nav-item .nav-link{font-weight:400;font-size:1.125rem}}.modal-backdrop,.offcanvas-backdrop{visibility:hidden;background:rgba(23,24,28,0.5);opacity:0}[data-bs-theme="dark"] .modal-backdrop,[data-bs-theme="dark"] .offcanvas-backdrop{visibility:hidden;background:rgba(23,24,28,0.5);opacity:0}.modal-backdrop.show,.offcanvas-backdrop.show{visibility:visible;opacity:1;-webkit-backdrop-filter:blur(8px);backdrop-filter:blur(8px)}.showing,.hiding{transition:none;display:none}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg{padding-right:0.75rem}.docs-content>h2[id]::before,.docs-content>[id].h2::before,.docs-content>h3[id]::before,.docs-content>[id].h3::before,.docs-content>h4[id]::before,.docs-content>[id].h4::before{display:block;height:6rem;margin-top:-6rem;content:""}.docs-content ul,.docs-content ol{margin-bottom:1rem}.anchor{visibility:hidden;margin-left:0.375rem}h1:hover a,.h1:hover a,h2:hover a,.h2:hover a,h3:hover a,.h3:hover a,h4:hover a,.h4:hover a{visibility:visible;text-decoration:none}.card-list{margin-top:2.25rem}.page-footer-meta{margin-top:2rem;margin-bottom:2rem}p.meta{margin-top:0.5rem;font-size:1rem}.breadcrumb{margin-top:2.25rem;font-size:1rem}.toc-mobile{margin-top:2rem;margin-bottom:2rem}.page-link:hover{text-decoration:none}ul li{margin:0.25rem 0}.page-nav .card .icon-tabler-arrow-left{margin-right:0.75rem}.page-nav .card .icon-tabler-arrow-right{margin-left:0.75rem}.page-nav .card:hover{border:1px solid #d9d9d9}[data-bs-theme="dark"] .page-nav .card{border:1px solid #353841}[data-bs-theme="dark"] .page-nav .card:hover{border:1px solid #888c96}.home .card,.contributors.list .card,.blog.list .card,.blog.single .card,.categories.list .card,.tags.list .card{margin-top:2rem;margin-bottom:2rem;transition:transform 0.3s}.home .content .card:hover,.contributors.list .content .card:hover,.blog.list .content .card:hover,.blog.single .content .card:hover,.categories.list .content .card:hover,.tags.list .content .card:hover{transform:scale(1.025)}.home .content .card-body,.contributors.list .content .card-body,.blog.list .content .card-body,.blog.single .content .card-body,.categories.list .content .card-body,.tags.list .content .card-body{padding:0 2rem 1rem}.blog-header{text-align:center;margin-bottom:2rem}.page-item:first-child,.page-item:last-child,.page-item.disabled{display:none}.page-item a{margin-left:0.5rem;margin-right:0.5rem;padding-left:0.875rem;padding-right:0.875rem}span.reading-time{margin-left:2rem}span.reading-time svg{margin-right:0.3rem;vertical-align:-0.4rem}.docs-links,.docs-toc{scrollbar-width:thin;scrollbar-color:#fff #fff}.docs-links::-webkit-scrollbar,.docs-toc::-webkit-scrollbar{width:5px}.docs-links::-webkit-scrollbar-track,.docs-toc::-webkit-scrollbar-track{background:#fff}.docs-links::-webkit-scrollbar-thumb,.docs-toc::-webkit-scrollbar-thumb{background:#fff}.docs-links:hover,.docs-toc:hover{scrollbar-width:thin;scrollbar-color:#e9ecef #fff}.docs-links:hover::-webkit-scrollbar-thumb,.docs-toc:hover::-webkit-scrollbar-thumb{background:#e9ecef}.docs-links::-webkit-scrollbar-thumb:hover,.docs-toc::-webkit-scrollbar-thumb:hover{background:#e9ecef}.docs-links h3,.docs-links .h3,.page-links h3,.page-links .h3{font-size:1.125rem;margin:1.25rem 0 0.5rem;padding:1.5rem 0 0}@media (min-width: 992px){.docs-links h3,.docs-links .h3,.page-links h3,.page-links .h3{margin:1.125rem 1.5rem 0.75rem 0;padding:1.375rem 0 0}}.docs-links h3:not(:first-child),.docs-links .h3:not(:first-child){border-top:1px solid #e9ecef}.page-links li{margin-top:0.375rem;padding-top:0.375rem}.page-links li ul li{border-top:none;padding-left:1rem;margin-top:0.125rem;padding-top:0.125rem}.page-links li:not(:first-child){border-top:1px dashed #e9ecef}.page-links a{color:#1d2d35;display:block;padding:0.125rem 0;font-size:.9375rem;text-decoration:none}.page-links a:hover,.page-links a.active{text-decoration:none;color:#5d2f86}.nav-link.active{font-weight:500} +:root[data-bs-theme="light"],[data-bs-theme="light"] ::backdrop{--sl-color-white: hsl(224, 10%, 10%);--sl-color-gray-1: hsl(224, 14%, 16%);--sl-color-gray-2: hsl(224, 10%, 23%);--sl-color-gray-3: hsl(224, 7%, 36%);--sl-color-gray-4: hsl(224, 6%, 56%);--sl-color-gray-5: hsl(224, 6%, 77%);--sl-color-gray-6: hsl(224, 20%, 94%);--sl-color-gray-7: hsl(224, 19%, 97%);--sl-color-black: hsl(0, 0%, 100%)}:root,::backdrop{--sl-color-white: hsl(0, 0%, 100%);--sl-color-gray-1: hsl(224, 20%, 94%);--sl-color-gray-2: hsl(224, 6%, 77%);--sl-color-gray-3: hsl(224, 6%, 56%);--sl-color-gray-4: hsl(224, 7%, 36%);--sl-color-gray-5: hsl(224, 10%, 23%);--sl-color-gray-6: hsl(224, 14%, 16%);--sl-color-black: hsl(224, 10%, 10%);--sl-hue-orange: 41;--sl-color-orange-low: hsl(var(--sl-hue-orange), 39%, 22%);--sl-color-orange: hsl(var(--sl-hue-orange), 82%, 63%);--sl-color-orange-high: hsl(var(--sl-hue-orange), 82%, 87%);--sl-hue-green: 101;--sl-color-green-low: hsl(var(--sl-hue-green), 39%, 22%);--sl-color-green: hsl(var(--sl-hue-green), 82%, 63%);--sl-color-green-high: hsl(var(--sl-hue-green), 82%, 80%);--sl-hue-blue: 234;--sl-color-blue-low: hsl(var(--sl-hue-blue), 54%, 20%);--sl-color-blue: hsl(var(--sl-hue-blue), 100%, 60%);--sl-color-blue-high: hsl(var(--sl-hue-blue), 100%, 87%);--sl-hue-purple: 281;--sl-color-purple-low: hsl(var(--sl-hue-purple), 39%, 22%);--sl-color-purple: hsl(var(--sl-hue-purple), 82%, 63%);--sl-color-purple-high: hsl(var(--sl-hue-purple), 82%, 89%);--sl-hue-red: 339;--sl-color-red-low: hsl(var(--sl-hue-red), 39%, 22%);--sl-color-red: hsl(var(--sl-hue-red), 82%, 63%);--sl-color-red-high: hsl(var(--sl-hue-red), 82%, 87%);--sl-color-accent-low: hsl(224, 54%, 20%);--sl-color-accent: hsl(224, 100%, 60%);--sl-color-accent-high: hsl(224, 100%, 85%);--sl-color-text: var(--sl-color-gray-2);--sl-color-text-accent: var(--sl-color-accent-high);--sl-color-text-invert: var(--sl-color-accent-low);--sl-color-bg: var(--sl-color-black);--sl-color-bg-nav: var(--sl-color-gray-6);--sl-color-bg-sidebar: var(--sl-color-gray-6);--sl-color-bg-inline-code: var(--sl-color-gray-5);--sl-color-hairline-light: var(--sl-color-gray-5);--sl-color-hairline: var(--sl-color-gray-6);--sl-color-hairline-shade: var(--sl-color-black);--sl-color-backdrop-overlay: hsla(223, 13%, 10%, 0.66);--sl-shadow-sm: 0px 1px 1px hsla(0, 0%, 0%, 0.12), 0px 2px 1px hsla(0, 0%, 0%, 0.24);--sl-shadow-md: 0px 8px 4px hsla(0, 0%, 0%, 0.08), 0px 5px 2px hsla(0, 0%, 0%, 0.08), 0px 3px 2px hsla(0, 0%, 0%, 0.12), 0px 1px 1px hsla(0, 0%, 0%, 0.15);--sl-shadow-lg: 0px 25px 7px hsla(0, 0%, 0%, 0.03), 0px 16px 6px hsla(0, 0%, 0%, 0.1), 0px 9px 5px hsla(223, 13%, 10%, 0.33), 0px 4px 4px hsla(0, 0%, 0%, 0.75), 0px 4px 2px hsla(0, 0%, 0%, 0.25);--sl-text-xs: 0.8125rem;--sl-text-sm: 0.875rem;--sl-text-base: 1rem;--sl-text-lg: 1.125rem;--sl-text-xl: 1.25rem;--sl-text-2xl: 1.5rem;--sl-text-3xl: 1.8125rem;--sl-text-4xl: 2.1875rem;--sl-text-5xl: 2.625rem;--sl-text-6xl: 4rem;--sl-text-body: var(--sl-text-base);--sl-text-body-sm: var(--sl-text-xs);--sl-text-code: var(--sl-text-sm);--sl-text-code-sm: var(--sl-text-xs);--sl-text-h1: var(--sl-text-4xl);--sl-text-h2: var(--sl-text-3xl);--sl-text-h3: var(--sl-text-2xl);--sl-text-h4: var(--sl-text-xl);--sl-text-h5: var(--sl-text-lg);--sl-line-height: 1.8;--sl-line-height-headings: 1.2;--sl-font-system: ui-sans-serif, system-ui, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--sl-font-system-mono: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--__sl-font: var(--sl-font, ""), var(--sl-font-system);--__sl-font-mono: var(--sl-font-mono, ""), var(--sl-font-system-mono);--sl-nav-height: 3.5rem;--sl-nav-pad-x: 1rem;--sl-nav-pad-y: 0.75rem;--sl-mobile-toc-height: 3rem;--sl-sidebar-width: 18.75rem;--sl-sidebar-pad-x: 1rem;--sl-content-width: 45rem;--sl-content-pad-x: 1rem;--sl-menu-button-size: 2rem;--sl-nav-gap: var(--sl-content-pad-x);--sl-outline-offset-inside: -0.1875rem;--sl-z-index-toc: 4;--sl-z-index-menu: 5;--sl-z-index-navbar: 10;--sl-z-index-skiplink: 20}:root{--purple-hsl: 255, 60%, 60%;--overlay-blurple: hsla(var(--purple-hsl), 0.2)}:root{--ec-brdRad: 0px;--ec-brdWd: 1px;--ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-codeFontFml: var(--__sl-font-mono);--ec-codeFontSize: var(--sl-text-code);--ec-codeFontWg: 400;--ec-codeLineHt: var(--sl-line-height);--ec-codePadBlk: 0.75rem;--ec-codePadInl: 1rem;--ec-codeBg: #011627;--ec-codeFg: #d6deeb;--ec-codeSelBg: #1d3b53;--ec-uiFontFml: var(--__sl-font);--ec-uiFontSize: 0.9rem;--ec-uiFontWg: 400;--ec-uiLineHt: 1.65;--ec-uiPadBlk: 0.25rem;--ec-uiPadInl: 1rem;--ec-uiSelBg: #234d708c;--ec-uiSelFg: #ffffff;--ec-focusBrd: #122d42;--ec-sbThumbCol: #ffffff17;--ec-sbThumbHoverCol: #ffffff49;--ec-tm-lineMarkerAccentMarg: 0rem;--ec-tm-lineMarkerAccentWd: 0.15rem;--ec-tm-lineDiffIndMargLeft: 0.25rem;--ec-tm-inlMarkerBrdWd: 1.5px;--ec-tm-inlMarkerBrdRad: 0.2rem;--ec-tm-inlMarkerPad: 0.15rem;--ec-tm-insDiffIndContent: "+";--ec-tm-delDiffIndContent: "-";--ec-tm-markBg: #ffffff17;--ec-tm-markBrdCol: #ffffff40;--ec-tm-insBg: #1e571599;--ec-tm-insBrdCol: #487f3bd0;--ec-tm-insDiffIndCol: #79b169d0;--ec-tm-delBg: #862d2799;--ec-tm-delBrdCol: #b4554bd0;--ec-tm-delDiffIndCol: #ed8779d0;--ec-frm-shdCol: #011627;--ec-frm-frameBoxShdCssVal: none;--ec-frm-edActTabBg: var(--sl-color-gray-6);--ec-frm-edActTabFg: var(--sl-color-text);--ec-frm-edActTabBrdCol: transparent;--ec-frm-edActTabIndHt: 1px;--ec-frm-edActTabIndTopCol: var(--sl-color-accent-high);--ec-frm-edActTabIndBtmCol: transparent;--ec-frm-edTabsMargInlStart: 0;--ec-frm-edTabsMargBlkStart: 0;--ec-frm-edTabBrdRad: 0px;--ec-frm-edTabBarBg: var(--sl-color-black);--ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edBg: var(--sl-color-gray-6);--ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmTtbDotsOpa: 0.75;--ec-frm-trmTtbBg: var(--sl-color-black);--ec-frm-trmTtbFg: var(--sl-color-text);--ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmBg: var(--sl-color-gray-6);--ec-frm-inlBtnFg: var(--sl-color-text);--ec-frm-inlBtnBg: var(--sl-color-text);--ec-frm-inlBtnBgIdleOpa: 0;--ec-frm-inlBtnBgHoverOrFocusOpa: 0.2;--ec-frm-inlBtnBgActOpa: 0.3;--ec-frm-inlBtnBrd: var(--sl-color-text);--ec-frm-inlBtnBrdOpa: 0.4;--ec-frm-tooltipSuccessBg: #158744;--ec-frm-tooltipSuccessFg: white}:root,[data-bs-theme="light"]{--bs-blue: #3347ff;--bs-indigo: #6610f2;--bs-purple: #bd53ee;--bs-pink: #d63384;--bs-red: #ee5389;--bs-orange: #fd7e14;--bs-yellow: #eebd53;--bs-green: #84ee53;--bs-teal: #20c997;--bs-cyan: #0dcaf0;--bs-black: #000;--bs-white: #fff;--bs-gray: #6c757d;--bs-gray-dark: #343a40;--bs-gray-100: #f8f9fa;--bs-gray-200: #e9ecef;--bs-gray-300: #dee2e6;--bs-gray-400: #ced4da;--bs-gray-500: #adb5bd;--bs-gray-600: #6c757d;--bs-gray-700: #495057;--bs-gray-800: #343a40;--bs-gray-900: #212529;--bs-primary: #5d2f86;--bs-secondary: #6c757d;--bs-success: #84ee53;--bs-info: #3347ff;--bs-warning: #eebd53;--bs-danger: #ee5389;--bs-light: #f8f9fa;--bs-dark: #212529;--bs-primary-rgb: 93,47,134;--bs-secondary-rgb: 108,117,125;--bs-success-rgb: 132.2821,238.017,83.283;--bs-info-rgb: 51,71.4,255;--bs-warning-rgb: 238.017,189.0179,83.283;--bs-danger-rgb: 238.017,83.283,137.4399;--bs-light-rgb: 248,249,250;--bs-dark-rgb: 33,37,41;--bs-primary-text-emphasis: #251336;--bs-secondary-text-emphasis: #2b2f32;--bs-success-text-emphasis: #355f21;--bs-info-text-emphasis: #141d66;--bs-warning-text-emphasis: #5f4c21;--bs-danger-text-emphasis: #5f2137;--bs-light-text-emphasis: #495057;--bs-dark-text-emphasis: #495057;--bs-primary-bg-subtle: #dfd5e7;--bs-secondary-bg-subtle: #e2e3e5;--bs-success-bg-subtle: #e6fcdd;--bs-info-bg-subtle: #d6daff;--bs-warning-bg-subtle: #fcf2dd;--bs-danger-bg-subtle: #fcdde7;--bs-light-bg-subtle: #fcfcfd;--bs-dark-bg-subtle: #ced4da;--bs-primary-border-subtle: #beaccf;--bs-secondary-border-subtle: #c4c8cb;--bs-success-border-subtle: #cef8ba;--bs-info-border-subtle: #adb6ff;--bs-warning-border-subtle: #f8e5ba;--bs-danger-border-subtle: #f8bad0;--bs-light-border-subtle: #e9ecef;--bs-dark-border-subtle: #adb5bd;--bs-white-rgb: 255,255,255;--bs-black-rgb: 0,0,0;--bs-font-sans-serif: "Jost", system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--bs-gradient: linear-gradient(180deg, rgba(255,255,255,0.15), rgba(255,255,255,0));--bs-body-font-family: var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight: 400;--bs-body-line-height: 1.5;--bs-body-color: #1d2d35;--bs-body-color-rgb: 29,45,53;--bs-body-bg: #fff;--bs-body-bg-rgb: 255,255,255;--bs-emphasis-color: #000;--bs-emphasis-color-rgb: 0,0,0;--bs-secondary-color: rgba(29,45,53,0.75);--bs-secondary-color-rgb: 29,45,53;--bs-secondary-bg: #e9ecef;--bs-secondary-bg-rgb: 233,236,239;--bs-tertiary-color: rgba(29,45,53,0.5);--bs-tertiary-color-rgb: 29,45,53;--bs-tertiary-bg: #f8f9fa;--bs-tertiary-bg-rgb: 248,249,250;--bs-heading-color: inherit;--bs-link-color: #5d2f86;--bs-link-color-rgb: 93,47,134;--bs-link-decoration: none;--bs-link-hover-color: #4a266b;--bs-link-hover-color-rgb: 74,38,107;--bs-link-hover-decoration: underline;--bs-code-color: #d63384;--bs-highlight-color: #1d2d35;--bs-highlight-bg: #fcf2dd;--bs-border-width: 1px;--bs-border-style: solid;--bs-border-color: #dee2e6;--bs-border-color-translucent: rgba(0,0,0,0.175);--bs-border-radius: .375rem;--bs-border-radius-sm: .25rem;--bs-border-radius-lg: .5rem;--bs-border-radius-xl: 1rem;--bs-border-radius-xxl: 2rem;--bs-border-radius-2xl: var(--bs-border-radius-xxl);--bs-border-radius-pill: 50rem;--bs-box-shadow: 0 0.5rem 1rem rgba(0,0,0,0.15);--bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0,0,0,0.075);--bs-box-shadow-lg: 0 1rem 3rem rgba(0,0,0,0.175);--bs-box-shadow-inset: inset 0 1px 2px rgba(0,0,0,0.075);--bs-focus-ring-width: .25rem;--bs-focus-ring-opacity: .25;--bs-focus-ring-color: rgba(93,47,134,0.25);--bs-form-valid-color: #84ee53;--bs-form-valid-border-color: #84ee53;--bs-form-invalid-color: #ee5389;--bs-form-invalid-border-color: #ee5389}[data-bs-theme="dark"]{color-scheme:dark;--bs-body-color: #c1c3c8;--bs-body-color-rgb: 192.831,194.7078,199.869;--bs-body-bg: #17181c;--bs-body-bg-rgb: 22.95,24.31,28.05;--bs-emphasis-color: #fff;--bs-emphasis-color-rgb: 255,255,255;--bs-secondary-color: rgba(193,195,200,0.75);--bs-secondary-color-rgb: 192.831,194.7078,199.869;--bs-secondary-bg: #343a40;--bs-secondary-bg-rgb: 52,58,64;--bs-tertiary-color: rgba(193,195,200,0.5);--bs-tertiary-color-rgb: 192.831,194.7078,199.869;--bs-tertiary-bg: #2b3035;--bs-tertiary-bg-rgb: 43,48,53;--bs-primary-text-emphasis: #9e82b6;--bs-secondary-text-emphasis: #a7acb1;--bs-success-text-emphasis: #b5f598;--bs-info-text-emphasis: #8591ff;--bs-warning-text-emphasis: #f5d798;--bs-danger-text-emphasis: #f598b8;--bs-light-text-emphasis: #f8f9fa;--bs-dark-text-emphasis: #dee2e6;--bs-primary-bg-subtle: #13091b;--bs-secondary-bg-subtle: #161719;--bs-success-bg-subtle: #1a3011;--bs-info-bg-subtle: #0a0e33;--bs-warning-bg-subtle: #302611;--bs-danger-bg-subtle: #30111b;--bs-light-bg-subtle: #23262f;--bs-dark-bg-subtle: #1a1d20;--bs-primary-border-subtle: #381c50;--bs-secondary-border-subtle: #41464b;--bs-success-border-subtle: #4f8f32;--bs-info-border-subtle: #1f2b99;--bs-warning-border-subtle: #8f7132;--bs-danger-border-subtle: #8f3252;--bs-light-border-subtle: #353841;--bs-dark-border-subtle: #343a40;--bs-heading-color: #fff;--bs-link-color: #b3c7ff;--bs-link-hover-color: #c2d2ff;--bs-link-color-rgb: 178.5,198.9,255;--bs-link-hover-color-rgb: 194,210,255;--bs-code-color: #e685b5;--bs-highlight-color: #c1c3c8;--bs-highlight-bg: #5f4c21;--bs-border-color: #495057;--bs-border-color-translucent: rgba(255,255,255,0.15);--bs-form-valid-color: #b5f598;--bs-form-valid-border-color: #b5f598;--bs-form-invalid-color: #f598b8;--bs-form-invalid-border-color: #f598b8}*,*::before,*::after{box-sizing:border-box}@media (prefers-reduced-motion: no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:0;margin-bottom:.5rem;font-weight:700;line-height:1.2;color:var(--bs-heading-color)}h1,.h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width: 1200px){h1,.h1{font-size:2.5rem}}h2,.h2{font-size:calc(1.325rem + .9vw)}@media (min-width: 1200px){h2,.h2{font-size:2rem}}h3,.h3{font-size:calc(1.3rem + .6vw)}@media (min-width: 1200px){h3,.h3{font-size:1.75rem}}h4,.h4{font-size:calc(1.275rem + .3vw)}@media (min-width: 1200px){h4,.h4{font-size:1.5rem}}h5,.h5{font-size:1.25rem}p{margin-top:0;margin-bottom:1rem}ol,ul{padding-left:2rem}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}strong{font-weight:bolder}small,.small{font-size:.875em}mark,.mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}a{color:rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));text-decoration:none}a:hover{--bs-link-color-rgb: var(--bs-link-hover-color-rgb);text-decoration:underline}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}pre,code,kbd,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}th{text-align:inherit;text-align:-webkit-match-parent}thead,tbody,tr,td,th{border-color:inherit;border-style:solid;border-width:0}button{border-radius:0}button:focus:not(:focus-visible){outline:0}input,button{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button{text-transform:none}[list]:not([type="date"]):not([type="datetime-local"]):not([type="month"]):not([type="week"]):not([type="time"])::-webkit-calendar-picker-indicator{display:none !important}button,[type="button"],[type="reset"],[type="submit"]{-webkit-appearance:button}button:not(:disabled),[type="button"]:not(:disabled),[type="reset"]:not(:disabled),[type="submit"]:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-text,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type="search"]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}summary{display:list-item;cursor:pointer}[hidden]{display:none !important}.lead{font-size:1.25rem;font-weight:400}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.img-fluid{max-width:100%;height:auto}.figure{display:inline-block}.container,.container-fluid,.container-lg{--bs-gutter-x: 3rem;--bs-gutter-y: 0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width: 576px){.container{max-width:540px}}@media (min-width: 768px){.container{max-width:720px}}@media (min-width: 992px){.container-lg,.container{max-width:960px}}@media (min-width: 1200px){.container-lg,.container{max-width:1240px}}@media (min-width: 1400px){.container-lg,.container{max-width:1320px}}:root{--bs-breakpoint-xs: 0;--bs-breakpoint-sm: 576px;--bs-breakpoint-md: 768px;--bs-breakpoint-lg: 992px;--bs-breakpoint-xl: 1200px;--bs-breakpoint-xxl: 1400px}.row{--bs-gutter-x: 3rem;--bs-gutter-y: 0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}@media (min-width: 768px){.col-md-12{flex:0 0 auto;width:75%}}@media (min-width: 992px){.col-lg-5{flex:0 0 auto;width:31.25%}.col-lg-8{flex:0 0 auto;width:50%}.col-lg-9{flex:0 0 auto;width:56.25%}.col-lg-10{flex:0 0 auto;width:62.5%}.col-lg-11{flex:0 0 auto;width:68.75%}.col-lg-12{flex:0 0 auto;width:75%}}@media (min-width: 1200px){.col-xl-3{flex:0 0 auto;width:18.75%}.col-xl-4{flex:0 0 auto;width:25%}.col-xl-8{flex:0 0 auto;width:50%}.col-xl-9{flex:0 0 auto;width:56.25%}}.sticky-top{position:sticky;top:0;z-index:1020}.visually-hidden{width:1px !important;height:1px !important;padding:0 !important;margin:-1px !important;overflow:hidden !important;clip:rect(0, 0, 0, 0) !important;white-space:nowrap !important;border:0 !important}.visually-hidden:not(caption){position:absolute !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.table,table{--bs-table-color-type: initial;--bs-table-bg-type: initial;--bs-table-color-state: initial;--bs-table-bg-state: initial;--bs-table-color: var(--bs-emphasis-color);--bs-table-bg: var(--bs-body-bg);--bs-table-border-color: var(--bs-border-color);--bs-table-accent-bg: rgba(0,0,0,0);--bs-table-striped-color: var(--bs-emphasis-color);--bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color: var(--bs-emphasis-color);--bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color: var(--bs-emphasis-color);--bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*,table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)))}.table>tbody,table>tbody{vertical-align:inherit}.table>thead,table>thead{vertical-align:bottom}[data-bs-theme="dark"] table{--bs-table-color: #fff;--bs-table-bg: #212529;--bs-table-border-color: #4d5154;--bs-table-striped-bg: #2c3034;--bs-table-striped-color: #fff;--bs-table-active-bg: #373b3e;--bs-table-active-color: #fff;--bs-table-hover-bg: #323539;--bs-table-hover-color: #fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}li input[type="checkbox"]{--bs-form-check-bg: var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;print-color-adjust:exact}li input[type="checkbox"]{border-radius:.25em}li input[type="radio"][type="checkbox"]{border-radius:50%}li input[type="checkbox"]:active{filter:brightness(90%)}li input[type="checkbox"]:focus{border-color:#ae97c3;outline:0;box-shadow:0 0 0 .25rem rgba(93,47,134,0.25)}li input[type="checkbox"]:checked{background-color:#5d2f86;border-color:#5d2f86}li input:checked[type="checkbox"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}li input[type="checkbox"]:checked[type="radio"]{--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}li input[type="checkbox"]:indeterminate{background-color:#5d2f86;border-color:#5d2f86;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}li input[type="checkbox"]:disabled{pointer-events:none;filter:none;opacity:.5}.btn{--bs-btn-padding-x: .75rem;--bs-btn-padding-y: .375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight: 400;--bs-btn-line-height: 1.5;--bs-btn-color: var(--bs-body-color);--bs-btn-bg: transparent;--bs-btn-border-width: var(--bs-border-width);--bs-btn-border-color: transparent;--bs-btn-border-radius: var(--bs-border-radius);--bs-btn-hover-border-color: transparent;--bs-btn-box-shadow: inset 0 1px 0 rgba(255,255,255,0.15),0 1px 1px rgba(0,0,0,0.075);--bs-btn-disabled-opacity: .65;--bs-btn-focus-box-shadow: 0 0 0 0 rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);text-decoration:none;background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}:not(.btn-check)+.btn:active,.btn:first-child:active,.btn.active,.btn.show{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}:not(.btn-check)+.btn:active:focus-visible,.btn:first-child:active:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled,.btn.disabled{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color: #fff;--bs-btn-bg: #5d2f86;--bs-btn-border-color: #5d2f86;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #4f2872;--bs-btn-hover-border-color: #4a266b;--bs-btn-focus-shadow-rgb: 117,78,152;--bs-btn-active-color: #fff;--bs-btn-active-bg: #4a266b;--bs-btn-active-border-color: #462365;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #5d2f86;--bs-btn-disabled-border-color: #5d2f86}.btn-link{--bs-btn-font-weight: 400;--bs-btn-color: var(--bs-link-color);--bs-btn-bg: transparent;--bs-btn-border-color: transparent;--bs-btn-hover-color: var(--bs-link-hover-color);--bs-btn-hover-border-color: transparent;--bs-btn-active-color: var(--bs-link-hover-color);--bs-btn-active-border-color: transparent;--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-border-color: transparent;--bs-btn-box-shadow: 0 0 0 #000;--bs-btn-focus-shadow-rgb: 117,78,152;text-decoration:none}.btn-link:hover,.btn-link:focus-visible{text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.nav{--bs-nav-link-padding-x: 1rem;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-link-color);--bs-nav-link-hover-color: var(--bs-link-hover-color);--bs-nav-link-disabled-color: var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);background:none;border:0;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.nav-link{transition:none}}.nav-link:hover,.nav-link:focus{color:var(--bs-nav-link-hover-color);text-decoration:none}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(93,47,134,0.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.navbar{--bs-navbar-padding-x: 0;--bs-navbar-padding-y: .5rem;--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y: .3125rem;--bs-navbar-brand-margin-end: 1rem;--bs-navbar-brand-font-size: 1.25rem;--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x: .5rem;--bs-navbar-toggler-padding-y: .25rem;--bs-navbar-toggler-padding-x: .75rem;--bs-navbar-toggler-font-size: 1.25rem;--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2829,45,53,0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius: var(--bs-border-radius);--bs-navbar-toggler-focus-width: 0;--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{color:var(--bs-navbar-brand-hover-color);text-decoration:none}.navbar-nav{--bs-nav-link-padding-x: 0;--bs-nav-link-padding-y: .5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-navbar-color);--bs-nav-link-hover-color: var(--bs-navbar-hover-color);--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}@media (min-width: 992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:transparent !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar[data-bs-theme="dark"]{--bs-navbar-color: #c1c3c8;--bs-navbar-hover-color: #b3c7ff;--bs-navbar-disabled-color: rgba(255,255,255,0.25);--bs-navbar-active-color: #b3c7ff;--bs-navbar-brand-color: #b3c7ff;--bs-navbar-brand-hover-color: #b3c7ff;--bs-navbar-toggler-border-color: rgba(255,255,255,0.1);--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='%23c1c3c8' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y: 1rem;--bs-card-spacer-x: 1rem;--bs-card-title-spacer-y: .5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width: var(--bs-border-width);--bs-card-border-color: #e9ecef;--bs-card-border-radius: var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y: .5rem;--bs-card-cap-padding-x: 1rem;--bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg: var(--bs-body-bg);--bs-card-img-overlay-padding: 1rem;--bs-card-group-margin: 1.5rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-text:last-child{margin-bottom:0}.breadcrumb{--bs-breadcrumb-padding-x: 0;--bs-breadcrumb-padding-y: 0;--bs-breadcrumb-margin-bottom: 1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color: var(--bs-secondary-color);--bs-breadcrumb-item-padding-x: .5rem;--bs-breadcrumb-item-active-color: var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);text-decoration:none;background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.page-link.active,.active>.page-link{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.page-link.disabled,.disabled>.page-link{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.modal-backdrop{--bs-backdrop-zindex: 1050;--bs-backdrop-bg: #000;--bs-backdrop-opacity: .5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}@keyframes spinner-border{to{transform:rotate(360deg) /* rtl:ignore */}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.offcanvas{--bs-offcanvas-zindex: 1045;--bs-offcanvas-width: 332px;--bs-offcanvas-height: 30vh;--bs-offcanvas-padding-x: 1rem;--bs-offcanvas-padding-y: 1rem;--bs-offcanvas-color: var(--bs-body-color);--bs-offcanvas-bg: var(--bs-body-bg);--bs-offcanvas-border-width: var(--bs-border-width);--bs-offcanvas-border-color: var(--bs-border-color-translucent);--bs-offcanvas-box-shadow: var(--bs-box-shadow-sm);--bs-offcanvas-transition: transform .3s ease-in-out;--bs-offcanvas-title-line-height: 1.5}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion: reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.showing,.offcanvas.show:not(.hiding){transform:none}.offcanvas.showing,.offcanvas.hiding,.offcanvas.show{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}@keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}.d-none{display:none !important}.position-relative{position:relative !important}.w-100{width:100% !important}.h-auto{height:auto !important}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-grow-1{flex-grow:1 !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.order-3{order:3 !important}.m-2{margin:.5rem !important}.mx-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-auto{margin-right:auto !important;margin-left:auto !important}.my-0{margin-top:0 !important;margin-bottom:0 !important}.my-3{margin-top:1rem !important;margin-bottom:1rem !important}.mt-1{margin-top:.25rem !important}.mt-4{margin-top:1.5rem !important}.me-2{margin-right:.5rem !important}.me-auto{margin-right:auto !important}.mb-3{margin-bottom:1rem !important}.mb-4{margin-bottom:1.5rem !important}.ms-2{margin-left:.5rem !important}.ms-auto{margin-left:auto !important}.mt-n3{margin-top:-1rem !important}.p-0{padding:0 !important}.p-2{padding:.5rem !important}.pt-4{padding-top:1.5rem !important}.pe-4{padding-right:1.5rem !important}.pb-2{padding-bottom:.5rem !important}.pb-3{padding-bottom:1rem !important}.pb-4{padding-bottom:1.5rem !important}.ps-3{padding-left:1rem !important}.text-start{text-align:left !important}.text-end{text-align:right !important}.text-center{text-align:center !important}.text-decoration-none{text-decoration:none !important}.text-nowrap{white-space:nowrap !important}.text-body{--bs-text-opacity: 1;color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important}.text-muted{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-body-secondary{--bs-text-opacity: 1;color:var(--bs-secondary-color) !important}.text-reset{--bs-text-opacity: 1;color:inherit !important}.rounded-circle{border-radius:50% !important}@media (min-width: 576px){.flex-sm-row{flex-direction:row !important}}@media (min-width: 768px){.flex-md-row{flex-direction:row !important}}@media (min-width: 992px){.d-lg-block{display:block !important}.d-lg-none{display:none !important}.flex-lg-row{flex-direction:row !important}.order-lg-4{order:4 !important}.me-lg-1{margin-right:.25rem !important}.me-lg-3{margin-right:1rem !important}.ms-lg-2{margin-left:.5rem !important}.text-lg-start{text-align:left !important}.text-lg-end{text-align:right !important}}@media (min-width: 1200px){.d-xl-block{display:block !important}.d-xl-none{display:none !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.mx-xl-auto{margin-right:auto !important;margin-left:auto !important}}@font-face{font-family:Jost;font-style:normal;font-weight:400;font-display:swap;src:local("Jost Regular Regular"),local("Jost-Regular"),local("Jost* Book"),local("Jost-Book"),url("fonts/vendor/jost/jost-v4-latin-regular.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-regular.woff") format("woff")}@font-face{font-family:Jost;font-style:normal;font-weight:500;font-display:swap;src:local("Jost Regular Medium"),local("JostRoman-Medium"),local("Jost* Medium"),local("Jost-Medium"),url("fonts/vendor/jost/jost-v4-latin-500.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-500.woff") format("woff")}@font-face{font-family:Jost;font-style:normal;font-weight:700;font-display:swap;src:local("Jost Regular Bold"),local("JostRoman-Bold"),local("Jost* Bold"),local("Jost-Bold"),url("fonts/vendor/jost/jost-v4-latin-700.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-700.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:400;font-display:swap;src:local("Jost Italic Italic"),local("Jost-Italic"),local("Jost* BookItalic"),local("Jost-BookItalic"),url("fonts/vendor/jost/jost-v4-latin-italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-italic.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:500;font-display:swap;src:local("Jost Italic Medium Italic"),local("JostItalic-Medium"),local("Jost* Medium Italic"),local("Jost-MediumItalic"),url("fonts/vendor/jost/jost-v4-latin-500italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-500italic.woff") format("woff")}@font-face{font-family:Jost;font-style:italic;font-weight:700;font-display:swap;src:local("Jost Italic Bold Italic"),local("JostItalic-Bold"),local("Jost* Bold Italic"),local("Jost-BoldItalic"),url("fonts/vendor/jost/jost-v4-latin-700italic.woff2") format("woff2"),url("fonts/vendor/jost/jost-v4-latin-700italic.woff") format("woff")}html[data-bs-theme="dark"] .icon-tabler-sun{display:block}html[data-bs-theme="dark"] .icon-tabler-moon{display:none}html[data-bs-theme="light"] .icon-tabler-sun{display:none}html[data-bs-theme="light"] .icon-tabler-moon{display:block}.privacy .content,.contributors .content,.blog .content,.error404 .content,.docs.list .content,.categories.list .content,.tags.list .content,.list.section .content{padding-top:1rem;padding-bottom:3rem}.content img{max-width:100%}h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:2rem;margin-bottom:1rem}@media (min-width: 768px){body{font-size:1.125rem}h1,h2,h3,h4,h5,.h1,.h2,.h3,.h4,.h5{margin-bottom:1.125rem}}.home h1,.home .h1{font-size:calc(1.875rem + 1.5vw);margin-top:-1rem}a:hover,a:focus{text-decoration:underline}a.btn:hover,a.btn:focus{text-decoration:none}.section{padding-top:5rem;padding-bottom:5rem}body.section{padding-top:0;padding-bottom:0}.section-md{padding-top:3rem;padding-bottom:3rem}.docs-sidebar{order:2}@media (min-width: 992px){.docs-sidebar{order:0;border-right:1px solid #e9ecef}@supports (position: sticky){.docs-sidebar{position:sticky;top:4.25rem;z-index:1000;height:calc(100vh - 4.25rem)}}}@media (min-width: 1200px){.docs-sidebar{flex:0 1 320px}}.docs-links{padding-bottom:5rem}@media (min-width: 992px){@supports (position: sticky){.docs-links{max-height:calc(100vh - 4rem);overflow-y:scroll}}}@media (min-width: 992px){.docs-links{display:block;width:auto;margin-right:-1.5rem;padding-bottom:4rem}}.docs-toc{order:2}@supports (position: sticky){.docs-toc{position:sticky;top:4.25rem;height:calc(100vh - 4.25rem);overflow-y:auto}}.docs-content{padding-bottom:3rem;order:1}.navbar a:hover,.navbar a:focus{text-decoration:none}#TableOfContents ul,#toc ul{padding-left:0;list-style:none}#toc a.active{color:#5d2f86;font-weight:500}.section-features{padding-top:2rem}.bg-dots{background-image:radial-gradient(#dee2e6 15%, transparent 15%);background-position:0 0;background-size:1rem 1rem;-webkit-mask:linear-gradient(to top, #fff, transparent);mask:linear-gradient(to top, #fff, transparent);width:100%;height:11rem;margin-top:-10rem;z-index:-1}.modal-backdrop{background-color:#fff}.modal-backdrop.show{opacity:0.7}@media (min-width: 768px){.modal-backdrop.show{opacity:0}}li input[type="checkbox"]{margin:0.25rem;border:1px solid #ced4da}li input[type="checkbox"]:disabled{pointer-events:none;filter:none;opacity:1}li input[type="checkbox"]:checked{background-color:#5d2f86;border-color:#5d2f86}[data-bs-theme="dark"] li input[type="checkbox"]{border:1px solid #6c757d}[data-bs-theme="dark"] li input[type="checkbox"]:checked{background-color:#b3c7ff;border-color:#b3c7ff;--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%231d2d35' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.content .svg-inline{margin-bottom:1.5rem}.content .svg-inline:not(.svg-inline-custom){height:1.875rem;width:1.875rem;stroke-width:1.5}.card-nav{-moz-column-gap:1rem;column-gap:1rem}.card-nav .card{margin:0.5rem 0}.card-nav .card:hover{border:1px solid #d9d9d9;background-color:var(--sl-color-gray-7)}[data-bs-theme="dark"] .card-nav .card{border:1px solid #353841}[data-bs-theme="dark"] .card-nav .card:hover{border:1px solid #888c96;background-color:var(--sl-color-gray-6)}.highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}.bg{background-color:var(--sl-color-gray-7)}.chroma{background-color:var(--sl-color-gray-7)}.chroma .err{color:inherit}.chroma .lnlinks{outline:none;text-decoration:none;color:inherit}.chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}.chroma .lntable{border-spacing:0;padding:0;margin:0;border:0}.chroma .hl{background-color:#0000001a}.chroma .hl{border-inline-start:0.15rem solid #00000055;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}.chroma .hl .ln{margin-left:-0.15rem}.chroma .lnt{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#7f7f7f}.chroma .ln{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#7f7f7f}.chroma .line{display:flex}.chroma .k{color:#000000;font-weight:bold}.chroma .kc{color:#000000;font-weight:bold}.chroma .kd{color:#000000;font-weight:bold}.chroma .kn{color:#000000;font-weight:bold}.chroma .kp{color:#000000;font-weight:bold}.chroma .kr{color:#000000;font-weight:bold}.chroma .kt{color:#445588;font-weight:bold}.chroma .na{color:#008080}.chroma .nb{color:#0086b3}.chroma .bp{color:#999999}.chroma .nc{color:#445588;font-weight:bold}.chroma .no{color:#008080}.chroma .nd{color:#3c5d5d;font-weight:bold}.chroma .ni{color:#800080}.chroma .ne{color:#990000;font-weight:bold}.chroma .nf{color:#990000;font-weight:bold}.chroma .nl{color:#990000;font-weight:bold}.chroma .nn{color:#555555}.chroma .nt{color:#000080}.chroma .nv{color:#008080}.chroma .vc{color:#008080}.chroma .vg{color:#008080}.chroma .vi{color:#008080}.chroma .s{color:#dd1144}.chroma .sa{color:#dd1144}.chroma .sb{color:#dd1144}.chroma .sc{color:#dd1144}.chroma .dl{color:#dd1144}.chroma .sd{color:#dd1144}.chroma .s2{color:#dd1144}.chroma .se{color:#dd1144}.chroma .sh{color:#dd1144}.chroma .si{color:#dd1144}.chroma .sx{color:#dd1144}.chroma .sr{color:#009926}.chroma .s1{color:#dd1144}.chroma .ss{color:#990073}.chroma .m{color:#009999}.chroma .mb{color:#009999}.chroma .mf{color:#009999}.chroma .mh{color:#009999}.chroma .mi{color:#009999}.chroma .il{color:#009999}.chroma .mo{color:#009999}.chroma .o{color:#000000;font-weight:bold}.chroma .ow{color:#000000;font-weight:bold}.chroma .c{color:#999988;font-style:italic}.chroma .ch{color:#999988;font-style:italic}.chroma .cm{color:#999988;font-style:italic}.chroma .c1{color:#999988;font-style:italic}.chroma .cs{color:#999999;font-weight:bold;font-style:italic}.chroma .cp{color:#999999;font-weight:bold;font-style:italic}.chroma .cpf{color:#999999;font-weight:bold;font-style:italic}.chroma .gd{color:#000000;background-color:#ffdddd}.chroma .ge{color:inherit;font-style:italic}.chroma .gr{color:#aa0000}.chroma .gh{color:#999999}.chroma .gi{color:#000000;background-color:#ddffdd}.chroma .go{color:#888888}.chroma .gp{color:#555555}.chroma .gs{font-weight:bold}.chroma .gu{color:#aaaaaa}.chroma .gt{color:#aa0000}.chroma .gl{text-decoration:underline}.chroma .w{color:#bbbbbb}[data-bs-theme="dark"] .highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}[data-bs-theme="dark"] .bg{color:#c9d1d9;background-color:var(--sl-color-gray-6)}[data-bs-theme="dark"] .chroma{color:#c9d1d9;background-color:var(--sl-color-gray-6)}[data-bs-theme="dark"] .chroma .err{color:inherit}[data-bs-theme="dark"] .chroma .lnlinks{outline:none;text-decoration:none;color:inherit}[data-bs-theme="dark"] .chroma .lntd{vertical-align:top;padding:0;margin:0;border:0}[data-bs-theme="dark"] .chroma .lntable{border-spacing:0;padding:0;margin:0;border:0}[data-bs-theme="dark"] .chroma .hl{background-color:#ffffff17}[data-bs-theme="dark"] .chroma .hl{border-inline-start:0.15rem solid #ffffff40;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}[data-bs-theme="dark"] .chroma .hl .ln{margin-left:-0.15rem}[data-bs-theme="dark"] .chroma .lnt{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#64686c}[data-bs-theme="dark"] .chroma .ln{white-space:pre;-webkit-user-select:none;-moz-user-select:none;user-select:none;margin-right:0.4em;padding:0 0.4em 0 0.4em;color:#6e7681}[data-bs-theme="dark"] .chroma .line{display:flex}[data-bs-theme="dark"] .chroma .k{color:#ff7b72}[data-bs-theme="dark"] .chroma .kc{color:#79c0ff}[data-bs-theme="dark"] .chroma .kd{color:#ff7b72}[data-bs-theme="dark"] .chroma .kn{color:#ff7b72}[data-bs-theme="dark"] .chroma .kp{color:#79c0ff}[data-bs-theme="dark"] .chroma .kr{color:#ff7b72}[data-bs-theme="dark"] .chroma .kt{color:#ff7b72}[data-bs-theme="dark"] .chroma .na{color:#d2a8ff}[data-bs-theme="dark"] .chroma .nc{color:#f0883e;font-weight:bold}[data-bs-theme="dark"] .chroma .no{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nd{color:#d2a8ff;font-weight:bold}[data-bs-theme="dark"] .chroma .ni{color:#ffa657}[data-bs-theme="dark"] .chroma .ne{color:#f0883e;font-weight:bold}[data-bs-theme="dark"] .chroma .nf{color:#d2a8ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nl{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .nn{color:#ff7b72}[data-bs-theme="dark"] .chroma .py{color:#79c0ff}[data-bs-theme="dark"] .chroma .nt{color:#7ee787}[data-bs-theme="dark"] .chroma .nv{color:#79c0ff}[data-bs-theme="dark"] .chroma .l{color:#a5d6ff}[data-bs-theme="dark"] .chroma .ld{color:#79c0ff}[data-bs-theme="dark"] .chroma .s{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sa{color:#79c0ff}[data-bs-theme="dark"] .chroma .sb{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sc{color:#a5d6ff}[data-bs-theme="dark"] .chroma .dl{color:#79c0ff}[data-bs-theme="dark"] .chroma .sd{color:#a5d6ff}[data-bs-theme="dark"] .chroma .s2{color:#a5d6ff}[data-bs-theme="dark"] .chroma .se{color:#79c0ff}[data-bs-theme="dark"] .chroma .sh{color:#79c0ff}[data-bs-theme="dark"] .chroma .si{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sx{color:#a5d6ff}[data-bs-theme="dark"] .chroma .sr{color:#79c0ff}[data-bs-theme="dark"] .chroma .s1{color:#a5d6ff}[data-bs-theme="dark"] .chroma .ss{color:#a5d6ff}[data-bs-theme="dark"] .chroma .m{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mb{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mf{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mh{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mi{color:#a5d6ff}[data-bs-theme="dark"] .chroma .il{color:#a5d6ff}[data-bs-theme="dark"] .chroma .mo{color:#a5d6ff}[data-bs-theme="dark"] .chroma .o{color:inherit;font-weight:bold}[data-bs-theme="dark"] .chroma .ow{color:#ff7b72;font-weight:bold}[data-bs-theme="dark"] .chroma .c{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .ch{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .cm{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .c1{color:#8b949e;font-style:italic}[data-bs-theme="dark"] .chroma .cs{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .cp{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .cpf{color:#8b949e;font-weight:bold;font-style:italic}[data-bs-theme="dark"] .chroma .gd{color:#ffa198;background-color:#490202}[data-bs-theme="dark"] .chroma .ge{font-style:italic}[data-bs-theme="dark"] .chroma .gr{color:#ffa198}[data-bs-theme="dark"] .chroma .gh{color:#79c0ff;font-weight:bold}[data-bs-theme="dark"] .chroma .gi{color:#56d364;background-color:#0f5323}[data-bs-theme="dark"] .chroma .go{color:#8b949e}[data-bs-theme="dark"] .chroma .gp{color:#8b949e}[data-bs-theme="dark"] .chroma .gs{font-weight:bold}[data-bs-theme="dark"] .chroma .gu{color:#79c0ff}[data-bs-theme="dark"] .chroma .gt{color:#ff7b72}[data-bs-theme="dark"] .chroma .gl{text-decoration:underline}[data-bs-theme="dark"] .chroma .w{color:#6e7681}[data-bs-theme="dark"] h1,[data-bs-theme="dark"] .h1,[data-bs-theme="dark"] h2,[data-bs-theme="dark"] .h2,[data-bs-theme="dark"] h3,[data-bs-theme="dark"] .h3,[data-bs-theme="dark"] h4,[data-bs-theme="dark"] .h4{color:#fff}[data-bs-theme="dark"] body{background:#17181c;color:#c1c3c8}[data-bs-theme="dark"] a{color:#b3c7ff}[data-bs-theme="dark"] .callout a{color:inherit}[data-bs-theme="dark"] .btn-primary{--bs-btn-color: #000;--bs-btn-bg: #b3c7ff;--bs-btn-border-color: #b3c7ff;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #becfff;--bs-btn-hover-border-color: #bacdff;--bs-btn-focus-shadow-rgb: 152,169,217;--bs-btn-active-color: #000;--bs-btn-active-bg: #c2d2ff;--bs-btn-active-border-color: #bacdff;--bs-btn-active-shadow: inset 0 3px 5px rgba(0,0,0,0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #b3c7ff;--bs-btn-disabled-border-color: #b3c7ff;color:#17181c}[data-bs-theme="dark"] .navbar{background-color:rgba(23,24,28,0.95);border-bottom:1px solid #23262f}[data-bs-theme="dark"] body.home .navbar{border-bottom:0}[data-bs-theme="dark"] .offcanvas-header{border-bottom:1px solid #343a40}[data-bs-theme="dark"] .offcanvas .nav-link{color:#c1c3c8}[data-bs-theme="dark"] .offcanvas .nav-link:hover,[data-bs-theme="dark"] .offcanvas .nav-link:focus{color:#b3c7ff}[data-bs-theme="dark"] .offcanvas .nav-link.active{color:#b3c7ff}[data-bs-theme="dark"] .page-links a{color:#c1c3c8}[data-bs-theme="dark"] .page-links a:hover{text-decoration:none;color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link{color:#c1c3c8}[data-bs-theme="dark"] .content .btn-link{color:#b3c7ff}[data-bs-theme="dark"] .content .btn-link:hover{color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link:hover{color:#b3c7ff}[data-bs-theme="dark"] .navbar .btn-link:active{color:#b3c7ff}@media (min-width: 992px){[data-bs-theme="dark"] .docs-sidebar{order:0;border-right:1px solid #23262f}}[data-bs-theme="dark"] .footer{border-top:1px solid #23262f}[data-bs-theme="dark"] .docs-links,[data-bs-theme="dark"] .docs-toc{scrollbar-width:thin;scrollbar-color:#17181c #17181c}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar{width:5px}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-track,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-track{background:#17181c}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb{background:#17181c}[data-bs-theme="dark"] .docs-links:hover,[data-bs-theme="dark"] .docs-toc:hover{scrollbar-width:thin;scrollbar-color:#23262f #17181c}[data-bs-theme="dark"] .docs-links:hover::-webkit-scrollbar-thumb,[data-bs-theme="dark"] .docs-toc:hover::-webkit-scrollbar-thumb{background:#23262f}[data-bs-theme="dark"] .docs-links::-webkit-scrollbar-thumb:hover,[data-bs-theme="dark"] .docs-toc::-webkit-scrollbar-thumb:hover{background:#23262f}[data-bs-theme="dark"] .docs-links h3:not(:first-child),[data-bs-theme="dark"] .docs-links .h3:not(:first-child){border-top:1px solid #23262f}[data-bs-theme="dark"] .page-links li:not(:first-child){border-top:1px dashed #23262f}[data-bs-theme="dark"] .card{background:#17181c;border:1px solid #23262f}[data-bs-theme="dark"] .bg-dots{background-image:radial-gradient(#414349 15%, transparent 15%)}[data-bs-theme="dark"] .text-muted{color:#adafb6 !important}[data-bs-theme="dark"] .offcanvas{background-color:#17181c}[data-bs-theme="dark"] .page-link{color:#b3c7ff;background-color:transparent;border:var(--bs-border-width) solid #23262f}[data-bs-theme="dark"] .page-link:hover{color:#17181c;background-color:#c1c3c8;border-color:#c1c3c8}[data-bs-theme="dark"] .page-link:focus{color:#17181c;background-color:#c1c3c8}[data-bs-theme="dark"] .page-item.active .page-link{color:#17181c;background-color:#b3c7ff;border-color:#b3c7ff}[data-bs-theme="dark"] .page-item.disabled .page-link{color:var(--bs-secondary-color);background-color:#23262f;border-color:#23262f}[data-bs-theme="dark"] details{border:1px solid #23262f}[data-bs-theme="dark"] summary:hover{background:#23262f}[data-bs-theme="dark"] details[open]>summary{border-bottom:1px solid #23262f}[data-bs-theme="dark"] details summary::after{content:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%28222, 226, 230, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e")}[data-bs-theme="dark"] #toc a.active{color:#b3c7ff}[data-bs-theme="dark"] table th{color:#fff}[data-bs-theme="dark"] table,[data-bs-theme="dark"] [data-bs-theme="dark"] table{--bs-table-color: inherit;--bs-table-bg: $body-bg-dark;background:#17181c;border-color:#23262f}.navbar .btn-link{color:rgba(var(--bs-emphasis-color-rgb), 0.65);padding:0.4375rem 0}.btn-link:focus{outline:0;box-shadow:none}@media (min-width: 992px){.navbar .btn-link{padding:0.5625em 0.25rem 0.5rem 0.125rem}}.navbar .btn-link:hover{color:rgba(var(--bs-emphasis-color-rgb), 0.8)}.navbar .btn-link:active{color:rgba(var(--bs-emphasis-color-rgb), 1)}.clipboard{position:relative;float:right}.btn-clipboard{transition:opacity 0.25s ease-in-out;opacity:0;position:absolute;right:0.5rem;top:0.5rem;line-height:1;padding:0.3125rem 0.3125rem 0.1875rem;background-color:transparent;border-color:transparent}@media (max-width: 767.98px){.btn-clipboard{position:absolute;right:-0.5rem;top:0.5rem}}.btn-clipboard::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#495057}.btn-clipboard:hover{border-color:transparent}.btn-clipboard:hover::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' class='icon icon-tabler icon-tabler-copy' width='22' height='22' viewBox='0 0 24 24' stroke-width='1' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M8 8m0 2a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v8a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2z'%3E%3C/path%3E%3Cpath d='M16 8v-2a2 2 0 0 0 -2 -2h-8a2 2 0 0 0 -2 2v8a2 2 0 0 0 2 2h2'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#212529}.btn-clipboard:focus,.btn-clipboard:active{border-color:transparent !important}.btn-clipboard:focus::after,.btn-clipboard:active::after{width:22px;height:22px;display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='currentColor' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;background-color:#212529}[data-bs-theme="dark"] .btn-clipboard{background-color:transparent;border-color:transparent}[data-bs-theme="dark"] .btn-clipboard::after{background-color:#ced4da}[data-bs-theme="dark"] .btn-clipboard:hover{border-color:transparent}[data-bs-theme="dark"] .btn-clipboard:hover::after{background-color:#e9ecef}[data-bs-theme="dark"] .btn-clipboard:focus,[data-bs-theme="dark"] .btn-clipboard:active{border-color:transparent}[data-bs-theme="dark"] .btn-clipboard:focus::after,[data-bs-theme="dark"] .btn-clipboard:active::after{background-color:#e9ecef}.highlight{position:relative}@media (min-width: 768px){.highlight:hover .btn-clipboard{opacity:1}}#toTop{opacity:0;transition:opacity 0.3s ease-in-out}.callout{--bs-link-color-rgb: var(--callout-link);--bs-code-color: var(--callout-code-color);color:var(--callout-color, inherit);background-color:var(--callout-bg, var(--bs-gray-100));border-left:0.25rem solid var(--callout-border, var(--bs-gray-300));border-radius:0}.callout a{text-decoration:underline}.callout .highlight{background-color:rgba(0,0,0,0.05)}.callout .callout-icon.svg-inline{flex-shrink:0;height:calc(1.5 * 1.125rem)}.callout .callout-title{font-weight:700}.callout-content{min-width:0}.callout.callout-note{border-color:var(--sl-color-blue);background-color:var(--sl-color-blue-high)}.callout.callout-note .callout-icon,.callout.callout-note .callout-title,.callout.callout-note .callout-body a{color:var(--sl-color-blue-low)}.callout.callout-note .callout-body,.callout.callout-note .callout-body a:hover,.callout.callout-note .callout-body a:active{color:var(--sl-color-white)}.callout.callout-tip{border-color:var(--sl-color-purple);background-color:var(--sl-color-purple-high)}.callout.callout-tip .callout-icon,.callout.callout-tip .callout-title,.callout.callout-tip .callout-body a{color:var(--sl-color-purple-low)}.callout.callout-tip .callout-body,.callout.callout-tip .callout-body a:hover,.callout.callout-tip .callout-body a:active{color:var(--sl-color-white)}.callout.callout-danger{border-color:var(--sl-color-red);background-color:var(--sl-color-red-high)}.callout.callout-danger .callout-icon,.callout.callout-danger .callout-title,.callout.callout-danger .callout-body a{color:var(--sl-color-red-low)}.callout.callout-danger .callout-body,.callout.callout-danger .callout-body a:hover,.callout.callout-danger .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout{color:var(--sl-color-gray-1)}[data-bs-theme="dark"] .callout.callout-note{border-color:var(--sl-color-blue);background-color:var(--sl-color-blue-low)}[data-bs-theme="dark"] .callout.callout-note .callout-icon,[data-bs-theme="dark"] .callout.callout-note .callout-title,[data-bs-theme="dark"] .callout.callout-note .callout-body a{color:var(--sl-color-blue-high)}[data-bs-theme="dark"] .callout.callout-note .callout-body,[data-bs-theme="dark"] .callout.callout-note .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-note .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-note code:not(:where(.not-content *)){color:var(--ec-codeFg)}[data-bs-theme="dark"] .callout.callout-tip{border-color:var(--sl-color-purple);background-color:var(--sl-color-purple-low)}[data-bs-theme="dark"] .callout.callout-tip .callout-icon,[data-bs-theme="dark"] .callout.callout-tip .callout-title,[data-bs-theme="dark"] .callout.callout-tip .callout-body a{color:var(--sl-color-purple-high)}[data-bs-theme="dark"] .callout.callout-tip .callout-body,[data-bs-theme="dark"] .callout.callout-tip .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-tip .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-tip code:not(:where(.not-content *)){color:var(--ec-codeFg)}[data-bs-theme="dark"] .callout.callout-danger{border-color:var(--sl-color-red);background-color:var(--sl-color-red-low)}[data-bs-theme="dark"] .callout.callout-danger .callout-icon,[data-bs-theme="dark"] .callout.callout-danger .callout-title,[data-bs-theme="dark"] .callout.callout-danger .callout-body a{color:var(--sl-color-red-high)}[data-bs-theme="dark"] .callout.callout-danger .callout-body,[data-bs-theme="dark"] .callout.callout-danger .callout-body a:hover,[data-bs-theme="dark"] .callout.callout-danger .callout-body a:active{color:var(--sl-color-white)}[data-bs-theme="dark"] .callout.callout-danger code:not(:where(.not-content *)){color:var(--ec-codeFg)}.expressive-code{font-family:var(--ec-uiFontFml);font-size:var(--ec-uiFontSize);line-height:var(--ec-uiLineHt);-moz-text-size-adjust:none;text-size-adjust:none;-webkit-text-size-adjust:none;margin:1.5rem 0}.expressive-code *:not(path){all:revert;box-sizing:border-box}.expressive-code pre{display:flex;margin:0;padding:0;border:var(--ec-brdWd) solid var(--ec-brdCol);border-radius:calc(var(--ec-brdRad) + var(--ec-brdWd));background:var(--ec-codeBg)}.expressive-code pre:focus-visible{outline:3px solid var(--ec-focusBrd);outline-offset:-3px}.expressive-code pre>code{all:unset;display:block;flex:1 0 100%;padding:var(--ec-codePadBlk) 0;color:var(--ec-codeFg);font-family:var(--ec-codeFontFml);font-size:var(--ec-codeFontSize);line-height:var(--ec-codeLineHt)}.expressive-code pre{overflow-x:auto}.expressive-code pre::-webkit-scrollbar,.expressive-code pre::-webkit-scrollbar-track{background-color:inherit;border-radius:calc(var(--ec-brdRad) + var(--ec-brdWd));border-top-left-radius:0;border-top-right-radius:0}.expressive-code pre::-webkit-scrollbar-thumb{background-color:var(--ec-sbThumbCol);border:4px solid transparent;background-clip:content-box;border-radius:10px}.expressive-code pre::-webkit-scrollbar-thumb:hover{background-color:var(--ec-sbThumbHoverCol)}.expressive-code .ec-line{padding-inline:var(--ec-codePadInl);padding-inline-end:calc(2rem + var(--ec-codePadInl));direction:ltr;unicode-bidi:isolate}.expressive-code .sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);white-space:nowrap;border-width:0}.expressive-code .ec-line.mark{--tmLineBgCol: var(--ec-tm-markBg);--tmLineBrdCol: var(--ec-tm-markBrdCol)}.expressive-code .ec-line.ins{--tmLineBgCol: var(--ec-tm-insBg);--tmLineBrdCol: var(--ec-tm-insBrdCol)}.expressive-code .ec-line.ins::before{content:var(--ec-tm-insDiffIndContent);color:var(--ec-tm-insDiffIndCol)}.expressive-code .ec-line.del{--tmLineBgCol: var(--ec-tm-delBg);--tmLineBrdCol: var(--ec-tm-delBrdCol)}.expressive-code .ec-line.del::before{content:var(--ec-tm-delDiffIndContent);color:var(--ec-tm-delDiffIndCol)}.expressive-code .ec-line.mark,.expressive-code .ec-line.ins,.expressive-code .ec-line.del{position:relative;background:var(--tmLineBgCol);min-width:calc(100% - var(--ec-tm-lineMarkerAccentMarg));margin-inline-start:var(--ec-tm-lineMarkerAccentMarg);border-inline-start:var(--ec-tm-lineMarkerAccentWd) solid var(--tmLineBrdCol);padding-inline-start:calc(var(--ec-codePadInl) - var(--ec-tm-lineMarkerAccentMarg) - var(--ec-tm-lineMarkerAccentWd)) !important}.expressive-code .ec-line.mark::before,.expressive-code .ec-line.ins::before,.expressive-code .ec-line.del::before{position:absolute;left:var(--ec-tm-lineDiffIndMargLeft)}.expressive-code .ec-line mark,.expressive-code .ec-line .mark{--tmInlineBgCol: var(--ec-tm-markBg);--tmInlineBrdCol: var(--ec-tm-markBrdCol)}.expressive-code .ec-line ins{--tmInlineBgCol: var(--ec-tm-insBg);--tmInlineBrdCol: var(--ec-tm-insBrdCol)}.expressive-code .ec-line del{--tmInlineBgCol: var(--ec-tm-delBg);--tmInlineBrdCol: var(--ec-tm-delBrdCol)}.expressive-code .ec-line mark,.expressive-code .ec-line .mark,.expressive-code .ec-line ins,.expressive-code .ec-line del{all:unset;display:inline-block;position:relative;--tmBrdL: var(--ec-tm-inlMarkerBrdWd);--tmBrdR: var(--ec-tm-inlMarkerBrdWd);--tmRadL: var(--ec-tm-inlMarkerBrdRad);--tmRadR: var(--ec-tm-inlMarkerBrdRad);margin-inline:0.025rem;padding-inline:var(--ec-tm-inlMarkerPad);border-radius:var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL);background:var(--tmInlineBgCol);background-clip:padding-box}.expressive-code .ec-line mark.open-start,.expressive-code .ec-line .open-start.mark,.expressive-code .ec-line ins.open-start,.expressive-code .ec-line del.open-start{margin-inline-start:0;padding-inline-start:0;--tmBrdL: 0px;--tmRadL: 0}.expressive-code .ec-line mark.open-end,.expressive-code .ec-line .open-end.mark,.expressive-code .ec-line ins.open-end,.expressive-code .ec-line del.open-end{margin-inline-end:0;padding-inline-end:0;--tmBrdR: 0px;--tmRadR: 0}.expressive-code .ec-line mark::before,.expressive-code .ec-line .mark::before,.expressive-code .ec-line ins::before,.expressive-code .ec-line del::before{content:"";position:absolute;pointer-events:none;display:inline-block;inset:0;border-radius:var(--tmRadL) var(--tmRadR) var(--tmRadR) var(--tmRadL);border:var(--ec-tm-inlMarkerBrdWd) solid var(--tmInlineBrdCol);border-inline-width:var(--tmBrdL) var(--tmBrdR)}.expressive-code .frame{all:unset;position:relative;display:block;--header-border-radius: calc(var(--ec-brdRad) + var(--ec-brdWd));--tab-border-radius: calc(var(--ec-frm-edTabBrdRad) + var(--ec-brdWd));--button-spacing: 0.4rem;--code-background: var(--ec-frm-edBg);border-radius:var(--header-border-radius);box-shadow:var(--ec-frm-frameBoxShdCssVal)}.expressive-code .frame .header{display:none;z-index:1;position:relative;border-radius:var(--header-border-radius) var(--header-border-radius) 0 0}.expressive-code .frame.has-title pre,.expressive-code .frame.has-title code,.expressive-code .frame.is-terminal pre,.expressive-code .frame.is-terminal code{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.expressive-code .frame .title:empty:before{content:"\a0"}.expressive-code .frame.has-title:not(.is-terminal){--button-spacing: calc(1.9rem + 2 * (var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)))}.expressive-code .frame.has-title:not(.is-terminal) .title{position:relative;color:var(--ec-frm-edActTabFg);background:var(--ec-frm-edActTabBg);background-clip:padding-box;margin-block-start:var(--ec-frm-edTabsMargBlkStart);padding:calc(var(--ec-uiPadBlk) + var(--ec-frm-edActTabIndHt)) var(--ec-uiPadInl);border:var(--ec-brdWd) solid var(--ec-frm-edActTabBrdCol);border-radius:var(--tab-border-radius) var(--tab-border-radius) 0 0;border-bottom:none;overflow:hidden}.expressive-code .frame.has-title:not(.is-terminal) .title::after{content:"";position:absolute;pointer-events:none;inset:0;border-top:var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndTopCol);border-bottom:var(--ec-frm-edActTabIndHt) solid var(--ec-frm-edActTabIndBtmCol)}.expressive-code .frame.has-title:not(.is-terminal) .header{display:flex;background:linear-gradient(to top, var(--ec-frm-edTabBarBrdBtmCol) var(--ec-brdWd), transparent var(--ec-brdWd)),linear-gradient(var(--ec-frm-edTabBarBg), var(--ec-frm-edTabBarBg));background-repeat:no-repeat;padding-inline-start:var(--ec-frm-edTabsMargInlStart)}.expressive-code .frame.has-title:not(.is-terminal) .header::before{content:"";position:absolute;pointer-events:none;inset:0;border:var(--ec-brdWd) solid var(--ec-frm-edTabBarBrdCol);border-radius:inherit;border-bottom:none}.expressive-code .frame.is-terminal{--button-spacing: calc(1.9rem + var(--ec-brdWd) + 2 * var(--ec-uiPadBlk));--code-background: var(--ec-frm-trmBg)}.expressive-code .frame.is-terminal .header{display:flex;align-items:center;justify-content:center;padding-block:var(--ec-uiPadBlk);padding-block-end:calc(var(--ec-uiPadBlk) + var(--ec-brdWd));position:relative;font-weight:500;letter-spacing:0.025ch;color:var(--ec-frm-trmTtbFg);background:var(--ec-frm-trmTtbBg);border:var(--ec-brdWd) solid var(--ec-brdCol);border-bottom:none}.expressive-code .frame.is-terminal .header::before{content:"";position:absolute;pointer-events:none;left:var(--ec-uiPadInl);width:2.1rem;height:0.56rem;line-height:0;background-color:var(--ec-frm-trmTtbDotsFg);opacity:var(--ec-frm-trmTtbDotsOpa);-webkit-mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E");-webkit-mask-repeat:no-repeat;mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 60 16' preserveAspectRatio='xMidYMid meet'%3E%3Ccircle cx='8' cy='8' r='8'/%3E%3Ccircle cx='30' cy='8' r='8'/%3E%3Ccircle cx='52' cy='8' r='8'/%3E%3C/svg%3E");mask-repeat:no-repeat}.expressive-code .frame.is-terminal .header::after{content:"";position:absolute;pointer-events:none;inset:0;border-bottom:var(--ec-brdWd) solid var(--ec-frm-trmTtbBrdBtmCol)}.expressive-code .frame pre{background:var(--code-background)}.expressive-code .copy{display:flex;gap:0.25rem;flex-direction:row;position:absolute;inset-block-start:calc(var(--ec-brdWd) + var(--button-spacing));inset-inline-end:calc(var(--ec-brdWd) + var(--ec-uiPadInl) / 2);direction:ltr;unicode-bidi:isolate}.expressive-code .copy button{position:relative;align-self:flex-end;margin:0;padding:0;border:none;border-radius:0.2rem;z-index:1;cursor:pointer;transition-property:opacity, background, border-color;transition-duration:0.2s;transition-timing-function:cubic-bezier(0.25, 0.46, 0.45, 0.94);width:2.5rem;height:2.5rem;background:var(--code-background);opacity:0.75}.expressive-code .copy button div{position:absolute;inset:0;border-radius:inherit;background:var(--ec-frm-inlBtnBg);opacity:var(--ec-frm-inlBtnBgIdleOpa);transition-property:inherit;transition-duration:inherit;transition-timing-function:inherit}.expressive-code .copy button::before{content:"";position:absolute;pointer-events:none;inset:0;border-radius:inherit;border:var(--ec-brdWd) solid var(--ec-frm-inlBtnBrd);opacity:var(--ec-frm-inlBtnBrdOpa)}.expressive-code .copy button::after{content:"";position:absolute;pointer-events:none;inset:0;background-color:var(--ec-frm-inlBtnFg);-webkit-mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E");-webkit-mask-repeat:no-repeat;mask-image:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='black' stroke-width='1.75'%3E%3Cpath d='M3 19a2 2 0 0 1-1-2V2a2 2 0 0 1 1-1h13a2 2 0 0 1 2 1'/%3E%3Crect x='6' y='5' width='16' height='18' rx='1.5' ry='1.5'/%3E%3C/svg%3E");mask-repeat:no-repeat;margin:0.475rem;line-height:0}.expressive-code .copy button:focus::after,.expressive-code .copy button:active::after{display:inline-block;content:"";-webkit-mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;mask:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='22' height='22' viewBox='0 0 24 24' stroke-width='1.25' stroke='black' fill='none' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath stroke='none' d='M0 0h24v24H0z' fill='none'%3E%3C/path%3E%3Cpath d='M5 12l5 5l10 -10'%3E%3C/path%3E%3C/svg%3E") no-repeat 50% 50%;-webkit-mask-size:cover;mask-size:cover;margin:0.2375rem}.expressive-code .copy button:hover,.expressive-code .copy button:focus:focus-visible{opacity:1}.expressive-code .copy button:hover div,.expressive-code .copy button:focus:focus-visible div{opacity:var(--ec-frm-inlBtnBgHoverOrFocusOpa)}.expressive-code .copy button:active{opacity:1}.expressive-code .copy button:active div{opacity:var(--ec-frm-inlBtnBgActOpa)}.expressive-code .copy .feedback{--tooltip-arrow-size: 0.35rem;--tooltip-bg: var(--ec-frm-tooltipSuccessBg);color:var(--ec-frm-tooltipSuccessFg);pointer-events:none;-moz-user-select:none;user-select:none;-webkit-user-select:none;position:relative;align-self:center;background-color:var(--tooltip-bg);z-index:99;padding:0.125rem 0.75rem;border-radius:0.2rem;margin-inline-end:var(--tooltip-arrow-size);opacity:0;transition-property:opacity, transform;transition-duration:0.2s;transition-timing-function:ease-in-out;transform:translate3d(0, 0.25rem, 0)}.expressive-code .copy .feedback::after{content:"";position:absolute;pointer-events:none;top:calc(50% - var(--tooltip-arrow-size));inset-inline-end:calc(-2 * (var(--tooltip-arrow-size) - 0.5px));border:var(--tooltip-arrow-size) solid transparent;border-inline-start-color:var(--tooltip-bg)}.expressive-code .copy .feedback.show{opacity:1;transform:translate3d(0, 0, 0)}@media (hover: hover){.expressive-code .copy button{opacity:0;width:2rem;height:2rem}.expressive-code .frame:hover .copy button:not(:hover),.expressive-code .frame:focus-within :focus-visible~.copy button:not(:hover),.expressive-code .frame .copy .feedback.show~button:not(:hover){opacity:0.75}}:root{--ec-brdRad: 0px;--ec-brdWd: 1px;--ec-brdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-codeFontFml: var(--__sl-font-mono);--ec-codeFontSize: var(--sl-text-code);--ec-codeFontWg: 400;--ec-codeLineHt: var(--sl-line-height);--ec-codePadBlk: 0;--ec-codePadInl: 1rem;--ec-codeBg: #011627;--ec-codeFg: #d6deeb;--ec-codeSelBg: #1d3b53;--ec-uiFontFml: var(--__sl-font);--ec-uiFontSize: 0.9rem;--ec-uiFontWg: 400;--ec-uiLineHt: 1.65;--ec-uiPadBlk: 0.25rem;--ec-uiPadInl: 1rem;--ec-uiSelBg: #234d708c;--ec-uiSelFg: #ffffff;--ec-focusBrd: #122d42;--ec-sbThumbCol: #ffffff17;--ec-sbThumbHoverCol: #ffffff49;--ec-tm-lineMarkerAccentMarg: 0rem;--ec-tm-lineMarkerAccentWd: 0.15rem;--ec-tm-lineDiffIndMargLeft: 0.25rem;--ec-tm-inlMarkerBrdWd: 1.5px;--ec-tm-inlMarkerBrdRad: 0.2rem;--ec-tm-inlMarkerPad: 0.15rem;--ec-tm-insDiffIndContent: "+";--ec-tm-delDiffIndContent: "-";--ec-tm-markBg: #ffffff17;--ec-tm-markBrdCol: #ffffff40;--ec-tm-insBg: #1e571599;--ec-tm-insBrdCol: #487f3bd0;--ec-tm-insDiffIndCol: #79b169d0;--ec-tm-delBg: #862d2799;--ec-tm-delBrdCol: #b4554bd0;--ec-tm-delDiffIndCol: #ed8779d0;--ec-frm-shdCol: #011627;--ec-frm-frameBoxShdCssVal: none;--ec-frm-edActTabBg: var(--sl-color-gray-6);--ec-frm-edActTabFg: var(--sl-color-text);--ec-frm-edActTabBrdCol: transparent;--ec-frm-edActTabIndHt: 1px;--ec-frm-edActTabIndTopCol: var(--sl-color-accent-high);--ec-frm-edActTabIndBtmCol: transparent;--ec-frm-edTabsMargInlStart: 0;--ec-frm-edTabsMargBlkStart: 0;--ec-frm-edTabBrdRad: 0px;--ec-frm-edTabBarBg: var(--sl-color-black);--ec-frm-edTabBarBrdCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edTabBarBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-edBg: var(--sl-color-gray-6);--ec-frm-trmTtbDotsFg: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmTtbDotsOpa: 0.75;--ec-frm-trmTtbBg: var(--sl-color-black);--ec-frm-trmTtbFg: var(--sl-color-text);--ec-frm-trmTtbBrdBtmCol: color-mix(in srgb, var(--sl-color-gray-5), transparent 25%);--ec-frm-trmBg: var(--sl-color-gray-6);--ec-frm-inlBtnFg: var(--sl-color-text);--ec-frm-inlBtnBg: var(--sl-color-text);--ec-frm-inlBtnBgIdleOpa: 0;--ec-frm-inlBtnBgHoverOrFocusOpa: 0.2;--ec-frm-inlBtnBgActOpa: 0.3;--ec-frm-inlBtnBrd: var(--sl-color-text);--ec-frm-inlBtnBrdOpa: 0.4;--ec-frm-tooltipSuccessBg: #158744;--ec-frm-tooltipSuccessFg: white}.expressive-code .ec-line span[style^="--"]:not([class]){color:var(0, inherit);font-style:var(0fs, inherit);font-weight:var(0fw, inherit);-webkit-text-decoration:var(0td, inherit);text-decoration:var(0td, inherit)}@media (prefers-color-scheme: light){:root:not([data-bs-theme="dark"]){--ec-codeBg: #fbfbfb;--ec-codeFg: #403f53;--ec-codeSelBg: #e0e0e0;--ec-uiSelBg: #d3e8f8;--ec-uiSelFg: #403f53;--ec-focusBrd: #93a1a1;--ec-sbThumbCol: #0000001a;--ec-sbThumbHoverCol: #0000005c;--ec-tm-markBg: #0000001a;--ec-tm-markBrdCol: #00000055;--ec-tm-insBg: #8ec77d99;--ec-tm-insDiffIndCol: #336a28d0;--ec-tm-delBg: #ff9c8e99;--ec-tm-delDiffIndCol: #9d4138d0;--ec-frm-shdCol: #d9d9d9;--ec-frm-edActTabBg: var(--sl-color-gray-7);--ec-frm-edActTabIndTopCol: #5d2f86;--ec-frm-edTabBarBg: var(--sl-color-gray-6);--ec-frm-edBg: var(--sl-color-gray-7);--ec-frm-trmTtbBg: var(--sl-color-gray-6);--ec-frm-trmBg: var(--sl-color-gray-7);--ec-frm-tooltipSuccessBg: #078662}:root:not([data-bs-theme="dark"]) .expressive-code .ec-line span[style^="--"]:not([class]){color:var(1, inherit);font-style:var(1fs, inherit);font-weight:var(1fw, inherit);-webkit-text-decoration:var(1td, inherit);text-decoration:var(1td, inherit)}}:root[data-bs-theme="light"] .expressive-code,.expressive-code[data-bs-theme="light"]{--ec-codeBg: #fbfbfb;--ec-codeFg: #403f53;--ec-codeSelBg: #e0e0e0;--ec-uiSelBg: #d3e8f8;--ec-uiSelFg: #403f53;--ec-focusBrd: #93a1a1;--ec-sbThumbCol: #0000001a;--ec-sbThumbHoverCol: #0000005c;--ec-tm-markBg: #0000001a;--ec-tm-markBrdCol: #00000055;--ec-tm-insBg: #8ec77d99;--ec-tm-insDiffIndCol: #336a28d0;--ec-tm-delBg: #ff9c8e99;--ec-tm-delDiffIndCol: #9d4138d0;--ec-frm-shdCol: #d9d9d9;--ec-frm-edActTabBg: var(--sl-color-gray-7);--ec-frm-edActTabIndTopCol: #5d2f86;--ec-frm-edTabBarBg: var(--sl-color-gray-6);--ec-frm-edBg: var(--sl-color-gray-7);--ec-frm-trmTtbBg: var(--sl-color-gray-6);--ec-frm-trmBg: var(--sl-color-gray-7);--ec-frm-tooltipSuccessBg: #078662}:root[data-bs-theme="light"] .expressive-code .ec-line span[style^="--"]:not([class]),.expressive-code[data-bs-theme="light"] .ec-line span[style^="--"]:not([class]){color:var(1, inherit);font-style:var(1fs, inherit);font-weight:var(1fw, inherit);-webkit-text-decoration:var(1td, inherit);text-decoration:var(1td, inherit)}pre,code,kbd,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:.875rem}code:not(:where(.not-content *)){background-color:var(--sl-color-gray-6);margin-block:-0.125rem;padding:0.125rem 0.375rem;color:inherit}[data-bs-theme="dark"] code:not(:where(.not-content *)){background-color:var(--sl-color-gray-5)}.math-block{display:block;margin:2rem 0;overflow-x:auto}.math-inline{display:inline}[data-bs-theme="dark"] .math-inline img,[data-bs-theme="dark"] .math-block img{filter:invert(1)}img.diagram{height:auto;width:100%;margin:1rem 0 2rem}img.diagram-kroki-mermaid{background:#fff}.highlight>pre{padding:0.875rem 1rem}.highlight div{padding:0}.highlight>.chroma{overflow-x:auto;border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}.chroma .ln{padding:0 0.5rem 0 0}.chroma .hl{border-inline-start:0.15rem solid #0005;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}.chroma .hl .ln{margin-left:-0.15rem}.highlight .chroma .lntable .lnt,.highlight .chroma .lntable .hl{display:flex}.chroma .lntd:first-child{padding:0}.chroma .lntd:first-child .lnt{padding-left:1rem}.chroma .lntd:nth-child(2){padding:0}.highlight .chroma .lntable .lntd+.lntd{width:100%}[data-bs-theme="dark"] .chroma .ln{padding:0 0.5em 0 0}.chroma .lntd pre{padding:1rem 0;margin-bottom:0}.highlight>.chroma::-webkit-scrollbar,.highlight>.chroma::-webkit-scrollbar-track{background-color:inherit;border-radius:1px;border-top-left-radius:0;border-top-right-radius:0}.highlight>.chroma::-webkit-scrollbar-thumb{background-color:#dddee0;border:4px solid transparent;background-clip:content-box;border-radius:10px}.highlight>.chroma::-webkit-scrollbar-thumb:hover{background-color:#9d9e9f}[data-bs-theme="dark"] .highlight>.chroma::-webkit-scrollbar-thumb{background-color:#ffffff17}[data-bs-theme="dark"] .highlight>.chroma::-webkit-scrollbar-thumb:hover{background-color:#ffffff49}[data-bs-theme="dark"] .highlight>.chroma{border:1px solid color-mix(in srgb, var(--sl-color-gray-5), transparent 25%)}[data-bs-theme="dark"] .chroma .hl{border-inline-start:0.15rem solid #ffffff40;margin-left:-1rem;margin-right:-1rem;padding-left:1rem;padding-right:1rem}[data-bs-theme="dark"] .chroma .hl .ln{margin-left:-0.15rem}details{display:block;position:relative;border:1px solid #e9ecef;border-radius:0.25rem;padding:0.5rem 1rem 0;margin:0.5rem 0}summary{list-style:none;display:inline-block;width:calc(100% + 2rem);margin:-0.5rem -1rem 0;padding:0.5rem 1rem}summary::-webkit-details-marker{display:none}summary:hover{background:#f8f9fa}details summary::after{display:inline-block;content:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='rgba%2829, 45, 53, 0.75%29' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M5 14l6-6-6-6'/%3e%3c/svg%3e");transition:transform 0.35s ease;transform-origin:center center;position:absolute;right:1rem}details[open]>summary::after{transform:rotate(90deg)}details[open]{padding:0.5rem 1rem}details[open]>summary{border-bottom:1px solid #dee2e6;margin-bottom:0.5rem}details h2,details .h2,details h3,details .h3,details h4,details .h4{margin:1rem 0 0.5rem}details p:last-child{margin-bottom:0}details ul,details ol{margin-bottom:0}details pre{margin:0 0 1rem}img{max-width:100%;height:auto}img[data-sizes="auto"]{display:block}img{font-size:0}figcaption{font-size:1rem;margin-top:0.5rem;font-style:italic}.blur-up{filter:blur(5px);transition:filter 400ms}.blur-up.lazyloaded{filter:unset}.section-nav{padding-top:2rem}.section-nav details{border:0;padding:0;margin:0.5rem 0}.section-nav details[open]{padding:0}.section-nav summary{width:100%;padding:0;margin:0;font-weight:700}.section-nav summary:hover{background:none}.section-nav details[open]>summary{border-bottom:0;margin-bottom:0}.section-nav ul.list-nested details{padding-left:1rem;margin-top:0.5rem}.section-nav ul.list-nested li{margin:0}.section-nav a{display:block;margin:0.5rem 0;color:#1d2d35;font-size:1rem;text-decoration:none}.section-nav a:hover,.section-nav a:active{color:#5d2f86}.section-nav li.active a{color:#5d2f86;font-weight:500}.section-nav ul.list-nested li a{padding-left:1rem}.section-nav ul.list-nested{border-left:1px solid #e9ecef}[data-bs-theme="dark"] .section-nav ul.list-nested{border-left:1px solid #23262f}[data-bs-theme="dark"] .section-nav a{color:#c1c3c8}[data-bs-theme="dark"] .section-nav a:hover,[data-bs-theme="dark"] .section-nav a:active{color:var(--sl-color-text-accent)}[data-bs-theme="dark"] .section-nav li.active a{color:var(--sl-color-text-accent);font-weight:500}[data-bs-theme="dark"] .section-nav summary{color:#fff}table{margin:3rem 0}.footer{border-top:1px solid #e9ecef;padding-top:1.125rem;padding-bottom:1.125rem}.footer ul{margin-bottom:0}.footer li{font-size:.875rem;margin-bottom:0}.footer .list-inline-item:not(:last-child){margin-right:1rem}@media (max-width: 991.98px){.footer .col-lg-8{margin-top:0.25rem;margin-bottom:0.25rem}}@media (min-width: 768px){.footer li{font-size:1rem}}.fixed-bottom-right{position:fixed;right:0;bottom:0;z-index:1000}.navbar-brand{font-weight:700}.navbar-brand svg{margin-right:0.25rem}[data-bs-theme="dark"] .navbar-brand{color:inherit}.navbar{z-index:1000;background-color:rgba(255,255,255,0.95);border-bottom:1px solid #e9ecef}@media (min-width: 992px){.navbar{z-index:1025}}@media (min-width: 768px){.navbar-brand{font-size:1.375rem}}.nav-item{margin-left:0}@media (max-width: 991.98px){.navbar-nav .nav-link{font-weight:400}}@media (min-width: 768px){.nav-item{margin-left:0.5rem}}@media (max-width: 575.98px){.navbar .offcanvas.offcanvas-start,.navbar .offcanvas.offcanvas-end{width:80vw}}.offcanvas-header{border-bottom:1px solid #dee2e6;padding-top:1.0625rem;padding-bottom:0.8125rem}h5.offcanvas-title,.offcanvas-title.h5{margin:0;color:inherit}.offcanvas .nav-link{color:#1d2d35}.offcanvas .nav-link:hover,.offcanvas .nav-link:focus{color:#5d2f86}.offcanvas .nav-link.active{color:#5d2f86}.home .navbar{border-bottom:0}@media (min-width: 992px){.navbar-brand{margin-right:0.75rem !important}}.social-link{padding-right:0.375rem;padding-left:0.375rem}@media (max-width: 991.98px){#buttonColorMode{margin:0.5rem 0}#socialMenu{margin:0.5rem 0 0.5rem -0.25rem}.navbar-nav{margin-top:1rem}.nav-item .nav-link{font-weight:400;font-size:1.125rem}}.modal-backdrop,.offcanvas-backdrop{visibility:hidden;background:rgba(23,24,28,0.5);opacity:0}[data-bs-theme="dark"] .modal-backdrop,[data-bs-theme="dark"] .offcanvas-backdrop{visibility:hidden;background:rgba(23,24,28,0.5);opacity:0}.modal-backdrop.show,.offcanvas-backdrop.show{visibility:visible;opacity:1;-webkit-backdrop-filter:blur(8px);backdrop-filter:blur(8px)}.showing,.hiding{transition:none;display:none}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg{padding-right:0.75rem}.docs-content>h2[id]::before,.docs-content>[id].h2::before,.docs-content>h3[id]::before,.docs-content>[id].h3::before,.docs-content>h4[id]::before,.docs-content>[id].h4::before{display:block;height:6rem;margin-top:-6rem;content:""}.docs-content ul,.docs-content ol{margin-bottom:1rem}.anchor{visibility:hidden;margin-left:0.375rem}h1:hover a,.h1:hover a,h2:hover a,.h2:hover a,h3:hover a,.h3:hover a,h4:hover a,.h4:hover a{visibility:visible;text-decoration:none}.card-list{margin-top:2.25rem}.page-footer-meta{margin-top:2rem;margin-bottom:2rem}p.meta{margin-top:0.5rem;font-size:1rem}.breadcrumb{margin-top:2.25rem;font-size:1rem}.toc-mobile{margin-top:2rem;margin-bottom:2rem}.page-link:hover{text-decoration:none}ul li{margin:0.25rem 0}.page-nav .card .icon-tabler-arrow-left{margin-right:0.75rem}.page-nav .card .icon-tabler-arrow-right{margin-left:0.75rem}.page-nav .card:hover{border:1px solid #d9d9d9}[data-bs-theme="dark"] .page-nav .card{border:1px solid #353841}[data-bs-theme="dark"] .page-nav .card:hover{border:1px solid #888c96}.home .card,.contributors.list .card,.blog.list .card,.blog.single .card,.categories.list .card,.tags.list .card{margin-top:2rem;margin-bottom:2rem;transition:transform 0.3s}.home .content .card:hover,.contributors.list .content .card:hover,.blog.list .content .card:hover,.blog.single .content .card:hover,.categories.list .content .card:hover,.tags.list .content .card:hover{transform:scale(1.025)}.home .content .card-body,.contributors.list .content .card-body,.blog.list .content .card-body,.blog.single .content .card-body,.categories.list .content .card-body,.tags.list .content .card-body{padding:0 2rem 1rem}.blog-header{text-align:center;margin-bottom:2rem}.page-item:first-child,.page-item:last-child,.page-item.disabled{display:none}.page-item a{margin-left:0.5rem;margin-right:0.5rem;padding-left:0.875rem;padding-right:0.875rem}span.reading-time{margin-left:2rem}span.reading-time svg{margin-right:0.3rem;vertical-align:-0.4rem}.docs-links,.docs-toc{scrollbar-width:thin;scrollbar-color:#fff #fff}.docs-links::-webkit-scrollbar,.docs-toc::-webkit-scrollbar{width:5px}.docs-links::-webkit-scrollbar-track,.docs-toc::-webkit-scrollbar-track{background:#fff}.docs-links::-webkit-scrollbar-thumb,.docs-toc::-webkit-scrollbar-thumb{background:#fff}.docs-links:hover,.docs-toc:hover{scrollbar-width:thin;scrollbar-color:#e9ecef #fff}.docs-links:hover::-webkit-scrollbar-thumb,.docs-toc:hover::-webkit-scrollbar-thumb{background:#e9ecef}.docs-links::-webkit-scrollbar-thumb:hover,.docs-toc::-webkit-scrollbar-thumb:hover{background:#e9ecef}.docs-links h3,.docs-links .h3,.page-links h3,.page-links .h3{font-size:1.125rem;margin:1.25rem 0 0.5rem;padding:1.5rem 0 0}@media (min-width: 992px){.docs-links h3,.docs-links .h3,.page-links h3,.page-links .h3{margin:1.125rem 1.5rem 0.75rem 0;padding:1.375rem 0 0}}.docs-links h3:not(:first-child),.docs-links .h3:not(:first-child){border-top:1px solid #e9ecef}.page-links li{margin-top:0.375rem;padding-top:0.375rem}.page-links li ul li{border-top:none;padding-left:1rem;margin-top:0.125rem;padding-top:0.125rem}.page-links li:not(:first-child){border-top:1px dashed #e9ecef}.page-links a{color:#1d2d35;display:block;padding:0.125rem 0;font-size:.9375rem;text-decoration:none}.page-links a:hover,.page-links a.active{text-decoration:none;color:#5d2f86}.nav-link.active{font-weight:500}a.CTAbutton{background-color:var(--sl-color-purple-low);display:inline-block;width:200px;border-radius:5px;padding:10px;color:var(--sl-color-gray-1);text-transform:uppercase} diff --git a/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.json b/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.json index c81c65d..e2874eb 100644 --- a/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.json +++ b/resources/_gen/assets/scss/app.scss_cdf9d7c9eb97e4550ded64a8776dd9e8.json @@ -1 +1 @@ -{"Target":"main.613871732ccb1207cce9d0486e0db82e01f94851b8674fc41fc739fd74ec069587716f50c3f5502f680df4c7f9e7360a8dd43087efea745b9718012a9d1f9c2f.css","MediaType":"text/css","Data":{"Integrity":"sha512-YThxcyzLEgfM6dBIbg24LgH5SFG4Z0/EH8c5/XTsBpWHcW9Qw/VQL2gN9Mf55zYKjdQwh+/qdFuXGAEqnR+cLw=="}} \ No newline at end of file +{"Target":"main.e28529c7be9ecda8ce19eac1174bca0d6f2153f0711f154ca27317330d3f0085350487d79841146fa897321b65f8f7d4a783d14c4a5829172cc3c9a243115e50.css","MediaType":"text/css","Data":{"Integrity":"sha512-4oUpx76ezajOGerBF0vKDW8hU/BxHxVMonMXMw0/AIU1BIfXmEEUb6iXMhtl+PfUp4PRTEpYKRcsw8miQxFeUA=="}} \ No newline at end of file